From 9cd57b731ab1c666d4a1cb725538fdc137763d12 Mon Sep 17 00:00:00 2001 From: Starla Insigna Date: Sat, 30 Jul 2011 11:19:14 -0400 Subject: Initial commit (version 0.2.1) --- libs/CocosDenshion/CDAudioManager.h | 243 +++ libs/CocosDenshion/CDAudioManager.m | 887 +++++++++++ libs/CocosDenshion/CDConfig.h | 60 + libs/CocosDenshion/CDOpenALSupport.h | 77 + libs/CocosDenshion/CDOpenALSupport.m | 246 +++ libs/CocosDenshion/CocosDenshion.h | 440 ++++++ libs/CocosDenshion/CocosDenshion.m | 1602 ++++++++++++++++++++ libs/CocosDenshion/SimpleAudioEngine.h | 90 ++ libs/CocosDenshion/SimpleAudioEngine.m | 220 +++ libs/FontLabel/FontLabel.h | 44 + libs/FontLabel/FontLabel.m | 195 +++ libs/FontLabel/FontLabelStringDrawing.h | 69 + libs/FontLabel/FontLabelStringDrawing.m | 892 +++++++++++ libs/FontLabel/FontManager.h | 85 ++ libs/FontLabel/FontManager.m | 123 ++ libs/FontLabel/ZAttributedString.h | 77 + libs/FontLabel/ZAttributedString.m | 597 ++++++++ libs/FontLabel/ZAttributedStringPrivate.h | 24 + libs/FontLabel/ZFont.h | 47 + libs/FontLabel/ZFont.m | 170 +++ libs/README | 1 + libs/TouchJSON/CDataScanner.h | 71 + libs/TouchJSON/CDataScanner.m | 340 +++++ .../TouchJSON/Extensions/CDataScanner_Extensions.h | 40 + .../TouchJSON/Extensions/CDataScanner_Extensions.m | 135 ++ .../Extensions/NSDictionary_JSONExtensions.h | 37 + .../Extensions/NSDictionary_JSONExtensions.m | 47 + libs/TouchJSON/JSON/CJSONDeserializer.h | 63 + libs/TouchJSON/JSON/CJSONDeserializer.m | 161 ++ libs/TouchJSON/JSON/CJSONScanner.h | 95 ++ libs/TouchJSON/JSON/CJSONScanner.m | 676 +++++++++ libs/TouchJSON/JSON/CJSONSerializer.h | 53 + libs/TouchJSON/JSON/CJSONSerializer.m | 342 +++++ libs/TouchJSON/JSON/JSONRepresentation.h | 18 + libs/cocos2d/CCAction.h | 195 +++ libs/cocos2d/CCAction.m | 360 +++++ libs/cocos2d/CCActionCamera.h | 73 + libs/cocos2d/CCActionCamera.m | 147 ++ libs/cocos2d/CCActionEase.h | 159 ++ libs/cocos2d/CCActionEase.m | 534 +++++++ libs/cocos2d/CCActionGrid.h | 165 ++ libs/cocos2d/CCActionGrid.m | 386 +++++ libs/cocos2d/CCActionGrid3D.h | 208 +++ libs/cocos2d/CCActionGrid3D.m | 659 ++++++++ libs/cocos2d/CCActionInstant.h | 205 +++ libs/cocos2d/CCActionInstant.m | 477 ++++++ libs/cocos2d/CCActionInterval.h | 421 +++++ libs/cocos2d/CCActionInterval.m | 1355 +++++++++++++++++ libs/cocos2d/CCActionManager.h | 111 ++ libs/cocos2d/CCActionManager.m | 345 +++++ libs/cocos2d/CCActionPageTurn3D.h | 42 + libs/cocos2d/CCActionPageTurn3D.m | 86 ++ libs/cocos2d/CCActionProgressTimer.h | 59 + libs/cocos2d/CCActionProgressTimer.m | 103 ++ libs/cocos2d/CCActionTiledGrid.h | 211 +++ libs/cocos2d/CCActionTiledGrid.m | 768 ++++++++++ libs/cocos2d/CCActionTween.h | 62 + libs/cocos2d/CCActionTween.m | 72 + libs/cocos2d/CCAnimation.h | 136 ++ libs/cocos2d/CCAnimation.m | 153 ++ libs/cocos2d/CCAnimationCache.h | 64 + libs/cocos2d/CCAnimationCache.m | 101 ++ libs/cocos2d/CCAtlasNode.h | 93 ++ libs/cocos2d/CCAtlasNode.m | 211 +++ libs/cocos2d/CCBlockSupport.h | 51 + libs/cocos2d/CCBlockSupport.m | 46 + libs/cocos2d/CCCamera.h | 95 ++ libs/cocos2d/CCCamera.m | 131 ++ libs/cocos2d/CCConfiguration.h | 116 ++ libs/cocos2d/CCConfiguration.m | 193 +++ libs/cocos2d/CCDirector.h | 307 ++++ libs/cocos2d/CCDirector.m | 565 +++++++ libs/cocos2d/CCDrawingPrimitives.h | 92 ++ libs/cocos2d/CCDrawingPrimitives.m | 272 ++++ libs/cocos2d/CCGrabber.h | 43 + libs/cocos2d/CCGrabber.m | 95 ++ libs/cocos2d/CCGrid.h | 121 ++ libs/cocos2d/CCGrid.m | 571 +++++++ libs/cocos2d/CCLabelAtlas.h | 62 + libs/cocos2d/CCLabelAtlas.m | 170 +++ libs/cocos2d/CCLabelBMFont.h | 190 +++ libs/cocos2d/CCLabelBMFont.m | 675 +++++++++ libs/cocos2d/CCLabelTTF.h | 78 + libs/cocos2d/CCLabelTTF.m | 138 ++ libs/cocos2d/CCLayer.h | 293 ++++ libs/cocos2d/CCLayer.m | 621 ++++++++ libs/cocos2d/CCMenu.h | 93 ++ libs/cocos2d/CCMenu.m | 523 +++++++ libs/cocos2d/CCMenuItem.h | 377 +++++ libs/cocos2d/CCMenuItem.m | 795 ++++++++++ libs/cocos2d/CCMotionStreak.h | 67 + libs/cocos2d/CCMotionStreak.m | 104 ++ libs/cocos2d/CCNode.h | 529 +++++++ libs/cocos2d/CCNode.m | 921 +++++++++++ libs/cocos2d/CCParallaxNode.h | 50 + libs/cocos2d/CCParallaxNode.m | 161 ++ libs/cocos2d/CCParticleExamples.h | 111 ++ libs/cocos2d/CCParticleExamples.m | 926 +++++++++++ libs/cocos2d/CCParticleSystem.h | 445 ++++++ libs/cocos2d/CCParticleSystem.m | 808 ++++++++++ libs/cocos2d/CCParticleSystemPoint.h | 65 + libs/cocos2d/CCParticleSystemPoint.m | 211 +++ libs/cocos2d/CCParticleSystemQuad.h | 76 + libs/cocos2d/CCParticleSystemQuad.m | 318 ++++ libs/cocos2d/CCProgressTimer.h | 83 + libs/cocos2d/CCProgressTimer.m | 493 ++++++ libs/cocos2d/CCProtocols.h | 125 ++ libs/cocos2d/CCRenderTexture.h | 108 ++ libs/cocos2d/CCRenderTexture.m | 340 +++++ libs/cocos2d/CCRibbon.h | 117 ++ libs/cocos2d/CCRibbon.m | 383 +++++ libs/cocos2d/CCScene.h | 43 + libs/cocos2d/CCScene.m | 45 + libs/cocos2d/CCScheduler.h | 199 +++ libs/cocos2d/CCScheduler.m | 657 ++++++++ libs/cocos2d/CCSprite.h | 351 +++++ libs/cocos2d/CCSprite.m | 1029 +++++++++++++ libs/cocos2d/CCSpriteBatchNode.h | 145 ++ libs/cocos2d/CCSpriteBatchNode.m | 503 ++++++ libs/cocos2d/CCSpriteFrame.h | 90 ++ libs/cocos2d/CCSpriteFrame.m | 111 ++ libs/cocos2d/CCSpriteFrameCache.h | 137 ++ libs/cocos2d/CCSpriteFrameCache.m | 347 +++++ libs/cocos2d/CCTMXLayer.h | 152 ++ libs/cocos2d/CCTMXLayer.m | 670 ++++++++ libs/cocos2d/CCTMXObjectGroup.h | 67 + libs/cocos2d/CCTMXObjectGroup.m | 86 ++ libs/cocos2d/CCTMXTiledMap.h | 145 ++ libs/cocos2d/CCTMXTiledMap.m | 201 +++ libs/cocos2d/CCTMXXMLParser.h | 202 +++ libs/cocos2d/CCTMXXMLParser.m | 456 ++++++ libs/cocos2d/CCTexture2D.h | 328 ++++ libs/cocos2d/CCTexture2D.m | 814 ++++++++++ libs/cocos2d/CCTextureAtlas.h | 147 ++ libs/cocos2d/CCTextureAtlas.m | 369 +++++ libs/cocos2d/CCTextureCache.h | 149 ++ libs/cocos2d/CCTextureCache.m | 498 ++++++ libs/cocos2d/CCTexturePVR.h | 127 ++ libs/cocos2d/CCTexturePVR.m | 428 ++++++ libs/cocos2d/CCTileMapAtlas.h | 83 + libs/cocos2d/CCTileMapAtlas.m | 234 +++ libs/cocos2d/CCTransition.h | 296 ++++ libs/cocos2d/CCTransition.m | 1059 +++++++++++++ libs/cocos2d/CCTransitionPageTurn.h | 60 + libs/cocos2d/CCTransitionPageTurn.m | 117 ++ libs/cocos2d/CCTransitionRadial.h | 40 + libs/cocos2d/CCTransitionRadial.m | 115 ++ libs/cocos2d/Platforms/CCGL.h | 83 + libs/cocos2d/Platforms/CCNS.h | 78 + libs/cocos2d/Platforms/Mac/CCDirectorMac.h | 103 ++ libs/cocos2d/Platforms/Mac/CCDirectorMac.m | 479 ++++++ libs/cocos2d/Platforms/Mac/CCEventDispatcher.h | 277 ++++ libs/cocos2d/Platforms/Mac/CCEventDispatcher.m | 645 ++++++++ libs/cocos2d/Platforms/Mac/MacGLView.h | 89 ++ libs/cocos2d/Platforms/Mac/MacGLView.m | 242 +++ libs/cocos2d/Platforms/Mac/MacWindow.h | 42 + libs/cocos2d/Platforms/Mac/MacWindow.m | 70 + libs/cocos2d/Platforms/iOS/CCDirectorIOS.h | 255 ++++ libs/cocos2d/Platforms/iOS/CCDirectorIOS.m | 735 +++++++++ .../Platforms/iOS/CCTouchDelegateProtocol.h | 75 + libs/cocos2d/Platforms/iOS/CCTouchDispatcher.h | 123 ++ libs/cocos2d/Platforms/iOS/CCTouchDispatcher.m | 347 +++++ libs/cocos2d/Platforms/iOS/CCTouchHandler.h | 93 ++ libs/cocos2d/Platforms/iOS/CCTouchHandler.m | 135 ++ libs/cocos2d/Platforms/iOS/EAGLView.h | 155 ++ libs/cocos2d/Platforms/iOS/EAGLView.m | 343 +++++ libs/cocos2d/Platforms/iOS/ES1Renderer.h | 72 + libs/cocos2d/Platforms/iOS/ES1Renderer.m | 259 ++++ libs/cocos2d/Platforms/iOS/ESRenderer.h | 54 + libs/cocos2d/Platforms/iOS/glu.c | 113 ++ libs/cocos2d/Platforms/iOS/glu.h | 29 + libs/cocos2d/Support/CCArray.h | 106 ++ libs/cocos2d/Support/CCArray.m | 290 ++++ libs/cocos2d/Support/CCFileUtils.h | 62 + libs/cocos2d/Support/CCFileUtils.m | 169 +++ libs/cocos2d/Support/CCProfiling.h | 53 + libs/cocos2d/Support/CCProfiling.m | 117 ++ libs/cocos2d/Support/CGPointExtension.h | 334 ++++ libs/cocos2d/Support/CGPointExtension.m | 196 +++ libs/cocos2d/Support/OpenGL_Internal.h | 80 + libs/cocos2d/Support/TGAlib.h | 55 + libs/cocos2d/Support/TGAlib.m | 274 ++++ libs/cocos2d/Support/TransformUtils.h | 37 + libs/cocos2d/Support/TransformUtils.m | 46 + libs/cocos2d/Support/ZipUtils.h | 91 ++ libs/cocos2d/Support/ZipUtils.m | 251 +++ libs/cocos2d/Support/base64.c | 93 ++ libs/cocos2d/Support/base64.h | 33 + libs/cocos2d/Support/ccCArray.h | 447 ++++++ libs/cocos2d/Support/ccUtils.c | 20 + libs/cocos2d/Support/ccUtils.h | 29 + libs/cocos2d/Support/uthash.h | 972 ++++++++++++ libs/cocos2d/Support/utlist.h | 490 ++++++ libs/cocos2d/ccConfig.h | 334 ++++ libs/cocos2d/ccMacros.h | 253 ++++ libs/cocos2d/ccTypes.h | 287 ++++ libs/cocos2d/cocos2d.h | 161 ++ libs/cocos2d/cocos2d.m | 34 + libs/cocoslive/CLScoreServerPost.h | 142 ++ libs/cocoslive/CLScoreServerPost.m | 335 ++++ libs/cocoslive/CLScoreServerRequest.h | 122 ++ libs/cocoslive/CLScoreServerRequest.m | 257 ++++ libs/cocoslive/cocoslive.h | 43 + libs/cocoslive/cocoslive.m | 37 + 204 files changed, 51028 insertions(+) create mode 100755 libs/CocosDenshion/CDAudioManager.h create mode 100755 libs/CocosDenshion/CDAudioManager.m create mode 100755 libs/CocosDenshion/CDConfig.h create mode 100755 libs/CocosDenshion/CDOpenALSupport.h create mode 100755 libs/CocosDenshion/CDOpenALSupport.m create mode 100755 libs/CocosDenshion/CocosDenshion.h create mode 100755 libs/CocosDenshion/CocosDenshion.m create mode 100755 libs/CocosDenshion/SimpleAudioEngine.h create mode 100755 libs/CocosDenshion/SimpleAudioEngine.m create mode 100755 libs/FontLabel/FontLabel.h create mode 100755 libs/FontLabel/FontLabel.m create mode 100755 libs/FontLabel/FontLabelStringDrawing.h create mode 100755 libs/FontLabel/FontLabelStringDrawing.m create mode 100755 libs/FontLabel/FontManager.h create mode 100755 libs/FontLabel/FontManager.m create mode 100755 libs/FontLabel/ZAttributedString.h create mode 100755 libs/FontLabel/ZAttributedString.m create mode 100755 libs/FontLabel/ZAttributedStringPrivate.h create mode 100755 libs/FontLabel/ZFont.h create mode 100755 libs/FontLabel/ZFont.m create mode 100755 libs/README create mode 100755 libs/TouchJSON/CDataScanner.h create mode 100755 libs/TouchJSON/CDataScanner.m create mode 100755 libs/TouchJSON/Extensions/CDataScanner_Extensions.h create mode 100755 libs/TouchJSON/Extensions/CDataScanner_Extensions.m create mode 100755 libs/TouchJSON/Extensions/NSDictionary_JSONExtensions.h create mode 100755 libs/TouchJSON/Extensions/NSDictionary_JSONExtensions.m create mode 100755 libs/TouchJSON/JSON/CJSONDeserializer.h create mode 100755 libs/TouchJSON/JSON/CJSONDeserializer.m create mode 100755 libs/TouchJSON/JSON/CJSONScanner.h create mode 100755 libs/TouchJSON/JSON/CJSONScanner.m create mode 100755 libs/TouchJSON/JSON/CJSONSerializer.h create mode 100755 libs/TouchJSON/JSON/CJSONSerializer.m create mode 100755 libs/TouchJSON/JSON/JSONRepresentation.h create mode 100755 libs/cocos2d/CCAction.h create mode 100755 libs/cocos2d/CCAction.m create mode 100755 libs/cocos2d/CCActionCamera.h create mode 100755 libs/cocos2d/CCActionCamera.m create mode 100755 libs/cocos2d/CCActionEase.h create mode 100755 libs/cocos2d/CCActionEase.m create mode 100755 libs/cocos2d/CCActionGrid.h create mode 100755 libs/cocos2d/CCActionGrid.m create mode 100755 libs/cocos2d/CCActionGrid3D.h create mode 100755 libs/cocos2d/CCActionGrid3D.m create mode 100755 libs/cocos2d/CCActionInstant.h create mode 100755 libs/cocos2d/CCActionInstant.m create mode 100755 libs/cocos2d/CCActionInterval.h create mode 100755 libs/cocos2d/CCActionInterval.m create mode 100755 libs/cocos2d/CCActionManager.h create mode 100755 libs/cocos2d/CCActionManager.m create mode 100755 libs/cocos2d/CCActionPageTurn3D.h create mode 100755 libs/cocos2d/CCActionPageTurn3D.m create mode 100755 libs/cocos2d/CCActionProgressTimer.h create mode 100755 libs/cocos2d/CCActionProgressTimer.m create mode 100755 libs/cocos2d/CCActionTiledGrid.h create mode 100755 libs/cocos2d/CCActionTiledGrid.m create mode 100755 libs/cocos2d/CCActionTween.h create mode 100755 libs/cocos2d/CCActionTween.m create mode 100755 libs/cocos2d/CCAnimation.h create mode 100755 libs/cocos2d/CCAnimation.m create mode 100755 libs/cocos2d/CCAnimationCache.h create mode 100755 libs/cocos2d/CCAnimationCache.m create mode 100755 libs/cocos2d/CCAtlasNode.h create mode 100755 libs/cocos2d/CCAtlasNode.m create mode 100755 libs/cocos2d/CCBlockSupport.h create mode 100755 libs/cocos2d/CCBlockSupport.m create mode 100755 libs/cocos2d/CCCamera.h create mode 100755 libs/cocos2d/CCCamera.m create mode 100755 libs/cocos2d/CCConfiguration.h create mode 100755 libs/cocos2d/CCConfiguration.m create mode 100755 libs/cocos2d/CCDirector.h create mode 100755 libs/cocos2d/CCDirector.m create mode 100755 libs/cocos2d/CCDrawingPrimitives.h create mode 100755 libs/cocos2d/CCDrawingPrimitives.m create mode 100755 libs/cocos2d/CCGrabber.h create mode 100755 libs/cocos2d/CCGrabber.m create mode 100755 libs/cocos2d/CCGrid.h create mode 100755 libs/cocos2d/CCGrid.m create mode 100755 libs/cocos2d/CCLabelAtlas.h create mode 100755 libs/cocos2d/CCLabelAtlas.m create mode 100755 libs/cocos2d/CCLabelBMFont.h create mode 100755 libs/cocos2d/CCLabelBMFont.m create mode 100755 libs/cocos2d/CCLabelTTF.h create mode 100755 libs/cocos2d/CCLabelTTF.m create mode 100755 libs/cocos2d/CCLayer.h create mode 100755 libs/cocos2d/CCLayer.m create mode 100755 libs/cocos2d/CCMenu.h create mode 100755 libs/cocos2d/CCMenu.m create mode 100755 libs/cocos2d/CCMenuItem.h create mode 100755 libs/cocos2d/CCMenuItem.m create mode 100755 libs/cocos2d/CCMotionStreak.h create mode 100755 libs/cocos2d/CCMotionStreak.m create mode 100755 libs/cocos2d/CCNode.h create mode 100755 libs/cocos2d/CCNode.m create mode 100755 libs/cocos2d/CCParallaxNode.h create mode 100755 libs/cocos2d/CCParallaxNode.m create mode 100755 libs/cocos2d/CCParticleExamples.h create mode 100755 libs/cocos2d/CCParticleExamples.m create mode 100755 libs/cocos2d/CCParticleSystem.h create mode 100755 libs/cocos2d/CCParticleSystem.m create mode 100755 libs/cocos2d/CCParticleSystemPoint.h create mode 100755 libs/cocos2d/CCParticleSystemPoint.m create mode 100755 libs/cocos2d/CCParticleSystemQuad.h create mode 100755 libs/cocos2d/CCParticleSystemQuad.m create mode 100755 libs/cocos2d/CCProgressTimer.h create mode 100755 libs/cocos2d/CCProgressTimer.m create mode 100755 libs/cocos2d/CCProtocols.h create mode 100755 libs/cocos2d/CCRenderTexture.h create mode 100755 libs/cocos2d/CCRenderTexture.m create mode 100755 libs/cocos2d/CCRibbon.h create mode 100755 libs/cocos2d/CCRibbon.m create mode 100755 libs/cocos2d/CCScene.h create mode 100755 libs/cocos2d/CCScene.m create mode 100755 libs/cocos2d/CCScheduler.h create mode 100755 libs/cocos2d/CCScheduler.m create mode 100755 libs/cocos2d/CCSprite.h create mode 100755 libs/cocos2d/CCSprite.m create mode 100755 libs/cocos2d/CCSpriteBatchNode.h create mode 100755 libs/cocos2d/CCSpriteBatchNode.m create mode 100755 libs/cocos2d/CCSpriteFrame.h create mode 100755 libs/cocos2d/CCSpriteFrame.m create mode 100755 libs/cocos2d/CCSpriteFrameCache.h create mode 100755 libs/cocos2d/CCSpriteFrameCache.m create mode 100755 libs/cocos2d/CCTMXLayer.h create mode 100755 libs/cocos2d/CCTMXLayer.m create mode 100755 libs/cocos2d/CCTMXObjectGroup.h create mode 100755 libs/cocos2d/CCTMXObjectGroup.m create mode 100755 libs/cocos2d/CCTMXTiledMap.h create mode 100755 libs/cocos2d/CCTMXTiledMap.m create mode 100755 libs/cocos2d/CCTMXXMLParser.h create mode 100755 libs/cocos2d/CCTMXXMLParser.m create mode 100755 libs/cocos2d/CCTexture2D.h create mode 100755 libs/cocos2d/CCTexture2D.m create mode 100755 libs/cocos2d/CCTextureAtlas.h create mode 100755 libs/cocos2d/CCTextureAtlas.m create mode 100755 libs/cocos2d/CCTextureCache.h create mode 100755 libs/cocos2d/CCTextureCache.m create mode 100755 libs/cocos2d/CCTexturePVR.h create mode 100755 libs/cocos2d/CCTexturePVR.m create mode 100755 libs/cocos2d/CCTileMapAtlas.h create mode 100755 libs/cocos2d/CCTileMapAtlas.m create mode 100755 libs/cocos2d/CCTransition.h create mode 100755 libs/cocos2d/CCTransition.m create mode 100755 libs/cocos2d/CCTransitionPageTurn.h create mode 100755 libs/cocos2d/CCTransitionPageTurn.m create mode 100755 libs/cocos2d/CCTransitionRadial.h create mode 100755 libs/cocos2d/CCTransitionRadial.m create mode 100755 libs/cocos2d/Platforms/CCGL.h create mode 100755 libs/cocos2d/Platforms/CCNS.h create mode 100755 libs/cocos2d/Platforms/Mac/CCDirectorMac.h create mode 100755 libs/cocos2d/Platforms/Mac/CCDirectorMac.m create mode 100755 libs/cocos2d/Platforms/Mac/CCEventDispatcher.h create mode 100755 libs/cocos2d/Platforms/Mac/CCEventDispatcher.m create mode 100755 libs/cocos2d/Platforms/Mac/MacGLView.h create mode 100755 libs/cocos2d/Platforms/Mac/MacGLView.m create mode 100755 libs/cocos2d/Platforms/Mac/MacWindow.h create mode 100755 libs/cocos2d/Platforms/Mac/MacWindow.m create mode 100755 libs/cocos2d/Platforms/iOS/CCDirectorIOS.h create mode 100755 libs/cocos2d/Platforms/iOS/CCDirectorIOS.m create mode 100755 libs/cocos2d/Platforms/iOS/CCTouchDelegateProtocol.h create mode 100755 libs/cocos2d/Platforms/iOS/CCTouchDispatcher.h create mode 100755 libs/cocos2d/Platforms/iOS/CCTouchDispatcher.m create mode 100755 libs/cocos2d/Platforms/iOS/CCTouchHandler.h create mode 100755 libs/cocos2d/Platforms/iOS/CCTouchHandler.m create mode 100755 libs/cocos2d/Platforms/iOS/EAGLView.h create mode 100755 libs/cocos2d/Platforms/iOS/EAGLView.m create mode 100755 libs/cocos2d/Platforms/iOS/ES1Renderer.h create mode 100755 libs/cocos2d/Platforms/iOS/ES1Renderer.m create mode 100755 libs/cocos2d/Platforms/iOS/ESRenderer.h create mode 100755 libs/cocos2d/Platforms/iOS/glu.c create mode 100755 libs/cocos2d/Platforms/iOS/glu.h create mode 100755 libs/cocos2d/Support/CCArray.h create mode 100755 libs/cocos2d/Support/CCArray.m create mode 100755 libs/cocos2d/Support/CCFileUtils.h create mode 100755 libs/cocos2d/Support/CCFileUtils.m create mode 100755 libs/cocos2d/Support/CCProfiling.h create mode 100755 libs/cocos2d/Support/CCProfiling.m create mode 100755 libs/cocos2d/Support/CGPointExtension.h create mode 100755 libs/cocos2d/Support/CGPointExtension.m create mode 100755 libs/cocos2d/Support/OpenGL_Internal.h create mode 100755 libs/cocos2d/Support/TGAlib.h create mode 100755 libs/cocos2d/Support/TGAlib.m create mode 100755 libs/cocos2d/Support/TransformUtils.h create mode 100755 libs/cocos2d/Support/TransformUtils.m create mode 100755 libs/cocos2d/Support/ZipUtils.h create mode 100755 libs/cocos2d/Support/ZipUtils.m create mode 100755 libs/cocos2d/Support/base64.c create mode 100755 libs/cocos2d/Support/base64.h create mode 100755 libs/cocos2d/Support/ccCArray.h create mode 100755 libs/cocos2d/Support/ccUtils.c create mode 100755 libs/cocos2d/Support/ccUtils.h create mode 100755 libs/cocos2d/Support/uthash.h create mode 100755 libs/cocos2d/Support/utlist.h create mode 100755 libs/cocos2d/ccConfig.h create mode 100755 libs/cocos2d/ccMacros.h create mode 100755 libs/cocos2d/ccTypes.h create mode 100755 libs/cocos2d/cocos2d.h create mode 100755 libs/cocos2d/cocos2d.m create mode 100755 libs/cocoslive/CLScoreServerPost.h create mode 100755 libs/cocoslive/CLScoreServerPost.m create mode 100755 libs/cocoslive/CLScoreServerRequest.h create mode 100755 libs/cocoslive/CLScoreServerRequest.m create mode 100755 libs/cocoslive/cocoslive.h create mode 100755 libs/cocoslive/cocoslive.m (limited to 'libs') diff --git a/libs/CocosDenshion/CDAudioManager.h b/libs/CocosDenshion/CDAudioManager.h new file mode 100755 index 0000000..2475929 --- /dev/null +++ b/libs/CocosDenshion/CDAudioManager.h @@ -0,0 +1,243 @@ +/* + Copyright (c) 2010 Steve Oldmeadow + + Permission is hereby granted, free of charge, to any person obtaining a copy + of this software and associated documentation files (the "Software"), to deal + in the Software without restriction, including without limitation the rights + to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + copies of the Software, and to permit persons to whom the Software is + furnished to do so, subject to the following conditions: + + The above copyright notice and this permission notice shall be included in + all copies or substantial portions of the Software. + + THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + THE SOFTWARE. + + $Id$ + */ + +#import "CocosDenshion.h" +#if __IPHONE_OS_VERSION_MIN_REQUIRED >= 30000 + #import +#else + #import "CDXMacOSXSupport.h" +#endif + +/** Different modes of the engine */ +typedef enum { + kAMM_FxOnly, //!Other apps will be able to play audio + kAMM_FxPlusMusic, //!Only this app will play audio + kAMM_FxPlusMusicIfNoOtherAudio, //!If another app is playing audio at start up then allow it to continue and don't play music + kAMM_MediaPlayback, //!This app takes over audio e.g music player app + kAMM_PlayAndRecord //!App takes over audio and has input and output +} tAudioManagerMode; + +/** Possible states of the engine */ +typedef enum { + kAMStateUninitialised, //!Audio manager has not been initialised - do not use + kAMStateInitialising, //!Audio manager is in the process of initialising - do not use + kAMStateInitialised //!Audio manager is initialised - safe to use +} tAudioManagerState; + +typedef enum { + kAMRBDoNothing, //Audio manager will not do anything on resign or becoming active + kAMRBStopPlay, //Background music is stopped on resign and resumed on become active + kAMRBStop //Background music is stopped on resign but not resumed - maybe because you want to do this from within your game +} tAudioManagerResignBehavior; + +/** Notifications */ +extern NSString * const kCDN_AudioManagerInitialised; + +@interface CDAsynchInitialiser : NSOperation {} +@end + +/** CDAudioManager supports two long audio source channels called left and right*/ +typedef enum { + kASC_Left = 0, + kASC_Right = 1 +} tAudioSourceChannel; + +typedef enum { + kLAS_Init, + kLAS_Loaded, + kLAS_Playing, + kLAS_Paused, + kLAS_Stopped, +} tLongAudioSourceState; + +@class CDLongAudioSource; +@protocol CDLongAudioSourceDelegate +@optional +/** The audio source completed playing */ +- (void) cdAudioSourceDidFinishPlaying:(CDLongAudioSource *) audioSource; +/** The file used to load the audio source has changed */ +- (void) cdAudioSourceFileDidChange:(CDLongAudioSource *) audioSource; +@end + +/** + CDLongAudioSource represents an audio source that has a long duration which makes + it costly to load into memory for playback as an effect using CDSoundEngine. Examples + include background music and narration tracks. The audio file may or may not be compressed. + Bear in mind that current iDevices can only use hardware to decode a single compressed + audio file at a time and playing multiple compressed files will result in a performance drop + as software decompression will take place. + @since v0.99 + */ +@interface CDLongAudioSource : NSObject { + AVAudioPlayer *audioSourcePlayer; + NSString *audioSourceFilePath; + NSInteger numberOfLoops; + float volume; + id delegate; + BOOL mute; + BOOL enabled_; + BOOL backgroundMusic; +@public + BOOL systemPaused;//Used for auto resign handling + NSTimeInterval systemPauseLocation;//Used for auto resign handling +@protected + tLongAudioSourceState state; +} +@property (readonly) AVAudioPlayer *audioSourcePlayer; +@property (readonly) NSString *audioSourceFilePath; +@property (readwrite, nonatomic) NSInteger numberOfLoops; +@property (readwrite, nonatomic) float volume; +@property (assign) id delegate; +/* This long audio source functions as background music */ +@property (readwrite, nonatomic) BOOL backgroundMusic; + +/** Loads the file into the audio source */ +-(void) load:(NSString*) filePath; +/** Plays the audio source */ +-(void) play; +/** Stops playing the audio soruce */ +-(void) stop; +/** Pauses the audio source */ +-(void) pause; +/** Rewinds the audio source */ +-(void) rewind; +/** Resumes playing the audio source if it was paused */ +-(void) resume; +/** Returns whether or not the audio source is playing */ +-(BOOL) isPlaying; + +@end + +/** + CDAudioManager manages audio requirements for a game. It provides access to a CDSoundEngine object + for playing sound effects. It provides access to two CDLongAudioSource object (left and right channel) + for playing long duration audio such as background music and narration tracks. Additionally it manages + the audio session to take care of things like audio session interruption and interacting with the audio + of other apps that are running on the device. + + Requirements: + - Firmware: OS 2.2 or greater + - Files: CDAudioManager.*, CocosDenshion.* + - Frameworks: OpenAL, AudioToolbox, AVFoundation + @since v0.8 + */ +@interface CDAudioManager : NSObject { + CDSoundEngine *soundEngine; + CDLongAudioSource *backgroundMusic; + NSMutableArray *audioSourceChannels; + NSString* _audioSessionCategory; + BOOL _audioWasPlayingAtStartup; + tAudioManagerMode _mode; + SEL backgroundMusicCompletionSelector; + id backgroundMusicCompletionListener; + BOOL willPlayBackgroundMusic; + BOOL _mute; + BOOL _resigned; + BOOL _interrupted; + BOOL _audioSessionActive; + BOOL enabled_; + + //For handling resign/become active + BOOL _isObservingAppEvents; + tAudioManagerResignBehavior _resignBehavior; +} + +@property (readonly) CDSoundEngine *soundEngine; +@property (readonly) CDLongAudioSource *backgroundMusic; +@property (readonly) BOOL willPlayBackgroundMusic; + +/** Returns the shared singleton */ ++ (CDAudioManager *) sharedManager; ++ (tAudioManagerState) sharedManagerState; +/** Configures the shared singleton with a mode*/ ++ (void) configure: (tAudioManagerMode) mode; +/** Initializes the engine asynchronously with a mode */ ++ (void) initAsynchronously: (tAudioManagerMode) mode; +/** Initializes the engine synchronously with a mode, channel definition and a total number of channels */ +- (id) init: (tAudioManagerMode) mode; +-(void) audioSessionInterrupted; +-(void) audioSessionResumed; +-(void) setResignBehavior:(tAudioManagerResignBehavior) resignBehavior autoHandle:(BOOL) autoHandle; +/** Returns true is audio is muted at a hardware level e.g user has ringer switch set to off */ +-(BOOL) isDeviceMuted; +/** Returns true if another app is playing audio such as the iPod music player */ +-(BOOL) isOtherAudioPlaying; +/** Sets the way the audio manager interacts with the operating system such as whether it shares output with other apps or obeys the mute switch */ +-(void) setMode:(tAudioManagerMode) mode; +/** Shuts down the shared audio manager instance so that it can be reinitialised */ ++(void) end; + +/** Call if you want to use built in resign behavior but need to do some additional audio processing on resign active. */ +- (void) applicationWillResignActive; +/** Call if you want to use built in resign behavior but need to do some additional audio processing on become active. */ +- (void) applicationDidBecomeActive; + +//New AVAudioPlayer API +/** Loads the data from the specified file path to the channel's audio source */ +-(CDLongAudioSource*) audioSourceLoad:(NSString*) filePath channel:(tAudioSourceChannel) channel; +/** Retrieves the audio source for the specified channel */ +-(CDLongAudioSource*) audioSourceForChannel:(tAudioSourceChannel) channel; + +//Legacy AVAudioPlayer API +/** Plays music in background. The music can be looped or not + It is recommended to use .aac files as background music since they are decoded by the device (hardware). + */ +-(void) playBackgroundMusic:(NSString*) filePath loop:(BOOL) loop; +/** Preloads a background music */ +-(void) preloadBackgroundMusic:(NSString*) filePath; +/** Stops playing the background music */ +-(void) stopBackgroundMusic; +/** Pauses the background music */ +-(void) pauseBackgroundMusic; +/** Rewinds the background music */ +-(void) rewindBackgroundMusic; +/** Resumes playing the background music */ +-(void) resumeBackgroundMusic; +/** Returns whether or not the background music is playing */ +-(BOOL) isBackgroundMusicPlaying; + +-(void) setBackgroundMusicCompletionListener:(id) listener selector:(SEL) selector; + +@end + +/** Fader for long audio source objects */ +@interface CDLongAudioSourceFader : CDPropertyModifier{} +@end + +static const int kCDNoBuffer = -1; + +/** Allows buffers to be associated with file names */ +@interface CDBufferManager:NSObject{ + NSMutableDictionary* loadedBuffers; + NSMutableArray *freedBuffers; + CDSoundEngine *soundEngine; + int nextBufferId; +} + +-(id) initWithEngine:(CDSoundEngine *) theSoundEngine; +-(int) bufferForFile:(NSString*) filePath create:(BOOL) create; +-(void) releaseBufferForFile:(NSString *) filePath; + +@end + diff --git a/libs/CocosDenshion/CDAudioManager.m b/libs/CocosDenshion/CDAudioManager.m new file mode 100755 index 0000000..0929f3c --- /dev/null +++ b/libs/CocosDenshion/CDAudioManager.m @@ -0,0 +1,887 @@ +/* + Copyright (c) 2010 Steve Oldmeadow + + Permission is hereby granted, free of charge, to any person obtaining a copy + of this software and associated documentation files (the "Software"), to deal + in the Software without restriction, including without limitation the rights + to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + copies of the Software, and to permit persons to whom the Software is + furnished to do so, subject to the following conditions: + + The above copyright notice and this permission notice shall be included in + all copies or substantial portions of the Software. + + THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + THE SOFTWARE. + + $Id$ + */ + + +#import "CDAudioManager.h" + +NSString * const kCDN_AudioManagerInitialised = @"kCDN_AudioManagerInitialised"; + +//NSOperation object used to asynchronously initialise +@implementation CDAsynchInitialiser + +-(void) main { + [super main]; + [CDAudioManager sharedManager]; +} + +@end + +@implementation CDLongAudioSource + +@synthesize audioSourcePlayer, audioSourceFilePath, delegate, backgroundMusic; + +-(id) init { + if ((self = [super init])) { + state = kLAS_Init; + volume = 1.0f; + mute = NO; + enabled_ = YES; + } + return self; +} + +-(void) dealloc { + CDLOGINFO(@"Denshion::CDLongAudioSource - deallocating %@", self); + [audioSourcePlayer release]; + [audioSourceFilePath release]; + [super dealloc]; +} + +-(void) load:(NSString*) filePath { + //We have alread loaded a file previously, check if we are being asked to load the same file + if (state == kLAS_Init || ![filePath isEqualToString:audioSourceFilePath]) { + CDLOGINFO(@"Denshion::CDLongAudioSource - Loading new audio source %@",filePath); + //New file + if (state != kLAS_Init) { + [audioSourceFilePath release];//Release old file path + [audioSourcePlayer release];//Release old AVAudioPlayer, they can't be reused + } + audioSourceFilePath = [filePath copy]; + NSError *error = nil; + NSString *path = [CDUtilities fullPathFromRelativePath:audioSourceFilePath]; + audioSourcePlayer = [(AVAudioPlayer*)[AVAudioPlayer alloc] initWithContentsOfURL:[NSURL fileURLWithPath:path] error:&error]; + if (error == nil) { + [audioSourcePlayer prepareToPlay]; + audioSourcePlayer.delegate = self; + if (delegate && [delegate respondsToSelector:@selector(cdAudioSourceFileDidChange:)]) { + //Tell our delegate the file has changed + [delegate cdAudioSourceFileDidChange:self]; + } + } else { + CDLOG(@"Denshion::CDLongAudioSource - Error initialising audio player: %@",error); + } + } else { + //Same file - just return it to a consistent state + [self pause]; + [self rewind]; + } + audioSourcePlayer.volume = volume; + audioSourcePlayer.numberOfLoops = numberOfLoops; + state = kLAS_Loaded; +} + +-(void) play { + if (enabled_) { + self->systemPaused = NO; + [audioSourcePlayer play]; + } else { + CDLOGINFO(@"Denshion::CDLongAudioSource long audio source didn't play because it is disabled"); + } +} + +-(void) stop { + [audioSourcePlayer stop]; +} + +-(void) pause { + [audioSourcePlayer pause]; +} + +-(void) rewind { + [audioSourcePlayer setCurrentTime:0]; +} + +-(void) resume { + [audioSourcePlayer play]; +} + +-(BOOL) isPlaying { + if (state != kLAS_Init) { + return [audioSourcePlayer isPlaying]; + } else { + return NO; + } +} + +-(void) setVolume:(float) newVolume +{ + volume = newVolume; + if (state != kLAS_Init && !mute) { + audioSourcePlayer.volume = newVolume; + } +} + +-(float) volume +{ + return volume; +} + +#pragma mark Audio Interrupt Protocol +-(BOOL) mute +{ + return mute; +} + +-(void) setMute:(BOOL) muteValue +{ + if (mute != muteValue) { + if (mute) { + //Turn sound back on + audioSourcePlayer.volume = volume; + } else { + audioSourcePlayer.volume = 0.0f; + } + mute = muteValue; + } +} + +-(BOOL) enabled +{ + return enabled_; +} + +-(void) setEnabled:(BOOL)enabledValue +{ + if (enabledValue != enabled_) { + enabled_ = enabledValue; + if (!enabled_) { + //"Stop" the sounds + [self pause]; + [self rewind]; + } + } +} + +-(NSInteger) numberOfLoops { + return numberOfLoops; +} + +-(void) setNumberOfLoops:(NSInteger) loopCount +{ + audioSourcePlayer.numberOfLoops = loopCount; + numberOfLoops = loopCount; +} + +- (void)audioPlayerDidFinishPlaying:(AVAudioPlayer *)player successfully:(BOOL)flag { + CDLOGINFO(@"Denshion::CDLongAudioSource - audio player finished"); +#if TARGET_IPHONE_SIMULATOR + CDLOGINFO(@"Denshion::CDLongAudioSource - workaround for OpenAL clobbered audio issue"); + //This is a workaround for an issue in all simulators (tested to 3.1.2). Problem is + //that OpenAL audio playback is clobbered when an AVAudioPlayer stops. Workaround + //is to keep the player playing on an endless loop with 0 volume and then when + //it is played again reset the volume and set loop count appropriately. + //NB: this workaround is not foolproof but it is good enough for most situations. + player.numberOfLoops = -1; + player.volume = 0; + [player play]; +#endif + if (delegate && [delegate respondsToSelector:@selector(cdAudioSourceDidFinishPlaying:)]) { + [delegate cdAudioSourceDidFinishPlaying:self]; + } +} + +-(void)audioPlayerBeginInterruption:(AVAudioPlayer *)player { + CDLOGINFO(@"Denshion::CDLongAudioSource - audio player interrupted"); +} + +-(void)audioPlayerEndInterruption:(AVAudioPlayer *)player { + CDLOGINFO(@"Denshion::CDLongAudioSource - audio player resumed"); + if (self.backgroundMusic) { + //Check if background music can play as rules may have changed during + //the interruption. This is to address a specific issue in 4.x when + //fast task switching + if([CDAudioManager sharedManager].willPlayBackgroundMusic) { + [player play]; + } + } else { + [player play]; + } +} + +@end + + +@interface CDAudioManager (PrivateMethods) +-(BOOL) audioSessionSetActive:(BOOL) active; +-(BOOL) audioSessionSetCategory:(NSString*) category; +-(void) badAlContextHandler; +@end + + +@implementation CDAudioManager +#define BACKGROUND_MUSIC_CHANNEL kASC_Left + +@synthesize soundEngine, willPlayBackgroundMusic; +static CDAudioManager *sharedManager; +static tAudioManagerState _sharedManagerState = kAMStateUninitialised; +static tAudioManagerMode configuredMode; +static BOOL configured = FALSE; + +-(BOOL) audioSessionSetActive:(BOOL) active { + NSError *activationError = nil; + if ([[AVAudioSession sharedInstance] setActive:active error:&activationError]) { + _audioSessionActive = active; + CDLOGINFO(@"Denshion::CDAudioManager - Audio session set active %i succeeded", active); + return YES; + } else { + //Failed + CDLOG(@"Denshion::CDAudioManager - Audio session set active %i failed with error %@", active, activationError); + return NO; + } +} + +-(BOOL) audioSessionSetCategory:(NSString*) category { + NSError *categoryError = nil; + if ([[AVAudioSession sharedInstance] setCategory:category error:&categoryError]) { + CDLOGINFO(@"Denshion::CDAudioManager - Audio session set category %@ succeeded", category); + return YES; + } else { + //Failed + CDLOG(@"Denshion::CDAudioManager - Audio session set category %@ failed with error %@", category, categoryError); + return NO; + } +} + +// Init ++ (CDAudioManager *) sharedManager +{ + @synchronized(self) { + if (!sharedManager) { + if (!configured) { + //Set defaults here + configuredMode = kAMM_FxPlusMusicIfNoOtherAudio; + } + sharedManager = [[CDAudioManager alloc] init:configuredMode]; + _sharedManagerState = kAMStateInitialised;//This is only really relevant when using asynchronous initialisation + [[NSNotificationCenter defaultCenter] postNotificationName:kCDN_AudioManagerInitialised object:nil]; + } + } + return sharedManager; +} + ++ (tAudioManagerState) sharedManagerState { + return _sharedManagerState; +} + +/** + * Call this to set up audio manager asynchronously. Initialisation is finished when sharedManagerState == kAMStateInitialised + */ ++ (void) initAsynchronously: (tAudioManagerMode) mode { + @synchronized(self) { + if (_sharedManagerState == kAMStateUninitialised) { + _sharedManagerState = kAMStateInitialising; + [CDAudioManager configure:mode]; + CDAsynchInitialiser *initOp = [[[CDAsynchInitialiser alloc] init] autorelease]; + NSOperationQueue *opQ = [[[NSOperationQueue alloc] init] autorelease]; + [opQ addOperation:initOp]; + } + } +} + ++ (id) alloc +{ + @synchronized(self) { + NSAssert(sharedManager == nil, @"Attempted to allocate a second instance of a singleton."); + return [super alloc]; + } + return nil; +} + +/* + * Call this method before accessing the shared manager in order to configure the shared audio manager + */ ++ (void) configure: (tAudioManagerMode) mode { + configuredMode = mode; + configured = TRUE; +} + +-(BOOL) isOtherAudioPlaying { + UInt32 isPlaying = 0; + UInt32 varSize = sizeof(isPlaying); + AudioSessionGetProperty (kAudioSessionProperty_OtherAudioIsPlaying, &varSize, &isPlaying); + return (isPlaying != 0); +} + +-(void) setMode:(tAudioManagerMode) mode { + + _mode = mode; + switch (_mode) { + + case kAMM_FxOnly: + //Share audio with other app + CDLOGINFO(@"Denshion::CDAudioManager - Audio will be shared"); + //_audioSessionCategory = kAudioSessionCategory_AmbientSound; + _audioSessionCategory = AVAudioSessionCategoryAmbient; + willPlayBackgroundMusic = NO; + break; + + case kAMM_FxPlusMusic: + //Use audio exclusively - if other audio is playing it will be stopped + CDLOGINFO(@"Denshion::CDAudioManager - Audio will be exclusive"); + //_audioSessionCategory = kAudioSessionCategory_SoloAmbientSound; + _audioSessionCategory = AVAudioSessionCategorySoloAmbient; + willPlayBackgroundMusic = YES; + break; + + case kAMM_MediaPlayback: + //Use audio exclusively, ignore mute switch and sleep + CDLOGINFO(@"Denshion::CDAudioManager - Media playback mode, audio will be exclusive"); + //_audioSessionCategory = kAudioSessionCategory_MediaPlayback; + _audioSessionCategory = AVAudioSessionCategoryPlayback; + willPlayBackgroundMusic = YES; + break; + + case kAMM_PlayAndRecord: + //Use audio exclusively, ignore mute switch and sleep, has inputs and outputs + CDLOGINFO(@"Denshion::CDAudioManager - Play and record mode, audio will be exclusive"); + //_audioSessionCategory = kAudioSessionCategory_PlayAndRecord; + _audioSessionCategory = AVAudioSessionCategoryPlayAndRecord; + willPlayBackgroundMusic = YES; + break; + + default: + //kAudioManagerFxPlusMusicIfNoOtherAudio + if ([self isOtherAudioPlaying]) { + CDLOGINFO(@"Denshion::CDAudioManager - Other audio is playing audio will be shared"); + //_audioSessionCategory = kAudioSessionCategory_AmbientSound; + _audioSessionCategory = AVAudioSessionCategoryAmbient; + willPlayBackgroundMusic = NO; + } else { + CDLOGINFO(@"Denshion::CDAudioManager - Other audio is not playing audio will be exclusive"); + //_audioSessionCategory = kAudioSessionCategory_SoloAmbientSound; + _audioSessionCategory = AVAudioSessionCategorySoloAmbient; + willPlayBackgroundMusic = YES; + } + + break; + } + + [self audioSessionSetCategory:_audioSessionCategory]; + +} + +/** + * This method is used to work around various bugs introduced in 4.x OS versions. In some circumstances the + * audio session is interrupted but never resumed, this results in the loss of OpenAL audio when following + * standard practices. If we detect this situation then we will attempt to resume the audio session ourselves. + * Known triggers: lock the device then unlock it (iOS 4.2 gm), playback a song using MPMediaPlayer (iOS 4.0) + */ +- (void) badAlContextHandler { + if (_interrupted && alcGetCurrentContext() == NULL) { + CDLOG(@"Denshion::CDAudioManager - bad OpenAL context detected, attempting to resume audio session"); + [self audioSessionResumed]; + } +} + +- (id) init: (tAudioManagerMode) mode { + if ((self = [super init])) { + + //Initialise the audio session + AVAudioSession* session = [AVAudioSession sharedInstance]; + session.delegate = self; + + _mode = mode; + backgroundMusicCompletionSelector = nil; + _isObservingAppEvents = FALSE; + _mute = NO; + _resigned = NO; + _interrupted = NO; + enabled_ = YES; + _audioSessionActive = NO; + [self setMode:mode]; + soundEngine = [[CDSoundEngine alloc] init]; + + //Set up audioSource channels + audioSourceChannels = [[NSMutableArray alloc] init]; + CDLongAudioSource *leftChannel = [[CDLongAudioSource alloc] init]; + leftChannel.backgroundMusic = YES; + CDLongAudioSource *rightChannel = [[CDLongAudioSource alloc] init]; + rightChannel.backgroundMusic = NO; + [audioSourceChannels insertObject:leftChannel atIndex:kASC_Left]; + [audioSourceChannels insertObject:rightChannel atIndex:kASC_Right]; + [leftChannel release]; + [rightChannel release]; + //Used to support legacy APIs + backgroundMusic = [self audioSourceForChannel:BACKGROUND_MUSIC_CHANNEL]; + backgroundMusic.delegate = self; + + //Add handler for bad al context messages, these are posted by the sound engine. + [[NSNotificationCenter defaultCenter] addObserver:self selector:@selector(badAlContextHandler) name:kCDN_BadAlContext object:nil]; + + } + return self; +} + +-(void) dealloc { + CDLOGINFO(@"Denshion::CDAudioManager - deallocating"); + [self stopBackgroundMusic]; + [soundEngine release]; + [[NSNotificationCenter defaultCenter] removeObserver:self]; + [self audioSessionSetActive:NO]; + [audioSourceChannels release]; + [super dealloc]; +} + +/** Retrieves the audio source for the specified channel */ +-(CDLongAudioSource*) audioSourceForChannel:(tAudioSourceChannel) channel +{ + return (CDLongAudioSource*)[audioSourceChannels objectAtIndex:channel]; +} + +/** Loads the data from the specified file path to the channel's audio source */ +-(CDLongAudioSource*) audioSourceLoad:(NSString*) filePath channel:(tAudioSourceChannel) channel +{ + CDLongAudioSource *audioSource = [self audioSourceForChannel:channel]; + if (audioSource) { + [audioSource load:filePath]; + } + return audioSource; +} + +-(BOOL) isBackgroundMusicPlaying { + return [self.backgroundMusic isPlaying]; +} + +//NB: originally I tried using a route change listener and intended to store the current route, +//however, on a 3gs running 3.1.2 no route change is generated when the user switches the +//ringer mute switch to off (i.e. enables sound) therefore polling is the only reliable way to +//determine ringer switch state +-(BOOL) isDeviceMuted { + +#if TARGET_IPHONE_SIMULATOR + //Calling audio route stuff on the simulator causes problems + return NO; +#else + CFStringRef newAudioRoute; + UInt32 propertySize = sizeof (CFStringRef); + + AudioSessionGetProperty ( + kAudioSessionProperty_AudioRoute, + &propertySize, + &newAudioRoute + ); + + if (newAudioRoute == NULL) { + //Don't expect this to happen but playing safe otherwise a null in the CFStringCompare will cause a crash + return YES; + } else { + CFComparisonResult newDeviceIsMuted = CFStringCompare ( + newAudioRoute, + (CFStringRef) @"", + 0 + ); + + return (newDeviceIsMuted == kCFCompareEqualTo); + } +#endif +} + +#pragma mark Audio Interrupt Protocol + +-(BOOL) mute { + return _mute; +} + +-(void) setMute:(BOOL) muteValue { + if (muteValue != _mute) { + _mute = muteValue; + [soundEngine setMute:muteValue]; + for( CDLongAudioSource *audioSource in audioSourceChannels) { + audioSource.mute = muteValue; + } + } +} + +-(BOOL) enabled { + return enabled_; +} + +-(void) setEnabled:(BOOL) enabledValue { + if (enabledValue != enabled_) { + enabled_ = enabledValue; + [soundEngine setEnabled:enabled_]; + for( CDLongAudioSource *audioSource in audioSourceChannels) { + audioSource.enabled = enabled_; + } + } +} + +-(CDLongAudioSource*) backgroundMusic +{ + return backgroundMusic; +} + +//Load background music ready for playing +-(void) preloadBackgroundMusic:(NSString*) filePath +{ + [self.backgroundMusic load:filePath]; +} + +-(void) playBackgroundMusic:(NSString*) filePath loop:(BOOL) loop +{ + [self.backgroundMusic load:filePath]; + + if (!willPlayBackgroundMusic || _mute) { + CDLOGINFO(@"Denshion::CDAudioManager - play bgm aborted because audio is not exclusive or sound is muted"); + return; + } + + if (loop) { + [self.backgroundMusic setNumberOfLoops:-1]; + } else { + [self.backgroundMusic setNumberOfLoops:0]; + } + [self.backgroundMusic play]; +} + +-(void) stopBackgroundMusic +{ + [self.backgroundMusic stop]; +} + +-(void) pauseBackgroundMusic +{ + [self.backgroundMusic pause]; +} + +-(void) resumeBackgroundMusic +{ + if (!willPlayBackgroundMusic || _mute) { + CDLOGINFO(@"Denshion::CDAudioManager - resume bgm aborted because audio is not exclusive or sound is muted"); + return; + } + + [self.backgroundMusic resume]; +} + +-(void) rewindBackgroundMusic +{ + [self.backgroundMusic rewind]; +} + +-(void) setBackgroundMusicCompletionListener:(id) listener selector:(SEL) selector { + backgroundMusicCompletionListener = listener; + backgroundMusicCompletionSelector = selector; +} + +/* + * Call this method to have the audio manager automatically handle application resign and + * become active. Pass a tAudioManagerResignBehavior to indicate the desired behavior + * for resigning and becoming active again. + * + * If autohandle is YES then the applicationWillResignActive and applicationDidBecomActive + * methods are automatically called, otherwise you must call them yourself at the appropriate time. + * + * Based on idea of Dominique Bongard + */ +-(void) setResignBehavior:(tAudioManagerResignBehavior) resignBehavior autoHandle:(BOOL) autoHandle { + + if (!_isObservingAppEvents && autoHandle) { + [[NSNotificationCenter defaultCenter] addObserver:self selector:@selector(applicationWillResignActive:) name:@"UIApplicationWillResignActiveNotification" object:nil]; + [[NSNotificationCenter defaultCenter] addObserver:self selector:@selector(applicationDidBecomeActive:) name:@"UIApplicationDidBecomeActiveNotification" object:nil]; + [[NSNotificationCenter defaultCenter] addObserver:self selector:@selector(applicationWillTerminate:) name:@"UIApplicationWillTerminateNotification" object:nil]; + _isObservingAppEvents = TRUE; + } + _resignBehavior = resignBehavior; +} + +- (void) applicationWillResignActive { + self->_resigned = YES; + + //Set the audio sesssion to one that allows sharing so that other audio won't be clobbered on resume + [self audioSessionSetCategory:AVAudioSessionCategoryAmbient]; + + switch (_resignBehavior) { + + case kAMRBStopPlay: + + for( CDLongAudioSource *audioSource in audioSourceChannels) { + if (audioSource.isPlaying) { + audioSource->systemPaused = YES; + audioSource->systemPauseLocation = audioSource.audioSourcePlayer.currentTime; + [audioSource stop]; + } else { + //Music is either paused or stopped, if it is paused it will be restarted + //by OS so we will stop it. + audioSource->systemPaused = NO; + [audioSource stop]; + } + } + break; + + case kAMRBStop: + //Stop music regardless of whether it is playing or not because if it was paused + //then the OS would resume it + for( CDLongAudioSource *audioSource in audioSourceChannels) { + [audioSource stop]; + } + + default: + break; + + } + CDLOGINFO(@"Denshion::CDAudioManager - handled resign active"); +} + +//Called when application resigns active only if setResignBehavior has been called +- (void) applicationWillResignActive:(NSNotification *) notification +{ + [self applicationWillResignActive]; +} + +- (void) applicationDidBecomeActive { + + if (self->_resigned) { + _resigned = NO; + //Reset the mode incase something changed with audio while we were inactive + [self setMode:_mode]; + switch (_resignBehavior) { + + case kAMRBStopPlay: + + //Music had been stopped but stop maintains current time + //so playing again will continue from where music was before resign active. + //We check if music can be played because while we were inactive the user might have + //done something that should force music to not play such as starting a track in the iPod + if (self.willPlayBackgroundMusic) { + for( CDLongAudioSource *audioSource in audioSourceChannels) { + if (audioSource->systemPaused) { + [audioSource resume]; + audioSource->systemPaused = NO; + } + } + } + break; + + default: + break; + + } + CDLOGINFO(@"Denshion::CDAudioManager - audio manager handled become active"); + } +} + +//Called when application becomes active only if setResignBehavior has been called +- (void) applicationDidBecomeActive:(NSNotification *) notification +{ + [self applicationDidBecomeActive]; +} + +//Called when application terminates only if setResignBehavior has been called +- (void) applicationWillTerminate:(NSNotification *) notification +{ + CDLOGINFO(@"Denshion::CDAudioManager - audio manager handling terminate"); + [self stopBackgroundMusic]; +} + +/** The audio source completed playing */ +- (void) cdAudioSourceDidFinishPlaying:(CDLongAudioSource *) audioSource { + CDLOGINFO(@"Denshion::CDAudioManager - audio manager got told background music finished"); + if (backgroundMusicCompletionSelector != nil) { + [backgroundMusicCompletionListener performSelector:backgroundMusicCompletionSelector]; + } +} + +-(void) beginInterruption { + CDLOGINFO(@"Denshion::CDAudioManager - begin interruption"); + [self audioSessionInterrupted]; +} + +-(void) endInterruption { + CDLOGINFO(@"Denshion::CDAudioManager - end interruption"); + [self audioSessionResumed]; +} + +#if __IPHONE_OS_VERSION_MAX_ALLOWED >= 40000 +-(void) endInterruptionWithFlags:(NSUInteger)flags { + CDLOGINFO(@"Denshion::CDAudioManager - interruption ended with flags %i",flags); + if (flags == AVAudioSessionInterruptionFlags_ShouldResume) { + [self audioSessionResumed]; + } +} +#endif + +-(void)audioSessionInterrupted +{ + if (!_interrupted) { + CDLOGINFO(@"Denshion::CDAudioManager - Audio session interrupted"); + _interrupted = YES; + + // Deactivate the current audio session + [self audioSessionSetActive:NO]; + + if (alcGetCurrentContext() != NULL) { + CDLOGINFO(@"Denshion::CDAudioManager - Setting OpenAL context to NULL"); + + ALenum error = AL_NO_ERROR; + + // set the current context to NULL will 'shutdown' openAL + alcMakeContextCurrent(NULL); + + if((error = alGetError()) != AL_NO_ERROR) { + CDLOG(@"Denshion::CDAudioManager - Error making context current %x\n", error); + } + #pragma unused(error) + } + } +} + +-(void)audioSessionResumed +{ + if (_interrupted) { + CDLOGINFO(@"Denshion::CDAudioManager - Audio session resumed"); + _interrupted = NO; + + BOOL activationResult = NO; + // Reactivate the current audio session + activationResult = [self audioSessionSetActive:YES]; + + //This code is to handle a problem with iOS 4.0 and 4.01 where reactivating the session can fail if + //task switching is performed too rapidly. A test case that reliably reproduces the issue is to call the + //iPhone and then hang up after two rings (timing may vary ;)) + //Basically we keep waiting and trying to let the OS catch up with itself but the number of tries is + //limited. + if (!activationResult) { + CDLOG(@"Denshion::CDAudioManager - Failure reactivating audio session, will try wait-try cycle"); + int activateCount = 0; + while (!activationResult && activateCount < 10) { + [NSThread sleepForTimeInterval:0.5]; + activationResult = [self audioSessionSetActive:YES]; + activateCount++; + CDLOGINFO(@"Denshion::CDAudioManager - Reactivation attempt %i status = %i",activateCount,activationResult); + } + } + + if (alcGetCurrentContext() == NULL) { + CDLOGINFO(@"Denshion::CDAudioManager - Restoring OpenAL context"); + ALenum error = AL_NO_ERROR; + // Restore open al context + alcMakeContextCurrent([soundEngine openALContext]); + if((error = alGetError()) != AL_NO_ERROR) { + CDLOG(@"Denshion::CDAudioManager - Error making context current%x\n", error); + } + #pragma unused(error) + } + } +} + ++(void) end { + [sharedManager release]; + sharedManager = nil; +} + +@end + +/////////////////////////////////////////////////////////////////////////////////////// +@implementation CDLongAudioSourceFader + +-(void) _setTargetProperty:(float) newVal { + ((CDLongAudioSource*)target).volume = newVal; +} + +-(float) _getTargetProperty { + return ((CDLongAudioSource*)target).volume; +} + +-(void) _stopTarget { + //Pause instead of stop as stop releases resources and causes problems in the simulator + [((CDLongAudioSource*)target) pause]; +} + +-(Class) _allowableType { + return [CDLongAudioSource class]; +} + +@end +/////////////////////////////////////////////////////////////////////////////////////// +@implementation CDBufferManager + +-(id) initWithEngine:(CDSoundEngine *) theSoundEngine { + if ((self = [super init])) { + soundEngine = theSoundEngine; + loadedBuffers = [[NSMutableDictionary alloc] initWithCapacity:CD_BUFFERS_START]; + freedBuffers = [[NSMutableArray alloc] init]; + nextBufferId = 0; + } + return self; +} + +-(void) dealloc { + [loadedBuffers release]; + [freedBuffers release]; + [super dealloc]; +} + +-(int) bufferForFile:(NSString*) filePath create:(BOOL) create { + + NSNumber* soundId = (NSNumber*)[loadedBuffers objectForKey:filePath]; + if(soundId == nil) + { + if (create) { + NSNumber* bufferId = nil; + //First try to get a buffer from the free buffers + if ([freedBuffers count] > 0) { + bufferId = [[[freedBuffers lastObject] retain] autorelease]; + [freedBuffers removeLastObject]; + CDLOGINFO(@"Denshion::CDBufferManager reusing buffer id %i",[bufferId intValue]); + } else { + bufferId = [[NSNumber alloc] initWithInt:nextBufferId]; + [bufferId autorelease]; + CDLOGINFO(@"Denshion::CDBufferManager generating new buffer id %i",[bufferId intValue]); + nextBufferId++; + } + + if ([soundEngine loadBuffer:[bufferId intValue] filePath:filePath]) { + //File successfully loaded + CDLOGINFO(@"Denshion::CDBufferManager buffer loaded %@ %@",bufferId,filePath); + [loadedBuffers setObject:bufferId forKey:filePath]; + return [bufferId intValue]; + } else { + //File didn't load, put buffer id on free list + [freedBuffers addObject:bufferId]; + return kCDNoBuffer; + } + } else { + //No matching buffer was found + return kCDNoBuffer; + } + } else { + return [soundId intValue]; + } +} + +-(void) releaseBufferForFile:(NSString *) filePath { + int bufferId = [self bufferForFile:filePath create:NO]; + if (bufferId != kCDNoBuffer) { + [soundEngine unloadBuffer:bufferId]; + [loadedBuffers removeObjectForKey:filePath]; + NSNumber *freedBufferId = [[NSNumber alloc] initWithInt:bufferId]; + [freedBufferId autorelease]; + [freedBuffers addObject:freedBufferId]; + } +} +@end + + + diff --git a/libs/CocosDenshion/CDConfig.h b/libs/CocosDenshion/CDConfig.h new file mode 100755 index 0000000..2bd8f76 --- /dev/null +++ b/libs/CocosDenshion/CDConfig.h @@ -0,0 +1,60 @@ +/* + Copyright (c) 2010 Steve Oldmeadow + + Permission is hereby granted, free of charge, to any person obtaining a copy + of this software and associated documentation files (the "Software"), to deal + in the Software without restriction, including without limitation the rights + to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + copies of the Software, and to permit persons to whom the Software is + furnished to do so, subject to the following conditions: + + The above copyright notice and this permission notice shall be included in + all copies or substantial portions of the Software. + + THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + THE SOFTWARE. + + $Id$ + */ +#define COCOSDENSHION_VERSION "Aphex.rc" + + +/** + If enabled code useful for debugging such as parameter check assertions will be performed. + If you experience any problems you should enable this and test your code with a debug build. + */ +//#define CD_DEBUG 1 + +/** + The total number of sounds/buffers that can be loaded assuming memory is sufficient + */ +//Number of buffers slots that will be initially created +#define CD_BUFFERS_START 64 +//Number of buffers that will be added +#define CD_BUFFERS_INCREMENT 16 + +/** + If enabled, OpenAL code will use static buffers. When static buffers are used the audio + data is managed outside of OpenAL, this eliminates a memcpy operation which leads to + higher performance when loading sounds. + + However, the downside is that when the audio data is freed you must + be certain that it is no longer being accessed otherwise your app will crash. Testing on OS 2.2.1 + and 3.1.2 has shown that this may occur if a buffer is being used by a source with state = AL_PLAYING + when the buffer is deleted. If the data is freed too quickly after the source is stopped then + a crash will occur. The implemented workaround is that when static buffers are used the unloadBuffer code will wait for + any playing sources to finish playing before the associated buffer and data are deleted, however, this delay may negate any + performance gains that are achieved during loading. + + Performance tests on a 1st gen iPod running OS 2.2.1 loading the CocosDenshionDemo sounds were ~0.14 seconds without + static buffers and ~0.12 seconds when using static buffers. + + */ +//#define CD_USE_STATIC_BUFFERS 1 + + diff --git a/libs/CocosDenshion/CDOpenALSupport.h b/libs/CocosDenshion/CDOpenALSupport.h new file mode 100755 index 0000000..661c69e --- /dev/null +++ b/libs/CocosDenshion/CDOpenALSupport.h @@ -0,0 +1,77 @@ +/* + + Disclaimer: IMPORTANT: This Apple software is supplied to you by + Apple Inc. ("Apple") in consideration of your agreement to the + following terms, and your use, installation, modification or + redistribution of this Apple software constitutes acceptance of these + terms. If you do not agree with these terms, please do not use, + install, modify or redistribute this Apple software. + + In consideration of your agreement to abide by the following terms, and + subject to these terms, Apple grants you a personal, non-exclusive + license, under Apple's copyrights in this original Apple software (the + "Apple Software"), to use, reproduce, modify and redistribute the Apple + Software, with or without modifications, in source and/or binary forms; + provided that if you redistribute the Apple Software in its entirety and + without modifications, you must retain this notice and the following + text and disclaimers in all such redistributions of the Apple Software. + Neither the name, trademarks, service marks or logos of Apple Inc. + may be used to endorse or promote products derived from the Apple + Software without specific prior written permission from Apple. Except + as expressly stated in this notice, no other rights or licenses, express + or implied, are granted by Apple herein, including but not limited to + any patent rights that may be infringed by your derivative works or by + other works in which the Apple Software may be incorporated. + + The Apple Software is provided by Apple on an "AS IS" basis. APPLE + MAKES NO WARRANTIES, EXPRESS OR IMPLIED, INCLUDING WITHOUT LIMITATION + THE IMPLIED WARRANTIES OF NON-INFRINGEMENT, MERCHANTABILITY AND FITNESS + FOR A PARTICULAR PURPOSE, REGARDING THE APPLE SOFTWARE OR ITS USE AND + OPERATION ALONE OR IN COMBINATION WITH YOUR PRODUCTS. + + IN NO EVENT SHALL APPLE BE LIABLE FOR ANY SPECIAL, INDIRECT, INCIDENTAL + OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + INTERRUPTION) ARISING IN ANY WAY OUT OF THE USE, REPRODUCTION, + MODIFICATION AND/OR DISTRIBUTION OF THE APPLE SOFTWARE, HOWEVER CAUSED + AND WHETHER UNDER THEORY OF CONTRACT, TORT (INCLUDING NEGLIGENCE), + STRICT LIABILITY OR OTHERWISE, EVEN IF APPLE HAS BEEN ADVISED OF THE + POSSIBILITY OF SUCH DAMAGE. + + Copyright (C) 2009 Apple Inc. All Rights Reserved. + + $Id$ + */ + +/* + This file contains code from version 1.1 and 1.4 of MyOpenALSupport.h taken from Apple's oalTouch version. + The 1.4 version code is used for loading IMA4 files, however, this code causes very noticeable clicking + when used to load wave files that are looped so the 1.1 version code is used specifically for loading + wav files. + */ + +#ifndef __CD_OPENAL_H +#define __CD_OPENAL_H + +#ifdef __cplusplus +extern "C" { +#endif + + +#import +#import +#import + + +//Taken from oalTouch MyOpenALSupport 1.1 +void* CDloadWaveAudioData(CFURLRef inFileURL, ALsizei *outDataSize, ALenum *outDataFormat, ALsizei* outSampleRate); +void* CDloadCafAudioData(CFURLRef inFileURL, ALsizei *outDataSize, ALenum *outDataFormat, ALsizei* outSampleRate); +void* CDGetOpenALAudioData(CFURLRef inFileURL, ALsizei *outDataSize, ALenum *outDataFormat, ALsizei* outSampleRate); + +#ifdef __cplusplus +} +#endif + +#endif + + diff --git a/libs/CocosDenshion/CDOpenALSupport.m b/libs/CocosDenshion/CDOpenALSupport.m new file mode 100755 index 0000000..ab0df8e --- /dev/null +++ b/libs/CocosDenshion/CDOpenALSupport.m @@ -0,0 +1,246 @@ +/* + + Disclaimer: IMPORTANT: This Apple software is supplied to you by + Apple Inc. ("Apple") in consideration of your agreement to the + following terms, and your use, installation, modification or + redistribution of this Apple software constitutes acceptance of these + terms. If you do not agree with these terms, please do not use, + install, modify or redistribute this Apple software. + + In consideration of your agreement to abide by the following terms, and + subject to these terms, Apple grants you a personal, non-exclusive + license, under Apple's copyrights in this original Apple software (the + "Apple Software"), to use, reproduce, modify and redistribute the Apple + Software, with or without modifications, in source and/or binary forms; + provided that if you redistribute the Apple Software in its entirety and + without modifications, you must retain this notice and the following + text and disclaimers in all such redistributions of the Apple Software. + Neither the name, trademarks, service marks or logos of Apple Inc. + may be used to endorse or promote products derived from the Apple + Software without specific prior written permission from Apple. Except + as expressly stated in this notice, no other rights or licenses, express + or implied, are granted by Apple herein, including but not limited to + any patent rights that may be infringed by your derivative works or by + other works in which the Apple Software may be incorporated. + + The Apple Software is provided by Apple on an "AS IS" basis. APPLE + MAKES NO WARRANTIES, EXPRESS OR IMPLIED, INCLUDING WITHOUT LIMITATION + THE IMPLIED WARRANTIES OF NON-INFRINGEMENT, MERCHANTABILITY AND FITNESS + FOR A PARTICULAR PURPOSE, REGARDING THE APPLE SOFTWARE OR ITS USE AND + OPERATION ALONE OR IN COMBINATION WITH YOUR PRODUCTS. + + IN NO EVENT SHALL APPLE BE LIABLE FOR ANY SPECIAL, INDIRECT, INCIDENTAL + OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF + SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS + INTERRUPTION) ARISING IN ANY WAY OUT OF THE USE, REPRODUCTION, + MODIFICATION AND/OR DISTRIBUTION OF THE APPLE SOFTWARE, HOWEVER CAUSED + AND WHETHER UNDER THEORY OF CONTRACT, TORT (INCLUDING NEGLIGENCE), + STRICT LIABILITY OR OTHERWISE, EVEN IF APPLE HAS BEEN ADVISED OF THE + POSSIBILITY OF SUCH DAMAGE. + + Copyright (C) 2009 Apple Inc. All Rights Reserved. + + $Id: CDOpenALSupport.h 16 2010-03-11 06:22:10Z steveoldmeadow $ + */ + +#import "CDOpenALSupport.h" +#import "CocosDenshion.h" +#import +#import + +//Taken from oalTouch MyOpenALSupport 1.1 +void* CDloadWaveAudioData(CFURLRef inFileURL, ALsizei *outDataSize, ALenum *outDataFormat, ALsizei* outSampleRate) +{ + OSStatus err = noErr; + UInt64 fileDataSize = 0; + AudioStreamBasicDescription theFileFormat; + UInt32 thePropertySize = sizeof(theFileFormat); + AudioFileID afid = 0; + void* theData = NULL; + + // Open a file with ExtAudioFileOpen() + err = AudioFileOpenURL(inFileURL, kAudioFileReadPermission, 0, &afid); + if(err) { CDLOG(@"MyGetOpenALAudioData: AudioFileOpenURL FAILED, Error = %ld\n", err); goto Exit; } + + // Get the audio data format + err = AudioFileGetProperty(afid, kAudioFilePropertyDataFormat, &thePropertySize, &theFileFormat); + if(err) { CDLOG(@"MyGetOpenALAudioData: AudioFileGetProperty(kAudioFileProperty_DataFormat) FAILED, Error = %ld\n", err); goto Exit; } + + if (theFileFormat.mChannelsPerFrame > 2) { + CDLOG(@"MyGetOpenALAudioData - Unsupported Format, channel count is greater than stereo\n"); goto Exit; + } + + if ((theFileFormat.mFormatID != kAudioFormatLinearPCM) || (!TestAudioFormatNativeEndian(theFileFormat))) { + CDLOG(@"MyGetOpenALAudioData - Unsupported Format, must be little-endian PCM\n"); goto Exit; + } + + if ((theFileFormat.mBitsPerChannel != 8) && (theFileFormat.mBitsPerChannel != 16)) { + CDLOG(@"MyGetOpenALAudioData - Unsupported Format, must be 8 or 16 bit PCM\n"); goto Exit; + } + + + thePropertySize = sizeof(fileDataSize); + err = AudioFileGetProperty(afid, kAudioFilePropertyAudioDataByteCount, &thePropertySize, &fileDataSize); + if(err) { CDLOG(@"MyGetOpenALAudioData: AudioFileGetProperty(kAudioFilePropertyAudioDataByteCount) FAILED, Error = %ld\n", err); goto Exit; } + + // Read all the data into memory + UInt32 dataSize = (UInt32)fileDataSize; + theData = malloc(dataSize); + if (theData) + { + AudioFileReadBytes(afid, false, 0, &dataSize, theData); + if(err == noErr) + { + // success + *outDataSize = (ALsizei)dataSize; + //This fix was added by me, however, 8 bit sounds have a clipping sound at the end so aren't really usable (SO) + if (theFileFormat.mBitsPerChannel == 16) { + *outDataFormat = (theFileFormat.mChannelsPerFrame > 1) ? AL_FORMAT_STEREO16 : AL_FORMAT_MONO16; + } else { + *outDataFormat = (theFileFormat.mChannelsPerFrame > 1) ? AL_FORMAT_STEREO8 : AL_FORMAT_MONO8; + } + *outSampleRate = (ALsizei)theFileFormat.mSampleRate; + } + else + { + // failure + free (theData); + theData = NULL; // make sure to return NULL + CDLOG(@"MyGetOpenALAudioData: ExtAudioFileRead FAILED, Error = %ld\n", err); goto Exit; + } + } + +Exit: + // Dispose the ExtAudioFileRef, it is no longer needed + if (afid) AudioFileClose(afid); + return theData; +} + +//Taken from oalTouch MyOpenALSupport 1.4 +void* CDloadCafAudioData(CFURLRef inFileURL, ALsizei *outDataSize, ALenum *outDataFormat, ALsizei* outSampleRate) +{ + OSStatus status = noErr; + BOOL abort = NO; + SInt64 theFileLengthInFrames = 0; + AudioStreamBasicDescription theFileFormat; + UInt32 thePropertySize = sizeof(theFileFormat); + ExtAudioFileRef extRef = NULL; + void* theData = NULL; + AudioStreamBasicDescription theOutputFormat; + UInt32 dataSize = 0; + + // Open a file with ExtAudioFileOpen() + status = ExtAudioFileOpenURL(inFileURL, &extRef); + if (status != noErr) + { + CDLOG(@"MyGetOpenALAudioData: ExtAudioFileOpenURL FAILED, Error = %ld\n", status); + abort = YES; + } + if (abort) + goto Exit; + + // Get the audio data format + status = ExtAudioFileGetProperty(extRef, kExtAudioFileProperty_FileDataFormat, &thePropertySize, &theFileFormat); + if (status != noErr) + { + CDLOG(@"MyGetOpenALAudioData: ExtAudioFileGetProperty(kExtAudioFileProperty_FileDataFormat) FAILED, Error = %ld\n", status); + abort = YES; + } + if (abort) + goto Exit; + + if (theFileFormat.mChannelsPerFrame > 2) + { + CDLOG(@"MyGetOpenALAudioData - Unsupported Format, channel count is greater than stereo\n"); + abort = YES; + } + if (abort) + goto Exit; + + // Set the client format to 16 bit signed integer (native-endian) data + // Maintain the channel count and sample rate of the original source format + theOutputFormat.mSampleRate = theFileFormat.mSampleRate; + theOutputFormat.mChannelsPerFrame = theFileFormat.mChannelsPerFrame; + + theOutputFormat.mFormatID = kAudioFormatLinearPCM; + theOutputFormat.mBytesPerPacket = 2 * theOutputFormat.mChannelsPerFrame; + theOutputFormat.mFramesPerPacket = 1; + theOutputFormat.mBytesPerFrame = 2 * theOutputFormat.mChannelsPerFrame; + theOutputFormat.mBitsPerChannel = 16; + theOutputFormat.mFormatFlags = kAudioFormatFlagsNativeEndian | kAudioFormatFlagIsPacked | kAudioFormatFlagIsSignedInteger; + + // Set the desired client (output) data format + status = ExtAudioFileSetProperty(extRef, kExtAudioFileProperty_ClientDataFormat, sizeof(theOutputFormat), &theOutputFormat); + if (status != noErr) + { + CDLOG(@"MyGetOpenALAudioData: ExtAudioFileSetProperty(kExtAudioFileProperty_ClientDataFormat) FAILED, Error = %ld\n", status); + abort = YES; + } + if (abort) + goto Exit; + + // Get the total frame count + thePropertySize = sizeof(theFileLengthInFrames); + status = ExtAudioFileGetProperty(extRef, kExtAudioFileProperty_FileLengthFrames, &thePropertySize, &theFileLengthInFrames); + if (status != noErr) + { + CDLOG(@"MyGetOpenALAudioData: ExtAudioFileGetProperty(kExtAudioFileProperty_FileLengthFrames) FAILED, Error = %ld\n", status); + abort = YES; + } + if (abort) + goto Exit; + + // Read all the data into memory + dataSize = (UInt32) theFileLengthInFrames * theOutputFormat.mBytesPerFrame; + theData = malloc(dataSize); + if (theData) + { + AudioBufferList theDataBuffer; + theDataBuffer.mNumberBuffers = 1; + theDataBuffer.mBuffers[0].mDataByteSize = dataSize; + theDataBuffer.mBuffers[0].mNumberChannels = theOutputFormat.mChannelsPerFrame; + theDataBuffer.mBuffers[0].mData = theData; + + // Read the data into an AudioBufferList + status = ExtAudioFileRead(extRef, (UInt32*)&theFileLengthInFrames, &theDataBuffer); + if(status == noErr) + { + // success + *outDataSize = (ALsizei)dataSize; + *outDataFormat = (theOutputFormat.mChannelsPerFrame > 1) ? AL_FORMAT_STEREO16 : AL_FORMAT_MONO16; + *outSampleRate = (ALsizei)theOutputFormat.mSampleRate; + } + else + { + // failure + free (theData); + theData = NULL; // make sure to return NULL + CDLOG(@"MyGetOpenALAudioData: ExtAudioFileRead FAILED, Error = %ld\n", status); + abort = YES; + } + } + if (abort) + goto Exit; + +Exit: + // Dispose the ExtAudioFileRef, it is no longer needed + if (extRef) ExtAudioFileDispose(extRef); + return theData; +} + +void* CDGetOpenALAudioData(CFURLRef inFileURL, ALsizei *outDataSize, ALenum *outDataFormat, ALsizei* outSampleRate) { + + CFStringRef extension = CFURLCopyPathExtension(inFileURL); + CFComparisonResult isWavFile = 0; + if (extension != NULL) { + isWavFile = CFStringCompare (extension,(CFStringRef)@"wav", kCFCompareCaseInsensitive); + CFRelease(extension); + } + + if (isWavFile == kCFCompareEqualTo) { + return CDloadWaveAudioData(inFileURL, outDataSize, outDataFormat, outSampleRate); + } else { + return CDloadCafAudioData(inFileURL, outDataSize, outDataFormat, outSampleRate); + } +} + diff --git a/libs/CocosDenshion/CocosDenshion.h b/libs/CocosDenshion/CocosDenshion.h new file mode 100755 index 0000000..638d852 --- /dev/null +++ b/libs/CocosDenshion/CocosDenshion.h @@ -0,0 +1,440 @@ +/* + Copyright (c) 2010 Steve Oldmeadow + + Permission is hereby granted, free of charge, to any person obtaining a copy + of this software and associated documentation files (the "Software"), to deal + in the Software without restriction, including without limitation the rights + to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + copies of the Software, and to permit persons to whom the Software is + furnished to do so, subject to the following conditions: + + The above copyright notice and this permission notice shall be included in + all copies or substantial portions of the Software. + + THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + THE SOFTWARE. + + $Id$ + */ + + + +/** +@file +@b IMPORTANT +There are 3 different ways of using CocosDenshion. Depending on which you choose you +will need to include different files and frameworks. + +@par SimpleAudioEngine +This is recommended for basic audio requirements. If you just want to play some sound fx +and some background music and have no interest in learning the lower level workings then +this is the interface to use. + +Requirements: + - Firmware: OS 2.2 or greater + - Files: SimpleAudioEngine.*, CocosDenshion.* + - Frameworks: OpenAL, AudioToolbox, AVFoundation + +@par CDAudioManager +CDAudioManager is basically a thin wrapper around an AVAudioPlayer object used for playing +background music and a CDSoundEngine object used for playing sound effects. It manages the +audio session for you deals with audio session interruption. It is fairly low level and it +is expected you have some understanding of the underlying technologies. For example, for +many use cases regarding background music it is expected you will work directly with the +backgroundMusic AVAudioPlayer which is exposed as a property. + +Requirements: + - Firmware: OS 2.2 or greater + - Files: CDAudioManager.*, CocosDenshion.* + - Frameworks: OpenAL, AudioToolbox, AVFoundation + +@par CDSoundEngine +CDSoundEngine is a sound engine built upon OpenAL and derived from Apple's oalTouch +example. It can playback up to 32 sounds simultaneously with control over pitch, pan +and gain. It can be set up to handle audio session interruption automatically. You +may decide to use CDSoundEngine directly instead of CDAudioManager or SimpleAudioEngine +because you require OS 2.0 compatibility. + +Requirements: + - Firmware: OS 2.0 or greater + - Files: CocosDenshion.* + - Frameworks: OpenAL, AudioToolbox + +*/ + +#import +#import +#import +#import +#import "CDConfig.h" + + +#if !defined(CD_DEBUG) || CD_DEBUG == 0 +#define CDLOG(...) do {} while (0) +#define CDLOGINFO(...) do {} while (0) + +#elif CD_DEBUG == 1 +#define CDLOG(...) NSLog(__VA_ARGS__) +#define CDLOGINFO(...) do {} while (0) + +#elif CD_DEBUG > 1 +#define CDLOG(...) NSLog(__VA_ARGS__) +#define CDLOGINFO(...) NSLog(__VA_ARGS__) +#endif // CD_DEBUG + + +#import "CDOpenALSupport.h" + +//Tested source limit on 2.2.1 and 3.1.2 with up to 128 sources and appears to work. Older OS versions e.g 2.2 may support only 32 +#define CD_SOURCE_LIMIT 32 //Total number of sources we will ever want, may actually get less +#define CD_NO_SOURCE 0xFEEDFAC //Return value indicating playback failed i.e. no source +#define CD_IGNORE_AUDIO_SESSION 0xBEEFBEE //Used internally to indicate audio session will not be handled +#define CD_MUTE 0xFEEDBAB //Return value indicating sound engine is muted or non functioning +#define CD_NO_SOUND = -1; + +#define CD_SAMPLE_RATE_HIGH 44100 +#define CD_SAMPLE_RATE_MID 22050 +#define CD_SAMPLE_RATE_LOW 16000 +#define CD_SAMPLE_RATE_BASIC 8000 +#define CD_SAMPLE_RATE_DEFAULT 44100 + +extern NSString * const kCDN_BadAlContext; +extern NSString * const kCDN_AsynchLoadComplete; + +extern float const kCD_PitchDefault; +extern float const kCD_PitchLowerOneOctave; +extern float const kCD_PitchHigherOneOctave; +extern float const kCD_PanDefault; +extern float const kCD_PanFullLeft; +extern float const kCD_PanFullRight; +extern float const kCD_GainDefault; + +enum bufferState { + CD_BS_EMPTY = 0, + CD_BS_LOADED = 1, + CD_BS_FAILED = 2 +}; + +typedef struct _sourceGroup { + int startIndex; + int currentIndex; + int totalSources; + bool enabled; + bool nonInterruptible; + int *sourceStatuses;//pointer into array of source status information +} sourceGroup; + +typedef struct _bufferInfo { + ALuint bufferId; + int bufferState; + void* bufferData; + ALenum format; + ALsizei sizeInBytes; + ALsizei frequencyInHertz; +} bufferInfo; + +typedef struct _sourceInfo { + bool usable; + ALuint sourceId; + ALuint attachedBufferId; +} sourceInfo; + +#pragma mark CDAudioTransportProtocol + +@protocol CDAudioTransportProtocol +/** Play the audio */ +-(BOOL) play; +/** Pause the audio, retain resources */ +-(BOOL) pause; +/** Stop the audio, release resources */ +-(BOOL) stop; +/** Return playback to beginning */ +-(BOOL) rewind; +@end + +#pragma mark CDAudioInterruptProtocol + +@protocol CDAudioInterruptProtocol +/** Is audio mute */ +-(BOOL) mute; +/** If YES then audio is silenced but not stopped, calls to start new audio will proceed but silently */ +-(void) setMute:(BOOL) muteValue; +/** Is audio enabled */ +-(BOOL) enabled; +/** If NO then all audio is stopped and any calls to start new audio will be ignored */ +-(void) setEnabled:(BOOL) enabledValue; +@end + +#pragma mark CDUtilities +/** + Collection of utilities required by CocosDenshion + */ +@interface CDUtilities : NSObject +{ +} + +/** Fundamentally the same as the corresponding method is CCFileUtils but added to break binding to cocos2d */ ++(NSString*) fullPathFromRelativePath:(NSString*) relPath; + +@end + + +#pragma mark CDSoundEngine + +/** CDSoundEngine is built upon OpenAL and works with SDK 2.0. + CDSoundEngine is a sound engine built upon OpenAL and derived from Apple's oalTouch + example. It can playback up to 32 sounds simultaneously with control over pitch, pan + and gain. It can be set up to handle audio session interruption automatically. You + may decide to use CDSoundEngine directly instead of CDAudioManager or SimpleAudioEngine + because you require OS 2.0 compatibility. + + Requirements: + - Firmware: OS 2.0 or greater + - Files: CocosDenshion.* + - Frameworks: OpenAL, AudioToolbox + + @since v0.8 + */ +@class CDSoundSource; +@interface CDSoundEngine : NSObject { + + bufferInfo *_buffers; + sourceInfo *_sources; + sourceGroup *_sourceGroups; + ALCcontext *context; + NSUInteger _sourceGroupTotal; + UInt32 _audioSessionCategory; + BOOL _handleAudioSession; + ALfloat _preMuteGain; + NSObject *_mutexBufferLoad; + BOOL mute_; + BOOL enabled_; + + ALenum lastErrorCode_; + BOOL functioning_; + float asynchLoadProgress_; + BOOL getGainWorks_; + + //For managing dynamic allocation of sources and buffers + int sourceTotal_; + int bufferTotal; + +} + +@property (readwrite, nonatomic) ALfloat masterGain; +@property (readonly) ALenum lastErrorCode;//Last OpenAL error code that was generated +@property (readonly) BOOL functioning;//Is the sound engine functioning +@property (readwrite) float asynchLoadProgress; +@property (readonly) BOOL getGainWorks;//Does getting the gain for a source work +/** Total number of sources available */ +@property (readonly) int sourceTotal; +/** Total number of source groups that have been defined */ +@property (readonly) NSUInteger sourceGroupTotal; + +/** Sets the sample rate for the audio mixer. For best performance this should match the sample rate of your audio content */ ++(void) setMixerSampleRate:(Float32) sampleRate; + +/** Initializes the engine with a group definition and a total number of groups */ +-(id)init; + +/** Plays a sound in a channel group with a pitch, pan and gain. The sound could played looped or not */ +-(ALuint) playSound:(int) soundId sourceGroupId:(int)sourceGroupId pitch:(float) pitch pan:(float) pan gain:(float) gain loop:(BOOL) loop; + +/** Creates and returns a sound source object for the specified sound within the specified source group. + */ +-(CDSoundSource *) soundSourceForSound:(int) soundId sourceGroupId:(int) sourceGroupId; + +/** Stops playing a sound */ +- (void) stopSound:(ALuint) sourceId; +/** Stops playing a source group */ +- (void) stopSourceGroup:(int) sourceGroupId; +/** Stops all playing sounds */ +-(void) stopAllSounds; +-(void) defineSourceGroups:(NSArray*) sourceGroupDefinitions; +-(void) defineSourceGroups:(int[]) sourceGroupDefinitions total:(NSUInteger) total; +-(void) setSourceGroupNonInterruptible:(int) sourceGroupId isNonInterruptible:(BOOL) isNonInterruptible; +-(void) setSourceGroupEnabled:(int) sourceGroupId enabled:(BOOL) enabled; +-(BOOL) sourceGroupEnabled:(int) sourceGroupId; +-(BOOL) loadBufferFromData:(int) soundId soundData:(ALvoid*) soundData format:(ALenum) format size:(ALsizei) size freq:(ALsizei) freq; +-(BOOL) loadBuffer:(int) soundId filePath:(NSString*) filePath; +-(void) loadBuffersAsynchronously:(NSArray *) loadRequests; +-(BOOL) unloadBuffer:(int) soundId; +-(ALCcontext *) openALContext; + +/** Returns the duration of the buffer in seconds or a negative value if the buffer id is invalid */ +-(float) bufferDurationInSeconds:(int) soundId; +/** Returns the size of the buffer in bytes or a negative value if the buffer id is invalid */ +-(ALsizei) bufferSizeInBytes:(int) soundId; +/** Returns the sampling frequency of the buffer in hertz or a negative value if the buffer id is invalid */ +-(ALsizei) bufferFrequencyInHertz:(int) soundId; + +/** Used internally, never call unless you know what you are doing */ +-(void) _soundSourcePreRelease:(CDSoundSource *) soundSource; + +@end + +#pragma mark CDSoundSource +/** CDSoundSource is a wrapper around an OpenAL sound source. + It allows you to manipulate properties such as pitch, gain, pan and looping while the + sound is playing. CDSoundSource is based on the old CDSourceWrapper class but with much + added functionality. + + @since v1.0 + */ +@interface CDSoundSource : NSObject { + ALenum lastError; +@public + ALuint _sourceId; + ALuint _sourceIndex; + CDSoundEngine* _engine; + int _soundId; + float _preMuteGain; + BOOL enabled_; + BOOL mute_; +} +@property (readwrite, nonatomic) float pitch; +@property (readwrite, nonatomic) float gain; +@property (readwrite, nonatomic) float pan; +@property (readwrite, nonatomic) BOOL looping; +@property (readonly) BOOL isPlaying; +@property (readwrite, nonatomic) int soundId; +/** Returns the duration of the attached buffer in seconds or a negative value if the buffer is invalid */ +@property (readonly) float durationInSeconds; + +/** Stores the last error code that occurred. Check against AL_NO_ERROR */ +@property (readonly) ALenum lastError; +/** Do not init yourself, get an instance from the sourceForSound factory method on CDSoundEngine */ +-(id)init:(ALuint) theSourceId sourceIndex:(int) index soundEngine:(CDSoundEngine*) engine; + +@end + +#pragma mark CDAudioInterruptTargetGroup + +/** Container for objects that implement audio interrupt protocol i.e. they can be muted and enabled. + Setting mute and enabled for the group propagates to all children. + Designed to be used with your CDSoundSource objects to get them to comply with global enabled and mute settings + if that is what you want to do.*/ +@interface CDAudioInterruptTargetGroup : NSObject { + BOOL mute_; + BOOL enabled_; + NSMutableArray *children_; +} +-(void) addAudioInterruptTarget:(NSObject*) interruptibleTarget; +@end + +#pragma mark CDAsynchBufferLoader + +/** CDAsynchBufferLoader + TODO + */ +@interface CDAsynchBufferLoader : NSOperation { + NSArray *_loadRequests; + CDSoundEngine *_soundEngine; +} + +-(id) init:(NSArray *)loadRequests soundEngine:(CDSoundEngine *) theSoundEngine; + +@end + +#pragma mark CDBufferLoadRequest + +/** CDBufferLoadRequest */ +@interface CDBufferLoadRequest: NSObject +{ + NSString *filePath; + int soundId; + //id loader; +} + +@property (readonly) NSString *filePath; +@property (readonly) int soundId; + +- (id)init:(int) theSoundId filePath:(const NSString *) theFilePath; +@end + +/** Interpolation type */ +typedef enum { + kIT_Linear, //!Straight linear interpolation fade + kIT_SCurve, //!S curved interpolation + kIT_Exponential //!Exponential interpolation +} tCDInterpolationType; + +#pragma mark CDFloatInterpolator +@interface CDFloatInterpolator: NSObject +{ + float start; + float end; + float lastValue; + tCDInterpolationType interpolationType; +} +@property (readwrite, nonatomic) float start; +@property (readwrite, nonatomic) float end; +@property (readwrite, nonatomic) tCDInterpolationType interpolationType; + +/** Return a value between min and max based on t which represents fractional progress where 0 is the start + and 1 is the end */ +-(float) interpolate:(float) t; +-(id) init:(tCDInterpolationType) type startVal:(float) startVal endVal:(float) endVal; + +@end + +#pragma mark CDPropertyModifier + +/** Base class for classes that modify properties such as pitch, pan and gain */ +@interface CDPropertyModifier: NSObject +{ + CDFloatInterpolator *interpolator; + float startValue; + float endValue; + id target; + BOOL stopTargetWhenComplete; + +} +@property (readwrite, nonatomic) BOOL stopTargetWhenComplete; +@property (readwrite, nonatomic) float startValue; +@property (readwrite, nonatomic) float endValue; +@property (readwrite, nonatomic) tCDInterpolationType interpolationType; + +-(id) init:(id) theTarget interpolationType:(tCDInterpolationType) type startVal:(float) startVal endVal:(float) endVal; +/** Set to a fractional value between 0 and 1 where 0 equals the start and 1 equals the end*/ +-(void) modify:(float) t; + +-(void) _setTargetProperty:(float) newVal; +-(float) _getTargetProperty; +-(void) _stopTarget; +-(Class) _allowableType; + +@end + +#pragma mark CDSoundSourceFader + +/** Fader for CDSoundSource objects */ +@interface CDSoundSourceFader : CDPropertyModifier{} +@end + +#pragma mark CDSoundSourcePanner + +/** Panner for CDSoundSource objects */ +@interface CDSoundSourcePanner : CDPropertyModifier{} +@end + +#pragma mark CDSoundSourcePitchBender + +/** Pitch bender for CDSoundSource objects */ +@interface CDSoundSourcePitchBender : CDPropertyModifier{} +@end + +#pragma mark CDSoundEngineFader + +/** Fader for CDSoundEngine objects */ +@interface CDSoundEngineFader : CDPropertyModifier{} +@end + + + + diff --git a/libs/CocosDenshion/CocosDenshion.m b/libs/CocosDenshion/CocosDenshion.m new file mode 100755 index 0000000..6956c3a --- /dev/null +++ b/libs/CocosDenshion/CocosDenshion.m @@ -0,0 +1,1602 @@ +/* + Copyright (c) 2010 Steve Oldmeadow + + Permission is hereby granted, free of charge, to any person obtaining a copy + of this software and associated documentation files (the "Software"), to deal + in the Software without restriction, including without limitation the rights + to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + copies of the Software, and to permit persons to whom the Software is + furnished to do so, subject to the following conditions: + + The above copyright notice and this permission notice shall be included in + all copies or substantial portions of the Software. + + THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + THE SOFTWARE. + + $Id$ + */ + +#import "CocosDenshion.h" + +ALvoid alBufferDataStaticProc(const ALint bid, ALenum format, ALvoid* data, ALsizei size, ALsizei freq); +ALvoid alcMacOSXMixerOutputRateProc(const ALdouble value); + + +typedef ALvoid AL_APIENTRY (*alBufferDataStaticProcPtr) (const ALint bid, ALenum format, ALvoid* data, ALsizei size, ALsizei freq); +ALvoid alBufferDataStaticProc(const ALint bid, ALenum format, ALvoid* data, ALsizei size, ALsizei freq) +{ + static alBufferDataStaticProcPtr proc = NULL; + + if (proc == NULL) { + proc = (alBufferDataStaticProcPtr) alcGetProcAddress(NULL, (const ALCchar*) "alBufferDataStatic"); + } + + if (proc) + proc(bid, format, data, size, freq); + + return; +} + +typedef ALvoid AL_APIENTRY (*alcMacOSXMixerOutputRateProcPtr) (const ALdouble value); +ALvoid alcMacOSXMixerOutputRateProc(const ALdouble value) +{ + static alcMacOSXMixerOutputRateProcPtr proc = NULL; + + if (proc == NULL) { + proc = (alcMacOSXMixerOutputRateProcPtr) alcGetProcAddress(NULL, (const ALCchar*) "alcMacOSXMixerOutputRate"); + } + + if (proc) + proc(value); + + return; +} + +NSString * const kCDN_BadAlContext = @"kCDN_BadAlContext"; +NSString * const kCDN_AsynchLoadComplete = @"kCDN_AsynchLoadComplete"; +float const kCD_PitchDefault = 1.0f; +float const kCD_PitchLowerOneOctave = 0.5f; +float const kCD_PitchHigherOneOctave = 2.0f; +float const kCD_PanDefault = 0.0f; +float const kCD_PanFullLeft = -1.0f; +float const kCD_PanFullRight = 1.0f; +float const kCD_GainDefault = 1.0f; + +@interface CDSoundEngine (PrivateMethods) +-(BOOL) _initOpenAL; +-(void) _testGetGain; +-(void) _dumpSourceGroupsInfo; +-(void) _getSourceIndexForSourceGroup; +-(void) _freeSourceGroups; +-(BOOL) _setUpSourceGroups:(int[]) definitions total:(NSUInteger) total; +@end + +#pragma mark - +#pragma mark CDUtilities + +@implementation CDUtilities + ++(NSString*) fullPathFromRelativePath:(NSString*) relPath +{ + // do not convert an absolute path (starting with '/') + if(([relPath length] > 0) && ([relPath characterAtIndex:0] == '/')) + { + return relPath; + } + + NSMutableArray *imagePathComponents = [NSMutableArray arrayWithArray:[relPath pathComponents]]; + NSString *file = [imagePathComponents lastObject]; + + [imagePathComponents removeLastObject]; + NSString *imageDirectory = [NSString pathWithComponents:imagePathComponents]; + + NSString *fullpath = [[NSBundle mainBundle] pathForResource:file ofType:nil inDirectory:imageDirectory]; + if (fullpath == nil) + fullpath = relPath; + + return fullpath; +} + +@end + +#pragma mark - +#pragma mark CDSoundEngine + +@implementation CDSoundEngine + +static Float32 _mixerSampleRate; +static BOOL _mixerRateSet = NO; + +@synthesize lastErrorCode = lastErrorCode_; +@synthesize functioning = functioning_; +@synthesize asynchLoadProgress = asynchLoadProgress_; +@synthesize getGainWorks = getGainWorks_; +@synthesize sourceTotal = sourceTotal_; + ++ (void) setMixerSampleRate:(Float32) sampleRate { + _mixerRateSet = YES; + _mixerSampleRate = sampleRate; +} + +- (void) _testGetGain { + float testValue = 0.7f; + ALuint testSourceId = _sources[0].sourceId; + alSourcef(testSourceId, AL_GAIN, 0.0f);//Start from know value + alSourcef(testSourceId, AL_GAIN, testValue); + ALfloat gainVal; + alGetSourcef(testSourceId, AL_GAIN, &gainVal); + getGainWorks_ = (gainVal == testValue); +} + +//Generate sources one at a time until we fail +-(void) _generateSources { + + _sources = (sourceInfo*)malloc( sizeof(_sources[0]) * CD_SOURCE_LIMIT); + BOOL hasFailed = NO; + sourceTotal_ = 0; + alGetError();//Clear error + while (!hasFailed && sourceTotal_ < CD_SOURCE_LIMIT) { + alGenSources(1, &(_sources[sourceTotal_].sourceId)); + if (alGetError() == AL_NO_ERROR) { + //Now try attaching source to null buffer + alSourcei(_sources[sourceTotal_].sourceId, AL_BUFFER, 0); + if (alGetError() == AL_NO_ERROR) { + _sources[sourceTotal_].usable = true; + sourceTotal_++; + } else { + hasFailed = YES; + } + } else { + _sources[sourceTotal_].usable = false; + hasFailed = YES; + } + } + //Mark the rest of the sources as not usable + for (int i=sourceTotal_; i < CD_SOURCE_LIMIT; i++) { + _sources[i].usable = false; + } +} + +-(void) _generateBuffers:(int) startIndex endIndex:(int) endIndex { + if (_buffers) { + alGetError(); + for (int i=startIndex; i <= endIndex; i++) { + alGenBuffers(1, &_buffers[i].bufferId); + _buffers[i].bufferData = NULL; + if (alGetError() == AL_NO_ERROR) { + _buffers[i].bufferState = CD_BS_EMPTY; + } else { + _buffers[i].bufferState = CD_BS_FAILED; + CDLOG(@"Denshion::CDSoundEngine - buffer creation failed %i",i); + } + } + } +} + +/** + * Internal method called during init + */ +- (BOOL) _initOpenAL +{ + //ALenum error; + context = NULL; + ALCdevice *newDevice = NULL; + + //Set the mixer rate for the audio mixer + if (!_mixerRateSet) { + _mixerSampleRate = CD_SAMPLE_RATE_DEFAULT; + } + alcMacOSXMixerOutputRateProc(_mixerSampleRate); + CDLOGINFO(@"Denshion::CDSoundEngine - mixer output rate set to %0.2f",_mixerSampleRate); + + // Create a new OpenAL Device + // Pass NULL to specify the system's default output device + newDevice = alcOpenDevice(NULL); + if (newDevice != NULL) + { + // Create a new OpenAL Context + // The new context will render to the OpenAL Device just created + context = alcCreateContext(newDevice, 0); + if (context != NULL) + { + // Make the new context the Current OpenAL Context + alcMakeContextCurrent(context); + + // Create some OpenAL Buffer Objects + [self _generateBuffers:0 endIndex:bufferTotal-1]; + + // Create some OpenAL Source Objects + [self _generateSources]; + + } + } else { + return FALSE;//No device + } + alGetError();//Clear error + return TRUE; +} + +- (void) dealloc { + + ALCcontext *currentContext = NULL; + ALCdevice *device = NULL; + + [self stopAllSounds]; + + CDLOGINFO(@"Denshion::CDSoundEngine - Deallocing sound engine."); + [self _freeSourceGroups]; + + // Delete the Sources + CDLOGINFO(@"Denshion::CDSoundEngine - deleting sources."); + for (int i=0; i < sourceTotal_; i++) { + alSourcei(_sources[i].sourceId, AL_BUFFER, 0);//Detach from current buffer + alDeleteSources(1, &(_sources[i].sourceId)); + if((lastErrorCode_ = alGetError()) != AL_NO_ERROR) { + CDLOG(@"Denshion::CDSoundEngine - Error deleting source! %x\n", lastErrorCode_); + } + } + + // Delete the Buffers + CDLOGINFO(@"Denshion::CDSoundEngine - deleting buffers."); + for (int i=0; i < bufferTotal; i++) { + alDeleteBuffers(1, &_buffers[i].bufferId); +#ifdef CD_USE_STATIC_BUFFERS + if (_buffers[i].bufferData) { + free(_buffers[i].bufferData); + } +#endif + } + CDLOGINFO(@"Denshion::CDSoundEngine - free buffers."); + free(_buffers); + currentContext = alcGetCurrentContext(); + //Get device for active context + device = alcGetContextsDevice(currentContext); + //Release context + CDLOGINFO(@"Denshion::CDSoundEngine - destroy context."); + alcDestroyContext(currentContext); + //Close device + CDLOGINFO(@"Denshion::CDSoundEngine - close device."); + alcCloseDevice(device); + CDLOGINFO(@"Denshion::CDSoundEngine - free sources."); + free(_sources); + + //Release mutexes + [_mutexBufferLoad release]; + + [super dealloc]; +} + +-(NSUInteger) sourceGroupTotal { + return _sourceGroupTotal; +} + +-(void) _freeSourceGroups +{ + CDLOGINFO(@"Denshion::CDSoundEngine freeing source groups"); + if(_sourceGroups) { + for (int i=0; i < _sourceGroupTotal; i++) { + if (_sourceGroups[i].sourceStatuses) { + free(_sourceGroups[i].sourceStatuses); + CDLOGINFO(@"Denshion::CDSoundEngine freed source statuses %i",i); + } + } + free(_sourceGroups); + } +} + +-(BOOL) _redefineSourceGroups:(int[]) definitions total:(NSUInteger) total +{ + if (_sourceGroups) { + //Stop all sounds + [self stopAllSounds]; + //Need to free source groups + [self _freeSourceGroups]; + } + return [self _setUpSourceGroups:definitions total:total]; +} + +-(BOOL) _setUpSourceGroups:(int[]) definitions total:(NSUInteger) total +{ + _sourceGroups = (sourceGroup *)malloc( sizeof(_sourceGroups[0]) * total); + if(!_sourceGroups) { + CDLOG(@"Denshion::CDSoundEngine - source groups memory allocation failed"); + return NO; + } + + _sourceGroupTotal = total; + int sourceCount = 0; + for (int i=0; i < _sourceGroupTotal; i++) { + + _sourceGroups[i].startIndex = 0; + _sourceGroups[i].currentIndex = _sourceGroups[i].startIndex; + _sourceGroups[i].enabled = false; + _sourceGroups[i].nonInterruptible = false; + _sourceGroups[i].totalSources = definitions[i]; + _sourceGroups[i].sourceStatuses = malloc(sizeof(_sourceGroups[i].sourceStatuses[0]) * _sourceGroups[i].totalSources); + if (_sourceGroups[i].sourceStatuses) { + for (int j=0; j < _sourceGroups[i].totalSources; j++) { + //First bit is used to indicate whether source is locked, index is shifted back 1 bit + _sourceGroups[i].sourceStatuses[j] = (sourceCount + j) << 1; + } + } + sourceCount += definitions[i]; + } + return YES; +} + +-(void) defineSourceGroups:(int[]) sourceGroupDefinitions total:(NSUInteger) total { + [self _redefineSourceGroups:sourceGroupDefinitions total:total]; +} + +-(void) defineSourceGroups:(NSArray*) sourceGroupDefinitions { + CDLOGINFO(@"Denshion::CDSoundEngine - source groups defined by NSArray."); + NSUInteger totalDefs = [sourceGroupDefinitions count]; + int* defs = (int *)malloc( sizeof(int) * totalDefs); + int currentIndex = 0; + for (id currentDef in sourceGroupDefinitions) { + if ([currentDef isKindOfClass:[NSNumber class]]) { + defs[currentIndex] = (int)[(NSNumber*)currentDef integerValue]; + CDLOGINFO(@"Denshion::CDSoundEngine - found definition %i.",defs[currentIndex]); + } else { + CDLOG(@"Denshion::CDSoundEngine - warning, did not understand source definition."); + defs[currentIndex] = 0; + } + currentIndex++; + } + [self _redefineSourceGroups:defs total:totalDefs]; + free(defs); +} + +- (id)init +{ + if ((self = [super init])) { + + //Create mutexes + _mutexBufferLoad = [[NSObject alloc] init]; + + asynchLoadProgress_ = 0.0f; + + bufferTotal = CD_BUFFERS_START; + _buffers = (bufferInfo *)malloc( sizeof(_buffers[0]) * bufferTotal); + + // Initialize our OpenAL environment + if ([self _initOpenAL]) { + //Set up the default source group - a single group that contains all the sources + int sourceDefs[1]; + sourceDefs[0] = self.sourceTotal; + [self _setUpSourceGroups:sourceDefs total:1]; + + functioning_ = YES; + //Synchronize premute gain + _preMuteGain = self.masterGain; + mute_ = NO; + enabled_ = YES; + //Test whether get gain works for sources + [self _testGetGain]; + } else { + //Something went wrong with OpenAL + functioning_ = NO; + } + } + + return self; +} + +/** + * Delete the buffer identified by soundId + * @return true if buffer deleted successfully, otherwise false + */ +- (BOOL) unloadBuffer:(int) soundId +{ + //Ensure soundId is within array bounds otherwise memory corruption will occur + if (soundId < 0 || soundId >= bufferTotal) { + CDLOG(@"Denshion::CDSoundEngine - soundId is outside array bounds, maybe you need to increase CD_MAX_BUFFERS"); + return FALSE; + } + + //Before a buffer can be deleted any sources that are attached to it must be stopped + for (int i=0; i < sourceTotal_; i++) { + //Note: tried getting the AL_BUFFER attribute of the source instead but doesn't + //appear to work on a device - just returned zero. + if (_buffers[soundId].bufferId == _sources[i].attachedBufferId) { + + CDLOG(@"Denshion::CDSoundEngine - Found attached source %i %i %i",i,_buffers[soundId].bufferId,_sources[i].sourceId); +#ifdef CD_USE_STATIC_BUFFERS + //When using static buffers a crash may occur if a source is playing with a buffer that is about + //to be deleted even though we stop the source and successfully delete the buffer. Crash is confirmed + //on 2.2.1 and 3.1.2, however, it will only occur if a source is used rapidly after having its prior + //data deleted. To avoid any possibility of the crash we wait for the source to finish playing. + ALint state; + + alGetSourcei(_sources[i].sourceId, AL_SOURCE_STATE, &state); + + if (state == AL_PLAYING) { + CDLOG(@"Denshion::CDSoundEngine - waiting for source to complete playing before removing buffer data"); + alSourcei(_sources[i].sourceId, AL_LOOPING, FALSE);//Turn off looping otherwise loops will never end + while (state == AL_PLAYING) { + alGetSourcei(_sources[i].sourceId, AL_SOURCE_STATE, &state); + usleep(10000); + } + } +#endif + //Stop source and detach + alSourceStop(_sources[i].sourceId); + if((lastErrorCode_ = alGetError()) != AL_NO_ERROR) { + CDLOG(@"Denshion::CDSoundEngine - error stopping source: %x\n", lastErrorCode_); + } + + alSourcei(_sources[i].sourceId, AL_BUFFER, 0);//Attach to "NULL" buffer to detach + if((lastErrorCode_ = alGetError()) != AL_NO_ERROR) { + CDLOG(@"Denshion::CDSoundEngine - error detaching buffer: %x\n", lastErrorCode_); + } else { + //Record that source is now attached to nothing + _sources[i].attachedBufferId = 0; + } + } + } + + alDeleteBuffers(1, &_buffers[soundId].bufferId); + if((lastErrorCode_ = alGetError()) != AL_NO_ERROR) { + CDLOG(@"Denshion::CDSoundEngine - error deleting buffer: %x\n", lastErrorCode_); + _buffers[soundId].bufferState = CD_BS_FAILED; + return FALSE; + } else { +#ifdef CD_USE_STATIC_BUFFERS + //Free previous data, if alDeleteBuffer has returned without error then no + if (_buffers[soundId].bufferData) { + CDLOGINFO(@"Denshion::CDSoundEngine - freeing static data for soundId %i @ %i",soundId,_buffers[soundId].bufferData); + free(_buffers[soundId].bufferData);//Free the old data + _buffers[soundId].bufferData = NULL; + } +#endif + } + + alGenBuffers(1, &_buffers[soundId].bufferId); + if((lastErrorCode_ = alGetError()) != AL_NO_ERROR) { + CDLOG(@"Denshion::CDSoundEngine - error regenerating buffer: %x\n", lastErrorCode_); + _buffers[soundId].bufferState = CD_BS_FAILED; + return FALSE; + } else { + //We now have an empty buffer + _buffers[soundId].bufferState = CD_BS_EMPTY; + CDLOGINFO(@"Denshion::CDSoundEngine - buffer %i successfully unloaded\n",soundId); + return TRUE; + } +} + +/** + * Load buffers asynchronously + * Check asynchLoadProgress for progress. asynchLoadProgress represents fraction of completion. When it equals 1.0 loading + * is complete. NB: asynchLoadProgress is simply based on the number of load requests, it does not take into account + * file sizes. + * @param An array of CDBufferLoadRequest objects + */ +- (void) loadBuffersAsynchronously:(NSArray *) loadRequests { + @synchronized(self) { + asynchLoadProgress_ = 0.0f; + CDAsynchBufferLoader *loaderOp = [[[CDAsynchBufferLoader alloc] init:loadRequests soundEngine:self] autorelease]; + NSOperationQueue *opQ = [[[NSOperationQueue alloc] init] autorelease]; + [opQ addOperation:loaderOp]; + } +} + +-(BOOL) _resizeBuffers:(int) increment { + + void * tmpBufferInfos = realloc( _buffers, sizeof(_buffers[0]) * (bufferTotal + increment) ); + + if(!tmpBufferInfos) { + free(tmpBufferInfos); + return NO; + } else { + _buffers = tmpBufferInfos; + int oldBufferTotal = bufferTotal; + bufferTotal = bufferTotal + increment; + [self _generateBuffers:oldBufferTotal endIndex:bufferTotal-1]; + return YES; + } +} + +-(BOOL) loadBufferFromData:(int) soundId soundData:(ALvoid*) soundData format:(ALenum) format size:(ALsizei) size freq:(ALsizei) freq { + + @synchronized(_mutexBufferLoad) { + + if (!functioning_) { + //OpenAL initialisation has previously failed + CDLOG(@"Denshion::CDSoundEngine - Loading buffer failed because sound engine state != functioning"); + return FALSE; + } + + //Ensure soundId is within array bounds otherwise memory corruption will occur + if (soundId < 0) { + CDLOG(@"Denshion::CDSoundEngine - soundId is negative"); + return FALSE; + } + + if (soundId >= bufferTotal) { + //Need to resize the buffers + int requiredIncrement = CD_BUFFERS_INCREMENT; + while (bufferTotal + requiredIncrement < soundId) { + requiredIncrement += CD_BUFFERS_INCREMENT; + } + CDLOGINFO(@"Denshion::CDSoundEngine - attempting to resize buffers by %i for sound %i",requiredIncrement,soundId); + if (![self _resizeBuffers:requiredIncrement]) { + CDLOG(@"Denshion::CDSoundEngine - buffer resize failed"); + return FALSE; + } + } + + if (soundData) + { + if (_buffers[soundId].bufferState != CD_BS_EMPTY) { + CDLOGINFO(@"Denshion::CDSoundEngine - non empty buffer, regenerating"); + if (![self unloadBuffer:soundId]) { + //Deletion of buffer failed, delete buffer routine has set buffer state and lastErrorCode + return NO; + } + } + +#ifdef CD_DEBUG + //Check that sample rate matches mixer rate and warn if they do not + if (freq != (int)_mixerSampleRate) { + CDLOGINFO(@"Denshion::CDSoundEngine - WARNING sample rate does not match mixer sample rate performance may not be optimal."); + } +#endif + +#ifdef CD_USE_STATIC_BUFFERS + alBufferDataStaticProc(_buffers[soundId].bufferId, format, soundData, size, freq); + _buffers[soundId].bufferData = data;//Save the pointer to the new data +#else + alBufferData(_buffers[soundId].bufferId, format, soundData, size, freq); +#endif + if((lastErrorCode_ = alGetError()) != AL_NO_ERROR) { + CDLOG(@"Denshion::CDSoundEngine - error attaching audio to buffer: %x", lastErrorCode_); + _buffers[soundId].bufferState = CD_BS_FAILED; + return FALSE; + } + } else { + CDLOG(@"Denshion::CDSoundEngine Buffer data is null!"); + _buffers[soundId].bufferState = CD_BS_FAILED; + return FALSE; + } + + _buffers[soundId].format = format; + _buffers[soundId].sizeInBytes = size; + _buffers[soundId].frequencyInHertz = freq; + _buffers[soundId].bufferState = CD_BS_LOADED; + CDLOGINFO(@"Denshion::CDSoundEngine Buffer %i loaded format:%i freq:%i size:%i",soundId,format,freq,size); + return TRUE; + }//end mutex +} + +/** + * Load sound data for later play back. + * @return TRUE if buffer loaded okay for play back otherwise false + */ +- (BOOL) loadBuffer:(int) soundId filePath:(NSString*) filePath +{ + + ALvoid* data; + ALenum format; + ALsizei size; + ALsizei freq; + + CDLOGINFO(@"Denshion::CDSoundEngine - Loading openAL buffer %i %@", soundId, filePath); + + CFURLRef fileURL = nil; + NSString *path = [CDUtilities fullPathFromRelativePath:filePath]; + if (path) { + fileURL = (CFURLRef)[[NSURL fileURLWithPath:path] retain]; + } + + if (fileURL) + { + data = CDGetOpenALAudioData(fileURL, &size, &format, &freq); + CFRelease(fileURL); + BOOL result = [self loadBufferFromData:soundId soundData:data format:format size:size freq:freq]; +#ifndef CD_USE_STATIC_BUFFERS + free(data);//Data can be freed here because alBufferData performs a memcpy +#endif + return result; + } else { + CDLOG(@"Denshion::CDSoundEngine Could not find file!\n"); + //Don't change buffer state here as it will be the same as before method was called + return FALSE; + } +} + +-(BOOL) validateBufferId:(int) soundId { + if (soundId < 0 || soundId >= bufferTotal) { + CDLOGINFO(@"Denshion::CDSoundEngine - validateBufferId buffer outside range %i",soundId); + return NO; + } else if (_buffers[soundId].bufferState != CD_BS_LOADED) { + CDLOGINFO(@"Denshion::CDSoundEngine - validateBufferId invalide buffer state %i",soundId); + return NO; + } else { + return YES; + } +} + +-(float) bufferDurationInSeconds:(int) soundId { + if ([self validateBufferId:soundId]) { + float factor = 0.0f; + switch (_buffers[soundId].format) { + case AL_FORMAT_MONO8: + factor = 1.0f; + break; + case AL_FORMAT_MONO16: + factor = 0.5f; + break; + case AL_FORMAT_STEREO8: + factor = 0.5f; + break; + case AL_FORMAT_STEREO16: + factor = 0.25f; + break; + } + return (float)_buffers[soundId].sizeInBytes/(float)_buffers[soundId].frequencyInHertz * factor; + } else { + return -1.0f; + } +} + +-(ALsizei) bufferSizeInBytes:(int) soundId { + if ([self validateBufferId:soundId]) { + return _buffers[soundId].sizeInBytes; + } else { + return -1.0f; + } +} + +-(ALsizei) bufferFrequencyInHertz:(int) soundId { + if ([self validateBufferId:soundId]) { + return _buffers[soundId].frequencyInHertz; + } else { + return -1.0f; + } +} + +- (ALfloat) masterGain { + if (mute_) { + //When mute the real gain will always be 0 therefore return the preMuteGain value + return _preMuteGain; + } else { + ALfloat gain; + alGetListenerf(AL_GAIN, &gain); + return gain; + } +} + +/** + * Overall gain setting multiplier. e.g 0.5 is half the gain. + */ +- (void) setMasterGain:(ALfloat) newGainValue { + if (mute_) { + _preMuteGain = newGainValue; + } else { + alListenerf(AL_GAIN, newGainValue); + } +} + +#pragma mark CDSoundEngine AudioInterrupt protocol +- (BOOL) mute { + return mute_; +} + +/** + * Setting mute silences all sounds but playing sounds continue to advance playback + */ +- (void) setMute:(BOOL) newMuteValue { + + if (newMuteValue == mute_) { + return; + } + + mute_ = newMuteValue; + if (mute_) { + //Remember what the gain was + _preMuteGain = self.masterGain; + //Set gain to 0 - do not use the property as this will adjust preMuteGain when muted + alListenerf(AL_GAIN, 0.0f); + } else { + //Restore gain to what it was before being muted + self.masterGain = _preMuteGain; + } +} + +- (BOOL) enabled { + return enabled_; +} + +- (void) setEnabled:(BOOL)enabledValue +{ + if (enabled_ == enabledValue) { + return; + } + enabled_ = enabledValue; + if (enabled_ == NO) { + [self stopAllSounds]; + } +} + +-(void) _lockSource:(int) sourceIndex lock:(BOOL) lock { + BOOL found = NO; + for (int i=0; i < _sourceGroupTotal && !found; i++) { + if (_sourceGroups[i].sourceStatuses) { + for (int j=0; j < _sourceGroups[i].totalSources && !found; j++) { + //First bit is used to indicate whether source is locked, index is shifted back 1 bit + if((_sourceGroups[i].sourceStatuses[j] >> 1)==sourceIndex) { + if (lock) { + //Set first bit to lock this source + _sourceGroups[i].sourceStatuses[j] |= 1; + } else { + //Unset first bit to unlock this source + _sourceGroups[i].sourceStatuses[j] &= ~1; + } + found = YES; + } + } + } + } +} + +-(int) _getSourceIndexForSourceGroup:(int)sourceGroupId +{ + //Ensure source group id is valid to prevent memory corruption + if (sourceGroupId < 0 || sourceGroupId >= _sourceGroupTotal) { + CDLOG(@"Denshion::CDSoundEngine invalid source group id %i",sourceGroupId); + return CD_NO_SOURCE; + } + + int sourceIndex = -1;//Using -1 to indicate no source found + BOOL complete = NO; + ALint sourceState = 0; + sourceGroup *thisSourceGroup = &_sourceGroups[sourceGroupId]; + thisSourceGroup->currentIndex = thisSourceGroup->startIndex; + while (!complete) { + //Iterate over sources looking for one that is not locked, first bit indicates if source is locked + if ((thisSourceGroup->sourceStatuses[thisSourceGroup->currentIndex] & 1) == 0) { + //This source is not locked + sourceIndex = thisSourceGroup->sourceStatuses[thisSourceGroup->currentIndex] >> 1;//shift back to get the index + if (thisSourceGroup->nonInterruptible) { + //Check if this source is playing, if so it can't be interrupted + alGetSourcei(_sources[sourceIndex].sourceId, AL_SOURCE_STATE, &sourceState); + if (sourceState != AL_PLAYING) { + //complete = YES; + //Set start index so next search starts at the next position + thisSourceGroup->startIndex = thisSourceGroup->currentIndex + 1; + break; + } else { + sourceIndex = -1;//The source index was no good because the source was playing + } + } else { + //complete = YES; + //Set start index so next search starts at the next position + thisSourceGroup->startIndex = thisSourceGroup->currentIndex + 1; + break; + } + } + thisSourceGroup->currentIndex++; + if (thisSourceGroup->currentIndex >= thisSourceGroup->totalSources) { + //Reset to the beginning + thisSourceGroup->currentIndex = 0; + } + if (thisSourceGroup->currentIndex == thisSourceGroup->startIndex) { + //We have looped around and got back to the start + complete = YES; + } + } + + //Reset start index to beginning if beyond bounds + if (thisSourceGroup->startIndex >= thisSourceGroup->totalSources) { + thisSourceGroup->startIndex = 0; + } + + if (sourceIndex >= 0) { + return sourceIndex; + } else { + return CD_NO_SOURCE; + } + +} + +/** + * Play a sound. + * @param soundId the id of the sound to play (buffer id). + * @param SourceGroupId the source group that will be used to play the sound. + * @param pitch pitch multiplier. e.g 1.0 is unaltered, 0.5 is 1 octave lower. + * @param pan stereo position. -1 is fully left, 0 is centre and 1 is fully right. + * @param gain gain multiplier. e.g. 1.0 is unaltered, 0.5 is half the gain + * @param loop should the sound be looped or one shot. + * @return the id of the source being used to play the sound or CD_MUTE if the sound engine is muted or non functioning + * or CD_NO_SOURCE if a problem occurs setting up the source + * + */ +- (ALuint)playSound:(int) soundId sourceGroupId:(int)sourceGroupId pitch:(float) pitch pan:(float) pan gain:(float) gain loop:(BOOL) loop { + +#ifdef CD_DEBUG + //Sanity check parameters - only in DEBUG + NSAssert(soundId >= 0, @"soundId can not be negative"); + NSAssert(soundId < bufferTotal, @"soundId exceeds limit"); + NSAssert(sourceGroupId >= 0, @"sourceGroupId can not be negative"); + NSAssert(sourceGroupId < _sourceGroupTotal, @"sourceGroupId exceeds limit"); + NSAssert(pitch > 0, @"pitch must be greater than zero"); + NSAssert(pan >= -1 && pan <= 1, @"pan must be between -1 and 1"); + NSAssert(gain >= 0, @"gain can not be negative"); +#endif + //If mute or initialisation has failed or buffer is not loaded then do nothing + if (!enabled_ || !functioning_ || _buffers[soundId].bufferState != CD_BS_LOADED || _sourceGroups[sourceGroupId].enabled) { +#ifdef CD_DEBUG + if (!functioning_) { + CDLOGINFO(@"Denshion::CDSoundEngine - sound playback aborted because sound engine is not functioning"); + } else if (_buffers[soundId].bufferState != CD_BS_LOADED) { + CDLOGINFO(@"Denshion::CDSoundEngine - sound playback aborted because buffer %i is not loaded", soundId); + } +#endif + return CD_MUTE; + } + + int sourceIndex = [self _getSourceIndexForSourceGroup:sourceGroupId];//This method ensures sourceIndex is valid + + if (sourceIndex != CD_NO_SOURCE) { + ALint state; + ALuint source = _sources[sourceIndex].sourceId; + ALuint buffer = _buffers[soundId].bufferId; + alGetError();//Clear the error code + alGetSourcei(source, AL_SOURCE_STATE, &state); + if (state == AL_PLAYING) { + alSourceStop(source); + } + alSourcei(source, AL_BUFFER, buffer);//Attach to sound + alSourcef(source, AL_PITCH, pitch);//Set pitch + alSourcei(source, AL_LOOPING, loop);//Set looping + alSourcef(source, AL_GAIN, gain);//Set gain/volume + float sourcePosAL[] = {pan, 0.0f, 0.0f};//Set position - just using left and right panning + alSourcefv(source, AL_POSITION, sourcePosAL); + alGetError();//Clear the error code + alSourcePlay(source); + if((lastErrorCode_ = alGetError()) == AL_NO_ERROR) { + //Everything was okay + _sources[sourceIndex].attachedBufferId = buffer; + return source; + } else { + if (alcGetCurrentContext() == NULL) { + CDLOGINFO(@"Denshion::CDSoundEngine - posting bad OpenAL context message"); + [[NSNotificationCenter defaultCenter] postNotificationName:kCDN_BadAlContext object:nil]; + } + return CD_NO_SOURCE; + } + } else { + return CD_NO_SOURCE; + } +} + +-(BOOL) _soundSourceAttachToBuffer:(CDSoundSource*) soundSource soundId:(int) soundId { + //Attach the source to the buffer + ALint state; + ALuint source = soundSource->_sourceId; + ALuint buffer = _buffers[soundId].bufferId; + alGetSourcei(source, AL_SOURCE_STATE, &state); + if (state == AL_PLAYING) { + alSourceStop(source); + } + alGetError();//Clear the error code + alSourcei(source, AL_BUFFER, buffer);//Attach to sound data + if((lastErrorCode_ = alGetError()) == AL_NO_ERROR) { + _sources[soundSource->_sourceIndex].attachedBufferId = buffer; + //_sourceBufferAttachments[soundSource->_sourceIndex] = buffer;//Keep track of which + soundSource->_soundId = soundId; + return YES; + } else { + return NO; + } +} + +/** + * Get a sound source for the specified sound in the specified source group + */ +-(CDSoundSource *) soundSourceForSound:(int) soundId sourceGroupId:(int) sourceGroupId +{ + if (!functioning_) { + return nil; + } + //Check if a source is available + int sourceIndex = [self _getSourceIndexForSourceGroup:sourceGroupId]; + if (sourceIndex != CD_NO_SOURCE) { + CDSoundSource *result = [[CDSoundSource alloc] init:_sources[sourceIndex].sourceId sourceIndex:sourceIndex soundEngine:self]; + [self _lockSource:sourceIndex lock:YES]; + //Try to attach to the buffer + if ([self _soundSourceAttachToBuffer:result soundId:soundId]) { + //Set to a known state + result.pitch = 1.0f; + result.pan = 0.0f; + result.gain = 1.0f; + result.looping = NO; + return [result autorelease]; + } else { + //Release the sound source we just created, this will also unlock the source + [result release]; + return nil; + } + } else { + //No available source within that source group + return nil; + } +} + +-(void) _soundSourcePreRelease:(CDSoundSource *) soundSource { + CDLOGINFO(@"Denshion::CDSoundEngine _soundSourcePreRelease %i",soundSource->_sourceIndex); + //Unlock the sound source's source + [self _lockSource:soundSource->_sourceIndex lock:NO]; +} + +/** + * Stop all sounds playing within a source group + */ +- (void) stopSourceGroup:(int) sourceGroupId { + + if (!functioning_ || sourceGroupId >= _sourceGroupTotal || sourceGroupId < 0) { + return; + } + int sourceCount = _sourceGroups[sourceGroupId].totalSources; + for (int i=0; i < sourceCount; i++) { + int sourceIndex = _sourceGroups[sourceGroupId].sourceStatuses[i] >> 1; + alSourceStop(_sources[sourceIndex].sourceId); + } + alGetError();//Clear error in case we stopped any sounds that couldn't be stopped +} + +/** + * Stop a sound playing. + * @param sourceId an OpenAL source identifier i.e. the return value of playSound + */ +- (void)stopSound:(ALuint) sourceId { + if (!functioning_) { + return; + } + alSourceStop(sourceId); + alGetError();//Clear error in case we stopped any sounds that couldn't be stopped +} + +- (void) stopAllSounds { + for (int i=0; i < sourceTotal_; i++) { + alSourceStop(_sources[i].sourceId); + } + alGetError();//Clear error in case we stopped any sounds that couldn't be stopped +} + +/** + * Set a source group as non interruptible. Default is that source groups are interruptible. + * Non interruptible means that if a request to play a sound is made for a source group and there are + * no free sources available then the play request will be ignored and CD_NO_SOURCE will be returned. + */ +- (void) setSourceGroupNonInterruptible:(int) sourceGroupId isNonInterruptible:(BOOL) isNonInterruptible { + //Ensure source group id is valid to prevent memory corruption + if (sourceGroupId < 0 || sourceGroupId >= _sourceGroupTotal) { + CDLOG(@"Denshion::CDSoundEngine setSourceGroupNonInterruptible invalid source group id %i",sourceGroupId); + return; + } + + if (isNonInterruptible) { + _sourceGroups[sourceGroupId].nonInterruptible = true; + } else { + _sourceGroups[sourceGroupId].nonInterruptible = false; + } +} + +/** + * Set the mute property for a source group. If mute is turned on any sounds in that source group + * will be stopped and further sounds in that source group will play. However, turning mute off + * will not restart any sounds that were playing when mute was turned on. Also the mute setting + * for the sound engine must be taken into account. If the sound engine is mute no sounds will play + * no matter what the source group mute setting is. + */ +- (void) setSourceGroupEnabled:(int) sourceGroupId enabled:(BOOL) enabled { + //Ensure source group id is valid to prevent memory corruption + if (sourceGroupId < 0 || sourceGroupId >= _sourceGroupTotal) { + CDLOG(@"Denshion::CDSoundEngine setSourceGroupEnabled invalid source group id %i",sourceGroupId); + return; + } + + if (enabled) { + _sourceGroups[sourceGroupId].enabled = true; + [self stopSourceGroup:sourceGroupId]; + } else { + _sourceGroups[sourceGroupId].enabled = false; + } +} + +/** + * Return the mute property for the source group identified by sourceGroupId + */ +- (BOOL) sourceGroupEnabled:(int) sourceGroupId { + return _sourceGroups[sourceGroupId].enabled; +} + +-(ALCcontext *) openALContext { + return context; +} + +- (void) _dumpSourceGroupsInfo { +#ifdef CD_DEBUG + CDLOGINFO(@"-------------- source Group Info --------------"); + for (int i=0; i < _sourceGroupTotal; i++) { + CDLOGINFO(@"Group: %i start:%i total:%i",i,_sourceGroups[i].startIndex, _sourceGroups[i].totalSources); + CDLOGINFO(@"----- mute:%i nonInterruptible:%i",_sourceGroups[i].enabled, _sourceGroups[i].nonInterruptible); + CDLOGINFO(@"----- Source statuses ----"); + for (int j=0; j < _sourceGroups[i].totalSources; j++) { + CDLOGINFO(@"Source status:%i index=%i locked=%i",j,_sourceGroups[i].sourceStatuses[j] >> 1, _sourceGroups[i].sourceStatuses[j] & 1); + } + } +#endif +} + +@end + +/////////////////////////////////////////////////////////////////////////////////////// +@implementation CDSoundSource + +@synthesize lastError; + +//Macro for handling the al error code +#define CDSOUNDSOURCE_UPDATE_LAST_ERROR (lastError = alGetError()) +#define CDSOUNDSOURCE_ERROR_HANDLER ( CDSOUNDSOURCE_UPDATE_LAST_ERROR == AL_NO_ERROR) + +-(id)init:(ALuint) theSourceId sourceIndex:(int) index soundEngine:(CDSoundEngine*) engine { + if ((self = [super init])) { + _sourceId = theSourceId; + _engine = engine; + _sourceIndex = index; + enabled_ = YES; + mute_ = NO; + _preMuteGain = self.gain; + } + return self; +} + +-(void) dealloc +{ + CDLOGINFO(@"Denshion::CDSoundSource deallocated %i",self->_sourceIndex); + + //Notify sound engine we are about to release + [_engine _soundSourcePreRelease:self]; + [super dealloc]; +} + +- (void) setPitch:(float) newPitchValue { + alSourcef(_sourceId, AL_PITCH, newPitchValue); + CDSOUNDSOURCE_UPDATE_LAST_ERROR; +} + +- (void) setGain:(float) newGainValue { + if (!mute_) { + alSourcef(_sourceId, AL_GAIN, newGainValue); + } else { + _preMuteGain = newGainValue; + } + CDSOUNDSOURCE_UPDATE_LAST_ERROR; +} + +- (void) setPan:(float) newPanValue { + float sourcePosAL[] = {newPanValue, 0.0f, 0.0f};//Set position - just using left and right panning + alSourcefv(_sourceId, AL_POSITION, sourcePosAL); + CDSOUNDSOURCE_UPDATE_LAST_ERROR; + +} + +- (void) setLooping:(BOOL) newLoopingValue { + alSourcei(_sourceId, AL_LOOPING, newLoopingValue); + CDSOUNDSOURCE_UPDATE_LAST_ERROR; + +} + +- (BOOL) isPlaying { + ALint state; + alGetSourcei(_sourceId, AL_SOURCE_STATE, &state); + CDSOUNDSOURCE_UPDATE_LAST_ERROR; + return (state == AL_PLAYING); +} + +- (float) pitch { + ALfloat pitchVal; + alGetSourcef(_sourceId, AL_PITCH, &pitchVal); + CDSOUNDSOURCE_UPDATE_LAST_ERROR; + return pitchVal; +} + +- (float) pan { + ALfloat sourcePosAL[] = {0.0f,0.0f,0.0f}; + alGetSourcefv(_sourceId, AL_POSITION, sourcePosAL); + CDSOUNDSOURCE_UPDATE_LAST_ERROR; + return sourcePosAL[0]; +} + +- (float) gain { + if (!mute_) { + ALfloat val; + alGetSourcef(_sourceId, AL_GAIN, &val); + CDSOUNDSOURCE_UPDATE_LAST_ERROR; + return val; + } else { + return _preMuteGain; + } +} + +- (BOOL) looping { + ALfloat val; + alGetSourcef(_sourceId, AL_LOOPING, &val); + CDSOUNDSOURCE_UPDATE_LAST_ERROR; + return val; +} + +-(BOOL) stop { + alSourceStop(_sourceId); + return CDSOUNDSOURCE_ERROR_HANDLER; +} + +-(BOOL) play { + if (enabled_) { + alSourcePlay(_sourceId); + CDSOUNDSOURCE_UPDATE_LAST_ERROR; + if (lastError != AL_NO_ERROR) { + if (alcGetCurrentContext() == NULL) { + CDLOGINFO(@"Denshion::CDSoundSource - posting bad OpenAL context message"); + [[NSNotificationCenter defaultCenter] postNotificationName:kCDN_BadAlContext object:nil]; + } + return NO; + } else { + return YES; + } + } else { + return NO; + } +} + +-(BOOL) pause { + alSourcePause(_sourceId); + return CDSOUNDSOURCE_ERROR_HANDLER; +} + +-(BOOL) rewind { + alSourceRewind(_sourceId); + return CDSOUNDSOURCE_ERROR_HANDLER; +} + +-(void) setSoundId:(int) soundId { + [_engine _soundSourceAttachToBuffer:self soundId:soundId]; +} + +-(int) soundId { + return _soundId; +} + +-(float) durationInSeconds { + return [_engine bufferDurationInSeconds:_soundId]; +} + +#pragma mark CDSoundSource AudioInterrupt protocol +- (BOOL) mute { + return mute_; +} + +/** + * Setting mute silences all sounds but playing sounds continue to advance playback + */ +- (void) setMute:(BOOL) newMuteValue { + + if (newMuteValue == mute_) { + return; + } + + if (newMuteValue) { + //Remember what the gain was + _preMuteGain = self.gain; + self.gain = 0.0f; + mute_ = newMuteValue;//Make sure this is done after setting the gain property as the setter behaves differently depending on mute value + } else { + //Restore gain to what it was before being muted + mute_ = newMuteValue; + self.gain = _preMuteGain; + } +} + +- (BOOL) enabled { + return enabled_; +} + +- (void) setEnabled:(BOOL)enabledValue +{ + if (enabled_ == enabledValue) { + return; + } + enabled_ = enabledValue; + if (enabled_ == NO) { + [self stop]; + } +} + +@end + +//////////////////////////////////////////////////////////////////////////// +#pragma mark - +#pragma mark CDAudioInterruptTargetGroup + +@implementation CDAudioInterruptTargetGroup + +-(id) init { + if ((self = [super init])) { + children_ = [[NSMutableArray alloc] initWithCapacity:32]; + enabled_ = YES; + mute_ = NO; + } + return self; +} + +-(void) addAudioInterruptTarget:(NSObject*) interruptibleTarget { + //Synchronize child with group settings; + [interruptibleTarget setMute:mute_]; + [interruptibleTarget setEnabled:enabled_]; + [children_ addObject:interruptibleTarget]; +} + +-(void) removeAudioInterruptTarget:(NSObject*) interruptibleTarget { + [children_ removeObjectIdenticalTo:interruptibleTarget]; +} + +- (BOOL) mute { + return mute_; +} + +/** + * Setting mute silences all sounds but playing sounds continue to advance playback + */ +- (void) setMute:(BOOL) newMuteValue { + + if (newMuteValue == mute_) { + return; + } + + for (NSObject* target in children_) { + [target setMute:newMuteValue]; + } +} + +- (BOOL) enabled { + return enabled_; +} + +- (void) setEnabled:(BOOL)enabledValue +{ + if (enabledValue == enabled_) { + return; + } + + for (NSObject* target in children_) { + [target setEnabled:enabledValue]; + } +} + +@end + + + +//////////////////////////////////////////////////////////////////////////// + +#pragma mark - +#pragma mark CDAsynchBufferLoader + +@implementation CDAsynchBufferLoader + +-(id) init:(NSArray *)loadRequests soundEngine:(CDSoundEngine *) theSoundEngine { + if ((self = [super init])) { + _loadRequests = loadRequests; + [_loadRequests retain]; + _soundEngine = theSoundEngine; + [_soundEngine retain]; + } + return self; +} + +-(void) main { + CDLOGINFO(@"Denshion::CDAsynchBufferLoader - loading buffers"); + [super main]; + _soundEngine.asynchLoadProgress = 0.0f; + + if ([_loadRequests count] > 0) { + float increment = 1.0f / [_loadRequests count]; + //Iterate over load request and load + for (CDBufferLoadRequest *loadRequest in _loadRequests) { + [_soundEngine loadBuffer:loadRequest.soundId filePath:loadRequest.filePath]; + _soundEngine.asynchLoadProgress += increment; + } + } + + //Completed + _soundEngine.asynchLoadProgress = 1.0f; + [[NSNotificationCenter defaultCenter] postNotificationName:kCDN_AsynchLoadComplete object:nil]; + +} + +-(void) dealloc { + [_loadRequests release]; + [_soundEngine release]; + [super dealloc]; +} + +@end + + +/////////////////////////////////////////////////////////////////////////////////////// +#pragma mark - +#pragma mark CDBufferLoadRequest + +@implementation CDBufferLoadRequest + +@synthesize filePath, soundId; + +-(id) init:(int) theSoundId filePath:(const NSString *) theFilePath { + if ((self = [super init])) { + soundId = theSoundId; + filePath = [theFilePath copy];//TODO: is retain necessary or does copy set retain count + [filePath retain]; + } + return self; +} + +-(void) dealloc { + [filePath release]; + [super dealloc]; +} + +@end + +/////////////////////////////////////////////////////////////////////////////////////// +#pragma mark - +#pragma mark CDFloatInterpolator + +@implementation CDFloatInterpolator +@synthesize start,end,interpolationType; + +-(float) interpolate:(float) t { + + if (t < 1.0f) { + switch (interpolationType) { + case kIT_Linear: + //Linear interpolation + return ((end - start) * t) + start; + + case kIT_SCurve: + //Cubic s curve t^2 * (3 - 2t) + return ((float)(t * t * (3.0 - (2.0 * t))) * (end - start)) + start; + + case kIT_Exponential: + //Formulas taken from EaseAction + if (end > start) { + //Fade in + float logDelta = (t==0) ? 0 : powf(2, 10 * (t/1 - 1)) - 1 * 0.001f; + return ((end - start) * logDelta) + start; + } else { + //Fade Out + float logDelta = (-powf(2, -10 * t/1) + 1); + return ((end - start) * logDelta) + start; + } + default: + return 0.0f; + } + } else { + return end; + } +} + +-(id) init:(tCDInterpolationType) type startVal:(float) startVal endVal:(float) endVal { + if ((self = [super init])) { + start = startVal; + end = endVal; + interpolationType = type; + } + return self; +} + +@end + +/////////////////////////////////////////////////////////////////////////////////////// +#pragma mark - +#pragma mark CDPropertyModifier + +@implementation CDPropertyModifier + +@synthesize stopTargetWhenComplete; + +-(id) init:(id) theTarget interpolationType:(tCDInterpolationType) type startVal:(float) startVal endVal:(float) endVal { + if ((self = [super init])) { + if (target) { + //Release the previous target if there is one + [target release]; + } + target = theTarget; +#if CD_DEBUG + //Check target is of the required type + if (![theTarget isMemberOfClass:[self _allowableType]] ) { + CDLOG(@"Denshion::CDPropertyModifier target is not of type %@",[self _allowableType]); + NSAssert([theTarget isKindOfClass:[CDSoundEngine class]], @"CDPropertyModifier target not of required type"); + } +#endif + [target retain]; + startValue = startVal; + endValue = endVal; + if (interpolator) { + //Release previous interpolator if there is one + [interpolator release]; + } + interpolator = [[CDFloatInterpolator alloc] init:type startVal:startVal endVal:endVal]; + stopTargetWhenComplete = NO; + } + return self; +} + +-(void) dealloc { + CDLOGINFO(@"Denshion::CDPropertyModifier deallocated %@",self); + [target release]; + [interpolator release]; + [super dealloc]; +} + +-(void) modify:(float) t { + if (t < 1.0) { + [self _setTargetProperty:[interpolator interpolate:t]]; + } else { + //At the end + [self _setTargetProperty:endValue]; + if (stopTargetWhenComplete) { + [self _stopTarget]; + } + } +} + +-(float) startValue { + return startValue; +} + +-(void) setStartValue:(float) startVal +{ + startValue = startVal; + interpolator.start = startVal; +} + +-(float) endValue { + return startValue; +} + +-(void) setEndValue:(float) endVal +{ + endValue = endVal; + interpolator.end = endVal; +} + +-(tCDInterpolationType) interpolationType { + return interpolator.interpolationType; +} + +-(void) setInterpolationType:(tCDInterpolationType) interpolationType { + interpolator.interpolationType = interpolationType; +} + +-(void) _setTargetProperty:(float) newVal { + +} + +-(float) _getTargetProperty { + return 0.0f; +} + +-(void) _stopTarget { + +} + +-(Class) _allowableType { + return [NSObject class]; +} +@end + +/////////////////////////////////////////////////////////////////////////////////////// +#pragma mark - +#pragma mark CDSoundSourceFader + +@implementation CDSoundSourceFader + +-(void) _setTargetProperty:(float) newVal { + ((CDSoundSource*)target).gain = newVal; +} + +-(float) _getTargetProperty { + return ((CDSoundSource*)target).gain; +} + +-(void) _stopTarget { + [((CDSoundSource*)target) stop]; +} + +-(Class) _allowableType { + return [CDSoundSource class]; +} + +@end + +/////////////////////////////////////////////////////////////////////////////////////// +#pragma mark - +#pragma mark CDSoundSourcePanner + +@implementation CDSoundSourcePanner + +-(void) _setTargetProperty:(float) newVal { + ((CDSoundSource*)target).pan = newVal; +} + +-(float) _getTargetProperty { + return ((CDSoundSource*)target).pan; +} + +-(void) _stopTarget { + [((CDSoundSource*)target) stop]; +} + +-(Class) _allowableType { + return [CDSoundSource class]; +} + +@end + +/////////////////////////////////////////////////////////////////////////////////////// +#pragma mark - +#pragma mark CDSoundSourcePitchBender + +@implementation CDSoundSourcePitchBender + +-(void) _setTargetProperty:(float) newVal { + ((CDSoundSource*)target).pitch = newVal; +} + +-(float) _getTargetProperty { + return ((CDSoundSource*)target).pitch; +} + +-(void) _stopTarget { + [((CDSoundSource*)target) stop]; +} + +-(Class) _allowableType { + return [CDSoundSource class]; +} + +@end + +/////////////////////////////////////////////////////////////////////////////////////// +#pragma mark - +#pragma mark CDSoundEngineFader + +@implementation CDSoundEngineFader + +-(void) _setTargetProperty:(float) newVal { + ((CDSoundEngine*)target).masterGain = newVal; +} + +-(float) _getTargetProperty { + return ((CDSoundEngine*)target).masterGain; +} + +-(void) _stopTarget { + [((CDSoundEngine*)target) stopAllSounds]; +} + +-(Class) _allowableType { + return [CDSoundEngine class]; +} + +@end + + diff --git a/libs/CocosDenshion/SimpleAudioEngine.h b/libs/CocosDenshion/SimpleAudioEngine.h new file mode 100755 index 0000000..35396c6 --- /dev/null +++ b/libs/CocosDenshion/SimpleAudioEngine.h @@ -0,0 +1,90 @@ +/* + Copyright (c) 2010 Steve Oldmeadow + + Permission is hereby granted, free of charge, to any person obtaining a copy + of this software and associated documentation files (the "Software"), to deal + in the Software without restriction, including without limitation the rights + to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + copies of the Software, and to permit persons to whom the Software is + furnished to do so, subject to the following conditions: + + The above copyright notice and this permission notice shall be included in + all copies or substantial portions of the Software. + + THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + THE SOFTWARE. + + $Id$ + */ + + +#import "CDAudioManager.h" + +/** + A wrapper to the CDAudioManager object. + This is recommended for basic audio requirements. If you just want to play some sound fx + and some background music and have no interest in learning the lower level workings then + this is the interface to use. + + Requirements: + - Firmware: OS 2.2 or greater + - Files: SimpleAudioEngine.*, CocosDenshion.* + - Frameworks: OpenAL, AudioToolbox, AVFoundation + @since v0.8 + */ +@interface SimpleAudioEngine : NSObject { + + BOOL mute_; + BOOL enabled_; +} + +/** Background music volume. Range is 0.0f to 1.0f. This will only have an effect if willPlayBackgroundMusic returns YES */ +@property (readwrite) float backgroundMusicVolume; +/** Effects volume. Range is 0.0f to 1.0f */ +@property (readwrite) float effectsVolume; +/** If NO it indicates background music will not be played either because no background music is loaded or the audio session does not permit it.*/ +@property (readonly) BOOL willPlayBackgroundMusic; + +/** returns the shared instance of the SimpleAudioEngine object */ ++ (SimpleAudioEngine*) sharedEngine; + +/** Preloads a music file so it will be ready to play as background music */ +-(void) preloadBackgroundMusic:(NSString*) filePath; + +/** plays background music in a loop*/ +-(void) playBackgroundMusic:(NSString*) filePath; +/** plays background music, if loop is true the music will repeat otherwise it will be played once */ +-(void) playBackgroundMusic:(NSString*) filePath loop:(BOOL) loop; +/** stops playing background music */ +-(void) stopBackgroundMusic; +/** pauses the background music */ +-(void) pauseBackgroundMusic; +/** resume background music that has been paused */ +-(void) resumeBackgroundMusic; +/** rewind the background music */ +-(void) rewindBackgroundMusic; +/** returns whether or not the background music is playing */ +-(BOOL) isBackgroundMusicPlaying; + +/** plays an audio effect with a file path*/ +-(ALuint) playEffect:(NSString*) filePath; +/** stop a sound that is playing, note you must pass in the soundId that is returned when you started playing the sound with playEffect */ +-(void) stopEffect:(ALuint) soundId; +/** plays an audio effect with a file path, pitch, pan and gain */ +-(ALuint) playEffect:(NSString*) filePath pitch:(Float32) pitch pan:(Float32) pan gain:(Float32) gain; +/** preloads an audio effect */ +-(void) preloadEffect:(NSString*) filePath; +/** unloads an audio effect from memory */ +-(void) unloadEffect:(NSString*) filePath; +/** Gets a CDSoundSource object set up to play the specified file. */ +-(CDSoundSource *) soundSourceForFile:(NSString*) filePath; + +/** Shuts down the shared audio engine instance so that it can be reinitialised */ ++(void) end; + +@end diff --git a/libs/CocosDenshion/SimpleAudioEngine.m b/libs/CocosDenshion/SimpleAudioEngine.m new file mode 100755 index 0000000..cdff26c --- /dev/null +++ b/libs/CocosDenshion/SimpleAudioEngine.m @@ -0,0 +1,220 @@ +/* + Copyright (c) 2010 Steve Oldmeadow + + Permission is hereby granted, free of charge, to any person obtaining a copy + of this software and associated documentation files (the "Software"), to deal + in the Software without restriction, including without limitation the rights + to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + copies of the Software, and to permit persons to whom the Software is + furnished to do so, subject to the following conditions: + + The above copyright notice and this permission notice shall be included in + all copies or substantial portions of the Software. + + THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + THE SOFTWARE. + + $Id$ + */ + +#import "SimpleAudioEngine.h" + +@implementation SimpleAudioEngine + +static SimpleAudioEngine *sharedEngine = nil; +static CDSoundEngine* soundEngine = nil; +static CDAudioManager *am = nil; +static CDBufferManager *bufferManager = nil; + +// Init ++ (SimpleAudioEngine *) sharedEngine +{ + @synchronized(self) { + if (!sharedEngine) + sharedEngine = [[SimpleAudioEngine alloc] init]; + } + return sharedEngine; +} + ++ (id) alloc +{ + @synchronized(self) { + NSAssert(sharedEngine == nil, @"Attempted to allocate a second instance of a singleton."); + return [super alloc]; + } + return nil; +} + +-(id) init +{ + if((self=[super init])) { + am = [CDAudioManager sharedManager]; + soundEngine = am.soundEngine; + bufferManager = [[CDBufferManager alloc] initWithEngine:soundEngine]; + mute_ = NO; + enabled_ = YES; + } + return self; +} + +// Memory +- (void) dealloc +{ + am = nil; + soundEngine = nil; + bufferManager = nil; + [super dealloc]; +} + ++(void) end +{ + am = nil; + [CDAudioManager end]; + [bufferManager release]; + [sharedEngine release]; + sharedEngine = nil; +} + +#pragma mark SimpleAudioEngine - background music + +-(void) preloadBackgroundMusic:(NSString*) filePath { + [am preloadBackgroundMusic:filePath]; +} + +-(void) playBackgroundMusic:(NSString*) filePath +{ + [am playBackgroundMusic:filePath loop:TRUE]; +} + +-(void) playBackgroundMusic:(NSString*) filePath loop:(BOOL) loop +{ + [am playBackgroundMusic:filePath loop:loop]; +} + +-(void) stopBackgroundMusic +{ + [am stopBackgroundMusic]; +} + +-(void) pauseBackgroundMusic { + [am pauseBackgroundMusic]; +} + +-(void) resumeBackgroundMusic { + [am resumeBackgroundMusic]; +} + +-(void) rewindBackgroundMusic { + [am rewindBackgroundMusic]; +} + +-(BOOL) isBackgroundMusicPlaying { + return [am isBackgroundMusicPlaying]; +} + +-(BOOL) willPlayBackgroundMusic { + return [am willPlayBackgroundMusic]; +} + +#pragma mark SimpleAudioEngine - sound effects + +-(ALuint) playEffect:(NSString*) filePath +{ + return [self playEffect:filePath pitch:1.0f pan:0.0f gain:1.0f]; +} + +-(ALuint) playEffect:(NSString*) filePath pitch:(Float32) pitch pan:(Float32) pan gain:(Float32) gain +{ + int soundId = [bufferManager bufferForFile:filePath create:YES]; + if (soundId != kCDNoBuffer) { + return [soundEngine playSound:soundId sourceGroupId:0 pitch:pitch pan:pan gain:gain loop:false]; + } else { + return CD_MUTE; + } +} + +-(void) stopEffect:(ALuint) soundId { + [soundEngine stopSound:soundId]; +} + +-(void) preloadEffect:(NSString*) filePath +{ + int soundId = [bufferManager bufferForFile:filePath create:YES]; + if (soundId == kCDNoBuffer) { + CDLOG(@"Denshion::SimpleAudioEngine sound failed to preload %@",filePath); + } +} + +-(void) unloadEffect:(NSString*) filePath +{ + CDLOGINFO(@"Denshion::SimpleAudioEngine unloadedEffect %@",filePath); + [bufferManager releaseBufferForFile:filePath]; +} + +#pragma mark Audio Interrupt Protocol +-(BOOL) mute +{ + return mute_; +} + +-(void) setMute:(BOOL) muteValue +{ + if (mute_ != muteValue) { + mute_ = muteValue; + am.mute = mute_; + } +} + +-(BOOL) enabled +{ + return enabled_; +} + +-(void) setEnabled:(BOOL) enabledValue +{ + if (enabled_ != enabledValue) { + enabled_ = enabledValue; + am.enabled = enabled_; + } +} + + +#pragma mark SimpleAudioEngine - BackgroundMusicVolume +-(float) backgroundMusicVolume +{ + return am.backgroundMusic.volume; +} + +-(void) setBackgroundMusicVolume:(float) volume +{ + am.backgroundMusic.volume = volume; +} + +#pragma mark SimpleAudioEngine - EffectsVolume +-(float) effectsVolume +{ + return am.soundEngine.masterGain; +} + +-(void) setEffectsVolume:(float) volume +{ + am.soundEngine.masterGain = volume; +} + +-(CDSoundSource *) soundSourceForFile:(NSString*) filePath { + int soundId = [bufferManager bufferForFile:filePath create:YES]; + if (soundId != kCDNoBuffer) { + CDSoundSource *result = [soundEngine soundSourceForSound:soundId sourceGroupId:0]; + CDLOGINFO(@"Denshion::SimpleAudioEngine sound source created for %@",filePath); + return result; + } else { + return nil; + } +} + +@end diff --git a/libs/FontLabel/FontLabel.h b/libs/FontLabel/FontLabel.h new file mode 100755 index 0000000..6de9c2c --- /dev/null +++ b/libs/FontLabel/FontLabel.h @@ -0,0 +1,44 @@ +// +// FontLabel.h +// FontLabel +// +// Created by Kevin Ballard on 5/8/09. +// Copyright © 2009 Zynga Game Networks +// +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. +// + +#import +#import + +@class ZFont; +@class ZAttributedString; + +@interface FontLabel : UILabel { + void *reserved; // works around a bug in UILabel + ZFont *zFont; + ZAttributedString *zAttributedText; +} +@property (nonatomic, setter=setCGFont:) CGFontRef cgFont __AVAILABILITY_INTERNAL_DEPRECATED; +@property (nonatomic, assign) CGFloat pointSize __AVAILABILITY_INTERNAL_DEPRECATED; +@property (nonatomic, retain, setter=setZFont:) ZFont *zFont; +// if attributedText is nil, fall back on using the inherited UILabel properties +// if attributedText is non-nil, the font/text/textColor +// in addition, adjustsFontSizeToFitWidth does not work with attributed text +@property (nonatomic, copy) ZAttributedString *zAttributedText; +// -initWithFrame:fontName:pointSize: uses FontManager to look up the font name +- (id)initWithFrame:(CGRect)frame fontName:(NSString *)fontName pointSize:(CGFloat)pointSize; +- (id)initWithFrame:(CGRect)frame zFont:(ZFont *)font; +- (id)initWithFrame:(CGRect)frame font:(CGFontRef)font pointSize:(CGFloat)pointSize __AVAILABILITY_INTERNAL_DEPRECATED; +@end diff --git a/libs/FontLabel/FontLabel.m b/libs/FontLabel/FontLabel.m new file mode 100755 index 0000000..58975b1 --- /dev/null +++ b/libs/FontLabel/FontLabel.m @@ -0,0 +1,195 @@ +// +// FontLabel.m +// FontLabel +// +// Created by Kevin Ballard on 5/8/09. +// Copyright © 2009 Zynga Game Networks +// +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. +// + +#import "FontLabel.h" +#import "FontManager.h" +#import "FontLabelStringDrawing.h" +#import "ZFont.h" + +@interface ZFont (ZFontPrivate) +@property (nonatomic, readonly) CGFloat ratio; +@end + +@implementation FontLabel +@synthesize zFont; +@synthesize zAttributedText; + +- (id)initWithFrame:(CGRect)frame fontName:(NSString *)fontName pointSize:(CGFloat)pointSize { + return [self initWithFrame:frame zFont:[[FontManager sharedManager] zFontWithName:fontName pointSize:pointSize]]; +} + +- (id)initWithFrame:(CGRect)frame zFont:(ZFont *)font { + if ((self = [super initWithFrame:frame])) { + zFont = [font retain]; + } + return self; +} + +- (id)initWithFrame:(CGRect)frame font:(CGFontRef)font pointSize:(CGFloat)pointSize { + return [self initWithFrame:frame zFont:[ZFont fontWithCGFont:font size:pointSize]]; +} + +- (CGFontRef)cgFont { + return self.zFont.cgFont; +} + +- (void)setCGFont:(CGFontRef)font { + if (self.zFont.cgFont != font) { + self.zFont = [ZFont fontWithCGFont:font size:self.zFont.pointSize]; + } +} + +- (CGFloat)pointSize { + return self.zFont.pointSize; +} + +- (void)setPointSize:(CGFloat)pointSize { + if (self.zFont.pointSize != pointSize) { + self.zFont = [ZFont fontWithCGFont:self.zFont.cgFont size:pointSize]; + } +} + +- (void)setZAttributedText:(ZAttributedString *)attStr { + if (zAttributedText != attStr) { + [zAttributedText release]; + zAttributedText = [attStr copy]; + [self setNeedsDisplay]; + } +} + +- (void)drawTextInRect:(CGRect)rect { + if (self.zFont == NULL && self.zAttributedText == nil) { + [super drawTextInRect:rect]; + return; + } + + if (self.zAttributedText == nil) { + // this method is documented as setting the text color for us, but that doesn't appear to be the case + if (self.highlighted) { + [(self.highlightedTextColor ?: [UIColor whiteColor]) setFill]; + } else { + [(self.textColor ?: [UIColor blackColor]) setFill]; + } + + ZFont *actualFont = self.zFont; + CGSize origSize = rect.size; + if (self.numberOfLines == 1) { + origSize.height = actualFont.leading; + CGPoint point = CGPointMake(rect.origin.x, + rect.origin.y + roundf(((rect.size.height - actualFont.leading) / 2.0f))); + CGSize size = [self.text sizeWithZFont:actualFont]; + if (self.adjustsFontSizeToFitWidth && self.minimumFontSize < actualFont.pointSize) { + if (size.width > origSize.width) { + CGFloat desiredRatio = (origSize.width * actualFont.ratio) / size.width; + CGFloat desiredPointSize = desiredRatio * actualFont.pointSize / actualFont.ratio; + actualFont = [actualFont fontWithSize:MAX(MAX(desiredPointSize, self.minimumFontSize), 1.0f)]; + size = [self.text sizeWithZFont:actualFont]; + } + if (!CGSizeEqualToSize(origSize, size)) { + switch (self.baselineAdjustment) { + case UIBaselineAdjustmentAlignCenters: + point.y += roundf((origSize.height - size.height) / 2.0f); + break; + case UIBaselineAdjustmentAlignBaselines: + point.y += (self.zFont.ascender - actualFont.ascender); + break; + case UIBaselineAdjustmentNone: + break; + } + } + } + size.width = MIN(size.width, origSize.width); + // adjust the point for alignment + switch (self.textAlignment) { + case UITextAlignmentLeft: + break; + case UITextAlignmentCenter: + point.x += (origSize.width - size.width) / 2.0f; + break; + case UITextAlignmentRight: + point.x += origSize.width - size.width; + break; + } + [self.text drawAtPoint:point forWidth:size.width withZFont:actualFont lineBreakMode:self.lineBreakMode]; + } else { + CGSize size = [self.text sizeWithZFont:actualFont constrainedToSize:origSize lineBreakMode:self.lineBreakMode numberOfLines:self.numberOfLines]; + CGPoint point = rect.origin; + point.y += roundf((rect.size.height - size.height) / 2.0f); + rect = (CGRect){point, CGSizeMake(rect.size.width, size.height)}; + [self.text drawInRect:rect withZFont:actualFont lineBreakMode:self.lineBreakMode alignment:self.textAlignment numberOfLines:self.numberOfLines]; + } + } else { + ZAttributedString *attStr = self.zAttributedText; + if (self.highlighted) { + // modify the string to change the base color + ZMutableAttributedString *mutStr = [[attStr mutableCopy] autorelease]; + NSRange activeRange = NSMakeRange(0, attStr.length); + while (activeRange.length > 0) { + NSRange effective; + UIColor *color = [attStr attribute:ZForegroundColorAttributeName atIndex:activeRange.location + longestEffectiveRange:&effective inRange:activeRange]; + if (color == nil) { + [mutStr addAttribute:ZForegroundColorAttributeName value:[UIColor whiteColor] range:effective]; + } + activeRange.location += effective.length, activeRange.length -= effective.length; + } + attStr = mutStr; + } + CGSize size = [attStr sizeConstrainedToSize:rect.size lineBreakMode:self.lineBreakMode numberOfLines:self.numberOfLines]; + CGPoint point = rect.origin; + point.y += roundf((rect.size.height - size.height) / 2.0f); + rect = (CGRect){point, CGSizeMake(rect.size.width, size.height)}; + [attStr drawInRect:rect withLineBreakMode:self.lineBreakMode alignment:self.textAlignment numberOfLines:self.numberOfLines]; + } +} + +- (CGRect)textRectForBounds:(CGRect)bounds limitedToNumberOfLines:(NSInteger)numberOfLines { + if (self.zFont == NULL && self.zAttributedText == nil) { + return [super textRectForBounds:bounds limitedToNumberOfLines:numberOfLines]; + } + + if (numberOfLines == 1) { + // if numberOfLines == 1 we need to use the version that converts spaces + CGSize size; + if (self.zAttributedText == nil) { + size = [self.text sizeWithZFont:self.zFont]; + } else { + size = [self.zAttributedText size]; + } + bounds.size.width = MIN(bounds.size.width, size.width); + bounds.size.height = MIN(bounds.size.height, size.height); + } else { + if (numberOfLines > 0) bounds.size.height = MIN(bounds.size.height, self.zFont.leading * numberOfLines); + if (self.zAttributedText == nil) { + bounds.size = [self.text sizeWithZFont:self.zFont constrainedToSize:bounds.size lineBreakMode:self.lineBreakMode]; + } else { + bounds.size = [self.zAttributedText sizeConstrainedToSize:bounds.size lineBreakMode:self.lineBreakMode]; + } + } + return bounds; +} + +- (void)dealloc { + [zFont release]; + [zAttributedText release]; + [super dealloc]; +} +@end diff --git a/libs/FontLabel/FontLabelStringDrawing.h b/libs/FontLabel/FontLabelStringDrawing.h new file mode 100755 index 0000000..821da22 --- /dev/null +++ b/libs/FontLabel/FontLabelStringDrawing.h @@ -0,0 +1,69 @@ +// +// FontLabelStringDrawing.h +// FontLabel +// +// Created by Kevin Ballard on 5/5/09. +// Copyright © 2009 Zynga Game Networks +// +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. +// + +#import +#import "ZAttributedString.h" + +@class ZFont; + +@interface NSString (FontLabelStringDrawing) +// CGFontRef-based methods +- (CGSize)sizeWithCGFont:(CGFontRef)font pointSize:(CGFloat)pointSize __AVAILABILITY_INTERNAL_DEPRECATED; +- (CGSize)sizeWithCGFont:(CGFontRef)font pointSize:(CGFloat)pointSize constrainedToSize:(CGSize)size __AVAILABILITY_INTERNAL_DEPRECATED; +- (CGSize)sizeWithCGFont:(CGFontRef)font pointSize:(CGFloat)pointSize constrainedToSize:(CGSize)size + lineBreakMode:(UILineBreakMode)lineBreakMode __AVAILABILITY_INTERNAL_DEPRECATED; +- (CGSize)drawAtPoint:(CGPoint)point withCGFont:(CGFontRef)font pointSize:(CGFloat)pointSize __AVAILABILITY_INTERNAL_DEPRECATED; +- (CGSize)drawInRect:(CGRect)rect withCGFont:(CGFontRef)font pointSize:(CGFloat)pointSize __AVAILABILITY_INTERNAL_DEPRECATED; +- (CGSize)drawInRect:(CGRect)rect withCGFont:(CGFontRef)font pointSize:(CGFloat)pointSize + lineBreakMode:(UILineBreakMode)lineBreakMode __AVAILABILITY_INTERNAL_DEPRECATED; +- (CGSize)drawInRect:(CGRect)rect withCGFont:(CGFontRef)font pointSize:(CGFloat)pointSize + lineBreakMode:(UILineBreakMode)lineBreakMode alignment:(UITextAlignment)alignment __AVAILABILITY_INTERNAL_DEPRECATED; + +// ZFont-based methods +- (CGSize)sizeWithZFont:(ZFont *)font; +- (CGSize)sizeWithZFont:(ZFont *)font constrainedToSize:(CGSize)size; +- (CGSize)sizeWithZFont:(ZFont *)font constrainedToSize:(CGSize)size lineBreakMode:(UILineBreakMode)lineBreakMode; +- (CGSize)sizeWithZFont:(ZFont *)font constrainedToSize:(CGSize)size lineBreakMode:(UILineBreakMode)lineBreakMode + numberOfLines:(NSUInteger)numberOfLines; +- (CGSize)drawAtPoint:(CGPoint)point withZFont:(ZFont *)font; +- (CGSize)drawAtPoint:(CGPoint)point forWidth:(CGFloat)width withZFont:(ZFont *)font lineBreakMode:(UILineBreakMode)lineBreakMode; +- (CGSize)drawInRect:(CGRect)rect withZFont:(ZFont *)font; +- (CGSize)drawInRect:(CGRect)rect withZFont:(ZFont *)font lineBreakMode:(UILineBreakMode)lineBreakMode; +- (CGSize)drawInRect:(CGRect)rect withZFont:(ZFont *)font lineBreakMode:(UILineBreakMode)lineBreakMode + alignment:(UITextAlignment)alignment; +- (CGSize)drawInRect:(CGRect)rect withZFont:(ZFont *)font lineBreakMode:(UILineBreakMode)lineBreakMode + alignment:(UITextAlignment)alignment numberOfLines:(NSUInteger)numberOfLines; +@end + +@interface ZAttributedString (ZAttributedStringDrawing) +- (CGSize)size; +- (CGSize)sizeConstrainedToSize:(CGSize)size; +- (CGSize)sizeConstrainedToSize:(CGSize)size lineBreakMode:(UILineBreakMode)lineBreakMode; +- (CGSize)sizeConstrainedToSize:(CGSize)size lineBreakMode:(UILineBreakMode)lineBreakMode + numberOfLines:(NSUInteger)numberOfLines; +- (CGSize)drawAtPoint:(CGPoint)point; +- (CGSize)drawAtPoint:(CGPoint)point forWidth:(CGFloat)width lineBreakMode:(UILineBreakMode)lineBreakMode; +- (CGSize)drawInRect:(CGRect)rect; +- (CGSize)drawInRect:(CGRect)rect withLineBreakMode:(UILineBreakMode)lineBreakMode; +- (CGSize)drawInRect:(CGRect)rect withLineBreakMode:(UILineBreakMode)lineBreakMode alignment:(UITextAlignment)alignment; +- (CGSize)drawInRect:(CGRect)rect withLineBreakMode:(UILineBreakMode)lineBreakMode alignment:(UITextAlignment)alignment + numberOfLines:(NSUInteger)numberOfLines; +@end diff --git a/libs/FontLabel/FontLabelStringDrawing.m b/libs/FontLabel/FontLabelStringDrawing.m new file mode 100755 index 0000000..2907372 --- /dev/null +++ b/libs/FontLabel/FontLabelStringDrawing.m @@ -0,0 +1,892 @@ +// +// FontLabelStringDrawing.m +// FontLabel +// +// Created by Kevin Ballard on 5/5/09. +// Copyright © 2009 Zynga Game Networks +// +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. +// + +#import "FontLabelStringDrawing.h" +#import "ZFont.h" +#import "ZAttributedStringPrivate.h" + +@interface ZFont (ZFontPrivate) +@property (nonatomic, readonly) CGFloat ratio; +@end + +#define kUnicodeHighSurrogateStart 0xD800 +#define kUnicodeHighSurrogateEnd 0xDBFF +#define kUnicodeHighSurrogateMask kUnicodeHighSurrogateStart +#define kUnicodeLowSurrogateStart 0xDC00 +#define kUnicodeLowSurrogateEnd 0xDFFF +#define kUnicodeLowSurrogateMask kUnicodeLowSurrogateStart +#define kUnicodeSurrogateTypeMask 0xFC00 +#define UnicharIsHighSurrogate(c) ((c & kUnicodeSurrogateTypeMask) == kUnicodeHighSurrogateMask) +#define UnicharIsLowSurrogate(c) ((c & kUnicodeSurrogateTypeMask) == kUnicodeLowSurrogateMask) +#define ConvertSurrogatePairToUTF32(high, low) ((UInt32)((high - 0xD800) * 0x400 + (low - 0xDC00) + 0x10000)) + +typedef enum { + kFontTableFormat4 = 4, + kFontTableFormat12 = 12, +} FontTableFormat; + +typedef struct fontTable { + NSUInteger retainCount; + CFDataRef cmapTable; + FontTableFormat format; + union { + struct { + UInt16 segCountX2; + UInt16 *endCodes; + UInt16 *startCodes; + UInt16 *idDeltas; + UInt16 *idRangeOffsets; + } format4; + struct { + UInt32 nGroups; + struct { + UInt32 startCharCode; + UInt32 endCharCode; + UInt32 startGlyphCode; + } *groups; + } format12; + } cmap; +} fontTable; + +static FontTableFormat supportedFormats[] = { kFontTableFormat4, kFontTableFormat12 }; +static size_t supportedFormatsCount = sizeof(supportedFormats) / sizeof(FontTableFormat); + +static fontTable *newFontTable(CFDataRef cmapTable, FontTableFormat format) { + fontTable *table = (struct fontTable *)malloc(sizeof(struct fontTable)); + table->retainCount = 1; + table->cmapTable = CFRetain(cmapTable); + table->format = format; + return table; +} + +static fontTable *retainFontTable(fontTable *table) { + if (table != NULL) { + table->retainCount++; + } + return table; +} + +static void releaseFontTable(fontTable *table) { + if (table != NULL) { + if (table->retainCount <= 1) { + CFRelease(table->cmapTable); + free(table); + } else { + table->retainCount--; + } + } +} + +static const void *fontTableRetainCallback(CFAllocatorRef allocator, const void *value) { + return retainFontTable((fontTable *)value); +} + +static void fontTableReleaseCallback(CFAllocatorRef allocator, const void *value) { + releaseFontTable((fontTable *)value); +} + +static const CFDictionaryValueCallBacks kFontTableDictionaryValueCallBacks = { + .version = 0, + .retain = &fontTableRetainCallback, + .release = &fontTableReleaseCallback, + .copyDescription = NULL, + .equal = NULL +}; + +// read the cmap table from the font +// we only know how to understand some of the table formats at the moment +static fontTable *readFontTableFromCGFont(CGFontRef font) { + CFDataRef cmapTable = CGFontCopyTableForTag(font, 'cmap'); + NSCAssert1(cmapTable != NULL, @"CGFontCopyTableForTag returned NULL for 'cmap' tag in font %@", + (font ? [(id)CFCopyDescription(font) autorelease] : @"(null)")); + const UInt8 * const bytes = CFDataGetBytePtr(cmapTable); + NSCAssert1(OSReadBigInt16(bytes, 0) == 0, @"cmap table for font %@ has bad version number", + (font ? [(id)CFCopyDescription(font) autorelease] : @"(null)")); + UInt16 numberOfSubtables = OSReadBigInt16(bytes, 2); + const UInt8 *unicodeSubtable = NULL; + //UInt16 unicodeSubtablePlatformID; + UInt16 unicodeSubtablePlatformSpecificID; + FontTableFormat unicodeSubtableFormat; + const UInt8 * const encodingSubtables = &bytes[4]; + for (UInt16 i = 0; i < numberOfSubtables; i++) { + const UInt8 * const encodingSubtable = &encodingSubtables[8 * i]; + UInt16 platformID = OSReadBigInt16(encodingSubtable, 0); + UInt16 platformSpecificID = OSReadBigInt16(encodingSubtable, 2); + // find the best subtable + // best is defined by a combination of encoding and format + // At the moment we only support format 4, so ignore all other format tables + // We prefer platformID == 0, but we will also accept Microsoft's unicode format + if (platformID == 0 || (platformID == 3 && platformSpecificID == 1)) { + BOOL preferred = NO; + if (unicodeSubtable == NULL) { + preferred = YES; + } else if (platformID == 0 && platformSpecificID > unicodeSubtablePlatformSpecificID) { + preferred = YES; + } + if (preferred) { + UInt32 offset = OSReadBigInt32(encodingSubtable, 4); + const UInt8 *subtable = &bytes[offset]; + UInt16 format = OSReadBigInt16(subtable, 0); + for (size_t i = 0; i < supportedFormatsCount; i++) { + if (format == supportedFormats[i]) { + if (format >= 8) { + // the version is a fixed-point + UInt16 formatFrac = OSReadBigInt16(subtable, 2); + if (formatFrac != 0) { + // all the current formats with a Fixed version are always *.0 + continue; + } + } + unicodeSubtable = subtable; + //unicodeSubtablePlatformID = platformID; + unicodeSubtablePlatformSpecificID = platformSpecificID; + unicodeSubtableFormat = format; + break; + } + } + } + } + } + fontTable *table = NULL; + if (unicodeSubtable != NULL) { + table = newFontTable(cmapTable, unicodeSubtableFormat); + switch (unicodeSubtableFormat) { + case kFontTableFormat4: + // subtable format 4 + //UInt16 length = OSReadBigInt16(unicodeSubtable, 2); + //UInt16 language = OSReadBigInt16(unicodeSubtable, 4); + table->cmap.format4.segCountX2 = OSReadBigInt16(unicodeSubtable, 6); + //UInt16 searchRange = OSReadBigInt16(unicodeSubtable, 8); + //UInt16 entrySelector = OSReadBigInt16(unicodeSubtable, 10); + //UInt16 rangeShift = OSReadBigInt16(unicodeSubtable, 12); + table->cmap.format4.endCodes = (UInt16*)&unicodeSubtable[14]; + table->cmap.format4.startCodes = (UInt16*)&((UInt8*)table->cmap.format4.endCodes)[table->cmap.format4.segCountX2+2]; + table->cmap.format4.idDeltas = (UInt16*)&((UInt8*)table->cmap.format4.startCodes)[table->cmap.format4.segCountX2]; + table->cmap.format4.idRangeOffsets = (UInt16*)&((UInt8*)table->cmap.format4.idDeltas)[table->cmap.format4.segCountX2]; + //UInt16 *glyphIndexArray = &idRangeOffsets[segCountX2]; + break; + case kFontTableFormat12: + table->cmap.format12.nGroups = OSReadBigInt32(unicodeSubtable, 12); + table->cmap.format12.groups = (void *)&unicodeSubtable[16]; + break; + default: + releaseFontTable(table); + table = NULL; + } + } + CFRelease(cmapTable); + return table; +} + +// outGlyphs must be at least size n +static void mapCharactersToGlyphsInFont(const fontTable *table, unichar characters[], size_t charLen, CGGlyph outGlyphs[], size_t *outGlyphLen) { + if (table != NULL) { + NSUInteger j = 0; + switch (table->format) { + case kFontTableFormat4: { + for (NSUInteger i = 0; i < charLen; i++, j++) { + unichar c = characters[i]; + UInt16 segOffset; + BOOL foundSegment = NO; + for (segOffset = 0; segOffset < table->cmap.format4.segCountX2; segOffset += 2) { + UInt16 endCode = OSReadBigInt16(table->cmap.format4.endCodes, segOffset); + if (endCode >= c) { + foundSegment = YES; + break; + } + } + if (!foundSegment) { + // no segment + // this is an invalid font + outGlyphs[j] = 0; + } else { + UInt16 startCode = OSReadBigInt16(table->cmap.format4.startCodes, segOffset); + if (!(startCode <= c)) { + // the code falls in a hole between segments + outGlyphs[j] = 0; + } else { + UInt16 idRangeOffset = OSReadBigInt16(table->cmap.format4.idRangeOffsets, segOffset); + if (idRangeOffset == 0) { + UInt16 idDelta = OSReadBigInt16(table->cmap.format4.idDeltas, segOffset); + outGlyphs[j] = (c + idDelta) % 65536; + } else { + // use the glyphIndexArray + UInt16 glyphOffset = idRangeOffset + 2 * (c - startCode); + outGlyphs[j] = OSReadBigInt16(&((UInt8*)table->cmap.format4.idRangeOffsets)[segOffset], glyphOffset); + } + } + } + } + break; + } + case kFontTableFormat12: { + UInt32 lastSegment = UINT32_MAX; + for (NSUInteger i = 0; i < charLen; i++, j++) { + unichar c = characters[i]; + UInt32 c32 = c; + if (UnicharIsHighSurrogate(c)) { + if (i+1 < charLen) { // do we have another character after this one? + unichar cc = characters[i+1]; + if (UnicharIsLowSurrogate(cc)) { + c32 = ConvertSurrogatePairToUTF32(c, cc); + i++; + } + } + } + // Start the heuristic search + // If this is an ASCII char, just do a linear search + // Otherwise do a hinted, modified binary search + // Start the first pivot at the last range found + // And when moving the pivot, limit the movement by increasing + // powers of two. This should help with locality + __typeof__(table->cmap.format12.groups[0]) *foundGroup = NULL; + if (c32 <= 0x7F) { + // ASCII + for (UInt32 idx = 0; idx < table->cmap.format12.nGroups; idx++) { + __typeof__(table->cmap.format12.groups[idx]) *group = &table->cmap.format12.groups[idx]; + if (c32 < OSSwapBigToHostInt32(group->startCharCode)) { + // we've fallen into a hole + break; + } else if (c32 <= OSSwapBigToHostInt32(group->endCharCode)) { + // this is the range + foundGroup = group; + break; + } + } + } else { + // heuristic search + UInt32 maxJump = (lastSegment == UINT32_MAX ? UINT32_MAX / 2 : 8); + UInt32 lowIdx = 0, highIdx = table->cmap.format12.nGroups; // highIdx is the first invalid idx + UInt32 pivot = (lastSegment == UINT32_MAX ? lowIdx + (highIdx - lowIdx) / 2 : lastSegment); + while (highIdx > lowIdx) { + __typeof__(table->cmap.format12.groups[pivot]) *group = &table->cmap.format12.groups[pivot]; + if (c32 < OSSwapBigToHostInt32(group->startCharCode)) { + highIdx = pivot; + } else if (c32 > OSSwapBigToHostInt32(group->endCharCode)) { + lowIdx = pivot + 1; + } else { + // we've hit the range + foundGroup = group; + break; + } + if (highIdx - lowIdx > maxJump * 2) { + if (highIdx == pivot) { + pivot -= maxJump; + } else { + pivot += maxJump; + } + maxJump *= 2; + } else { + pivot = lowIdx + (highIdx - lowIdx) / 2; + } + } + if (foundGroup != NULL) lastSegment = pivot; + } + if (foundGroup == NULL) { + outGlyphs[j] = 0; + } else { + outGlyphs[j] = (CGGlyph)(OSSwapBigToHostInt32(foundGroup->startGlyphCode) + + (c32 - OSSwapBigToHostInt32(foundGroup->startCharCode))); + } + } + break; + } + } + if (outGlyphLen != NULL) *outGlyphLen = j; + } else { + // we have no table, so just null out the glyphs + bzero(outGlyphs, charLen*sizeof(CGGlyph)); + if (outGlyphLen != NULL) *outGlyphLen = 0; + } +} + +static BOOL mapGlyphsToAdvancesInFont(ZFont *font, size_t n, CGGlyph glyphs[], CGFloat outAdvances[]) { + int advances[n]; + if (CGFontGetGlyphAdvances(font.cgFont, glyphs, n, advances)) { + CGFloat ratio = font.ratio; + + for (size_t i = 0; i < n; i++) { + outAdvances[i] = advances[i]*ratio; + } + return YES; + } else { + bzero(outAdvances, n*sizeof(CGFloat)); + } + return NO; +} + +static id getValueOrDefaultForRun(ZAttributeRun *run, NSString *key) { + id value = [run.attributes objectForKey:key]; + if (value == nil) { + static NSDictionary *defaultValues = nil; + if (defaultValues == nil) { + defaultValues = [[NSDictionary alloc] initWithObjectsAndKeys: + [ZFont fontWithUIFont:[UIFont systemFontOfSize:12]], ZFontAttributeName, + [UIColor blackColor], ZForegroundColorAttributeName, + [UIColor clearColor], ZBackgroundColorAttributeName, + [NSNumber numberWithInt:ZUnderlineStyleNone], ZUnderlineStyleAttributeName, + nil]; + } + value = [defaultValues objectForKey:key]; + } + return value; +} + +static void readRunInformation(NSArray *attributes, NSUInteger len, CFMutableDictionaryRef fontTableMap, + NSUInteger index, ZAttributeRun **currentRun, NSUInteger *nextRunStart, + ZFont **currentFont, fontTable **currentTable) { + *currentRun = [attributes objectAtIndex:index]; + *nextRunStart = ([attributes count] > index+1 ? [[attributes objectAtIndex:index+1] index] : len); + *currentFont = getValueOrDefaultForRun(*currentRun, ZFontAttributeName); + if (!CFDictionaryGetValueIfPresent(fontTableMap, (*currentFont).cgFont, (const void **)currentTable)) { + *currentTable = readFontTableFromCGFont((*currentFont).cgFont); + CFDictionarySetValue(fontTableMap, (*currentFont).cgFont, *currentTable); + releaseFontTable(*currentTable); + } +} + +static CGSize drawOrSizeTextConstrainedToSize(BOOL performDraw, NSString *string, NSArray *attributes, CGSize constrainedSize, NSUInteger maxLines, + UILineBreakMode lineBreakMode, UITextAlignment alignment, BOOL ignoreColor) { + NSUInteger len = [string length]; + NSUInteger idx = 0; + CGPoint drawPoint = CGPointZero; + CGSize retValue = CGSizeZero; + CGContextRef ctx = (performDraw ? UIGraphicsGetCurrentContext() : NULL); + + BOOL convertNewlines = (maxLines == 1); + + // Extract the characters from the string + // Convert newlines to spaces if necessary + unichar *characters = (unichar *)malloc(sizeof(unichar) * len); + if (convertNewlines) { + NSCharacterSet *charset = [NSCharacterSet newlineCharacterSet]; + NSRange range = NSMakeRange(0, len); + size_t cIdx = 0; + while (range.length > 0) { + NSRange newlineRange = [string rangeOfCharacterFromSet:charset options:0 range:range]; + if (newlineRange.location == NSNotFound) { + [string getCharacters:&characters[cIdx] range:range]; + cIdx += range.length; + break; + } else { + NSUInteger delta = newlineRange.location - range.location; + if (newlineRange.location > range.location) { + [string getCharacters:&characters[cIdx] range:NSMakeRange(range.location, delta)]; + } + cIdx += delta; + characters[cIdx] = (unichar)' '; + cIdx++; + delta += newlineRange.length; + range.location += delta, range.length -= delta; + if (newlineRange.length == 1 && range.length >= 1 && + [string characterAtIndex:newlineRange.location] == (unichar)'\r' && + [string characterAtIndex:range.location] == (unichar)'\n') { + // CRLF sequence, skip the LF + range.location += 1, range.length -= 1; + } + } + } + len = cIdx; + } else { + [string getCharacters:characters range:NSMakeRange(0, len)]; + } + + // Create storage for glyphs and advances + CGGlyph *glyphs; + CGFloat *advances; + { + NSUInteger maxRunLength = 0; + ZAttributeRun *a = [attributes objectAtIndex:0]; + for (NSUInteger i = 1; i < [attributes count]; i++) { + ZAttributeRun *b = [attributes objectAtIndex:i]; + maxRunLength = MAX(maxRunLength, b.index - a.index); + a = b; + } + maxRunLength = MAX(maxRunLength, len - a.index); + maxRunLength++; // for a potential ellipsis + glyphs = (CGGlyph *)malloc(sizeof(CGGlyph) * maxRunLength); + advances = (CGFloat *)malloc(sizeof(CGFloat) * maxRunLength); + } + + // Use this table to cache all fontTable objects + CFMutableDictionaryRef fontTableMap = CFDictionaryCreateMutable(NULL, 0, &kCFTypeDictionaryKeyCallBacks, + &kFontTableDictionaryValueCallBacks); + + // Fetch initial style values + NSUInteger currentRunIdx = 0; + ZAttributeRun *currentRun; + NSUInteger nextRunStart; + ZFont *currentFont; + fontTable *currentTable; + +#define READ_RUN() readRunInformation(attributes, len, fontTableMap, \ + currentRunIdx, ¤tRun, &nextRunStart, \ + ¤tFont, ¤tTable) + + READ_RUN(); + + // fetch the glyphs for the first run + size_t glyphCount; + NSUInteger glyphIdx; + +#define READ_GLYPHS() do { \ + mapCharactersToGlyphsInFont(currentTable, &characters[currentRun.index], (nextRunStart - currentRun.index), glyphs, &glyphCount); \ + mapGlyphsToAdvancesInFont(currentFont, (nextRunStart - currentRun.index), glyphs, advances); \ + glyphIdx = 0; \ + } while (0) + + READ_GLYPHS(); + + NSMutableCharacterSet *alphaCharset = [NSMutableCharacterSet alphanumericCharacterSet]; + [alphaCharset addCharactersInString:@"([{'\"\u2019\u02BC"]; + + // scan left-to-right looking for newlines or until we hit the width constraint + // When we hit a wrapping point, calculate truncation as follows: + // If we have room to draw at least one more character on the next line, no truncation + // Otherwise apply the truncation algorithm to the current line. + // After calculating any truncation, draw. + // Each time we hit the end of an attribute run, calculate the new font and make sure + // it fits (vertically) within the size constraint. If not, truncate this line. + // When we draw, iterate over the attribute runs for this line and draw each run separately + BOOL lastLine = NO; // used to indicate truncation and to stop the iterating + NSUInteger lineCount = 1; + while (idx < len && !lastLine) { + if (maxLines > 0 && lineCount == maxLines) { + lastLine = YES; + } + // scan left-to-right + struct { + NSUInteger index; + NSUInteger glyphIndex; + NSUInteger currentRunIdx; + } indexCache = { idx, glyphIdx, currentRunIdx }; + CGSize lineSize = CGSizeMake(0, currentFont.leading); + CGFloat lineAscender = currentFont.ascender; + struct { + NSUInteger index; + NSUInteger glyphIndex; + NSUInteger currentRunIdx; + CGSize lineSize; + } lastWrapCache = {0, 0, 0, CGSizeZero}; + BOOL inAlpha = NO; // used for calculating wrap points + + BOOL finishLine = NO; + for (;idx <= len && !finishLine;) { + NSUInteger skipCount = 0; + if (idx == len) { + finishLine = YES; + lastLine = YES; + } else { + if (idx >= nextRunStart) { + // cycle the font and table and grab the next set of glyphs + do { + currentRunIdx++; + READ_RUN(); + } while (idx >= nextRunStart); + READ_GLYPHS(); + // re-scan the characters to synchronize the glyph index + for (NSUInteger j = currentRun.index; j < idx; j++) { + if (UnicharIsHighSurrogate(characters[j]) && j+1 lineSize.height) { + lineSize.height = currentFont.leading; + if (retValue.height + currentFont.ascender > constrainedSize.height) { + lastLine = YES; + finishLine = YES; + } + } + lineAscender = MAX(lineAscender, currentFont.ascender); + } + unichar c = characters[idx]; + // Mark a wrap point before spaces and after any stretch of non-alpha characters + BOOL markWrap = NO; + if (c == (unichar)' ') { + markWrap = YES; + } else if ([alphaCharset characterIsMember:c]) { + if (!inAlpha) { + markWrap = YES; + inAlpha = YES; + } + } else { + inAlpha = NO; + } + if (markWrap) { + lastWrapCache = (__typeof__(lastWrapCache)){ + .index = idx, + .glyphIndex = glyphIdx, + .currentRunIdx = currentRunIdx, + .lineSize = lineSize + }; + } + // process the line + if (c == (unichar)'\n' || c == 0x0085) { // U+0085 is the NEXT_LINE unicode character + finishLine = YES; + skipCount = 1; + } else if (c == (unichar)'\r') { + finishLine = YES; + // check for CRLF + if (idx+1 < len && characters[idx+1] == (unichar)'\n') { + skipCount = 2; + } else { + skipCount = 1; + } + } else if (lineSize.width + advances[glyphIdx] > constrainedSize.width) { + finishLine = YES; + if (retValue.height + lineSize.height + currentFont.ascender > constrainedSize.height) { + lastLine = YES; + } + // walk backwards if wrapping is necessary + if (lastWrapCache.index > indexCache.index && lineBreakMode != UILineBreakModeCharacterWrap && + (!lastLine || lineBreakMode != UILineBreakModeClip)) { + // we're doing some sort of word wrapping + idx = lastWrapCache.index; + lineSize = lastWrapCache.lineSize; + if (!lastLine) { + // re-check if this is the last line + if (lastWrapCache.currentRunIdx != currentRunIdx) { + currentRunIdx = lastWrapCache.currentRunIdx; + READ_RUN(); + READ_GLYPHS(); + } + if (retValue.height + lineSize.height + currentFont.ascender > constrainedSize.height) { + lastLine = YES; + } + } + glyphIdx = lastWrapCache.glyphIndex; + // skip any spaces + for (NSUInteger j = idx; j < len && characters[j] == (unichar)' '; j++) { + skipCount++; + } + } + } + } + if (finishLine) { + // TODO: support head/middle truncation + if (lastLine && idx < len && lineBreakMode == UILineBreakModeTailTruncation) { + // truncate + unichar ellipsis = 0x2026; // ellipsis (…) + CGGlyph ellipsisGlyph; + mapCharactersToGlyphsInFont(currentTable, &ellipsis, 1, &ellipsisGlyph, NULL); + CGFloat ellipsisWidth; + mapGlyphsToAdvancesInFont(currentFont, 1, &ellipsisGlyph, &ellipsisWidth); + while ((idx - indexCache.index) > 1 && lineSize.width + ellipsisWidth > constrainedSize.width) { + // we have more than 1 character and we're too wide, so back up + idx--; + if (UnicharIsHighSurrogate(characters[idx]) && UnicharIsLowSurrogate(characters[idx+1])) { + idx--; + } + if (idx < currentRun.index) { + ZFont *oldFont = currentFont; + do { + currentRunIdx--; + READ_RUN(); + } while (idx < currentRun.index); + READ_GLYPHS(); + glyphIdx = glyphCount-1; + if (oldFont != currentFont) { + mapCharactersToGlyphsInFont(currentTable, &ellipsis, 1, &ellipsisGlyph, NULL); + mapGlyphsToAdvancesInFont(currentFont, 1, &ellipsisGlyph, &ellipsisWidth); + } + } else { + glyphIdx--; + } + lineSize.width -= advances[glyphIdx]; + } + // skip any spaces before truncating + while ((idx - indexCache.index) > 1 && characters[idx-1] == (unichar)' ') { + idx--; + if (idx < currentRun.index) { + currentRunIdx--; + READ_RUN(); + READ_GLYPHS(); + glyphIdx = glyphCount-1; + } else { + glyphIdx--; + } + lineSize.width -= advances[glyphIdx]; + } + lineSize.width += ellipsisWidth; + glyphs[glyphIdx] = ellipsisGlyph; + idx++; + glyphIdx++; + } + retValue.width = MAX(retValue.width, lineSize.width); + retValue.height += lineSize.height; + + // draw + if (performDraw) { + switch (alignment) { + case UITextAlignmentLeft: + drawPoint.x = 0; + break; + case UITextAlignmentCenter: + drawPoint.x = (constrainedSize.width - lineSize.width) / 2.0f; + break; + case UITextAlignmentRight: + drawPoint.x = constrainedSize.width - lineSize.width; + break; + } + NSUInteger stopGlyphIdx = glyphIdx; + NSUInteger lastRunIdx = currentRunIdx; + NSUInteger stopCharIdx = idx; + idx = indexCache.index; + if (currentRunIdx != indexCache.currentRunIdx) { + currentRunIdx = indexCache.currentRunIdx; + READ_RUN(); + READ_GLYPHS(); + } + glyphIdx = indexCache.glyphIndex; + for (NSUInteger drawIdx = currentRunIdx; drawIdx <= lastRunIdx; drawIdx++) { + if (drawIdx != currentRunIdx) { + currentRunIdx = drawIdx; + READ_RUN(); + READ_GLYPHS(); + } + NSUInteger numGlyphs; + if (drawIdx == lastRunIdx) { + numGlyphs = stopGlyphIdx - glyphIdx; + idx = stopCharIdx; + } else { + numGlyphs = glyphCount - glyphIdx; + idx = nextRunStart; + } + CGContextSetFont(ctx, currentFont.cgFont); + CGContextSetFontSize(ctx, currentFont.pointSize); + // calculate the fragment size + CGFloat fragmentWidth = 0; + for (NSUInteger g = 0; g < numGlyphs; g++) { + fragmentWidth += advances[glyphIdx + g]; + } + + if (!ignoreColor) { + UIColor *foregroundColor = getValueOrDefaultForRun(currentRun, ZForegroundColorAttributeName); + UIColor *backgroundColor = getValueOrDefaultForRun(currentRun, ZBackgroundColorAttributeName); + if (backgroundColor != nil && ![backgroundColor isEqual:[UIColor clearColor]]) { + [backgroundColor setFill]; + UIRectFillUsingBlendMode((CGRect){ drawPoint, { fragmentWidth, lineSize.height } }, kCGBlendModeNormal); + } + [foregroundColor setFill]; + } + + CGContextShowGlyphsAtPoint(ctx, drawPoint.x, drawPoint.y + lineAscender, &glyphs[glyphIdx], numGlyphs); + NSNumber *underlineStyle = getValueOrDefaultForRun(currentRun, ZUnderlineStyleAttributeName); + if ([underlineStyle integerValue] & ZUnderlineStyleMask) { + // we only support single for the time being + UIRectFill(CGRectMake(drawPoint.x, drawPoint.y + lineAscender, fragmentWidth, 1)); + } + drawPoint.x += fragmentWidth; + glyphIdx += numGlyphs; + } + drawPoint.y += lineSize.height; + } + idx += skipCount; + glyphIdx += skipCount; + lineCount++; + } else { + lineSize.width += advances[glyphIdx]; + glyphIdx++; + idx++; + if (idx < len && UnicharIsHighSurrogate(characters[idx-1]) && UnicharIsLowSurrogate(characters[idx])) { + // skip the second half of the surrogate pair + idx++; + } + } + } + } + CFRelease(fontTableMap); + free(glyphs); + free(advances); + free(characters); + +#undef READ_GLYPHS +#undef READ_RUN + + return retValue; +} + +static NSArray *attributeRunForFont(ZFont *font) { + return [NSArray arrayWithObject:[ZAttributeRun attributeRunWithIndex:0 + attributes:[NSDictionary dictionaryWithObject:font + forKey:ZFontAttributeName]]]; +} + +static CGSize drawTextInRect(CGRect rect, NSString *text, NSArray *attributes, UILineBreakMode lineBreakMode, + UITextAlignment alignment, NSUInteger numberOfLines, BOOL ignoreColor) { + CGContextRef ctx = UIGraphicsGetCurrentContext(); + + CGContextSaveGState(ctx); + + // flip it upside-down because our 0,0 is upper-left, whereas ttfs are for screens where 0,0 is lower-left + CGAffineTransform textTransform = CGAffineTransformMake(1.0f, 0.0f, 0.0f, -1.0f, 0.0f, 0.0f); + CGContextSetTextMatrix(ctx, textTransform); + + CGContextTranslateCTM(ctx, rect.origin.x, rect.origin.y); + + CGContextSetTextDrawingMode(ctx, kCGTextFill); + CGSize size = drawOrSizeTextConstrainedToSize(YES, text, attributes, rect.size, numberOfLines, lineBreakMode, alignment, ignoreColor); + + CGContextRestoreGState(ctx); + + return size; +} + +@implementation NSString (FontLabelStringDrawing) +// CGFontRef-based methods +- (CGSize)sizeWithCGFont:(CGFontRef)font pointSize:(CGFloat)pointSize { + return [self sizeWithZFont:[ZFont fontWithCGFont:font size:pointSize]]; +} + +- (CGSize)sizeWithCGFont:(CGFontRef)font pointSize:(CGFloat)pointSize constrainedToSize:(CGSize)size { + return [self sizeWithZFont:[ZFont fontWithCGFont:font size:pointSize] constrainedToSize:size]; +} + +- (CGSize)sizeWithCGFont:(CGFontRef)font pointSize:(CGFloat)pointSize constrainedToSize:(CGSize)size + lineBreakMode:(UILineBreakMode)lineBreakMode { + return [self sizeWithZFont:[ZFont fontWithCGFont:font size:pointSize] constrainedToSize:size lineBreakMode:lineBreakMode]; +} + +- (CGSize)drawAtPoint:(CGPoint)point withCGFont:(CGFontRef)font pointSize:(CGFloat)pointSize { + return [self drawAtPoint:point withZFont:[ZFont fontWithCGFont:font size:pointSize]]; +} + +- (CGSize)drawInRect:(CGRect)rect withCGFont:(CGFontRef)font pointSize:(CGFloat)pointSize { + return [self drawInRect:rect withZFont:[ZFont fontWithCGFont:font size:pointSize]]; +} + +- (CGSize)drawInRect:(CGRect)rect withCGFont:(CGFontRef)font pointSize:(CGFloat)pointSize lineBreakMode:(UILineBreakMode)lineBreakMode { + return [self drawInRect:rect withZFont:[ZFont fontWithCGFont:font size:pointSize] lineBreakMode:lineBreakMode]; +} + +- (CGSize)drawInRect:(CGRect)rect withCGFont:(CGFontRef)font pointSize:(CGFloat)pointSize + lineBreakMode:(UILineBreakMode)lineBreakMode alignment:(UITextAlignment)alignment { + return [self drawInRect:rect withZFont:[ZFont fontWithCGFont:font size:pointSize] lineBreakMode:lineBreakMode alignment:alignment]; +} + +// ZFont-based methods +- (CGSize)sizeWithZFont:(ZFont *)font { + CGSize size = drawOrSizeTextConstrainedToSize(NO, self, attributeRunForFont(font), CGSizeMake(CGFLOAT_MAX, CGFLOAT_MAX), 1, + UILineBreakModeClip, UITextAlignmentLeft, YES); + return CGSizeMake(ceilf(size.width), ceilf(size.height)); +} + +- (CGSize)sizeWithZFont:(ZFont *)font constrainedToSize:(CGSize)size { + return [self sizeWithZFont:font constrainedToSize:size lineBreakMode:UILineBreakModeWordWrap]; +} + +/* + According to experimentation with UIStringDrawing, this can actually return a CGSize whose height is greater + than the one passed in. The two cases are as follows: + 1. If the given size parameter's height is smaller than a single line, the returned value will + be the height of one line. + 2. If the given size parameter's height falls between multiples of a line height, and the wrapped string + actually extends past the size.height, and the difference between size.height and the previous multiple + of a line height is >= the font's ascender, then the returned size's height is extended to the next line. + To put it simply, if the baseline point of a given line falls in the given size, the entire line will + be present in the output size. + */ +- (CGSize)sizeWithZFont:(ZFont *)font constrainedToSize:(CGSize)size lineBreakMode:(UILineBreakMode)lineBreakMode { + size = drawOrSizeTextConstrainedToSize(NO, self, attributeRunForFont(font), size, 0, lineBreakMode, UITextAlignmentLeft, YES); + return CGSizeMake(ceilf(size.width), ceilf(size.height)); +} + +- (CGSize)sizeWithZFont:(ZFont *)font constrainedToSize:(CGSize)size lineBreakMode:(UILineBreakMode)lineBreakMode + numberOfLines:(NSUInteger)numberOfLines { + size = drawOrSizeTextConstrainedToSize(NO, self, attributeRunForFont(font), size, numberOfLines, lineBreakMode, UITextAlignmentLeft, YES); + return CGSizeMake(ceilf(size.width), ceilf(size.height)); +} + +- (CGSize)drawAtPoint:(CGPoint)point withZFont:(ZFont *)font { + return [self drawAtPoint:point forWidth:CGFLOAT_MAX withZFont:font lineBreakMode:UILineBreakModeClip]; +} + +- (CGSize)drawAtPoint:(CGPoint)point forWidth:(CGFloat)width withZFont:(ZFont *)font lineBreakMode:(UILineBreakMode)lineBreakMode { + return drawTextInRect((CGRect){ point, { width, CGFLOAT_MAX } }, self, attributeRunForFont(font), lineBreakMode, UITextAlignmentLeft, 1, YES); +} + +- (CGSize)drawInRect:(CGRect)rect withZFont:(ZFont *)font { + return [self drawInRect:rect withZFont:font lineBreakMode:UILineBreakModeWordWrap]; +} + +- (CGSize)drawInRect:(CGRect)rect withZFont:(ZFont *)font lineBreakMode:(UILineBreakMode)lineBreakMode { + return [self drawInRect:rect withZFont:font lineBreakMode:lineBreakMode alignment:UITextAlignmentLeft]; +} + +- (CGSize)drawInRect:(CGRect)rect withZFont:(ZFont *)font lineBreakMode:(UILineBreakMode)lineBreakMode + alignment:(UITextAlignment)alignment { + return drawTextInRect(rect, self, attributeRunForFont(font), lineBreakMode, alignment, 0, YES); +} + +- (CGSize)drawInRect:(CGRect)rect withZFont:(ZFont *)font lineBreakMode:(UILineBreakMode)lineBreakMode + alignment:(UITextAlignment)alignment numberOfLines:(NSUInteger)numberOfLines { + return drawTextInRect(rect, self, attributeRunForFont(font), lineBreakMode, alignment, numberOfLines, YES); +} +@end + +@implementation ZAttributedString (ZAttributedStringDrawing) +- (CGSize)size { + CGSize size = drawOrSizeTextConstrainedToSize(NO, self.string, self.attributes, CGSizeMake(CGFLOAT_MAX, CGFLOAT_MAX), 1, + UILineBreakModeClip, UITextAlignmentLeft, NO); + return CGSizeMake(ceilf(size.width), ceilf(size.height)); +} + +- (CGSize)sizeConstrainedToSize:(CGSize)size { + return [self sizeConstrainedToSize:size lineBreakMode:UILineBreakModeWordWrap]; +} + +- (CGSize)sizeConstrainedToSize:(CGSize)size lineBreakMode:(UILineBreakMode)lineBreakMode { + size = drawOrSizeTextConstrainedToSize(NO, self.string, self.attributes, size, 0, lineBreakMode, UITextAlignmentLeft, NO); + return CGSizeMake(ceilf(size.width), ceilf(size.height)); +} + +- (CGSize)sizeConstrainedToSize:(CGSize)size lineBreakMode:(UILineBreakMode)lineBreakMode + numberOfLines:(NSUInteger)numberOfLines { + size = drawOrSizeTextConstrainedToSize(NO, self.string, self.attributes, size, numberOfLines, lineBreakMode, UITextAlignmentLeft, NO); + return CGSizeMake(ceilf(size.width), ceilf(size.height)); +} + +- (CGSize)drawAtPoint:(CGPoint)point { + return [self drawAtPoint:point forWidth:CGFLOAT_MAX lineBreakMode:UILineBreakModeClip]; +} + +- (CGSize)drawAtPoint:(CGPoint)point forWidth:(CGFloat)width lineBreakMode:(UILineBreakMode)lineBreakMode { + return drawTextInRect((CGRect){ point, { width, CGFLOAT_MAX } }, self.string, self.attributes, lineBreakMode, UITextAlignmentLeft, 1, NO); +} + +- (CGSize)drawInRect:(CGRect)rect { + return [self drawInRect:rect withLineBreakMode:UILineBreakModeWordWrap]; +} + +- (CGSize)drawInRect:(CGRect)rect withLineBreakMode:(UILineBreakMode)lineBreakMode { + return [self drawInRect:rect withLineBreakMode:lineBreakMode alignment:UITextAlignmentLeft]; +} + +- (CGSize)drawInRect:(CGRect)rect withLineBreakMode:(UILineBreakMode)lineBreakMode alignment:(UITextAlignment)alignment { + return drawTextInRect(rect, self.string, self.attributes, lineBreakMode, alignment, 0, NO); +} + +- (CGSize)drawInRect:(CGRect)rect withLineBreakMode:(UILineBreakMode)lineBreakMode alignment:(UITextAlignment)alignment + numberOfLines:(NSUInteger)numberOfLines { + return drawTextInRect(rect, self.string, self.attributes, lineBreakMode, alignment, numberOfLines, NO); +} +@end diff --git a/libs/FontLabel/FontManager.h b/libs/FontLabel/FontManager.h new file mode 100755 index 0000000..1592b8a --- /dev/null +++ b/libs/FontLabel/FontManager.h @@ -0,0 +1,85 @@ +// +// FontManager.h +// FontLabel +// +// Created by Kevin Ballard on 5/5/09. +// Copyright © 2009 Zynga Game Networks +// +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. +// + +#import +#import + +@class ZFont; + +@interface FontManager : NSObject { + CFMutableDictionaryRef fonts; + NSMutableDictionary *urls; +} ++ (FontManager *)sharedManager; +/*! + @method + @abstract Loads a TTF font from the main bundle + @param filename The name of the font file to load (with or without extension). + @return YES if the font was loaded, NO if an error occurred + @discussion If the font has already been loaded, this method does nothing and returns YES. + This method first attempts to load the font by appending .ttf to the filename. + If that file does not exist, it tries the filename exactly as given. +*/ +- (BOOL)loadFont:(NSString *)filename; +/*! + @method + @abstract Loads a font from the given file URL + @param url A file URL that points to a font file + @return YES if the font was loaded, NO if an error occurred + @discussion If the font has already been loaded, this method does nothing and returns YES. +*/ +- (BOOL)loadFontURL:(NSURL *)url; +/*! + @method + @abstract Returns the loaded font with the given filename + @param filename The name of the font file that was given to -loadFont: + @return A CGFontRef, or NULL if the specified font cannot be found + @discussion If the font has not been loaded yet, -loadFont: will be + called with the given name first. +*/ +- (CGFontRef)fontWithName:(NSString *)filename __AVAILABILITY_INTERNAL_DEPRECATED; +/*! + @method + @abstract Returns a ZFont object corresponding to the loaded font with the given filename and point size + @param filename The name of the font file that was given to -loadFont: + @param pointSize The point size of the font + @return A ZFont, or NULL if the specified font cannot be found + @discussion If the font has not been loaded yet, -loadFont: will be + called with the given name first. +*/ +- (ZFont *)zFontWithName:(NSString *)filename pointSize:(CGFloat)pointSize; +/*! + @method + @abstract Returns a ZFont object corresponding to the loaded font with the given file URL and point size + @param url A file URL that points to a font file + @param pointSize The point size of the font + @return A ZFont, or NULL if the specified font cannot be loaded + @discussion If the font has not been loaded yet, -loadFontURL: will be called with the given URL first. +*/ +- (ZFont *)zFontWithURL:(NSURL *)url pointSize:(CGFloat)pointSize; +/*! + @method + @abstract Returns a CFArrayRef of all loaded CGFont objects + @return A CFArrayRef of all loaded CGFont objects + @description You are responsible for releasing the CFArrayRef +*/ +- (CFArrayRef)copyAllFonts; +@end diff --git a/libs/FontLabel/FontManager.m b/libs/FontLabel/FontManager.m new file mode 100755 index 0000000..12eac2d --- /dev/null +++ b/libs/FontLabel/FontManager.m @@ -0,0 +1,123 @@ +// +// FontManager.m +// FontLabel +// +// Created by Kevin Ballard on 5/5/09. +// Copyright © 2009 Zynga Game Networks +// +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. +// + +#import "FontManager.h" +#import "ZFont.h" + +static FontManager *sharedFontManager = nil; + +@implementation FontManager ++ (FontManager *)sharedManager { + @synchronized(self) { + if (sharedFontManager == nil) { + sharedFontManager = [[self alloc] init]; + } + } + return sharedFontManager; +} + +- (id)init { + if ((self = [super init])) { + fonts = CFDictionaryCreateMutable(NULL, 0, &kCFTypeDictionaryKeyCallBacks, &kCFTypeDictionaryValueCallBacks); + urls = [[NSMutableDictionary alloc] init]; + } + return self; +} + +- (BOOL)loadFont:(NSString *)filename { + NSString *fontPath = [[NSBundle mainBundle] pathForResource:filename ofType:@"ttf"]; + if (fontPath == nil) { + fontPath = [[NSBundle mainBundle] pathForResource:filename ofType:nil]; + } + if (fontPath == nil) return NO; + + NSURL *url = [NSURL fileURLWithPath:fontPath]; + if ([self loadFontURL:url]) { + [urls setObject:url forKey:filename]; + return YES; + } + return NO; +} + +- (BOOL)loadFontURL:(NSURL *)url { + CGDataProviderRef fontDataProvider = CGDataProviderCreateWithURL((CFURLRef)url); + if (fontDataProvider == NULL) return NO; + CGFontRef newFont = CGFontCreateWithDataProvider(fontDataProvider); + CGDataProviderRelease(fontDataProvider); + if (newFont == NULL) return NO; + + CFDictionarySetValue(fonts, url, newFont); + CGFontRelease(newFont); + return YES; +} + +- (CGFontRef)fontWithName:(NSString *)filename { + CGFontRef font = NULL; + NSURL *url = [urls objectForKey:filename]; + if (url == nil && [self loadFont:filename]) { + url = [urls objectForKey:filename]; + } + if (url != nil) { + font = (CGFontRef)CFDictionaryGetValue(fonts, url); + } + return font; +} + +- (ZFont *)zFontWithName:(NSString *)filename pointSize:(CGFloat)pointSize { + NSURL *url = [urls objectForKey:filename]; + if (url == nil && [self loadFont:filename]) { + url = [urls objectForKey:filename]; + } + if (url != nil) { + CGFontRef cgFont = (CGFontRef)CFDictionaryGetValue(fonts, url); + if (cgFont != NULL) { + return [ZFont fontWithCGFont:cgFont size:pointSize]; + } + } + return nil; +} + +- (ZFont *)zFontWithURL:(NSURL *)url pointSize:(CGFloat)pointSize { + CGFontRef cgFont = (CGFontRef)CFDictionaryGetValue(fonts, url); + if (cgFont == NULL && [self loadFontURL:url]) { + cgFont = (CGFontRef)CFDictionaryGetValue(fonts, url); + } + if (cgFont != NULL) { + return [ZFont fontWithCGFont:cgFont size:pointSize]; + } + return nil; +} + +- (CFArrayRef)copyAllFonts { + CFIndex count = CFDictionaryGetCount(fonts); + CGFontRef *values = (CGFontRef *)malloc(sizeof(CGFontRef) * count); + CFDictionaryGetKeysAndValues(fonts, NULL, (const void **)values); + CFArrayRef array = CFArrayCreate(NULL, (const void **)values, count, &kCFTypeArrayCallBacks); + free(values); + return array; +} + +- (void)dealloc { + CFRelease(fonts); + [urls release]; + [super dealloc]; +} +@end diff --git a/libs/FontLabel/ZAttributedString.h b/libs/FontLabel/ZAttributedString.h new file mode 100755 index 0000000..e194c81 --- /dev/null +++ b/libs/FontLabel/ZAttributedString.h @@ -0,0 +1,77 @@ +// +// ZAttributedString.h +// FontLabel +// +// Created by Kevin Ballard on 9/22/09. +// Copyright 2009 Zynga Game Networks. All rights reserved. +// + +#import + +#if NS_BLOCKS_AVAILABLE +#define Z_BLOCKS 1 +#else +// set this to 1 if you are using PLBlocks +#define Z_BLOCKS 0 +#endif + +#if Z_BLOCKS +enum { + ZAttributedStringEnumerationReverse = (1UL << 1), + ZAttributedStringEnumerationLongestEffectiveRangeNotRequired = (1UL << 20) +}; +typedef NSUInteger ZAttributedStringEnumerationOptions; +#endif + +@interface ZAttributedString : NSObject { + NSMutableString *_buffer; + NSMutableArray *_attributes; +} +@property (nonatomic, readonly) NSUInteger length; +@property (nonatomic, readonly) NSString *string; +- (id)initWithAttributedString:(ZAttributedString *)attr; +- (id)initWithString:(NSString *)str; +- (id)initWithString:(NSString *)str attributes:(NSDictionary *)attributes; +- (id)attribute:(NSString *)attributeName atIndex:(NSUInteger)index effectiveRange:(NSRangePointer)aRange; +- (id)attribute:(NSString *)attributeName atIndex:(NSUInteger)index longestEffectiveRange:(NSRangePointer)aRange inRange:(NSRange)rangeLimit; +- (ZAttributedString *)attributedSubstringFromRange:(NSRange)aRange; +- (NSDictionary *)attributesAtIndex:(NSUInteger)index effectiveRange:(NSRangePointer)aRange; +- (NSDictionary *)attributesAtIndex:(NSUInteger)index longestEffectiveRange:(NSRangePointer)aRange inRange:(NSRange)rangeLimit; +#if Z_BLOCKS +- (void)enumerateAttribute:(NSString *)attrName inRange:(NSRange)enumerationRange options:(ZAttributedStringEnumerationOptions)opts + usingBlock:(void (^)(id value, NSRange range, BOOL *stop))block; +- (void)enumerateAttributesInRange:(NSRange)enumerationRange options:(ZAttributedStringEnumerationOptions)opts + usingBlock:(void (^)(NSDictionary *attrs, NSRange range, BOOL *stop))block; +#endif +- (BOOL)isEqualToAttributedString:(ZAttributedString *)otherString; +@end + +@interface ZMutableAttributedString : ZAttributedString { +} +- (void)addAttribute:(NSString *)name value:(id)value range:(NSRange)range; +- (void)addAttributes:(NSDictionary *)attributes range:(NSRange)range; +- (void)appendAttributedString:(ZAttributedString *)str; +- (void)deleteCharactersInRange:(NSRange)range; +- (void)insertAttributedString:(ZAttributedString *)str atIndex:(NSUInteger)idx; +- (void)removeAttribute:(NSString *)name range:(NSRange)range; +- (void)replaceCharactersInRange:(NSRange)range withAttributedString:(ZAttributedString *)str; +- (void)replaceCharactersInRange:(NSRange)range withString:(NSString *)str; +- (void)setAttributedString:(ZAttributedString *)str; +- (void)setAttributes:(NSDictionary *)attributes range:(NSRange)range; +@end + +extern NSString * const ZFontAttributeName; +extern NSString * const ZForegroundColorAttributeName; +extern NSString * const ZBackgroundColorAttributeName; +extern NSString * const ZUnderlineStyleAttributeName; + +enum { + ZUnderlineStyleNone = 0x00, + ZUnderlineStyleSingle = 0x01 +}; +#define ZUnderlineStyleMask 0x00FF + +enum { + ZUnderlinePatternSolid = 0x0000 +}; +#define ZUnderlinePatternMask 0xFF00 diff --git a/libs/FontLabel/ZAttributedString.m b/libs/FontLabel/ZAttributedString.m new file mode 100755 index 0000000..a4163bc --- /dev/null +++ b/libs/FontLabel/ZAttributedString.m @@ -0,0 +1,597 @@ +// +// ZAttributedString.m +// FontLabel +// +// Created by Kevin Ballard on 9/22/09. +// Copyright 2009 Zynga Game Networks. All rights reserved. +// + +#import "ZAttributedString.h" +#import "ZAttributedStringPrivate.h" + +@interface ZAttributedString () +- (NSUInteger)indexOfEffectiveAttributeRunForIndex:(NSUInteger)index; +- (NSDictionary *)attributesAtIndex:(NSUInteger)index effectiveRange:(NSRangePointer)aRange uniquingOnName:(NSString *)attributeName; +- (NSDictionary *)attributesAtIndex:(NSUInteger)index longestEffectiveRange:(NSRangePointer)aRange + inRange:(NSRange)rangeLimit uniquingOnName:(NSString *)attributeName; +@end + +@interface ZAttributedString () +@property (nonatomic, readonly) NSArray *attributes; +@end + +@implementation ZAttributedString +@synthesize string = _buffer; +@synthesize attributes = _attributes; + +- (id)initWithAttributedString:(ZAttributedString *)attr { + NSParameterAssert(attr != nil); + if ((self = [super init])) { + _buffer = [attr->_buffer mutableCopy]; + _attributes = [[NSMutableArray alloc] initWithArray:attr->_attributes copyItems:YES]; + } + return self; +} + +- (id)initWithString:(NSString *)str { + return [self initWithString:str attributes:nil]; +} + +- (id)initWithString:(NSString *)str attributes:(NSDictionary *)attributes { + if ((self = [super init])) { + _buffer = [str mutableCopy]; + _attributes = [[NSMutableArray alloc] initWithObjects:[ZAttributeRun attributeRunWithIndex:0 attributes:attributes], nil]; + } + return self; +} + +- (id)init { + return [self initWithString:@"" attributes:nil]; +} + +- (id)initWithCoder:(NSCoder *)decoder { + if ((self = [super init])) { + _buffer = [[decoder decodeObjectForKey:@"buffer"] mutableCopy]; + _attributes = [[decoder decodeObjectForKey:@"attributes"] mutableCopy]; + } + return self; +} + +- (void)encodeWithCoder:(NSCoder *)aCoder { + [aCoder encodeObject:_buffer forKey:@"buffer"]; + [aCoder encodeObject:_attributes forKey:@"attributes"]; +} + +- (id)copyWithZone:(NSZone *)zone { + return [self retain]; +} + +- (id)mutableCopyWithZone:(NSZone *)zone { + return [(ZMutableAttributedString *)[ZMutableAttributedString allocWithZone:zone] initWithAttributedString:self]; +} + +- (NSUInteger)length { + return [_buffer length]; +} + +- (NSString *)description { + NSMutableArray *components = [NSMutableArray arrayWithCapacity:[_attributes count]*2]; + NSRange range = NSMakeRange(0, 0); + for (NSUInteger i = 0; i <= [_attributes count]; i++) { + range.location = NSMaxRange(range); + ZAttributeRun *run; + if (i < [_attributes count]) { + run = [_attributes objectAtIndex:i]; + range.length = run.index - range.location; + } else { + run = nil; + range.length = [_buffer length] - range.location; + } + if (range.length > 0) { + [components addObject:[NSString stringWithFormat:@"\"%@\"", [_buffer substringWithRange:range]]]; + } + if (run != nil) { + NSMutableArray *attrDesc = [NSMutableArray arrayWithCapacity:[run.attributes count]]; + for (id key in run.attributes) { + [attrDesc addObject:[NSString stringWithFormat:@"%@: %@", key, [run.attributes objectForKey:key]]]; + } + [components addObject:[NSString stringWithFormat:@"{%@}", [attrDesc componentsJoinedByString:@", "]]]; + } + } + return [NSString stringWithFormat:@"%@", [components componentsJoinedByString:@" "]]; +} + +- (id)attribute:(NSString *)attributeName atIndex:(NSUInteger)index effectiveRange:(NSRangePointer)aRange { + NSParameterAssert(attributeName != nil); + return [[self attributesAtIndex:index effectiveRange:aRange uniquingOnName:attributeName] objectForKey:attributeName]; +} + +- (id)attribute:(NSString *)attributeName atIndex:(NSUInteger)index longestEffectiveRange:(NSRangePointer)aRange inRange:(NSRange)rangeLimit { + NSParameterAssert(attributeName != nil); + return [[self attributesAtIndex:index longestEffectiveRange:aRange inRange:rangeLimit uniquingOnName:attributeName] objectForKey:attributeName]; +} + +- (ZAttributedString *)attributedSubstringFromRange:(NSRange)aRange { + if (NSMaxRange(aRange) > [_buffer length]) { + @throw [NSException exceptionWithName:NSRangeException reason:@"range was outisde of the attributed string" userInfo:nil]; + } + ZMutableAttributedString *newStr = [self mutableCopy]; + if (aRange.location > 0) { + [newStr deleteCharactersInRange:NSMakeRange(0, aRange.location)]; + } + if (NSMaxRange(aRange) < [_buffer length]) { + [newStr deleteCharactersInRange:NSMakeRange(aRange.length, [_buffer length] - NSMaxRange(aRange))]; + } + return [newStr autorelease]; +} + +- (NSDictionary *)attributesAtIndex:(NSUInteger)index effectiveRange:(NSRangePointer)aRange { + return [NSDictionary dictionaryWithDictionary:[self attributesAtIndex:index effectiveRange:aRange uniquingOnName:nil]]; +} + +- (NSDictionary *)attributesAtIndex:(NSUInteger)index longestEffectiveRange:(NSRangePointer)aRange inRange:(NSRange)rangeLimit { + return [NSDictionary dictionaryWithDictionary:[self attributesAtIndex:index longestEffectiveRange:aRange inRange:rangeLimit uniquingOnName:nil]]; +} + +#if Z_BLOCKS +// Warning: this code has not been tested. The only guarantee is that it compiles. +- (void)enumerateAttribute:(NSString *)attrName inRange:(NSRange)enumerationRange options:(ZAttributedStringEnumerationOptions)opts + usingBlock:(void (^)(id, NSRange, BOOL*))block { + if (opts & ZAttributedStringEnumerationLongestEffectiveRangeNotRequired) { + [self enumerateAttributesInRange:enumerationRange options:opts usingBlock:^(NSDictionary *attrs, NSRange range, BOOL *stop) { + id value = [attrs objectForKey:attrName]; + if (value != nil) { + block(value, range, stop); + } + }]; + } else { + __block id oldValue = nil; + __block NSRange effectiveRange = NSMakeRange(0, 0); + [self enumerateAttributesInRange:enumerationRange options:opts usingBlock:^(NSDictionary *attrs, NSRange range, BOOL *stop) { + id value = [attrs objectForKey:attrName]; + if (oldValue == nil) { + oldValue = value; + effectiveRange = range; + } else if (value != nil && [oldValue isEqual:value]) { + // combine the attributes + effectiveRange = NSUnionRange(effectiveRange, range); + } else { + BOOL innerStop = NO; + block(oldValue, effectiveRange, &innerStop); + if (innerStop) { + *stop = YES; + oldValue = nil; + } else { + oldValue = value; + } + } + }]; + if (oldValue != nil) { + BOOL innerStop = NO; // necessary for the block, but unused + block(oldValue, effectiveRange, &innerStop); + } + } +} + +- (void)enumerateAttributesInRange:(NSRange)enumerationRange options:(ZAttributedStringEnumerationOptions)opts + usingBlock:(void (^)(NSDictionary*, NSRange, BOOL*))block { + // copy the attributes so we can mutate the string if necessary during enumeration + // also clip the array during copy to only the subarray of attributes that cover the requested range + NSArray *attrs; + if (NSEqualRanges(enumerationRange, NSMakeRange(0, 0))) { + attrs = [NSArray arrayWithArray:_attributes]; + } else { + // in this binary search, last is the first run after the range + NSUInteger first = 0, last = [_attributes count]; + while (last > first+1) { + NSUInteger pivot = (last + first) / 2; + ZAttributeRun *run = [_attributes objectAtIndex:pivot]; + if (run.index < enumerationRange.location) { + first = pivot; + } else if (run.index >= NSMaxRange(enumerationRange)) { + last = pivot; + } + } + attrs = [_attributes subarrayWithRange:NSMakeRange(first, last-first)]; + } + if (opts & ZAttributedStringEnumerationReverse) { + NSUInteger end = [_buffer length]; + for (ZAttributeRun *run in [attrs reverseObjectEnumerator]) { + BOOL stop = NO; + NSUInteger start = run.index; + // clip to enumerationRange + start = MAX(start, enumerationRange.location); + end = MIN(end, NSMaxRange(enumerationRange)); + block(run.attributes, NSMakeRange(start, end - start), &stop); + if (stop) break; + end = run.index; + } + } else { + NSUInteger start = 0; + ZAttributeRun *run = [attrs objectAtIndex:0]; + NSInteger offset = 0; + NSInteger oldLength = [_buffer length]; + for (NSUInteger i = 1;;i++) { + NSUInteger end; + if (i >= [attrs count]) { + end = oldLength; + } else { + end = [[attrs objectAtIndex:i] index]; + } + BOOL stop = NO; + NSUInteger clippedStart = MAX(start, enumerationRange.location); + NSUInteger clippedEnd = MIN(end, NSMaxRange(enumerationRange)); + block(run.attributes, NSMakeRange(clippedStart + offset, clippedEnd - start), &stop); + if (stop || i >= [attrs count]) break; + start = end; + NSUInteger newLength = [_buffer length]; + offset += (newLength - oldLength); + oldLength = newLength; + } + } +} +#endif + +- (BOOL)isEqualToAttributedString:(ZAttributedString *)otherString { + return ([_buffer isEqualToString:otherString->_buffer] && [_attributes isEqualToArray:otherString->_attributes]); +} + +- (BOOL)isEqual:(id)object { + return [object isKindOfClass:[ZAttributedString class]] && [self isEqualToAttributedString:(ZAttributedString *)object]; +} + +#pragma mark - + +- (NSUInteger)indexOfEffectiveAttributeRunForIndex:(NSUInteger)index { + NSUInteger first = 0, last = [_attributes count]; + while (last > first + 1) { + NSUInteger pivot = (last + first) / 2; + ZAttributeRun *run = [_attributes objectAtIndex:pivot]; + if (run.index > index) { + last = pivot; + } else if (run.index < index) { + first = pivot; + } else { + first = pivot; + break; + } + } + return first; +} + +- (NSDictionary *)attributesAtIndex:(NSUInteger)index effectiveRange:(NSRangePointer)aRange uniquingOnName:(NSString *)attributeName { + if (index >= [_buffer length]) { + @throw [NSException exceptionWithName:NSRangeException reason:@"index beyond range of attributed string" userInfo:nil]; + } + NSUInteger runIndex = [self indexOfEffectiveAttributeRunForIndex:index]; + ZAttributeRun *run = [_attributes objectAtIndex:runIndex]; + if (aRange != NULL) { + aRange->location = run.index; + runIndex++; + if (runIndex < [_attributes count]) { + aRange->length = [[_attributes objectAtIndex:runIndex] index] - aRange->location; + } else { + aRange->length = [_buffer length] - aRange->location; + } + } + return run.attributes; +} +- (NSDictionary *)attributesAtIndex:(NSUInteger)index longestEffectiveRange:(NSRangePointer)aRange + inRange:(NSRange)rangeLimit uniquingOnName:(NSString *)attributeName { + if (index >= [_buffer length]) { + @throw [NSException exceptionWithName:NSRangeException reason:@"index beyond range of attributed string" userInfo:nil]; + } else if (NSMaxRange(rangeLimit) > [_buffer length]) { + @throw [NSException exceptionWithName:NSRangeException reason:@"rangeLimit beyond range of attributed string" userInfo:nil]; + } + NSUInteger runIndex = [self indexOfEffectiveAttributeRunForIndex:index]; + ZAttributeRun *run = [_attributes objectAtIndex:runIndex]; + if (aRange != NULL) { + if (attributeName != nil) { + id value = [run.attributes objectForKey:attributeName]; + NSUInteger endRunIndex = runIndex+1; + runIndex--; + // search backwards + while (1) { + if (run.index <= rangeLimit.location) { + break; + } + ZAttributeRun *prevRun = [_attributes objectAtIndex:runIndex]; + id prevValue = [prevRun.attributes objectForKey:attributeName]; + if (prevValue == value || (value != nil && [prevValue isEqual:value])) { + runIndex--; + run = prevRun; + } else { + break; + } + } + // search forwards + ZAttributeRun *endRun = nil; + while (endRunIndex < [_attributes count]) { + ZAttributeRun *nextRun = [_attributes objectAtIndex:endRunIndex]; + if (nextRun.index >= NSMaxRange(rangeLimit)) { + endRun = nextRun; + break; + } + id nextValue = [nextRun.attributes objectForKey:attributeName]; + if (nextValue == value || (value != nil && [nextValue isEqual:value])) { + endRunIndex++; + } else { + endRun = nextRun; + break; + } + } + aRange->location = MAX(run.index, rangeLimit.location); + aRange->length = MIN((endRun ? endRun.index : [_buffer length]), NSMaxRange(rangeLimit)) - aRange->location; + } else { + // with no attribute name, we don't need to do any real searching, + // as we already guarantee each run has unique attributes. + // just make sure to clip the range to the rangeLimit + aRange->location = MAX(run.index, rangeLimit.location); + ZAttributeRun *endRun = (runIndex+1 < [_attributes count] ? [_attributes objectAtIndex:runIndex+1] : nil); + aRange->length = MIN((endRun ? endRun.index : [_buffer length]), NSMaxRange(rangeLimit)) - aRange->location; + } + } + return run.attributes; +} + +- (void)dealloc { + [_buffer release]; + [_attributes release]; + [super dealloc]; +} +@end + +@interface ZMutableAttributedString () +- (void)cleanupAttributesInRange:(NSRange)range; +- (NSRange)rangeOfAttributeRunsForRange:(NSRange)range; +- (void)offsetRunsInRange:(NSRange )range byOffset:(NSInteger)offset; +@end + +@implementation ZMutableAttributedString +- (id)copyWithZone:(NSZone *)zone { + return [(ZAttributedString *)[ZAttributedString allocWithZone:zone] initWithAttributedString:self]; +} + +- (void)addAttribute:(NSString *)name value:(id)value range:(NSRange)range { + range = [self rangeOfAttributeRunsForRange:range]; + for (ZAttributeRun *run in [_attributes subarrayWithRange:range]) { + [run.attributes setObject:value forKey:name]; + } + [self cleanupAttributesInRange:range]; +} + +- (void)addAttributes:(NSDictionary *)attributes range:(NSRange)range { + range = [self rangeOfAttributeRunsForRange:range]; + for (ZAttributeRun *run in [_attributes subarrayWithRange:range]) { + [run.attributes addEntriesFromDictionary:attributes]; + } + [self cleanupAttributesInRange:range]; +} + +- (void)appendAttributedString:(ZAttributedString *)str { + [self insertAttributedString:str atIndex:[_buffer length]]; +} + +- (void)deleteCharactersInRange:(NSRange)range { + NSRange runRange = [self rangeOfAttributeRunsForRange:range]; + [_buffer replaceCharactersInRange:range withString:@""]; + [_attributes removeObjectsInRange:runRange]; + for (NSUInteger i = runRange.location; i < [_attributes count]; i++) { + ZAttributeRun *run = [_attributes objectAtIndex:i]; + ZAttributeRun *newRun = [[ZAttributeRun alloc] initWithIndex:(run.index - range.length) attributes:run.attributes]; + [_attributes replaceObjectAtIndex:i withObject:newRun]; + [newRun release]; + } + [self cleanupAttributesInRange:NSMakeRange(runRange.location, 0)]; +} + +- (void)insertAttributedString:(ZAttributedString *)str atIndex:(NSUInteger)idx { + [self replaceCharactersInRange:NSMakeRange(idx, 0) withAttributedString:str]; +} + +- (void)removeAttribute:(NSString *)name range:(NSRange)range { + range = [self rangeOfAttributeRunsForRange:range]; + for (ZAttributeRun *run in [_attributes subarrayWithRange:range]) { + [run.attributes removeObjectForKey:name]; + } + [self cleanupAttributesInRange:range]; +} + +- (void)replaceCharactersInRange:(NSRange)range withAttributedString:(ZAttributedString *)str { + NSRange replaceRange = [self rangeOfAttributeRunsForRange:range]; + NSInteger offset = [str->_buffer length] - range.length; + [_buffer replaceCharactersInRange:range withString:str->_buffer]; + [_attributes replaceObjectsInRange:replaceRange withObjectsFromArray:str->_attributes]; + NSRange newRange = NSMakeRange(replaceRange.location, [str->_attributes count]); + [self offsetRunsInRange:newRange byOffset:range.location]; + [self offsetRunsInRange:NSMakeRange(NSMaxRange(newRange), [_attributes count] - NSMaxRange(newRange)) byOffset:offset]; + [self cleanupAttributesInRange:NSMakeRange(newRange.location, 0)]; + [self cleanupAttributesInRange:NSMakeRange(NSMaxRange(newRange), 0)]; +} + +- (void)replaceCharactersInRange:(NSRange)range withString:(NSString *)str { + [self replaceCharactersInRange:range withAttributedString:[[[ZAttributedString alloc] initWithString:str] autorelease]]; +} + +- (void)setAttributedString:(ZAttributedString *)str { + [_buffer release], _buffer = [str->_buffer mutableCopy]; + [_attributes release], _attributes = [str->_attributes mutableCopy]; +} + +- (void)setAttributes:(NSDictionary *)attributes range:(NSRange)range { + range = [self rangeOfAttributeRunsForRange:range]; + for (ZAttributeRun *run in [_attributes subarrayWithRange:range]) { + [run.attributes setDictionary:attributes]; + } + [self cleanupAttributesInRange:range]; +} + +#pragma mark - + +// splits the existing runs to provide one or more new runs for the given range +- (NSRange)rangeOfAttributeRunsForRange:(NSRange)range { + NSParameterAssert(NSMaxRange(range) <= [_buffer length]); + + // find (or create) the first run + NSUInteger first = 0; + ZAttributeRun *lastRun = nil; + for (;;first++) { + if (first >= [_attributes count]) { + // we didn't find a run + first = [_attributes count]; + ZAttributeRun *newRun = [[ZAttributeRun alloc] initWithIndex:range.location attributes:lastRun.attributes]; + [_attributes addObject:newRun]; + [newRun release]; + break; + } + ZAttributeRun *run = [_attributes objectAtIndex:first]; + if (run.index == range.location) { + break; + } else if (run.index > range.location) { + ZAttributeRun *newRun = [[ZAttributeRun alloc] initWithIndex:range.location attributes:lastRun.attributes]; + [_attributes insertObject:newRun atIndex:first]; + [newRun release]; + break; + } + lastRun = run; + } + + if (((ZAttributeRun *)[_attributes lastObject]).index < NSMaxRange(range)) { + NSRange subrange = NSMakeRange(first, [_attributes count] - first); + if (NSMaxRange(range) < [_buffer length]) { + ZAttributeRun *newRun = [[ZAttributeRun alloc] initWithIndex:NSMaxRange(range) + attributes:(NSDictionary*)[(ZAttributeRun *)[_attributes lastObject] attributes]]; + [_attributes addObject:newRun]; + [newRun release]; + } + return subrange; + } else { + // find the last run within and the first run after the range + NSUInteger lastIn = first, firstAfter = [_attributes count]-1; + while (firstAfter > lastIn + 1) { + NSUInteger idx = (firstAfter + lastIn) / 2; + ZAttributeRun *run = [_attributes objectAtIndex:idx]; + if (run.index < range.location) { + lastIn = idx; + } else if (run.index > range.location) { + firstAfter = idx; + } else { + // this is definitively the first run after the range + firstAfter = idx; + break; + } + } + if ([[_attributes objectAtIndex:firstAfter] index] > NSMaxRange(range)) { + // the first after is too far after, insert another run! + ZAttributeRun *newRun = [[ZAttributeRun alloc] initWithIndex:NSMaxRange(range) + attributes:[(ZAttributeRun *)[_attributes objectAtIndex:firstAfter-1] attributes]]; + [_attributes insertObject:newRun atIndex:firstAfter]; + [newRun release]; + } + return NSMakeRange(lastIn, firstAfter - lastIn); + } +} + +- (void)cleanupAttributesInRange:(NSRange)range { + // expand the range to include one surrounding attribute on each side + if (range.location > 0) { + range.location -= 1; + range.length += 1; + } + if (NSMaxRange(range) < [_attributes count]) { + range.length += 1; + } else { + // make sure the range is capped to the attributes count + range.length = [_attributes count] - range.location; + } + if (range.length == 0) return; + ZAttributeRun *lastRun = [_attributes objectAtIndex:range.location]; + for (NSUInteger i = range.location+1; i < NSMaxRange(range);) { + ZAttributeRun *run = [_attributes objectAtIndex:i]; + if ([lastRun.attributes isEqualToDictionary:run.attributes]) { + [_attributes removeObjectAtIndex:i]; + range.length -= 1; + } else { + lastRun = run; + i++; + } + } +} + +- (void)offsetRunsInRange:(NSRange)range byOffset:(NSInteger)offset { + for (NSUInteger i = range.location; i < NSMaxRange(range); i++) { + ZAttributeRun *run = [_attributes objectAtIndex:i]; + ZAttributeRun *newRun = [[ZAttributeRun alloc] initWithIndex:run.index + offset attributes:run.attributes]; + [_attributes replaceObjectAtIndex:i withObject:newRun]; + [newRun release]; + } +} +@end + +@implementation ZAttributeRun +@synthesize index = _index; +@synthesize attributes = _attributes; + ++ (id)attributeRunWithIndex:(NSUInteger)idx attributes:(NSDictionary *)attrs { + return [[[self alloc] initWithIndex:idx attributes:attrs] autorelease]; +} + +- (id)initWithIndex:(NSUInteger)idx attributes:(NSDictionary *)attrs { + NSParameterAssert(idx >= 0); + if ((self = [super init])) { + _index = idx; + if (attrs == nil) { + _attributes = [[NSMutableDictionary alloc] init]; + } else { + _attributes = [attrs mutableCopy]; + } + } + return self; +} + +- (id)initWithCoder:(NSCoder *)decoder { + if ((self = [super init])) { + _index = [[decoder decodeObjectForKey:@"index"] unsignedIntegerValue]; + _attributes = [[decoder decodeObjectForKey:@"attributes"] mutableCopy]; + } + return self; +} + +- (id)init { + return [self initWithIndex:0 attributes:[NSDictionary dictionary]]; +} + +- (id)copyWithZone:(NSZone *)zone { + return [[ZAttributeRun allocWithZone:zone] initWithIndex:_index attributes:_attributes]; +} + +- (void)encodeWithCoder:(NSCoder *)aCoder { + [aCoder encodeObject:[NSNumber numberWithUnsignedInteger:_index] forKey:@"index"]; + [aCoder encodeObject:_attributes forKey:@"attributes"]; +} + +- (NSString *)description { + NSMutableArray *components = [NSMutableArray arrayWithCapacity:[_attributes count]]; + for (id key in _attributes) { + [components addObject:[NSString stringWithFormat:@"%@=%@", key, [_attributes objectForKey:key]]]; + } + return [NSString stringWithFormat:@"<%@: %p index=%lu attributes={%@}>", + NSStringFromClass([self class]), self, (unsigned long)_index, [components componentsJoinedByString:@" "]]; +} + +- (BOOL)isEqual:(id)object { + if (![object isKindOfClass:[ZAttributeRun class]]) return NO; + ZAttributeRun *other = (ZAttributeRun *)object; + return _index == other->_index && [_attributes isEqualToDictionary:other->_attributes]; +} + +- (void)dealloc { + [_attributes release]; + [super dealloc]; +} +@end + +NSString * const ZFontAttributeName = @"ZFontAttributeName"; +NSString * const ZForegroundColorAttributeName = @"ZForegroundColorAttributeName"; +NSString * const ZBackgroundColorAttributeName = @"ZBackgroundColorAttributeName"; +NSString * const ZUnderlineStyleAttributeName = @"ZUnderlineStyleAttributeName"; diff --git a/libs/FontLabel/ZAttributedStringPrivate.h b/libs/FontLabel/ZAttributedStringPrivate.h new file mode 100755 index 0000000..1021d7b --- /dev/null +++ b/libs/FontLabel/ZAttributedStringPrivate.h @@ -0,0 +1,24 @@ +// +// ZAttributedStringPrivate.h +// FontLabel +// +// Created by Kevin Ballard on 9/23/09. +// Copyright 2009 Zynga Game Networks. All rights reserved. +// + +#import +#import "ZAttributedString.h" + +@interface ZAttributeRun : NSObject { + NSUInteger _index; + NSMutableDictionary *_attributes; +} +@property (nonatomic, readonly) NSUInteger index; +@property (nonatomic, readonly) NSMutableDictionary *attributes; ++ (id)attributeRunWithIndex:(NSUInteger)idx attributes:(NSDictionary *)attrs; +- (id)initWithIndex:(NSUInteger)idx attributes:(NSDictionary *)attrs; +@end + +@interface ZAttributedString (ZAttributedStringPrivate) +@property (nonatomic, readonly) NSArray *attributes; +@end diff --git a/libs/FontLabel/ZFont.h b/libs/FontLabel/ZFont.h new file mode 100755 index 0000000..05ae823 --- /dev/null +++ b/libs/FontLabel/ZFont.h @@ -0,0 +1,47 @@ +// +// ZFont.h +// FontLabel +// +// Created by Kevin Ballard on 7/2/09. +// Copyright © 2009 Zynga Game Networks +// +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. +// + +#import +#import + +@interface ZFont : NSObject { + CGFontRef _cgFont; + CGFloat _pointSize; + CGFloat _ratio; + NSString *_familyName; + NSString *_fontName; + NSString *_postScriptName; +} +@property (nonatomic, readonly) CGFontRef cgFont; +@property (nonatomic, readonly) CGFloat pointSize; +@property (nonatomic, readonly) CGFloat ascender; +@property (nonatomic, readonly) CGFloat descender; +@property (nonatomic, readonly) CGFloat leading; +@property (nonatomic, readonly) CGFloat xHeight; +@property (nonatomic, readonly) CGFloat capHeight; +@property (nonatomic, readonly) NSString *familyName; +@property (nonatomic, readonly) NSString *fontName; +@property (nonatomic, readonly) NSString *postScriptName; ++ (ZFont *)fontWithCGFont:(CGFontRef)cgFont size:(CGFloat)fontSize; ++ (ZFont *)fontWithUIFont:(UIFont *)uiFont; +- (id)initWithCGFont:(CGFontRef)cgFont size:(CGFloat)fontSize; +- (ZFont *)fontWithSize:(CGFloat)fontSize; +@end diff --git a/libs/FontLabel/ZFont.m b/libs/FontLabel/ZFont.m new file mode 100755 index 0000000..793b13a --- /dev/null +++ b/libs/FontLabel/ZFont.m @@ -0,0 +1,170 @@ +// +// ZFont.m +// FontLabel +// +// Created by Kevin Ballard on 7/2/09. +// Copyright © 2009 Zynga Game Networks +// +// +// Licensed under the Apache License, Version 2.0 (the "License"); +// you may not use this file except in compliance with the License. +// You may obtain a copy of the License at +// +// http://www.apache.org/licenses/LICENSE-2.0 +// +// Unless required by applicable law or agreed to in writing, software +// distributed under the License is distributed on an "AS IS" BASIS, +// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +// See the License for the specific language governing permissions and +// limitations under the License. +// + +#import "ZFont.h" + +@interface ZFont () +@property (nonatomic, readonly) CGFloat ratio; +- (NSString *)copyNameTableEntryForID:(UInt16)nameID; +@end + +@implementation ZFont +@synthesize cgFont=_cgFont, pointSize=_pointSize, ratio=_ratio; + ++ (ZFont *)fontWithCGFont:(CGFontRef)cgFont size:(CGFloat)fontSize { + return [[[self alloc] initWithCGFont:cgFont size:fontSize] autorelease]; +} + ++ (ZFont *)fontWithUIFont:(UIFont *)uiFont { + NSParameterAssert(uiFont != nil); + CGFontRef cgFont = CGFontCreateWithFontName((CFStringRef)uiFont.fontName); + ZFont *zFont = [[self alloc] initWithCGFont:cgFont size:uiFont.pointSize]; + CGFontRelease(cgFont); + return [zFont autorelease]; +} + +- (id)initWithCGFont:(CGFontRef)cgFont size:(CGFloat)fontSize { + if ((self = [super init])) { + _cgFont = CGFontRetain(cgFont); + _pointSize = fontSize; + _ratio = fontSize/CGFontGetUnitsPerEm(cgFont); + } + return self; +} + +- (id)init { + NSAssert(NO, @"-init is not valid for ZFont"); + return nil; +} + +- (CGFloat)ascender { + return ceilf(self.ratio * CGFontGetAscent(self.cgFont)); +} + +- (CGFloat)descender { + return floorf(self.ratio * CGFontGetDescent(self.cgFont)); +} + +- (CGFloat)leading { + return (self.ascender - self.descender); +} + +- (CGFloat)capHeight { + return ceilf(self.ratio * CGFontGetCapHeight(self.cgFont)); +} + +- (CGFloat)xHeight { + return ceilf(self.ratio * CGFontGetXHeight(self.cgFont)); +} + +- (NSString *)familyName { + if (_familyName == nil) { + _familyName = [self copyNameTableEntryForID:1]; + } + return _familyName; +} + +- (NSString *)fontName { + if (_fontName == nil) { + _fontName = [self copyNameTableEntryForID:4]; + } + return _fontName; +} + +- (NSString *)postScriptName { + if (_postScriptName == nil) { + _postScriptName = [self copyNameTableEntryForID:6]; + } + return _postScriptName; +} + +- (ZFont *)fontWithSize:(CGFloat)fontSize { + if (fontSize == self.pointSize) return self; + NSParameterAssert(fontSize > 0.0); + return [[[ZFont alloc] initWithCGFont:self.cgFont size:fontSize] autorelease]; +} + +- (BOOL)isEqual:(id)object { + if (![object isKindOfClass:[ZFont class]]) return NO; + ZFont *font = (ZFont *)object; + return (font.cgFont == self.cgFont && font.pointSize == self.pointSize); +} + +- (NSString *)copyNameTableEntryForID:(UInt16)aNameID { + CFDataRef nameTable = CGFontCopyTableForTag(self.cgFont, 'name'); + NSAssert1(nameTable != NULL, @"CGFontCopyTableForTag returned NULL for 'name' tag in font %@", + [(id)CFCopyDescription(self.cgFont) autorelease]); + const UInt8 * const bytes = CFDataGetBytePtr(nameTable); + NSAssert1(OSReadBigInt16(bytes, 0) == 0, @"name table for font %@ has bad version number", + [(id)CFCopyDescription(self.cgFont) autorelease]); + const UInt16 count = OSReadBigInt16(bytes, 2); + const UInt16 stringOffset = OSReadBigInt16(bytes, 4); + const UInt8 * const nameRecords = &bytes[6]; + UInt16 nameLength = 0; + UInt16 nameOffset = 0; + NSStringEncoding encoding = 0; + for (UInt16 idx = 0; idx < count; idx++) { + const uintptr_t recordOffset = 12 * idx; + const UInt16 nameID = OSReadBigInt16(nameRecords, recordOffset + 6); + if (nameID != aNameID) continue; + const UInt16 platformID = OSReadBigInt16(nameRecords, recordOffset + 0); + const UInt16 platformSpecificID = OSReadBigInt16(nameRecords, recordOffset + 2); + encoding = 0; + // for now, we only support a subset of encodings + switch (platformID) { + case 0: // Unicode + encoding = NSUTF16StringEncoding; + break; + case 1: // Macintosh + switch (platformSpecificID) { + case 0: + encoding = NSMacOSRomanStringEncoding; + break; + } + case 3: // Microsoft + switch (platformSpecificID) { + case 1: + encoding = NSUTF16StringEncoding; + break; + } + } + if (encoding == 0) continue; + nameLength = OSReadBigInt16(nameRecords, recordOffset + 8); + nameOffset = OSReadBigInt16(nameRecords, recordOffset + 10); + break; + } + NSString *result = nil; + if (nameOffset > 0) { + const UInt8 *nameBytes = &bytes[stringOffset + nameOffset]; + result = [[NSString alloc] initWithBytes:nameBytes length:nameLength encoding:encoding]; + } + CFRelease(nameTable); + return result; +} + +- (void)dealloc { + CGFontRelease(_cgFont); + [_familyName release]; + [_fontName release]; + [_postScriptName release]; + [super dealloc]; +} +@end diff --git a/libs/README b/libs/README new file mode 100755 index 0000000..0d4d8fc --- /dev/null +++ b/libs/README @@ -0,0 +1 @@ +This directory contains the libraries used in cocos2d diff --git a/libs/TouchJSON/CDataScanner.h b/libs/TouchJSON/CDataScanner.h new file mode 100755 index 0000000..41f68e8 --- /dev/null +++ b/libs/TouchJSON/CDataScanner.h @@ -0,0 +1,71 @@ +// +// CDataScanner.h +// TouchCode +// +// Created by Jonathan Wight on 04/16/08. +// Copyright 2008 toxicsoftware.com. All rights reserved. +// +// Permission is hereby granted, free of charge, to any person +// obtaining a copy of this software and associated documentation +// files (the "Software"), to deal in the Software without +// restriction, including without limitation the rights to use, +// copy, modify, merge, publish, distribute, sublicense, and/or sell +// copies of the Software, and to permit persons to whom the +// Software is furnished to do so, subject to the following +// conditions: +// +// The above copyright notice and this permission notice shall be +// included in all copies or substantial portions of the Software. +// +// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +// EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES +// OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND +// NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT +// HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, +// WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING +// FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +// OTHER DEALINGS IN THE SOFTWARE. +// + +#import + +// NSScanner + +@interface CDataScanner : NSObject { + NSData *data; + + u_int8_t *start; + u_int8_t *end; + u_int8_t *current; + NSUInteger length; +} + +@property (readwrite, nonatomic, retain) NSData *data; +@property (readwrite, nonatomic, assign) NSUInteger scanLocation; +@property (readonly, nonatomic, assign) NSUInteger bytesRemaining; +@property (readonly, nonatomic, assign) BOOL isAtEnd; + +- (id)initWithData:(NSData *)inData; + +- (unichar)currentCharacter; +- (unichar)scanCharacter; +- (BOOL)scanCharacter:(unichar)inCharacter; + +- (BOOL)scanUTF8String:(const char *)inString intoString:(NSString **)outValue; +- (BOOL)scanString:(NSString *)inString intoString:(NSString **)outValue; +- (BOOL)scanCharactersFromSet:(NSCharacterSet *)inSet intoString:(NSString **)outValue; // inSet must only contain 7-bit ASCII characters + +- (BOOL)scanUpToString:(NSString *)string intoString:(NSString **)outValue; +- (BOOL)scanUpToCharactersFromSet:(NSCharacterSet *)set intoString:(NSString **)outValue; // inSet must only contain 7-bit ASCII characters + +- (BOOL)scanNumber:(NSNumber **)outValue; +- (BOOL)scanDecimalNumber:(NSDecimalNumber **)outValue; + +- (BOOL)scanDataOfLength:(NSUInteger)inLength intoData:(NSData **)outData; + +- (void)skipWhitespace; + +- (NSString *)remainingString; +- (NSData *)remainingData; + +@end diff --git a/libs/TouchJSON/CDataScanner.m b/libs/TouchJSON/CDataScanner.m new file mode 100755 index 0000000..b3cee6f --- /dev/null +++ b/libs/TouchJSON/CDataScanner.m @@ -0,0 +1,340 @@ +// +// CDataScanner.m +// TouchCode +// +// Created by Jonathan Wight on 04/16/08. +// Copyright 2008 toxicsoftware.com. All rights reserved. +// +// Permission is hereby granted, free of charge, to any person +// obtaining a copy of this software and associated documentation +// files (the "Software"), to deal in the Software without +// restriction, including without limitation the rights to use, +// copy, modify, merge, publish, distribute, sublicense, and/or sell +// copies of the Software, and to permit persons to whom the +// Software is furnished to do so, subject to the following +// conditions: +// +// The above copyright notice and this permission notice shall be +// included in all copies or substantial portions of the Software. +// +// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +// EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES +// OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND +// NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT +// HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, +// WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING +// FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +// OTHER DEALINGS IN THE SOFTWARE. +// + +#import "CDataScanner.h" + +#import "CDataScanner_Extensions.h" + +@interface CDataScanner () +@end + +#pragma mark - + +inline static unichar CharacterAtPointer(void *start, void *end) + { + #pragma unused(end) + + const u_int8_t theByte = *(u_int8_t *)start; + if (theByte & 0x80) + { + // TODO -- UNICODE!!!! (well in theory nothing todo here) + } + const unichar theCharacter = theByte; + return(theCharacter); + } + + static NSCharacterSet *sDoubleCharacters = NULL; + + @implementation CDataScanner + +- (id)init + { + if ((self = [super init]) != NULL) + { + } + return(self); + } + +- (id)initWithData:(NSData *)inData; + { + if ((self = [self init]) != NULL) + { + [self setData:inData]; + } + return(self); + } + + + (void)initialize + { + if (sDoubleCharacters == NULL) + { + sDoubleCharacters = [[NSCharacterSet characterSetWithCharactersInString:@"0123456789eE-+."] retain]; + } + } + +- (void)dealloc + { + [data release]; + data = NULL; + // + [super dealloc]; + } + +- (NSUInteger)scanLocation + { + return(current - start); + } + +- (NSUInteger)bytesRemaining + { + return(end - current); + } + +- (NSData *)data + { + return(data); + } + +- (void)setData:(NSData *)inData + { + if (data != inData) + { + [data release]; + data = [inData retain]; + } + + if (data) + { + start = (u_int8_t *)data.bytes; + end = start + data.length; + current = start; + length = data.length; + } + else + { + start = NULL; + end = NULL; + current = NULL; + length = 0; + } + } + +- (void)setScanLocation:(NSUInteger)inScanLocation + { + current = start + inScanLocation; + } + +- (BOOL)isAtEnd + { + return(self.scanLocation >= length); + } + +- (unichar)currentCharacter + { + return(CharacterAtPointer(current, end)); + } + +#pragma mark - + +- (unichar)scanCharacter + { + const unichar theCharacter = CharacterAtPointer(current++, end); + return(theCharacter); + } + +- (BOOL)scanCharacter:(unichar)inCharacter + { + unichar theCharacter = CharacterAtPointer(current, end); + if (theCharacter == inCharacter) + { + ++current; + return(YES); + } + else + return(NO); + } + +- (BOOL)scanUTF8String:(const char *)inString intoString:(NSString **)outValue + { + const size_t theLength = strlen(inString); + if ((size_t)(end - current) < theLength) + return(NO); + if (strncmp((char *)current, inString, theLength) == 0) + { + current += theLength; + if (outValue) + *outValue = [NSString stringWithUTF8String:inString]; + return(YES); + } + return(NO); + } + +- (BOOL)scanString:(NSString *)inString intoString:(NSString **)outValue + { + if ((size_t)(end - current) < inString.length) + return(NO); + if (strncmp((char *)current, [inString UTF8String], inString.length) == 0) + { + current += inString.length; + if (outValue) + *outValue = inString; + return(YES); + } + return(NO); + } + +- (BOOL)scanCharactersFromSet:(NSCharacterSet *)inSet intoString:(NSString **)outValue + { + u_int8_t *P; + for (P = current; P < end && [inSet characterIsMember:*P] == YES; ++P) + ; + + if (P == current) + { + return(NO); + } + + if (outValue) + { + *outValue = [[[NSString alloc] initWithBytes:current length:P - current encoding:NSUTF8StringEncoding] autorelease]; + } + + current = P; + + return(YES); + } + +- (BOOL)scanUpToString:(NSString *)inString intoString:(NSString **)outValue + { + const char *theToken = [inString UTF8String]; + const char *theResult = strnstr((char *)current, theToken, end - current); + if (theResult == NULL) + { + return(NO); + } + + if (outValue) + { + *outValue = [[[NSString alloc] initWithBytes:current length:theResult - (char *)current encoding:NSUTF8StringEncoding] autorelease]; + } + + current = (u_int8_t *)theResult; + + return(YES); + } + +- (BOOL)scanUpToCharactersFromSet:(NSCharacterSet *)inSet intoString:(NSString **)outValue + { + u_int8_t *P; + for (P = current; P < end && [inSet characterIsMember:*P] == NO; ++P) + ; + + if (P == current) + { + return(NO); + } + + if (outValue) + { + *outValue = [[[NSString alloc] initWithBytes:current length:P - current encoding:NSUTF8StringEncoding] autorelease]; + } + + current = P; + + return(YES); + } + +- (BOOL)scanNumber:(NSNumber **)outValue + { + NSString *theString = NULL; + if ([self scanCharactersFromSet:sDoubleCharacters intoString:&theString]) + { + if ([theString rangeOfString:@"."].location != NSNotFound) + { + if (outValue) + { + *outValue = [NSDecimalNumber decimalNumberWithString:theString]; + } + return(YES); + } + else if ([theString rangeOfString:@"-"].location != NSNotFound) + { + if (outValue != NULL) + { + *outValue = [NSNumber numberWithLongLong:[theString longLongValue]]; + } + return(YES); + } + else + { + if (outValue != NULL) + { + *outValue = [NSNumber numberWithUnsignedLongLong:strtoull([theString UTF8String], NULL, 0)]; + } + return(YES); + } + + } + return(NO); + } + +- (BOOL)scanDecimalNumber:(NSDecimalNumber **)outValue; + { + NSString *theString = NULL; + if ([self scanCharactersFromSet:sDoubleCharacters intoString:&theString]) + { + if (outValue) + { + *outValue = [NSDecimalNumber decimalNumberWithString:theString]; + } + return(YES); + } + return(NO); + } + +- (BOOL)scanDataOfLength:(NSUInteger)inLength intoData:(NSData **)outData; + { + if (self.bytesRemaining < inLength) + { + return(NO); + } + + if (outData) + { + *outData = [NSData dataWithBytes:current length:inLength]; + } + + current += inLength; + return(YES); + } + + +- (void)skipWhitespace + { + u_int8_t *P; + for (P = current; P < end && (isspace(*P)); ++P) + ; + + current = P; + } + +- (NSString *)remainingString + { + NSData *theRemainingData = [NSData dataWithBytes:current length:end - current]; + NSString *theString = [[[NSString alloc] initWithData:theRemainingData encoding:NSUTF8StringEncoding] autorelease]; + return(theString); + } + +- (NSData *)remainingData; + { + NSData *theRemainingData = [NSData dataWithBytes:current length:end - current]; + return(theRemainingData); + } + + @end diff --git a/libs/TouchJSON/Extensions/CDataScanner_Extensions.h b/libs/TouchJSON/Extensions/CDataScanner_Extensions.h new file mode 100755 index 0000000..cde1dbb --- /dev/null +++ b/libs/TouchJSON/Extensions/CDataScanner_Extensions.h @@ -0,0 +1,40 @@ +// +// CDataScanner_Extensions.h +// TouchCode +// +// Created by Jonathan Wight on 12/08/2005. +// Copyright 2005 toxicsoftware.com. All rights reserved. +// +// Permission is hereby granted, free of charge, to any person +// obtaining a copy of this software and associated documentation +// files (the "Software"), to deal in the Software without +// restriction, including without limitation the rights to use, +// copy, modify, merge, publish, distribute, sublicense, and/or sell +// copies of the Software, and to permit persons to whom the +// Software is furnished to do so, subject to the following +// conditions: +// +// The above copyright notice and this permission notice shall be +// included in all copies or substantial portions of the Software. +// +// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +// EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES +// OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND +// NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT +// HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, +// WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING +// FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +// OTHER DEALINGS IN THE SOFTWARE. +// + +#import "CDataScanner.h" + +@interface CDataScanner (CDataScanner_Extensions) + +- (BOOL)scanCStyleComment:(NSString **)outComment; +- (BOOL)scanCPlusPlusStyleComment:(NSString **)outComment; + +- (NSUInteger)lineOfScanLocation; +- (NSDictionary *)userInfoForScanLocation; + +@end diff --git a/libs/TouchJSON/Extensions/CDataScanner_Extensions.m b/libs/TouchJSON/Extensions/CDataScanner_Extensions.m new file mode 100755 index 0000000..90dbbda --- /dev/null +++ b/libs/TouchJSON/Extensions/CDataScanner_Extensions.m @@ -0,0 +1,135 @@ +// +// CDataScanner_Extensions.m +// TouchCode +// +// Created by Jonathan Wight on 12/08/2005. +// Copyright 2005 toxicsoftware.com. All rights reserved. +// +// Permission is hereby granted, free of charge, to any person +// obtaining a copy of this software and associated documentation +// files (the "Software"), to deal in the Software without +// restriction, including without limitation the rights to use, +// copy, modify, merge, publish, distribute, sublicense, and/or sell +// copies of the Software, and to permit persons to whom the +// Software is furnished to do so, subject to the following +// conditions: +// +// The above copyright notice and this permission notice shall be +// included in all copies or substantial portions of the Software. +// +// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +// EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES +// OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND +// NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT +// HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, +// WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING +// FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +// OTHER DEALINGS IN THE SOFTWARE. +// + +#import "CDataScanner_Extensions.h" + +#define LF 0x000a // Line Feed +#define FF 0x000c // Form Feed +#define CR 0x000d // Carriage Return +#define NEL 0x0085 // Next Line +#define LS 0x2028 // Line Separator +#define PS 0x2029 // Paragraph Separator + +@implementation CDataScanner (CDataScanner_Extensions) + +- (BOOL)scanCStyleComment:(NSString **)outComment +{ +if ([self scanString:@"/*" intoString:NULL] == YES) + { + NSString *theComment = NULL; + if ([self scanUpToString:@"*/" intoString:&theComment] == NO) + [NSException raise:NSGenericException format:@"Started to scan a C style comment but it wasn't terminated."]; + + if ([theComment rangeOfString:@"/*"].location != NSNotFound) + [NSException raise:NSGenericException format:@"C style comments should not be nested."]; + + if ([self scanString:@"*/" intoString:NULL] == NO) + [NSException raise:NSGenericException format:@"C style comment did not end correctly."]; + + if (outComment != NULL) + *outComment = theComment; + + return(YES); + } +else + { + return(NO); + } +} + +- (BOOL)scanCPlusPlusStyleComment:(NSString **)outComment + { + if ([self scanString:@"//" intoString:NULL] == YES) + { + unichar theCharacters[] = { LF, FF, CR, NEL, LS, PS, }; + NSCharacterSet *theLineBreaksCharacterSet = [NSCharacterSet characterSetWithCharactersInString:[NSString stringWithCharacters:theCharacters length:sizeof(theCharacters) / sizeof(*theCharacters)]]; + + NSString *theComment = NULL; + [self scanUpToCharactersFromSet:theLineBreaksCharacterSet intoString:&theComment]; + [self scanCharactersFromSet:theLineBreaksCharacterSet intoString:NULL]; + + if (outComment != NULL) + *outComment = theComment; + + return(YES); + } + else + { + return(NO); + } + } + +- (NSUInteger)lineOfScanLocation + { + NSUInteger theLine = 0; + for (const u_int8_t *C = start; C < current; ++C) + { + // TODO: JIW What about MS-DOS line endings you bastard! (Also other unicode line endings) + if (*C == '\n' || *C == '\r') + { + ++theLine; + } + } + return(theLine); + } + +- (NSDictionary *)userInfoForScanLocation + { + NSUInteger theLine = 0; + const u_int8_t *theLineStart = start; + for (const u_int8_t *C = start; C < current; ++C) + { + if (*C == '\n' || *C == '\r') + { + theLineStart = C - 1; + ++theLine; + } + } + + NSUInteger theCharacter = current - theLineStart; + + NSRange theStartRange = NSIntersectionRange((NSRange){ .location = MAX((NSInteger)self.scanLocation - 20, 0), .length = 20 + (NSInteger)self.scanLocation - 20 }, (NSRange){ .location = 0, .length = self.data.length }); + NSRange theEndRange = NSIntersectionRange((NSRange){ .location = self.scanLocation, .length = 20 }, (NSRange){ .location = 0, .length = self.data.length }); + + + NSString *theSnippet = [NSString stringWithFormat:@"%@!HERE>!%@", + [[[NSString alloc] initWithData:[self.data subdataWithRange:theStartRange] encoding:NSUTF8StringEncoding] autorelease], + [[[NSString alloc] initWithData:[self.data subdataWithRange:theEndRange] encoding:NSUTF8StringEncoding] autorelease] + ]; + + NSDictionary *theUserInfo = [NSDictionary dictionaryWithObjectsAndKeys: + [NSNumber numberWithUnsignedInteger:theLine], @"line", + [NSNumber numberWithUnsignedInteger:theCharacter], @"character", + [NSNumber numberWithUnsignedInteger:self.scanLocation], @"location", + theSnippet, @"snippet", + NULL]; + return(theUserInfo); + } + +@end diff --git a/libs/TouchJSON/Extensions/NSDictionary_JSONExtensions.h b/libs/TouchJSON/Extensions/NSDictionary_JSONExtensions.h new file mode 100755 index 0000000..6e611d0 --- /dev/null +++ b/libs/TouchJSON/Extensions/NSDictionary_JSONExtensions.h @@ -0,0 +1,37 @@ +// +// NSDictionary_JSONExtensions.h +// TouchCode +// +// Created by Jonathan Wight on 04/17/08. +// Copyright 2008 toxicsoftware.com. All rights reserved. +// +// Permission is hereby granted, free of charge, to any person +// obtaining a copy of this software and associated documentation +// files (the "Software"), to deal in the Software without +// restriction, including without limitation the rights to use, +// copy, modify, merge, publish, distribute, sublicense, and/or sell +// copies of the Software, and to permit persons to whom the +// Software is furnished to do so, subject to the following +// conditions: +// +// The above copyright notice and this permission notice shall be +// included in all copies or substantial portions of the Software. +// +// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +// EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES +// OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND +// NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT +// HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, +// WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING +// FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +// OTHER DEALINGS IN THE SOFTWARE. +// + +#import + +@interface NSDictionary (NSDictionary_JSONExtensions) + ++ (id)dictionaryWithJSONData:(NSData *)inData error:(NSError **)outError; ++ (id)dictionaryWithJSONString:(NSString *)inJSON error:(NSError **)outError; + +@end diff --git a/libs/TouchJSON/Extensions/NSDictionary_JSONExtensions.m b/libs/TouchJSON/Extensions/NSDictionary_JSONExtensions.m new file mode 100755 index 0000000..c0bb43c --- /dev/null +++ b/libs/TouchJSON/Extensions/NSDictionary_JSONExtensions.m @@ -0,0 +1,47 @@ +// +// NSDictionary_JSONExtensions.m +// TouchCode +// +// Created by Jonathan Wight on 04/17/08. +// Copyright 2008 toxicsoftware.com. All rights reserved. +// +// Permission is hereby granted, free of charge, to any person +// obtaining a copy of this software and associated documentation +// files (the "Software"), to deal in the Software without +// restriction, including without limitation the rights to use, +// copy, modify, merge, publish, distribute, sublicense, and/or sell +// copies of the Software, and to permit persons to whom the +// Software is furnished to do so, subject to the following +// conditions: +// +// The above copyright notice and this permission notice shall be +// included in all copies or substantial portions of the Software. +// +// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +// EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES +// OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND +// NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT +// HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, +// WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING +// FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +// OTHER DEALINGS IN THE SOFTWARE. +// + +#import "NSDictionary_JSONExtensions.h" + +#import "CJSONDeserializer.h" + +@implementation NSDictionary (NSDictionary_JSONExtensions) + ++ (id)dictionaryWithJSONData:(NSData *)inData error:(NSError **)outError + { + return([[CJSONDeserializer deserializer] deserialize:inData error:outError]); + } + ++ (id)dictionaryWithJSONString:(NSString *)inJSON error:(NSError **)outError; + { + NSData *theData = [inJSON dataUsingEncoding:NSUTF8StringEncoding]; + return([self dictionaryWithJSONData:theData error:outError]); + } + +@end diff --git a/libs/TouchJSON/JSON/CJSONDeserializer.h b/libs/TouchJSON/JSON/CJSONDeserializer.h new file mode 100755 index 0000000..0c3ed02 --- /dev/null +++ b/libs/TouchJSON/JSON/CJSONDeserializer.h @@ -0,0 +1,63 @@ +// +// CJSONDeserializer.h +// TouchCode +// +// Created by Jonathan Wight on 12/15/2005. +// Copyright 2005 toxicsoftware.com. All rights reserved. +// +// Permission is hereby granted, free of charge, to any person +// obtaining a copy of this software and associated documentation +// files (the "Software"), to deal in the Software without +// restriction, including without limitation the rights to use, +// copy, modify, merge, publish, distribute, sublicense, and/or sell +// copies of the Software, and to permit persons to whom the +// Software is furnished to do so, subject to the following +// conditions: +// +// The above copyright notice and this permission notice shall be +// included in all copies or substantial portions of the Software. +// +// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +// EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES +// OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND +// NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT +// HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, +// WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING +// FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +// OTHER DEALINGS IN THE SOFTWARE. +// + +#import + +#import "CJSONScanner.h" + +extern NSString *const kJSONDeserializerErrorDomain /* = @"CJSONDeserializerErrorDomain" */; + +enum { + kJSONDeserializationOptions_MutableContainers = kJSONScannerOptions_MutableContainers, + kJSONDeserializationOptions_MutableLeaves = kJSONScannerOptions_MutableLeaves, +}; +typedef NSUInteger EJSONDeserializationOptions; + +@class CJSONScanner; + +@interface CJSONDeserializer : NSObject { + CJSONScanner *scanner; + EJSONDeserializationOptions options; +} + +@property (readwrite, nonatomic, retain) CJSONScanner *scanner; +/// Object to return instead when a null encountered in the JSON. Defaults to NSNull. Setting to null causes the scanner to skip null values. +@property (readwrite, nonatomic, retain) id nullObject; +/// JSON must be encoded in Unicode (UTF-8, UTF-16 or UTF-32). Use this if you expect to get the JSON in another encoding. +@property (readwrite, nonatomic, assign) NSStringEncoding allowedEncoding; +@property (readwrite, nonatomic, assign) EJSONDeserializationOptions options; + ++ (id)deserializer; + +- (id)deserialize:(NSData *)inData error:(NSError **)outError; + +- (id)deserializeAsDictionary:(NSData *)inData error:(NSError **)outError; +- (id)deserializeAsArray:(NSData *)inData error:(NSError **)outError; + +@end diff --git a/libs/TouchJSON/JSON/CJSONDeserializer.m b/libs/TouchJSON/JSON/CJSONDeserializer.m new file mode 100755 index 0000000..27a2d03 --- /dev/null +++ b/libs/TouchJSON/JSON/CJSONDeserializer.m @@ -0,0 +1,161 @@ +// +// CJSONDeserializer.m +// TouchCode +// +// Created by Jonathan Wight on 12/15/2005. +// Copyright 2005 toxicsoftware.com. All rights reserved. +// +// Permission is hereby granted, free of charge, to any person +// obtaining a copy of this software and associated documentation +// files (the "Software"), to deal in the Software without +// restriction, including without limitation the rights to use, +// copy, modify, merge, publish, distribute, sublicense, and/or sell +// copies of the Software, and to permit persons to whom the +// Software is furnished to do so, subject to the following +// conditions: +// +// The above copyright notice and this permission notice shall be +// included in all copies or substantial portions of the Software. +// +// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +// EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES +// OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND +// NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT +// HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, +// WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING +// FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +// OTHER DEALINGS IN THE SOFTWARE. +// + +#import "CJSONDeserializer.h" + +#import "CJSONScanner.h" +#import "CDataScanner.h" + +NSString *const kJSONDeserializerErrorDomain = @"CJSONDeserializerErrorDomain"; + +@interface CJSONDeserializer () +@end + +@implementation CJSONDeserializer + +@synthesize scanner; +@synthesize options; + ++ (id)deserializer + { + return([[[self alloc] init] autorelease]); + } + +- (id)init + { + if ((self = [super init]) != NULL) + { + } + return(self); + } + +- (void)dealloc + { + [scanner release]; + scanner = NULL; + // + [super dealloc]; + } + +#pragma mark - + +- (CJSONScanner *)scanner + { + if (scanner == NULL) + { + scanner = [[CJSONScanner alloc] init]; + } + return(scanner); + } + +- (id)nullObject + { + return(self.scanner.nullObject); + } + +- (void)setNullObject:(id)inNullObject + { + self.scanner.nullObject = inNullObject; + } + +#pragma mark - + +- (NSStringEncoding)allowedEncoding + { + return(self.scanner.allowedEncoding); + } + +- (void)setAllowedEncoding:(NSStringEncoding)inAllowedEncoding + { + self.scanner.allowedEncoding = inAllowedEncoding; + } + +#pragma mark - + +- (id)deserialize:(NSData *)inData error:(NSError **)outError + { + if (inData == NULL || [inData length] == 0) + { + if (outError) + *outError = [NSError errorWithDomain:kJSONDeserializerErrorDomain code:kJSONScannerErrorCode_NothingToScan userInfo:NULL]; + + return(NULL); + } + if ([self.scanner setData:inData error:outError] == NO) + { + return(NULL); + } + id theObject = NULL; + if ([self.scanner scanJSONObject:&theObject error:outError] == YES) + return(theObject); + else + return(NULL); + } + +- (id)deserializeAsDictionary:(NSData *)inData error:(NSError **)outError + { + if (inData == NULL || [inData length] == 0) + { + if (outError) + *outError = [NSError errorWithDomain:kJSONDeserializerErrorDomain code:kJSONScannerErrorCode_NothingToScan userInfo:NULL]; + + return(NULL); + } + if ([self.scanner setData:inData error:outError] == NO) + { + return(NULL); + } + NSDictionary *theDictionary = NULL; + if ([self.scanner scanJSONDictionary:&theDictionary error:outError] == YES) + return(theDictionary); + else + return(NULL); + } + +- (id)deserializeAsArray:(NSData *)inData error:(NSError **)outError + { + if (inData == NULL || [inData length] == 0) + { + if (outError) + *outError = [NSError errorWithDomain:kJSONDeserializerErrorDomain code:kJSONScannerErrorCode_NothingToScan userInfo:NULL]; + + return(NULL); + } + if ([self.scanner setData:inData error:outError] == NO) + { + return(NULL); + } + NSArray *theArray = NULL; + if ([self.scanner scanJSONArray:&theArray error:outError] == YES) + return(theArray); + else + return(NULL); + } + +@end diff --git a/libs/TouchJSON/JSON/CJSONScanner.h b/libs/TouchJSON/JSON/CJSONScanner.h new file mode 100755 index 0000000..d410893 --- /dev/null +++ b/libs/TouchJSON/JSON/CJSONScanner.h @@ -0,0 +1,95 @@ +// +// CJSONScanner.h +// TouchCode +// +// Created by Jonathan Wight on 12/07/2005. +// Copyright 2005 toxicsoftware.com. All rights reserved. +// +// Permission is hereby granted, free of charge, to any person +// obtaining a copy of this software and associated documentation +// files (the "Software"), to deal in the Software without +// restriction, including without limitation the rights to use, +// copy, modify, merge, publish, distribute, sublicense, and/or sell +// copies of the Software, and to permit persons to whom the +// Software is furnished to do so, subject to the following +// conditions: +// +// The above copyright notice and this permission notice shall be +// included in all copies or substantial portions of the Software. +// +// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +// EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES +// OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND +// NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT +// HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, +// WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING +// FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +// OTHER DEALINGS IN THE SOFTWARE. +// + +#import "CDataScanner.h" + +enum { + kJSONScannerOptions_MutableContainers = 0x1, + kJSONScannerOptions_MutableLeaves = 0x2, +}; +typedef NSUInteger EJSONScannerOptions; + +/// CDataScanner subclass that understands JSON syntax natively. You should generally use CJSONDeserializer instead of this class. (TODO - this could have been a category?) +@interface CJSONScanner : CDataScanner { + BOOL strictEscapeCodes; + id nullObject; + NSStringEncoding allowedEncoding; + EJSONScannerOptions options; +} + +@property (readwrite, nonatomic, assign) BOOL strictEscapeCodes; +@property (readwrite, nonatomic, retain) id nullObject; +@property (readwrite, nonatomic, assign) NSStringEncoding allowedEncoding; +@property (readwrite, nonatomic, assign) EJSONScannerOptions options; + +- (BOOL)setData:(NSData *)inData error:(NSError **)outError; + +- (BOOL)scanJSONObject:(id *)outObject error:(NSError **)outError; +- (BOOL)scanJSONDictionary:(NSDictionary **)outDictionary error:(NSError **)outError; +- (BOOL)scanJSONArray:(NSArray **)outArray error:(NSError **)outError; +- (BOOL)scanJSONStringConstant:(NSString **)outStringConstant error:(NSError **)outError; +- (BOOL)scanJSONNumberConstant:(NSNumber **)outNumberConstant error:(NSError **)outError; + +@end + +extern NSString *const kJSONScannerErrorDomain /* = @"kJSONScannerErrorDomain" */; + +typedef enum { + + // Fundamental scanning errors + kJSONScannerErrorCode_NothingToScan = -11, + kJSONScannerErrorCode_CouldNotDecodeData = -12, + kJSONScannerErrorCode_CouldNotSerializeData = -13, + kJSONScannerErrorCode_CouldNotSerializeObject = -14, + kJSONScannerErrorCode_CouldNotScanObject = -15, + + // Dictionary scanning + kJSONScannerErrorCode_DictionaryStartCharacterMissing = -101, + kJSONScannerErrorCode_DictionaryKeyScanFailed = -102, + kJSONScannerErrorCode_DictionaryKeyNotTerminated = -103, + kJSONScannerErrorCode_DictionaryValueScanFailed = -104, + kJSONScannerErrorCode_DictionaryKeyValuePairNoDelimiter = -105, + kJSONScannerErrorCode_DictionaryNotTerminated = -106, + + // Array scanning + kJSONScannerErrorCode_ArrayStartCharacterMissing = -201, + kJSONScannerErrorCode_ArrayValueScanFailed = -202, + kJSONScannerErrorCode_ArrayValueIsNull = -203, + kJSONScannerErrorCode_ArrayNotTerminated = -204, + + // String scanning + kJSONScannerErrorCode_StringNotStartedWithBackslash = -301, + kJSONScannerErrorCode_StringUnicodeNotDecoded = -302, + kJSONScannerErrorCode_StringUnknownEscapeCode = -303, + kJSONScannerErrorCode_StringNotTerminated = -304, + + // Number scanning + kJSONScannerErrorCode_NumberNotScannable = -401 + +} EJSONScannerErrorCode; diff --git a/libs/TouchJSON/JSON/CJSONScanner.m b/libs/TouchJSON/JSON/CJSONScanner.m new file mode 100755 index 0000000..c5ffeb4 --- /dev/null +++ b/libs/TouchJSON/JSON/CJSONScanner.m @@ -0,0 +1,676 @@ +// +// CJSONScanner.m +// TouchCode +// +// Created by Jonathan Wight on 12/07/2005. +// Copyright 2005 toxicsoftware.com. All rights reserved. +// +// Permission is hereby granted, free of charge, to any person +// obtaining a copy of this software and associated documentation +// files (the "Software"), to deal in the Software without +// restriction, including without limitation the rights to use, +// copy, modify, merge, publish, distribute, sublicense, and/or sell +// copies of the Software, and to permit persons to whom the +// Software is furnished to do so, subject to the following +// conditions: +// +// The above copyright notice and this permission notice shall be +// included in all copies or substantial portions of the Software. +// +// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +// EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES +// OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND +// NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT +// HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, +// WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING +// FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +// OTHER DEALINGS IN THE SOFTWARE. +// + +#import "CJSONScanner.h" + +#import "CDataScanner_Extensions.h" + +#if !defined(TREAT_COMMENTS_AS_WHITESPACE) +#define TREAT_COMMENTS_AS_WHITESPACE 0 +#endif // !defined(TREAT_COMMENTS_AS_WHITESPACE) + +NSString *const kJSONScannerErrorDomain = @"kJSONScannerErrorDomain"; + +inline static int HexToInt(char inCharacter) + { + int theValues[] = { 0x0 /* 48 '0' */, 0x1 /* 49 '1' */, 0x2 /* 50 '2' */, 0x3 /* 51 '3' */, 0x4 /* 52 '4' */, 0x5 /* 53 '5' */, 0x6 /* 54 '6' */, 0x7 /* 55 '7' */, 0x8 /* 56 '8' */, 0x9 /* 57 '9' */, -1 /* 58 ':' */, -1 /* 59 ';' */, -1 /* 60 '<' */, -1 /* 61 '=' */, -1 /* 62 '>' */, -1 /* 63 '?' */, -1 /* 64 '@' */, 0xa /* 65 'A' */, 0xb /* 66 'B' */, 0xc /* 67 'C' */, 0xd /* 68 'D' */, 0xe /* 69 'E' */, 0xf /* 70 'F' */, -1 /* 71 'G' */, -1 /* 72 'H' */, -1 /* 73 'I' */, -1 /* 74 'J' */, -1 /* 75 'K' */, -1 /* 76 'L' */, -1 /* 77 'M' */, -1 /* 78 'N' */, -1 /* 79 'O' */, -1 /* 80 'P' */, -1 /* 81 'Q' */, -1 /* 82 'R' */, -1 /* 83 'S' */, -1 /* 84 'T' */, -1 /* 85 'U' */, -1 /* 86 'V' */, -1 /* 87 'W' */, -1 /* 88 'X' */, -1 /* 89 'Y' */, -1 /* 90 'Z' */, -1 /* 91 '[' */, -1 /* 92 '\' */, -1 /* 93 ']' */, -1 /* 94 '^' */, -1 /* 95 '_' */, -1 /* 96 '`' */, 0xa /* 97 'a' */, 0xb /* 98 'b' */, 0xc /* 99 'c' */, 0xd /* 100 'd' */, 0xe /* 101 'e' */, 0xf /* 102 'f' */, }; + if (inCharacter >= '0' && inCharacter <= 'f') + return(theValues[inCharacter - '0']); + else + return(-1); + } + +@interface CJSONScanner () +- (BOOL)scanNotQuoteCharactersIntoString:(NSString **)outValue; +@end + +#pragma mark - + +@implementation CJSONScanner + +@synthesize strictEscapeCodes; +@synthesize nullObject; +@synthesize allowedEncoding; +@synthesize options; + +- (id)init + { + if ((self = [super init]) != NULL) + { + strictEscapeCodes = NO; + nullObject = [[NSNull null] retain]; + } + return(self); + } + +- (void)dealloc + { + [nullObject release]; + nullObject = NULL; + // + [super dealloc]; + } + +#pragma mark - + +- (BOOL)setData:(NSData *)inData error:(NSError **)outError; + { + NSData *theData = inData; + if (theData && theData.length >= 4) + { + // This code is lame, but it works. Because the first character of any JSON string will always be a (ascii) control character we can work out the Unicode encoding by the bit pattern. See section 3 of http://www.ietf.org/rfc/rfc4627.txt + const char *theChars = theData.bytes; + NSStringEncoding theEncoding = NSUTF8StringEncoding; + if (theChars[0] != 0 && theChars[1] == 0) + { + if (theChars[2] != 0 && theChars[3] == 0) + theEncoding = NSUTF16LittleEndianStringEncoding; + else if (theChars[2] == 0 && theChars[3] == 0) + theEncoding = NSUTF32LittleEndianStringEncoding; + } + else if (theChars[0] == 0 && theChars[2] == 0 && theChars[3] != 0) + { + if (theChars[1] == 0) + theEncoding = NSUTF32BigEndianStringEncoding; + else if (theChars[1] != 0) + theEncoding = NSUTF16BigEndianStringEncoding; + } + + NSString *theString = [[NSString alloc] initWithData:theData encoding:theEncoding]; + if (theString == NULL && self.allowedEncoding != 0) + { + theString = [[NSString alloc] initWithData:theData encoding:self.allowedEncoding]; + } + theData = [theString dataUsingEncoding:NSUTF8StringEncoding]; + [theString release]; + } + + if (theData) + { + [super setData:theData]; + return(YES); + } + else + { + if (outError) + { + NSMutableDictionary *theUserInfo = [NSMutableDictionary dictionaryWithObjectsAndKeys: + @"Could not scan data. Data wasn't encoded properly?", NSLocalizedDescriptionKey, + NULL]; + [theUserInfo addEntriesFromDictionary:self.userInfoForScanLocation]; + *outError = [NSError errorWithDomain:kJSONScannerErrorDomain code:kJSONScannerErrorCode_CouldNotDecodeData userInfo:theUserInfo]; + } + return(NO); + } + } + +- (void)setData:(NSData *)inData + { + [self setData:inData error:NULL]; + } + +#pragma mark - + +- (BOOL)scanJSONObject:(id *)outObject error:(NSError **)outError + { + BOOL theResult = YES; + + [self skipWhitespace]; + + id theObject = NULL; + + const unichar C = [self currentCharacter]; + switch (C) + { + case 't': + if ([self scanUTF8String:"true" intoString:NULL]) + { + theObject = [NSNumber numberWithBool:YES]; + } + break; + case 'f': + if ([self scanUTF8String:"false" intoString:NULL]) + { + theObject = [NSNumber numberWithBool:NO]; + } + break; + case 'n': + if ([self scanUTF8String:"null" intoString:NULL]) + { + theObject = self.nullObject; + } + break; + case '\"': + case '\'': + theResult = [self scanJSONStringConstant:&theObject error:outError]; + break; + case '0': + case '1': + case '2': + case '3': + case '4': + case '5': + case '6': + case '7': + case '8': + case '9': + case '-': + theResult = [self scanJSONNumberConstant:&theObject error:outError]; + break; + case '{': + theResult = [self scanJSONDictionary:&theObject error:outError]; + break; + case '[': + theResult = [self scanJSONArray:&theObject error:outError]; + break; + default: + theResult = NO; + if (outError) + { + NSMutableDictionary *theUserInfo = [NSMutableDictionary dictionaryWithObjectsAndKeys: + @"Could not scan object. Character not a valid JSON character.", NSLocalizedDescriptionKey, + NULL]; + [theUserInfo addEntriesFromDictionary:self.userInfoForScanLocation]; + *outError = [NSError errorWithDomain:kJSONScannerErrorDomain code:kJSONScannerErrorCode_CouldNotScanObject userInfo:theUserInfo]; + } + break; + } + + if (outObject != NULL) + *outObject = theObject; + + return(theResult); + } + +- (BOOL)scanJSONDictionary:(NSDictionary **)outDictionary error:(NSError **)outError + { + NSUInteger theScanLocation = [self scanLocation]; + + [self skipWhitespace]; + + if ([self scanCharacter:'{'] == NO) + { + if (outError) + { + NSMutableDictionary *theUserInfo = [NSMutableDictionary dictionaryWithObjectsAndKeys: + @"Could not scan dictionary. Dictionary that does not start with '{' character.", NSLocalizedDescriptionKey, + NULL]; + [theUserInfo addEntriesFromDictionary:self.userInfoForScanLocation]; + *outError = [NSError errorWithDomain:kJSONScannerErrorDomain code:kJSONScannerErrorCode_DictionaryStartCharacterMissing userInfo:theUserInfo]; + } + return(NO); + } + + NSMutableDictionary *theDictionary = [[NSMutableDictionary alloc] init]; + + while ([self currentCharacter] != '}') + { + [self skipWhitespace]; + + if ([self currentCharacter] == '}') + break; + + NSString *theKey = NULL; + if ([self scanJSONStringConstant:&theKey error:outError] == NO) + { + [self setScanLocation:theScanLocation]; + if (outError) + { + NSMutableDictionary *theUserInfo = [NSMutableDictionary dictionaryWithObjectsAndKeys: + @"Could not scan dictionary. Failed to scan a key.", NSLocalizedDescriptionKey, + NULL]; + [theUserInfo addEntriesFromDictionary:self.userInfoForScanLocation]; + *outError = [NSError errorWithDomain:kJSONScannerErrorDomain code:kJSONScannerErrorCode_DictionaryKeyScanFailed userInfo:theUserInfo]; + } + [theDictionary release]; + return(NO); + } + + [self skipWhitespace]; + + if ([self scanCharacter:':'] == NO) + { + [self setScanLocation:theScanLocation]; + if (outError) + { + NSMutableDictionary *theUserInfo = [NSMutableDictionary dictionaryWithObjectsAndKeys: + @"Could not scan dictionary. Key was not terminated with a ':' character.", NSLocalizedDescriptionKey, + NULL]; + [theUserInfo addEntriesFromDictionary:self.userInfoForScanLocation]; + *outError = [NSError errorWithDomain:kJSONScannerErrorDomain code:kJSONScannerErrorCode_DictionaryKeyNotTerminated userInfo:theUserInfo]; + } + [theDictionary release]; + return(NO); + } + + id theValue = NULL; + if ([self scanJSONObject:&theValue error:outError] == NO) + { + [self setScanLocation:theScanLocation]; + if (outError) + { + NSMutableDictionary *theUserInfo = [NSMutableDictionary dictionaryWithObjectsAndKeys: + @"Could not scan dictionary. Failed to scan a value.", NSLocalizedDescriptionKey, + NULL]; + + [theUserInfo addEntriesFromDictionary:self.userInfoForScanLocation]; + *outError = [NSError errorWithDomain:kJSONScannerErrorDomain code:kJSONScannerErrorCode_DictionaryValueScanFailed userInfo:theUserInfo]; + } + [theDictionary release]; + return(NO); + } + + if (theValue == NULL && self.nullObject == NULL) + { + // If the value is a null and nullObject is also null then we're skipping this key/value pair. + } + else + { + [theDictionary setValue:theValue forKey:theKey]; + } + + [self skipWhitespace]; + if ([self scanCharacter:','] == NO) + { + if ([self currentCharacter] != '}') + { + [self setScanLocation:theScanLocation]; + if (outError) + { + NSMutableDictionary *theUserInfo = [NSMutableDictionary dictionaryWithObjectsAndKeys: + @"Could not scan dictionary. Key value pairs not delimited with a ',' character.", NSLocalizedDescriptionKey, + NULL]; + [theUserInfo addEntriesFromDictionary:self.userInfoForScanLocation]; + *outError = [NSError errorWithDomain:kJSONScannerErrorDomain code:kJSONScannerErrorCode_DictionaryKeyValuePairNoDelimiter userInfo:theUserInfo]; + } + [theDictionary release]; + return(NO); + } + break; + } + else + { + [self skipWhitespace]; + if ([self currentCharacter] == '}') + break; + } + } + + if ([self scanCharacter:'}'] == NO) + { + [self setScanLocation:theScanLocation]; + if (outError) + { + NSMutableDictionary *theUserInfo = [NSMutableDictionary dictionaryWithObjectsAndKeys: + @"Could not scan dictionary. Dictionary not terminated by a '}' character.", NSLocalizedDescriptionKey, + NULL]; + [theUserInfo addEntriesFromDictionary:self.userInfoForScanLocation]; + *outError = [NSError errorWithDomain:kJSONScannerErrorDomain code:kJSONScannerErrorCode_DictionaryNotTerminated userInfo:theUserInfo]; + } + [theDictionary release]; + return(NO); + } + + if (outDictionary != NULL) + { + if (self.options & kJSONScannerOptions_MutableContainers) + { + *outDictionary = [theDictionary autorelease]; + } + else + { + *outDictionary = [[theDictionary copy] autorelease]; + [theDictionary release]; + } + } + else + { + [theDictionary release]; + } + + return(YES); + } + +- (BOOL)scanJSONArray:(NSArray **)outArray error:(NSError **)outError + { + NSUInteger theScanLocation = [self scanLocation]; + + [self skipWhitespace]; + + if ([self scanCharacter:'['] == NO) + { + if (outError) + { + NSMutableDictionary *theUserInfo = [NSMutableDictionary dictionaryWithObjectsAndKeys: + @"Could not scan array. Array not started by a '[' character.", NSLocalizedDescriptionKey, + NULL]; + [theUserInfo addEntriesFromDictionary:self.userInfoForScanLocation]; + *outError = [NSError errorWithDomain:kJSONScannerErrorDomain code:kJSONScannerErrorCode_ArrayStartCharacterMissing userInfo:theUserInfo]; + } + return(NO); + } + + NSMutableArray *theArray = [[NSMutableArray alloc] init]; + + [self skipWhitespace]; + while ([self currentCharacter] != ']') + { + NSString *theValue = NULL; + if ([self scanJSONObject:&theValue error:outError] == NO) + { + [self setScanLocation:theScanLocation]; + if (outError) + { + NSMutableDictionary *theUserInfo = [NSMutableDictionary dictionaryWithObjectsAndKeys: + @"Could not scan array. Could not scan a value.", NSLocalizedDescriptionKey, + NULL]; + [theUserInfo addEntriesFromDictionary:self.userInfoForScanLocation]; + *outError = [NSError errorWithDomain:kJSONScannerErrorDomain code:kJSONScannerErrorCode_ArrayValueScanFailed userInfo:theUserInfo]; + } + [theArray release]; + return(NO); + } + + if (theValue == NULL) + { + if (self.nullObject != NULL) + { + if (outError) + { + NSMutableDictionary *theUserInfo = [NSMutableDictionary dictionaryWithObjectsAndKeys: + @"Could not scan array. Value is NULL.", NSLocalizedDescriptionKey, + NULL]; + [theUserInfo addEntriesFromDictionary:self.userInfoForScanLocation]; + *outError = [NSError errorWithDomain:kJSONScannerErrorDomain code:kJSONScannerErrorCode_ArrayValueIsNull userInfo:theUserInfo]; + } + [theArray release]; + return(NO); + } + } + else + { + [theArray addObject:theValue]; + } + + [self skipWhitespace]; + if ([self scanCharacter:','] == NO) + { + [self skipWhitespace]; + if ([self currentCharacter] != ']') + { + [self setScanLocation:theScanLocation]; + if (outError) + { + NSMutableDictionary *theUserInfo = [NSMutableDictionary dictionaryWithObjectsAndKeys: + @"Could not scan array. Array not terminated by a ']' character.", NSLocalizedDescriptionKey, + NULL]; + [theUserInfo addEntriesFromDictionary:self.userInfoForScanLocation]; + *outError = [NSError errorWithDomain:kJSONScannerErrorDomain code:kJSONScannerErrorCode_ArrayNotTerminated userInfo:theUserInfo]; + } + [theArray release]; + return(NO); + } + + break; + } + [self skipWhitespace]; + } + + [self skipWhitespace]; + + if ([self scanCharacter:']'] == NO) + { + [self setScanLocation:theScanLocation]; + if (outError) + { + NSMutableDictionary *theUserInfo = [NSMutableDictionary dictionaryWithObjectsAndKeys: + @"Could not scan array. Array not terminated by a ']' character.", NSLocalizedDescriptionKey, + NULL]; + [theUserInfo addEntriesFromDictionary:self.userInfoForScanLocation]; + *outError = [NSError errorWithDomain:kJSONScannerErrorDomain code:kJSONScannerErrorCode_ArrayNotTerminated userInfo:theUserInfo]; + } + [theArray release]; + return(NO); + } + + if (outArray != NULL) + { + if (self.options & kJSONScannerOptions_MutableContainers) + { + *outArray = [theArray autorelease]; + } + else + { + *outArray = [[theArray copy] autorelease]; + [theArray release]; + } + } + else + { + [theArray release]; + } + return(YES); + } + +- (BOOL)scanJSONStringConstant:(NSString **)outStringConstant error:(NSError **)outError + { + NSUInteger theScanLocation = [self scanLocation]; + + [self skipWhitespace]; + + NSMutableString *theString = [[NSMutableString alloc] init]; + + if ([self scanCharacter:'"'] == NO) + { + [self setScanLocation:theScanLocation]; + if (outError) + { + NSMutableDictionary *theUserInfo = [NSMutableDictionary dictionaryWithObjectsAndKeys: + @"Could not scan string constant. String not started by a '\"' character.", NSLocalizedDescriptionKey, + NULL]; + [theUserInfo addEntriesFromDictionary:self.userInfoForScanLocation]; + *outError = [NSError errorWithDomain:kJSONScannerErrorDomain code:kJSONScannerErrorCode_StringNotStartedWithBackslash userInfo:theUserInfo]; + } + [theString release]; + return(NO); + } + + while ([self scanCharacter:'"'] == NO) + { + NSString *theStringChunk = NULL; + if ([self scanNotQuoteCharactersIntoString:&theStringChunk]) + { + CFStringAppend((CFMutableStringRef)theString, (CFStringRef)theStringChunk); + } + else if ([self scanCharacter:'\\'] == YES) + { + unichar theCharacter = [self scanCharacter]; + switch (theCharacter) + { + case '"': + case '\\': + case '/': + break; + case 'b': + theCharacter = '\b'; + break; + case 'f': + theCharacter = '\f'; + break; + case 'n': + theCharacter = '\n'; + break; + case 'r': + theCharacter = '\r'; + break; + case 't': + theCharacter = '\t'; + break; + case 'u': + { + theCharacter = 0; + + int theShift; + for (theShift = 12; theShift >= 0; theShift -= 4) + { + const int theDigit = HexToInt([self scanCharacter]); + if (theDigit == -1) + { + [self setScanLocation:theScanLocation]; + if (outError) + { + NSMutableDictionary *theUserInfo = [NSMutableDictionary dictionaryWithObjectsAndKeys: + @"Could not scan string constant. Unicode character could not be decoded.", NSLocalizedDescriptionKey, + NULL]; + [theUserInfo addEntriesFromDictionary:self.userInfoForScanLocation]; + *outError = [NSError errorWithDomain:kJSONScannerErrorDomain code:kJSONScannerErrorCode_StringUnicodeNotDecoded userInfo:theUserInfo]; + } + [theString release]; + return(NO); + } + theCharacter |= (theDigit << theShift); + } + } + break; + default: + { + if (strictEscapeCodes == YES) + { + [self setScanLocation:theScanLocation]; + if (outError) + { + NSMutableDictionary *theUserInfo = [NSMutableDictionary dictionaryWithObjectsAndKeys: + @"Could not scan string constant. Unknown escape code.", NSLocalizedDescriptionKey, + NULL]; + [theUserInfo addEntriesFromDictionary:self.userInfoForScanLocation]; + *outError = [NSError errorWithDomain:kJSONScannerErrorDomain code:kJSONScannerErrorCode_StringUnknownEscapeCode userInfo:theUserInfo]; + } + [theString release]; + return(NO); + } + } + break; + } + CFStringAppendCharacters((CFMutableStringRef)theString, &theCharacter, 1); + } + else + { + if (outError) + { + NSMutableDictionary *theUserInfo = [NSMutableDictionary dictionaryWithObjectsAndKeys: + @"Could not scan string constant. No terminating double quote character.", NSLocalizedDescriptionKey, + NULL]; + [theUserInfo addEntriesFromDictionary:self.userInfoForScanLocation]; + *outError = [NSError errorWithDomain:kJSONScannerErrorDomain code:kJSONScannerErrorCode_StringNotTerminated userInfo:theUserInfo]; + } + [theString release]; + return(NO); + } + } + + if (outStringConstant != NULL) + { + if (self.options & kJSONScannerOptions_MutableLeaves) + { + *outStringConstant = [theString autorelease]; + } + else + { + *outStringConstant = [[theString copy] autorelease]; + [theString release]; + } + } + else + { + [theString release]; + } + + return(YES); + } + +- (BOOL)scanJSONNumberConstant:(NSNumber **)outNumberConstant error:(NSError **)outError + { + NSNumber *theNumber = NULL; + + [self skipWhitespace]; + + if ([self scanNumber:&theNumber] == YES) + { + if (outNumberConstant != NULL) + *outNumberConstant = theNumber; + return(YES); + } + else + { + if (outError) + { + NSMutableDictionary *theUserInfo = [NSMutableDictionary dictionaryWithObjectsAndKeys: + @"Could not scan number constant.", NSLocalizedDescriptionKey, + NULL]; + [theUserInfo addEntriesFromDictionary:self.userInfoForScanLocation]; + *outError = [NSError errorWithDomain:kJSONScannerErrorDomain code:kJSONScannerErrorCode_NumberNotScannable userInfo:theUserInfo]; + } + return(NO); + } + } + +#if TREAT_COMMENTS_AS_WHITESPACE +- (void)skipWhitespace + { + [super skipWhitespace]; + [self scanCStyleComment:NULL]; + [self scanCPlusPlusStyleComment:NULL]; + [super skipWhitespace]; + } +#endif // TREAT_COMMENTS_AS_WHITESPACE + +#pragma mark - + +- (BOOL)scanNotQuoteCharactersIntoString:(NSString **)outValue + { + u_int8_t *P; + for (P = current; P < end && *P != '\"' && *P != '\\'; ++P) + ; + + if (P == current) + { + return(NO); + } + + if (outValue) + { + *outValue = [[[NSString alloc] initWithBytes:current length:P - current encoding:NSUTF8StringEncoding] autorelease]; + } + + current = P; + + return(YES); + } + +@end diff --git a/libs/TouchJSON/JSON/CJSONSerializer.h b/libs/TouchJSON/JSON/CJSONSerializer.h new file mode 100755 index 0000000..748a85c --- /dev/null +++ b/libs/TouchJSON/JSON/CJSONSerializer.h @@ -0,0 +1,53 @@ +// +// CJSONSerializer.h +// TouchCode +// +// Created by Jonathan Wight on 12/07/2005. +// Copyright 2005 toxicsoftware.com. All rights reserved. +// +// Permission is hereby granted, free of charge, to any person +// obtaining a copy of this software and associated documentation +// files (the "Software"), to deal in the Software without +// restriction, including without limitation the rights to use, +// copy, modify, merge, publish, distribute, sublicense, and/or sell +// copies of the Software, and to permit persons to whom the +// Software is furnished to do so, subject to the following +// conditions: +// +// The above copyright notice and this permission notice shall be +// included in all copies or substantial portions of the Software. +// +// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +// EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES +// OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND +// NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT +// HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, +// WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING +// FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +// OTHER DEALINGS IN THE SOFTWARE. +// + +#import + +@interface CJSONSerializer : NSObject { +} + ++ (id)serializer; + +- (BOOL)isValidJSONObject:(id)inObject; + +/// Take any JSON compatible object (generally NSNull, NSNumber, NSString, NSArray and NSDictionary) and produce an NSData containing the serialized JSON. +- (NSData *)serializeObject:(id)inObject error:(NSError **)outError; + +- (NSData *)serializeNull:(NSNull *)inNull error:(NSError **)outError; +- (NSData *)serializeNumber:(NSNumber *)inNumber error:(NSError **)outError; +- (NSData *)serializeString:(NSString *)inString error:(NSError **)outError; +- (NSData *)serializeArray:(NSArray *)inArray error:(NSError **)outError; +- (NSData *)serializeDictionary:(NSDictionary *)inDictionary error:(NSError **)outError; + +@end + +typedef enum { + CJSONSerializerErrorCouldNotSerializeDataType = -1, + CJSONSerializerErrorCouldNotSerializeObject = -1 +} CJSONSerializerError; diff --git a/libs/TouchJSON/JSON/CJSONSerializer.m b/libs/TouchJSON/JSON/CJSONSerializer.m new file mode 100755 index 0000000..952b3c2 --- /dev/null +++ b/libs/TouchJSON/JSON/CJSONSerializer.m @@ -0,0 +1,342 @@ +// +// CJSONSerializer.m +// TouchCode +// +// Created by Jonathan Wight on 12/07/2005. +// Copyright 2005 toxicsoftware.com. All rights reserved. +// +// Permission is hereby granted, free of charge, to any person +// obtaining a copy of this software and associated documentation +// files (the "Software"), to deal in the Software without +// restriction, including without limitation the rights to use, +// copy, modify, merge, publish, distribute, sublicense, and/or sell +// copies of the Software, and to permit persons to whom the +// Software is furnished to do so, subject to the following +// conditions: +// +// The above copyright notice and this permission notice shall be +// included in all copies or substantial portions of the Software. +// +// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +// EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES +// OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND +// NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT +// HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, +// WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING +// FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +// OTHER DEALINGS IN THE SOFTWARE. +// + +#import "CJSONSerializer.h" + +#import "JSONRepresentation.h" + +static NSData *kNULL = NULL; +static NSData *kFalse = NULL; +static NSData *kTrue = NULL; + +@implementation CJSONSerializer + ++ (void)initialize + { + NSAutoreleasePool *thePool = [[NSAutoreleasePool alloc] init]; + + if (self == [CJSONSerializer class]) + { + if (kNULL == NULL) + kNULL = [[NSData alloc] initWithBytesNoCopy:(void *)"null" length:4 freeWhenDone:NO]; + if (kFalse == NULL) + kFalse = [[NSData alloc] initWithBytesNoCopy:(void *)"false" length:5 freeWhenDone:NO]; + if (kTrue == NULL) + kTrue = [[NSData alloc] initWithBytesNoCopy:(void *)"true" length:4 freeWhenDone:NO]; + + [thePool release]; + } + } + ++ (id)serializer + { + return([[[self alloc] init] autorelease]); + } + +- (BOOL)isValidJSONObject:(id)inObject + { + if ([inObject isKindOfClass:[NSNull class]]) + { + return(YES); + } + else if ([inObject isKindOfClass:[NSNumber class]]) + { + return(YES); + } + else if ([inObject isKindOfClass:[NSString class]]) + { + return(YES); + } + else if ([inObject isKindOfClass:[NSArray class]]) + { + return(YES); + } + else if ([inObject isKindOfClass:[NSDictionary class]]) + { + return(YES); + } + else if ([inObject isKindOfClass:[NSData class]]) + { + return(YES); + } + else if ([inObject respondsToSelector:@selector(JSONDataRepresentation)]) + { + return(YES); + } + else + { + return(NO); + } + } + +- (NSData *)serializeObject:(id)inObject error:(NSError **)outError + { + NSData *theResult = NULL; + + if ([inObject isKindOfClass:[NSNull class]]) + { + theResult = [self serializeNull:inObject error:outError]; + } + else if ([inObject isKindOfClass:[NSNumber class]]) + { + theResult = [self serializeNumber:inObject error:outError]; + } + else if ([inObject isKindOfClass:[NSString class]]) + { + theResult = [self serializeString:inObject error:outError]; + } + else if ([inObject isKindOfClass:[NSArray class]]) + { + theResult = [self serializeArray:inObject error:outError]; + } + else if ([inObject isKindOfClass:[NSDictionary class]]) + { + theResult = [self serializeDictionary:inObject error:outError]; + } + else if ([inObject isKindOfClass:[NSData class]]) + { + NSString *theString = [[[NSString alloc] initWithData:inObject encoding:NSUTF8StringEncoding] autorelease]; + theResult = [self serializeString:theString error:outError]; + } + else if ([inObject respondsToSelector:@selector(JSONDataRepresentation)]) + { + theResult = [inObject JSONDataRepresentation]; + } + else + { + if (outError) + { + NSDictionary *theUserInfo = [NSDictionary dictionaryWithObjectsAndKeys: + [NSString stringWithFormat:@"Cannot serialize data of type '%@'", NSStringFromClass([inObject class])], NSLocalizedDescriptionKey, + NULL]; + *outError = [NSError errorWithDomain:@"TODO_DOMAIN" code:CJSONSerializerErrorCouldNotSerializeDataType userInfo:theUserInfo]; + } + return(NULL); + } + if (theResult == NULL) + { + if (outError) + { + NSDictionary *theUserInfo = [NSDictionary dictionaryWithObjectsAndKeys: + [NSString stringWithFormat:@"Could not serialize object '%@'", inObject], NSLocalizedDescriptionKey, + NULL]; + *outError = [NSError errorWithDomain:@"TODO_DOMAIN" code:CJSONSerializerErrorCouldNotSerializeObject userInfo:theUserInfo]; + } + return(NULL); + } + return(theResult); + } + +- (NSData *)serializeNull:(NSNull *)inNull error:(NSError **)outError + { + #pragma unused (inNull, outError) + return(kNULL); + } + +- (NSData *)serializeNumber:(NSNumber *)inNumber error:(NSError **)outError + { + #pragma unused (outError) + NSData *theResult = NULL; + switch (CFNumberGetType((CFNumberRef)inNumber)) + { + case kCFNumberCharType: + { + int theValue = [inNumber intValue]; + if (theValue == 0) + theResult = kFalse; + else if (theValue == 1) + theResult = kTrue; + else + theResult = [[inNumber stringValue] dataUsingEncoding:NSASCIIStringEncoding]; + } + break; + case kCFNumberFloat32Type: + case kCFNumberFloat64Type: + case kCFNumberFloatType: + case kCFNumberDoubleType: + case kCFNumberSInt8Type: + case kCFNumberSInt16Type: + case kCFNumberSInt32Type: + case kCFNumberSInt64Type: + case kCFNumberShortType: + case kCFNumberIntType: + case kCFNumberLongType: + case kCFNumberLongLongType: + case kCFNumberCFIndexType: + default: + theResult = [[inNumber stringValue] dataUsingEncoding:NSASCIIStringEncoding]; + break; + } + return(theResult); + } + +- (NSData *)serializeString:(NSString *)inString error:(NSError **)outError + { + #pragma unused (outError) + + const char *theUTF8String = [inString UTF8String]; + + NSMutableData *theData = [NSMutableData dataWithLength:strlen(theUTF8String) * 2 + 2]; + + char *theOutputStart = [theData mutableBytes]; + char *OUT = theOutputStart; + + *OUT++ = '"'; + + for (const char *IN = theUTF8String; IN && *IN != '\0'; ++IN) + { + switch (*IN) + { + case '\\': + { + *OUT++ = '\\'; + *OUT++ = '\\'; + } + break; + case '\"': + { + *OUT++ = '\\'; + *OUT++ = '\"'; + } + break; + case '/': + { + *OUT++ = '\\'; + *OUT++ = '/'; + } + break; + case '\b': + { + *OUT++ = '\\'; + *OUT++ = 'b'; + } + break; + case '\f': + { + *OUT++ = '\\'; + *OUT++ = 'f'; + } + break; + case '\n': + { + *OUT++ = '\\'; + *OUT++ = 'n'; + } + break; + case '\r': + { + *OUT++ = '\\'; + *OUT++ = 'r'; + } + break; + case '\t': + { + *OUT++ = '\\'; + *OUT++ = 't'; + } + break; + default: + { + *OUT++ = *IN; + } + break; + } + } + + *OUT++ = '"'; + + theData.length = OUT - theOutputStart; + return(theData); + } + +- (NSData *)serializeArray:(NSArray *)inArray error:(NSError **)outError + { + NSMutableData *theData = [NSMutableData data]; + + [theData appendBytes:"[" length:1]; + + NSEnumerator *theEnumerator = [inArray objectEnumerator]; + id theValue = NULL; + NSUInteger i = 0; + while ((theValue = [theEnumerator nextObject]) != NULL) + { + NSData *theValueData = [self serializeObject:theValue error:outError]; + if (theValueData == NULL) + { + return(NULL); + } + [theData appendData:theValueData]; + if (++i < [inArray count]) + [theData appendBytes:"," length:1]; + } + + [theData appendBytes:"]" length:1]; + + return(theData); + } + +- (NSData *)serializeDictionary:(NSDictionary *)inDictionary error:(NSError **)outError + { + NSMutableData *theData = [NSMutableData data]; + + [theData appendBytes:"{" length:1]; + + NSArray *theKeys = [inDictionary allKeys]; + NSEnumerator *theEnumerator = [theKeys objectEnumerator]; + NSString *theKey = NULL; + while ((theKey = [theEnumerator nextObject]) != NULL) + { + id theValue = [inDictionary objectForKey:theKey]; + + NSData *theKeyData = [self serializeString:theKey error:outError]; + if (theKeyData == NULL) + { + return(NULL); + } + NSData *theValueData = [self serializeObject:theValue error:outError]; + if (theValueData == NULL) + { + return(NULL); + } + + + [theData appendData:theKeyData]; + [theData appendBytes:":" length:1]; + [theData appendData:theValueData]; + + if (theKey != [theKeys lastObject]) + [theData appendData:[@"," dataUsingEncoding:NSASCIIStringEncoding]]; + } + + [theData appendBytes:"}" length:1]; + + return(theData); + } + +@end diff --git a/libs/TouchJSON/JSON/JSONRepresentation.h b/libs/TouchJSON/JSON/JSONRepresentation.h new file mode 100755 index 0000000..a83d76f --- /dev/null +++ b/libs/TouchJSON/JSON/JSONRepresentation.h @@ -0,0 +1,18 @@ +// +// JSONRepresentation.h +// TouchJSON +// +// Created by Jonathan Wight on 10/15/10. +// Copyright 2010 toxicsoftware.com. All rights reserved. +// + +#import + +@protocol JSONRepresentation + +@optional +- (id)initWithJSONDataRepresentation:(NSData *)inJSONData; + +- (NSData *)JSONDataRepresentation; + +@end diff --git a/libs/cocos2d/CCAction.h b/libs/cocos2d/CCAction.h new file mode 100755 index 0000000..51bad8e --- /dev/null +++ b/libs/cocos2d/CCAction.h @@ -0,0 +1,195 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2008-2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + + +#include +#import + +#import "ccTypes.h" + +enum { + //! Default tag + kCCActionTagInvalid = -1, +}; + +/** Base class for CCAction objects. + */ +@interface CCAction : NSObject +{ + id originalTarget_; + id target_; + NSInteger tag_; +} + +/** The "target". The action will modify the target properties. + The target will be set with the 'startWithTarget' method. + When the 'stop' method is called, target will be set to nil. + The target is 'assigned', it is not 'retained'. + */ +@property (nonatomic,readonly,assign) id target; + +/** The original target, since target can be nil. + Is the target that were used to run the action. Unless you are doing something complex, like CCActionManager, you should NOT call this method. + @since v0.8.2 +*/ +@property (nonatomic,readonly,assign) id originalTarget; + + +/** The action tag. An identifier of the action */ +@property (nonatomic,readwrite,assign) NSInteger tag; + +/** Allocates and initializes the action */ ++(id) action; + +/** Initializes the action */ +-(id) init; + +-(id) copyWithZone: (NSZone*) zone; + +//! return YES if the action has finished +-(BOOL) isDone; +//! called before the action start. It will also set the target. +-(void) startWithTarget:(id)target; +//! called after the action has finished. It will set the 'target' to nil. +//! IMPORTANT: You should never call "[action stop]" manually. Instead, use: "[target stopAction:action];" +-(void) stop; +//! called every frame with it's delta time. DON'T override unless you know what you are doing. +-(void) step: (ccTime) dt; +//! called once per frame. time a value between 0 and 1 +//! For example: +//! * 0 means that the action just started +//! * 0.5 means that the action is in the middle +//! * 1 means that the action is over +-(void) update: (ccTime) time; + +@end + +/** Base class actions that do have a finite time duration. + Possible actions: + - An action with a duration of 0 seconds + - An action with a duration of 35.5 seconds + Infitite time actions are valid + */ +@interface CCFiniteTimeAction : CCAction +{ + //! duration in seconds + ccTime duration_; +} +//! duration in seconds of the action +@property (nonatomic,readwrite) ccTime duration; + +/** returns a reversed action */ +- (CCFiniteTimeAction*) reverse; +@end + + +@class CCActionInterval; +/** Repeats an action for ever. + To repeat the an action for a limited number of times use the Repeat action. + @warning This action can't be Sequenceable because it is not an IntervalAction + */ +@interface CCRepeatForever : CCAction +{ + CCActionInterval *innerAction_; +} +/** Inner action */ +@property (nonatomic, readwrite, retain) CCActionInterval *innerAction; + +/** creates the action */ ++(id) actionWithAction: (CCActionInterval*) action; +/** initializes the action */ +-(id) initWithAction: (CCActionInterval*) action; +@end + +/** Changes the speed of an action, making it take longer (speed>1) + or less (speed<1) time. + Useful to simulate 'slow motion' or 'fast forward' effect. + @warning This action can't be Sequenceable because it is not an CCIntervalAction + */ +@interface CCSpeed : CCAction +{ + CCActionInterval *innerAction_; + float speed_; +} +/** alter the speed of the inner function in runtime */ +@property (nonatomic,readwrite) float speed; +/** Inner action of CCSpeed */ +@property (nonatomic, readwrite, retain) CCActionInterval *innerAction; + +/** creates the action */ ++(id) actionWithAction: (CCActionInterval*) action speed:(float)rate; +/** initializes the action */ +-(id) initWithAction: (CCActionInterval*) action speed:(float)rate; +@end + +@class CCNode; +/** CCFollow is an action that "follows" a node. + + Eg: + [layer runAction: [CCFollow actionWithTarget:hero]]; + + Instead of using CCCamera as a "follower", use this action instead. + @since v0.99.2 + */ +@interface CCFollow : CCAction +{ + /* node to follow */ + CCNode *followedNode_; + + /* whether camera should be limited to certain area */ + BOOL boundarySet; + + /* if screensize is bigger than the boundary - update not needed */ + BOOL boundaryFullyCovered; + + /* fast access to the screen dimensions */ + CGPoint halfScreenSize; + CGPoint fullScreenSize; + + /* world boundaries */ + float leftBoundary; + float rightBoundary; + float topBoundary; + float bottomBoundary; +} + +/** alter behavior - turn on/off boundary */ +@property (nonatomic,readwrite) BOOL boundarySet; + +/** creates the action with no boundary set */ ++(id) actionWithTarget:(CCNode *)followedNode; + +/** creates the action with a set boundary */ ++(id) actionWithTarget:(CCNode *)followedNode worldBoundary:(CGRect)rect; + +/** initializes the action */ +-(id) initWithTarget:(CCNode *)followedNode; + +/** initializes the action with a set boundary */ +-(id) initWithTarget:(CCNode *)followedNode worldBoundary:(CGRect)rect; + +@end + diff --git a/libs/cocos2d/CCAction.m b/libs/cocos2d/CCAction.m new file mode 100755 index 0000000..27db20b --- /dev/null +++ b/libs/cocos2d/CCAction.m @@ -0,0 +1,360 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2008-2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + + + +#import +#import "CCDirector.h" +#import "ccMacros.h" +#import "CCAction.h" +#import "CCActionInterval.h" +#import "Support/CGPointExtension.h" + +// +// Action Base Class +// +#pragma mark - +#pragma mark Action +@implementation CCAction + +@synthesize tag = tag_, target = target_, originalTarget = originalTarget_; + ++(id) action +{ + return [[[self alloc] init] autorelease]; +} + +-(id) init +{ + if( (self=[super init]) ) { + originalTarget_ = target_ = nil; + tag_ = kCCActionTagInvalid; + } + return self; +} + +-(void) dealloc +{ + CCLOGINFO(@"cocos2d: deallocing %@", self); + [super dealloc]; +} + +-(NSString*) description +{ + return [NSString stringWithFormat:@"<%@ = %08X | Tag = %i>", [self class], self, tag_]; +} + +-(id) copyWithZone: (NSZone*) zone +{ + CCAction *copy = [[[self class] allocWithZone: zone] init]; + copy.tag = tag_; + return copy; +} + +-(void) startWithTarget:(id)aTarget +{ + originalTarget_ = target_ = aTarget; +} + +-(void) stop +{ + target_ = nil; +} + +-(BOOL) isDone +{ + return YES; +} + +-(void) step: (ccTime) dt +{ + NSLog(@"[Action step]. override me"); +} + +-(void) update: (ccTime) time +{ + NSLog(@"[Action update]. override me"); +} +@end + +// +// FiniteTimeAction +// +#pragma mark - +#pragma mark FiniteTimeAction +@implementation CCFiniteTimeAction +@synthesize duration = duration_; + +- (CCFiniteTimeAction*) reverse +{ + CCLOG(@"cocos2d: FiniteTimeAction#reverse: Implement me"); + return nil; +} +@end + + +// +// RepeatForever +// +#pragma mark - +#pragma mark RepeatForever +@implementation CCRepeatForever +@synthesize innerAction=innerAction_; ++(id) actionWithAction: (CCActionInterval*) action +{ + return [[[self alloc] initWithAction: action] autorelease]; +} + +-(id) initWithAction: (CCActionInterval*) action +{ + if( (self=[super init]) ) + self.innerAction = action; + + return self; +} + +-(id) copyWithZone: (NSZone*) zone +{ + CCAction *copy = [[[self class] allocWithZone: zone] initWithAction:[[innerAction_ copy] autorelease] ]; + return copy; +} + +-(void) dealloc +{ + [innerAction_ release]; + [super dealloc]; +} + +-(void) startWithTarget:(id)aTarget +{ + [super startWithTarget:aTarget]; + [innerAction_ startWithTarget:target_]; +} + +-(void) step:(ccTime) dt +{ + [innerAction_ step: dt]; + if( [innerAction_ isDone] ) { + ccTime diff = dt + innerAction_.duration - innerAction_.elapsed; + [innerAction_ startWithTarget:target_]; + + // to prevent jerk. issue #390 + [innerAction_ step: diff]; + } +} + + +-(BOOL) isDone +{ + return NO; +} + +- (CCActionInterval *) reverse +{ + return [CCRepeatForever actionWithAction:[innerAction_ reverse]]; +} +@end + +// +// Speed +// +#pragma mark - +#pragma mark Speed +@implementation CCSpeed +@synthesize speed=speed_; +@synthesize innerAction=innerAction_; + ++(id) actionWithAction: (CCActionInterval*) action speed:(float)r +{ + return [[[self alloc] initWithAction: action speed:r] autorelease]; +} + +-(id) initWithAction: (CCActionInterval*) action speed:(float)r +{ + if( (self=[super init]) ) { + self.innerAction = action; + speed_ = r; + } + return self; +} + +-(id) copyWithZone: (NSZone*) zone +{ + CCAction *copy = [[[self class] allocWithZone: zone] initWithAction:[[innerAction_ copy] autorelease] speed:speed_]; + return copy; +} + +-(void) dealloc +{ + [innerAction_ release]; + [super dealloc]; +} + +-(void) startWithTarget:(id)aTarget +{ + [super startWithTarget:aTarget]; + [innerAction_ startWithTarget:target_]; +} + +-(void) stop +{ + [innerAction_ stop]; + [super stop]; +} + +-(void) step:(ccTime) dt +{ + [innerAction_ step: dt * speed_]; +} + +-(BOOL) isDone +{ + return [innerAction_ isDone]; +} + +- (CCActionInterval *) reverse +{ + return [CCSpeed actionWithAction:[innerAction_ reverse] speed:speed_]; +} +@end + +// +// Follow +// +#pragma mark - +#pragma mark Follow +@implementation CCFollow + +@synthesize boundarySet; + ++(id) actionWithTarget:(CCNode *) fNode +{ + return [[[self alloc] initWithTarget:fNode] autorelease]; +} + ++(id) actionWithTarget:(CCNode *) fNode worldBoundary:(CGRect)rect +{ + return [[[self alloc] initWithTarget:fNode worldBoundary:rect] autorelease]; +} + +-(id) initWithTarget:(CCNode *)fNode +{ + if( (self=[super init]) ) { + + followedNode_ = [fNode retain]; + boundarySet = FALSE; + boundaryFullyCovered = FALSE; + + CGSize s = [[CCDirector sharedDirector] winSize]; + fullScreenSize = CGPointMake(s.width, s.height); + halfScreenSize = ccpMult(fullScreenSize, .5f); + } + + return self; +} + +-(id) initWithTarget:(CCNode *)fNode worldBoundary:(CGRect)rect +{ + if( (self=[super init]) ) { + + followedNode_ = [fNode retain]; + boundarySet = TRUE; + boundaryFullyCovered = FALSE; + + CGSize winSize = [[CCDirector sharedDirector] winSize]; + fullScreenSize = CGPointMake(winSize.width, winSize.height); + halfScreenSize = ccpMult(fullScreenSize, .5f); + + leftBoundary = -((rect.origin.x+rect.size.width) - fullScreenSize.x); + rightBoundary = -rect.origin.x ; + topBoundary = -rect.origin.y; + bottomBoundary = -((rect.origin.y+rect.size.height) - fullScreenSize.y); + + if(rightBoundary < leftBoundary) + { + // screen width is larger than world's boundary width + //set both in the middle of the world + rightBoundary = leftBoundary = (leftBoundary + rightBoundary) / 2; + } + if(topBoundary < bottomBoundary) + { + // screen width is larger than world's boundary width + //set both in the middle of the world + topBoundary = bottomBoundary = (topBoundary + bottomBoundary) / 2; + } + + if( (topBoundary == bottomBoundary) && (leftBoundary == rightBoundary) ) + boundaryFullyCovered = TRUE; + } + + return self; +} + +-(id) copyWithZone: (NSZone*) zone +{ + CCAction *copy = [[[self class] allocWithZone: zone] init]; + copy.tag = tag_; + return copy; +} + +-(void) step:(ccTime) dt +{ + if(boundarySet) + { + // whole map fits inside a single screen, no need to modify the position - unless map boundaries are increased + if(boundaryFullyCovered) + return; + + CGPoint tempPos = ccpSub( halfScreenSize, followedNode_.position); + [target_ setPosition:ccp(clampf(tempPos.x,leftBoundary,rightBoundary), clampf(tempPos.y,bottomBoundary,topBoundary))]; + } + else + [target_ setPosition:ccpSub( halfScreenSize, followedNode_.position )]; + +#undef CLAMP +} + + +-(BOOL) isDone +{ + return !followedNode_.isRunning; +} + +-(void) stop +{ + target_ = nil; + [super stop]; +} + +-(void) dealloc +{ + [followedNode_ release]; + [super dealloc]; +} + +@end + + diff --git a/libs/cocos2d/CCActionCamera.h b/libs/cocos2d/CCActionCamera.h new file mode 100755 index 0000000..1ea83a7 --- /dev/null +++ b/libs/cocos2d/CCActionCamera.h @@ -0,0 +1,73 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2008-2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + +#import "CCActionInterval.h" + +@class CCCamera; + +/** Base class for CCCamera actions + */ +@interface CCActionCamera : CCActionInterval +{ + float centerXOrig_; + float centerYOrig_; + float centerZOrig_; + + float eyeXOrig_; + float eyeYOrig_; + float eyeZOrig_; + + float upXOrig_; + float upYOrig_; + float upZOrig_; +} +@end + +/** CCOrbitCamera action + Orbits the camera around the center of the screen using spherical coordinates + */ +@interface CCOrbitCamera : CCActionCamera +{ + float radius_; + float deltaRadius_; + float angleZ_; + float deltaAngleZ_; + float angleX_; + float deltaAngleX_; + + float radZ_; + float radDeltaZ_; + float radX_; + float radDeltaX_; + +} +/** creates a CCOrbitCamera action with radius, delta-radius, z, deltaZ, x, deltaX */ ++(id) actionWithDuration:(float) t radius:(float)r deltaRadius:(float) dr angleZ:(float)z deltaAngleZ:(float)dz angleX:(float)x deltaAngleX:(float)dx; +/** initializes a CCOrbitCamera action with radius, delta-radius, z, deltaZ, x, deltaX */ +-(id) initWithDuration:(float) t radius:(float)r deltaRadius:(float) dr angleZ:(float)z deltaAngleZ:(float)dz angleX:(float)x deltaAngleX:(float)dx; +/** positions the camera according to spherical coordinates */ +-(void) sphericalRadius:(float*) r zenith:(float*) zenith azimuth:(float*) azimuth; +@end diff --git a/libs/cocos2d/CCActionCamera.m b/libs/cocos2d/CCActionCamera.m new file mode 100755 index 0000000..4dafc4e --- /dev/null +++ b/libs/cocos2d/CCActionCamera.m @@ -0,0 +1,147 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2008-2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + + + +#import "CCActionCamera.h" +#import "CCNode.h" +#import "CCCamera.h" +#import "ccMacros.h" + +// +// CameraAction +// +@implementation CCActionCamera +-(void) startWithTarget:(id)aTarget +{ + [super startWithTarget:aTarget]; + CCCamera *camera = [target_ camera]; + [camera centerX:¢erXOrig_ centerY:¢erYOrig_ centerZ:¢erZOrig_]; + [camera eyeX:&eyeXOrig_ eyeY:&eyeYOrig_ eyeZ:&eyeZOrig_]; + [camera upX:&upXOrig_ upY:&upYOrig_ upZ: &upZOrig_]; +} + +-(id) reverse +{ + return [CCReverseTime actionWithAction:self]; +} +@end + +@implementation CCOrbitCamera ++(id) actionWithDuration:(float)t radius:(float)r deltaRadius:(float) dr angleZ:(float)z deltaAngleZ:(float)dz angleX:(float)x deltaAngleX:(float)dx +{ + return [[[self alloc] initWithDuration:t radius:r deltaRadius:dr angleZ:z deltaAngleZ:dz angleX:x deltaAngleX:dx] autorelease]; +} + +-(id) copyWithZone: (NSZone*) zone +{ + return [[[self class] allocWithZone: zone] initWithDuration:duration_ radius:radius_ deltaRadius:deltaRadius_ angleZ:angleZ_ deltaAngleZ:deltaAngleZ_ angleX:angleX_ deltaAngleX:deltaAngleX_]; +} + + +-(id) initWithDuration:(float)t radius:(float)r deltaRadius:(float) dr angleZ:(float)z deltaAngleZ:(float)dz angleX:(float)x deltaAngleX:(float)dx +{ + if((self=[super initWithDuration:t]) ) { + + radius_ = r; + deltaRadius_ = dr; + angleZ_ = z; + deltaAngleZ_ = dz; + angleX_ = x; + deltaAngleX_ = dx; + + radDeltaZ_ = (CGFloat)CC_DEGREES_TO_RADIANS(dz); + radDeltaX_ = (CGFloat)CC_DEGREES_TO_RADIANS(dx); + } + + return self; +} + +-(void) startWithTarget:(id)aTarget +{ + [super startWithTarget:aTarget]; + float r, zenith, azimuth; + + [self sphericalRadius: &r zenith:&zenith azimuth:&azimuth]; + +#if 0 // isnan() is not supported on the simulator, and isnan() always returns false. + if( isnan(radius_) ) + radius_ = r; + + if( isnan( angleZ_) ) + angleZ_ = (CGFloat)CC_RADIANS_TO_DEGREES(zenith); + + if( isnan( angleX_ ) ) + angleX_ = (CGFloat)CC_RADIANS_TO_DEGREES(azimuth); +#endif + + radZ_ = (CGFloat)CC_DEGREES_TO_RADIANS(angleZ_); + radX_ = (CGFloat)CC_DEGREES_TO_RADIANS(angleX_); +} + +-(void) update: (ccTime) dt +{ + float r = (radius_ + deltaRadius_ * dt) *[CCCamera getZEye]; + float za = radZ_ + radDeltaZ_ * dt; + float xa = radX_ + radDeltaX_ * dt; + + float i = sinf(za) * cosf(xa) * r + centerXOrig_; + float j = sinf(za) * sinf(xa) * r + centerYOrig_; + float k = cosf(za) * r + centerZOrig_; + + [[target_ camera] setEyeX:i eyeY:j eyeZ:k]; +} + +-(void) sphericalRadius:(float*) newRadius zenith:(float*) zenith azimuth:(float*) azimuth +{ + float ex, ey, ez, cx, cy, cz, x, y, z; + float r; // radius + float s; + + CCCamera *camera = [target_ camera]; + [camera eyeX:&ex eyeY:&ey eyeZ:&ez]; + [camera centerX:&cx centerY:&cy centerZ:&cz]; + + x = ex-cx; + y = ey-cy; + z = ez-cz; + + r = sqrtf( x*x + y*y + z*z); + s = sqrtf( x*x + y*y); + if(s==0.0f) + s = FLT_EPSILON; + if(r==0.0f) + r = FLT_EPSILON; + + *zenith = acosf( z/r); + if( x < 0 ) + *azimuth = (float)M_PI - asinf(y/s); + else + *azimuth = asinf(y/s); + + *newRadius = r / [CCCamera getZEye]; +} +@end diff --git a/libs/cocos2d/CCActionEase.h b/libs/cocos2d/CCActionEase.h new file mode 100755 index 0000000..fced701 --- /dev/null +++ b/libs/cocos2d/CCActionEase.h @@ -0,0 +1,159 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2008-2009 Jason Booth + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + + +#import "CCActionInterval.h" + +/** Base class for Easing actions + */ +@interface CCActionEase : CCActionInterval +{ + CCActionInterval * other; +} +/** creates the action */ ++(id) actionWithAction: (CCActionInterval*) action; +/** initializes the action */ +-(id) initWithAction: (CCActionInterval*) action; +@end + +/** Base class for Easing actions with rate parameters + */ +@interface CCEaseRateAction : CCActionEase +{ + float rate; +} +/** rate value for the actions */ +@property (nonatomic,readwrite,assign) float rate; +/** Creates the action with the inner action and the rate parameter */ ++(id) actionWithAction: (CCActionInterval*) action rate:(float)rate; +/** Initializes the action with the inner action and the rate parameter */ +-(id) initWithAction: (CCActionInterval*) action rate:(float)rate; +@end + +/** CCEaseIn action with a rate + */ +@interface CCEaseIn : CCEaseRateAction {} @end + +/** CCEaseOut action with a rate + */ +@interface CCEaseOut : CCEaseRateAction {} @end + +/** CCEaseInOut action with a rate + */ +@interface CCEaseInOut : CCEaseRateAction {} @end + +/** CCEase Exponential In + */ +@interface CCEaseExponentialIn : CCActionEase {} @end +/** Ease Exponential Out + */ +@interface CCEaseExponentialOut : CCActionEase {} @end +/** Ease Exponential InOut + */ +@interface CCEaseExponentialInOut : CCActionEase {} @end +/** Ease Sine In + */ +@interface CCEaseSineIn : CCActionEase {} @end +/** Ease Sine Out + */ +@interface CCEaseSineOut : CCActionEase {} @end +/** Ease Sine InOut + */ +@interface CCEaseSineInOut : CCActionEase {} @end + +/** Ease Elastic abstract class + @since v0.8.2 + */ +@interface CCEaseElastic : CCActionEase +{ + float period_; +} + +/** period of the wave in radians. default is 0.3 */ +@property (nonatomic,readwrite) float period; + +/** Creates the action with the inner action and the period in radians (default is 0.3) */ ++(id) actionWithAction: (CCActionInterval*) action period:(float)period; +/** Initializes the action with the inner action and the period in radians (default is 0.3) */ +-(id) initWithAction: (CCActionInterval*) action period:(float)period; +@end + +/** Ease Elastic In action. + @warning This action doesn't use a bijective fucntion. Actions like Sequence might have an unexpected result when used with this action. + @since v0.8.2 + */ +@interface CCEaseElasticIn : CCEaseElastic {} @end +/** Ease Elastic Out action. + @warning This action doesn't use a bijective fucntion. Actions like Sequence might have an unexpected result when used with this action. + @since v0.8.2 + */ +@interface CCEaseElasticOut : CCEaseElastic {} @end +/** Ease Elastic InOut action. + @warning This action doesn't use a bijective fucntion. Actions like Sequence might have an unexpected result when used with this action. + @since v0.8.2 + */ +@interface CCEaseElasticInOut : CCEaseElastic {} @end + +/** CCEaseBounce abstract class. + @since v0.8.2 +*/ +@interface CCEaseBounce : CCActionEase {} @end + +/** CCEaseBounceIn action. + @warning This action doesn't use a bijective fucntion. Actions like Sequence might have an unexpected result when used with this action. + @since v0.8.2 +*/ +@interface CCEaseBounceIn : CCEaseBounce {} @end + +/** EaseBounceOut action. + @warning This action doesn't use a bijective fucntion. Actions like Sequence might have an unexpected result when used with this action. + @since v0.8.2 + */ +@interface CCEaseBounceOut : CCEaseBounce {} @end + +/** CCEaseBounceInOut action. + @warning This action doesn't use a bijective fucntion. Actions like Sequence might have an unexpected result when used with this action. + @since v0.8.2 + */ +@interface CCEaseBounceInOut : CCEaseBounce {} @end + +/** CCEaseBackIn action. + @warning This action doesn't use a bijective fucntion. Actions like Sequence might have an unexpected result when used with this action. + @since v0.8.2 + */ +@interface CCEaseBackIn : CCActionEase {} @end + +/** CCEaseBackOut action. + @warning This action doesn't use a bijective fucntion. Actions like Sequence might have an unexpected result when used with this action. + @since v0.8.2 + */ +@interface CCEaseBackOut : CCActionEase {} @end + +/** CCEaseBackInOut action. + @warning This action doesn't use a bijective fucntion. Actions like Sequence might have an unexpected result when used with this action. + @since v0.8.2 + */ +@interface CCEaseBackInOut : CCActionEase {} @end + diff --git a/libs/cocos2d/CCActionEase.m b/libs/cocos2d/CCActionEase.m new file mode 100755 index 0000000..f28be11 --- /dev/null +++ b/libs/cocos2d/CCActionEase.m @@ -0,0 +1,534 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2008-2009 Jason Booth + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + + +/* + * Elastic, Back and Bounce actions based on code from: + * http://github.com/NikhilK/silverlightfx/ + * + * by http://github.com/NikhilK + */ + +#import "CCActionEase.h" + +#ifndef M_PI_X_2 +#define M_PI_X_2 (float)M_PI * 2.0f +#endif + +#pragma mark EaseAction + +// +// EaseAction +// +@implementation CCActionEase + ++(id) actionWithAction: (CCActionInterval*) action +{ + return [[[self alloc] initWithAction: action] autorelease ]; +} + +-(id) initWithAction: (CCActionInterval*) action +{ + NSAssert( action!=nil, @"Ease: arguments must be non-nil"); + + if( (self=[super initWithDuration: action.duration]) ) + other = [action retain]; + + return self; +} + +-(id) copyWithZone: (NSZone*) zone +{ + CCAction *copy = [[[self class] allocWithZone:zone] initWithAction:[[other copy] autorelease]]; + return copy; +} + +-(void) dealloc +{ + [other release]; + [super dealloc]; +} + +-(void) startWithTarget:(id)aTarget +{ + [super startWithTarget:aTarget]; + [other startWithTarget:target_]; +} + +-(void) stop +{ + [other stop]; + [super stop]; +} + +-(void) update: (ccTime) t +{ + [other update: t]; +} + +-(CCActionInterval*) reverse +{ + return [[self class] actionWithAction: [other reverse]]; +} +@end + + +#pragma mark - +#pragma mark EaseRate + +// +// EaseRateAction +// +@implementation CCEaseRateAction +@synthesize rate; ++(id) actionWithAction: (CCActionInterval*) action rate:(float)aRate +{ + return [[[self alloc] initWithAction: action rate:aRate] autorelease ]; +} + +-(id) initWithAction: (CCActionInterval*) action rate:(float)aRate +{ + if( (self=[super initWithAction:action ]) ) + self.rate = aRate; + + return self; +} + +-(id) copyWithZone: (NSZone*) zone +{ + CCAction *copy = [[[self class] allocWithZone:zone] initWithAction:[[other copy] autorelease] rate:rate]; + return copy; +} + +-(void) dealloc +{ + [super dealloc]; +} + +-(CCActionInterval*) reverse +{ + return [[self class] actionWithAction: [other reverse] rate:1/rate]; +} +@end + +// +// EeseIn +// +@implementation CCEaseIn +-(void) update: (ccTime) t +{ + [other update: powf(t,rate)]; +} +@end + +// +// EaseOut +// +@implementation CCEaseOut +-(void) update: (ccTime) t +{ + [other update: powf(t,1/rate)]; +} +@end + +// +// EaseInOut +// +@implementation CCEaseInOut +-(void) update: (ccTime) t +{ + int sign =1; + int r = (int) rate; + if (r % 2 == 0) + sign = -1; + t *= 2; + if (t < 1) + [other update: 0.5f * powf (t, rate)]; + else + [other update: sign*0.5f * (powf (t-2, rate) + sign*2)]; +} + +// InOut and OutIn are symmetrical +-(CCActionInterval*) reverse +{ + return [[self class] actionWithAction: [other reverse] rate:rate]; +} + +@end + +#pragma mark - +#pragma mark EaseExponential + +// +// EaseExponentialIn +// +@implementation CCEaseExponentialIn +-(void) update: (ccTime) t +{ + [other update: (t==0) ? 0 : powf(2, 10 * (t/1 - 1)) - 1 * 0.001f]; +} + +- (CCActionInterval*) reverse +{ + return [CCEaseExponentialOut actionWithAction: [other reverse]]; +} +@end + +// +// EaseExponentialOut +// +@implementation CCEaseExponentialOut +-(void) update: (ccTime) t +{ + [other update: (t==1) ? 1 : (-powf(2, -10 * t/1) + 1)]; +} + +- (CCActionInterval*) reverse +{ + return [CCEaseExponentialIn actionWithAction: [other reverse]]; +} +@end + +// +// EaseExponentialInOut +// +@implementation CCEaseExponentialInOut +-(void) update: (ccTime) t +{ + t /= 0.5f; + if (t < 1) + t = 0.5f * powf(2, 10 * (t - 1)); + else + t = 0.5f * (-powf(2, -10 * (t -1) ) + 2); + + [other update:t]; +} +@end + + +#pragma mark - +#pragma mark EaseSin actions + +// +// EaseSineIn +// +@implementation CCEaseSineIn +-(void) update: (ccTime) t +{ + [other update:-1*cosf(t * (float)M_PI_2) +1]; +} + +- (CCActionInterval*) reverse +{ + return [CCEaseSineOut actionWithAction: [other reverse]]; +} +@end + +// +// EaseSineOut +// +@implementation CCEaseSineOut +-(void) update: (ccTime) t +{ + [other update:sinf(t * (float)M_PI_2)]; +} + +- (CCActionInterval*) reverse +{ + return [CCEaseSineIn actionWithAction: [other reverse]]; +} +@end + +// +// EaseSineInOut +// +@implementation CCEaseSineInOut +-(void) update: (ccTime) t +{ + [other update:-0.5f*(cosf( (float)M_PI*t) - 1)]; +} +@end + +#pragma mark - +#pragma mark EaseElastic actions + +// +// EaseElastic +// +@implementation CCEaseElastic + +@synthesize period = period_; + ++(id) actionWithAction: (CCActionInterval*) action +{ + return [[[self alloc] initWithAction:action period:0.3f] autorelease]; +} + ++(id) actionWithAction: (CCActionInterval*) action period:(float)period +{ + return [[[self alloc] initWithAction:action period:period] autorelease]; +} + +-(id) initWithAction: (CCActionInterval*) action +{ + return [self initWithAction:action period:0.3f]; +} + +-(id) initWithAction: (CCActionInterval*) action period:(float)period +{ + if( (self=[super initWithAction:action]) ) + period_ = period; + + return self; +} + +-(id) copyWithZone: (NSZone*) zone +{ + CCAction *copy = [[[self class] allocWithZone:zone] initWithAction:[[other copy] autorelease] period:period_]; + return copy; +} + +-(CCActionInterval*) reverse +{ + NSAssert(NO,@"Override me"); + return nil; +} + +@end + +// +// EaseElasticIn +// + +@implementation CCEaseElasticIn +-(void) update: (ccTime) t +{ + ccTime newT = 0; + if (t == 0 || t == 1) + newT = t; + + else { + float s = period_ / 4; + t = t - 1; + newT = -powf(2, 10 * t) * sinf( (t-s) *M_PI_X_2 / period_); + } + [other update:newT]; +} + +- (CCActionInterval*) reverse +{ + return [CCEaseElasticOut actionWithAction: [other reverse] period:period_]; +} + +@end + +// +// EaseElasticOut +// +@implementation CCEaseElasticOut + +-(void) update: (ccTime) t +{ + ccTime newT = 0; + if (t == 0 || t == 1) { + newT = t; + + } else { + float s = period_ / 4; + newT = powf(2, -10 * t) * sinf( (t-s) *M_PI_X_2 / period_) + 1; + } + [other update:newT]; +} + +- (CCActionInterval*) reverse +{ + return [CCEaseElasticIn actionWithAction: [other reverse] period:period_]; +} + +@end + +// +// EaseElasticInOut +// +@implementation CCEaseElasticInOut +-(void) update: (ccTime) t +{ + ccTime newT = 0; + + if( t == 0 || t == 1 ) + newT = t; + else { + t = t * 2; + if(! period_ ) + period_ = 0.3f * 1.5f; + ccTime s = period_ / 4; + + t = t -1; + if( t < 0 ) + newT = -0.5f * powf(2, 10 * t) * sinf((t - s) * M_PI_X_2 / period_); + else + newT = powf(2, -10 * t) * sinf((t - s) * M_PI_X_2 / period_) * 0.5f + 1; + } + [other update:newT]; +} + +- (CCActionInterval*) reverse +{ + return [CCEaseElasticInOut actionWithAction: [other reverse] period:period_]; +} + +@end + +#pragma mark - +#pragma mark EaseBounce actions + +// +// EaseBounce +// +@implementation CCEaseBounce +-(ccTime) bounceTime:(ccTime) t +{ + if (t < 1 / 2.75) { + return 7.5625f * t * t; + } + else if (t < 2 / 2.75) { + t -= 1.5f / 2.75f; + return 7.5625f * t * t + 0.75f; + } + else if (t < 2.5 / 2.75) { + t -= 2.25f / 2.75f; + return 7.5625f * t * t + 0.9375f; + } + + t -= 2.625f / 2.75f; + return 7.5625f * t * t + 0.984375f; +} +@end + +// +// EaseBounceIn +// + +@implementation CCEaseBounceIn + +-(void) update: (ccTime) t +{ + ccTime newT = 1 - [self bounceTime:1-t]; + [other update:newT]; +} + +- (CCActionInterval*) reverse +{ + return [CCEaseBounceOut actionWithAction: [other reverse]]; +} + +@end + +@implementation CCEaseBounceOut + +-(void) update: (ccTime) t +{ + ccTime newT = [self bounceTime:t]; + [other update:newT]; +} + +- (CCActionInterval*) reverse +{ + return [CCEaseBounceIn actionWithAction: [other reverse]]; +} + +@end + +@implementation CCEaseBounceInOut + +-(void) update: (ccTime) t +{ + ccTime newT = 0; + if (t < 0.5) { + t = t * 2; + newT = (1 - [self bounceTime:1-t] ) * 0.5f; + } else + newT = [self bounceTime:t * 2 - 1] * 0.5f + 0.5f; + + [other update:newT]; +} +@end + +#pragma mark - +#pragma mark Ease Back actions + +// +// EaseBackIn +// +@implementation CCEaseBackIn + +-(void) update: (ccTime) t +{ + ccTime overshoot = 1.70158f; + [other update: t * t * ((overshoot + 1) * t - overshoot)]; +} + +- (CCActionInterval*) reverse +{ + return [CCEaseBackOut actionWithAction: [other reverse]]; +} +@end + +// +// EaseBackOut +// +@implementation CCEaseBackOut +-(void) update: (ccTime) t +{ + ccTime overshoot = 1.70158f; + + t = t - 1; + [other update: t * t * ((overshoot + 1) * t + overshoot) + 1]; +} + +- (CCActionInterval*) reverse +{ + return [CCEaseBackIn actionWithAction: [other reverse]]; +} +@end + +// +// EaseBackInOut +// +@implementation CCEaseBackInOut + +-(void) update: (ccTime) t +{ + ccTime overshoot = 1.70158f * 1.525f; + + t = t * 2; + if (t < 1) + [other update: (t * t * ((overshoot + 1) * t - overshoot)) / 2]; + else { + t = t - 2; + [other update: (t * t * ((overshoot + 1) * t + overshoot)) / 2 + 1]; + } +} +@end diff --git a/libs/cocos2d/CCActionGrid.h b/libs/cocos2d/CCActionGrid.h new file mode 100755 index 0000000..6b31179 --- /dev/null +++ b/libs/cocos2d/CCActionGrid.h @@ -0,0 +1,165 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2009 On-Core + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + + +#import "CCActionInterval.h" +#import "CCActionInstant.h" +#import "CCGrid.h" + +@class CCGridBase; + +/** Base class for Grid actions */ +@interface CCGridAction : CCActionInterval +{ + ccGridSize gridSize_; +} + +/** size of the grid */ +@property (nonatomic,readwrite) ccGridSize gridSize; + +/** creates the action with size and duration */ ++(id) actionWithSize:(ccGridSize)size duration:(ccTime)d; +/** initializes the action with size and duration */ +-(id) initWithSize:(ccGridSize)gridSize duration:(ccTime)d; +/** returns the grid */ +-(CCGridBase *)grid; + +@end + +//////////////////////////////////////////////////////////// + +/** Base class for CCGrid3D actions. + Grid3D actions can modify a non-tiled grid. + */ +@interface CCGrid3DAction : CCGridAction +{ +} + +/** returns the vertex than belongs to certain position in the grid */ +-(ccVertex3F)vertex:(ccGridSize)pos; +/** returns the non-transformed vertex than belongs to certain position in the grid */ +-(ccVertex3F)originalVertex:(ccGridSize)pos; +/** sets a new vertex to a certain position of the grid */ +-(void)setVertex:(ccGridSize)pos vertex:(ccVertex3F)vertex; + +@end + +//////////////////////////////////////////////////////////// + +/** Base class for CCTiledGrid3D actions */ +@interface CCTiledGrid3DAction : CCGridAction +{ +} + +/** returns the tile that belongs to a certain position of the grid */ +-(ccQuad3)tile:(ccGridSize)pos; +/** returns the non-transformed tile that belongs to a certain position of the grid */ +-(ccQuad3)originalTile:(ccGridSize)pos; +/** sets a new tile to a certain position of the grid */ +-(void)setTile:(ccGridSize)pos coords:(ccQuad3)coords; + +@end + +//////////////////////////////////////////////////////////// + +/** CCAccelDeccelAmplitude action */ +@interface CCAccelDeccelAmplitude : CCActionInterval +{ + float rate_; + CCActionInterval *other_; +} + +/** amplitude rate */ +@property (nonatomic,readwrite) float rate; + +/** creates the action with an inner action that has the amplitude property, and a duration time */ ++(id)actionWithAction:(CCAction*)action duration:(ccTime)d; +/** initializes the action with an inner action that has the amplitude property, and a duration time */ +-(id)initWithAction:(CCAction*)action duration:(ccTime)d; + +@end + +//////////////////////////////////////////////////////////// + +/** CCAccelAmplitude action */ +@interface CCAccelAmplitude : CCActionInterval +{ + float rate_; + CCActionInterval *other_; +} + +/** amplitude rate */ +@property (nonatomic,readwrite) float rate; + +/** creates the action with an inner action that has the amplitude property, and a duration time */ ++(id)actionWithAction:(CCAction*)action duration:(ccTime)d; +/** initializes the action with an inner action that has the amplitude property, and a duration time */ +-(id)initWithAction:(CCAction*)action duration:(ccTime)d; + +@end + +//////////////////////////////////////////////////////////// + +/** CCDeccelAmplitude action */ +@interface CCDeccelAmplitude : CCActionInterval +{ + float rate_; + CCActionInterval *other_; +} + +/** amplitude rate */ +@property (nonatomic,readwrite) float rate; + +/** creates the action with an inner action that has the amplitude property, and a duration time */ ++(id)actionWithAction:(CCAction*)action duration:(ccTime)d; +/** initializes the action with an inner action that has the amplitude property, and a duration time */ +-(id)initWithAction:(CCAction*)action duration:(ccTime)d; + +@end + +//////////////////////////////////////////////////////////// + +/** CCStopGrid action. + Don't call this action if another grid action is active. + Call if you want to remove the the grid effect. Example: + [Sequence actions:[Lens ...], [StopGrid action], nil]; + */ +@interface CCStopGrid : CCActionInstant +{ +} +@end + +//////////////////////////////////////////////////////////// + +/** CCReuseGrid action */ +@interface CCReuseGrid : CCActionInstant +{ + int t_; +} +/** creates an action with the number of times that the current grid will be reused */ ++(id) actionWithTimes: (int) times; +/** initializes an action with the number of times that the current grid will be reused */ +-(id) initWithTimes: (int) times; +@end diff --git a/libs/cocos2d/CCActionGrid.m b/libs/cocos2d/CCActionGrid.m new file mode 100755 index 0000000..638e27d --- /dev/null +++ b/libs/cocos2d/CCActionGrid.m @@ -0,0 +1,386 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2009 On-Core + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + + +#import "CCActionGrid.h" +#import "CCDirector.h" + +#pragma mark - +#pragma mark GridAction + +@implementation CCGridAction + +@synthesize gridSize = gridSize_; + ++(id) actionWithSize:(ccGridSize)size duration:(ccTime)d +{ + return [[[self alloc] initWithSize:size duration:d ] autorelease]; +} + +-(id) initWithSize:(ccGridSize)gSize duration:(ccTime)d +{ + if ( (self = [super initWithDuration:d]) ) + { + gridSize_ = gSize; + } + + return self; +} + +-(void)startWithTarget:(id)aTarget +{ + [super startWithTarget:aTarget]; + + CCGridBase *newgrid = [self grid]; + + CCNode *t = (CCNode*) target_; + CCGridBase *targetGrid = [t grid]; + + if ( targetGrid && targetGrid.reuseGrid > 0 ) + { + if ( targetGrid.active && targetGrid.gridSize.x == gridSize_.x && targetGrid.gridSize.y == gridSize_.y && [targetGrid isKindOfClass:[newgrid class]] ) + [targetGrid reuse]; + else + [NSException raise:@"GridBase" format:@"Cannot reuse grid"]; + } + else + { + if ( targetGrid && targetGrid.active ) + targetGrid.active = NO; + + t.grid = newgrid; + t.grid.active = YES; + } +} + +-(CCGridBase *)grid +{ + [NSException raise:@"GridBase" format:@"Abstract class needs implementation"]; + return nil; +} + +- (CCActionInterval*) reverse +{ + return [CCReverseTime actionWithAction:self]; +} + +-(id) copyWithZone: (NSZone*) zone +{ + CCGridAction *copy = [[[self class] allocWithZone:zone] initWithSize:gridSize_ duration:duration_]; + return copy; +} +@end + +//////////////////////////////////////////////////////////// + +#pragma mark - +#pragma mark Grid3DAction + +@implementation CCGrid3DAction + +-(CCGridBase *)grid +{ + return [CCGrid3D gridWithSize:gridSize_]; +} + +-(ccVertex3F)vertex:(ccGridSize)pos +{ + CCGrid3D *g = (CCGrid3D *)[target_ grid]; + return [g vertex:pos]; +} + +-(ccVertex3F)originalVertex:(ccGridSize)pos +{ + CCGrid3D *g = (CCGrid3D *)[target_ grid]; + return [g originalVertex:pos]; +} + +-(void)setVertex:(ccGridSize)pos vertex:(ccVertex3F)vertex +{ + CCGrid3D *g = (CCGrid3D *)[target_ grid]; + [g setVertex:pos vertex:vertex]; +} +@end + +//////////////////////////////////////////////////////////// + +#pragma mark - +#pragma mark TiledGrid3DAction + +@implementation CCTiledGrid3DAction + +-(CCGridBase *)grid +{ + return [CCTiledGrid3D gridWithSize:gridSize_]; +} + +-(ccQuad3)tile:(ccGridSize)pos +{ + CCTiledGrid3D *g = (CCTiledGrid3D *)[target_ grid]; + return [g tile:pos]; +} + +-(ccQuad3)originalTile:(ccGridSize)pos +{ + CCTiledGrid3D *g = (CCTiledGrid3D *)[target_ grid]; + return [g originalTile:pos]; +} + +-(void)setTile:(ccGridSize)pos coords:(ccQuad3)coords +{ + CCTiledGrid3D *g = (CCTiledGrid3D *)[target_ grid]; + [g setTile:pos coords:coords]; +} + +@end + +//////////////////////////////////////////////////////////// + +@interface CCActionInterval (Amplitude) +-(void)setAmplitudeRate:(CGFloat)amp; +-(CGFloat)getAmplitudeRate; +@end + +@implementation CCActionInterval (Amplitude) +-(void)setAmplitudeRate:(CGFloat)amp +{ + [NSException raise:@"IntervalAction (Amplitude)" format:@"Abstract class needs implementation"]; +} + +-(CGFloat)getAmplitudeRate +{ + [NSException raise:@"IntervalAction (Amplitude)" format:@"Abstract class needs implementation"]; + return 0; +} +@end + +//////////////////////////////////////////////////////////// + +#pragma mark - +#pragma mark AccelDeccelAmplitude + +@implementation CCAccelDeccelAmplitude + +@synthesize rate=rate_; + ++(id)actionWithAction:(CCAction*)action duration:(ccTime)d +{ + return [[[self alloc] initWithAction:action duration:d ] autorelease]; +} + +-(id)initWithAction:(CCAction *)action duration:(ccTime)d +{ + if ( (self = [super initWithDuration:d]) ) + { + rate_ = 1.0f; + other_ = (CCActionInterval*)[action retain]; + } + + return self; +} + +-(void)dealloc +{ + [other_ release]; + [super dealloc]; +} + +-(void)startWithTarget:(id)aTarget +{ + [super startWithTarget:aTarget]; + [other_ startWithTarget:target_]; +} + +-(void) update: (ccTime) time +{ + float f = time*2; + + if (f > 1) + { + f -= 1; + f = 1 - f; + } + + [other_ setAmplitudeRate:powf(f, rate_)]; + [other_ update:time]; +} + +- (CCActionInterval*) reverse +{ + return [CCAccelDeccelAmplitude actionWithAction:[other_ reverse] duration:duration_]; +} + +@end + +//////////////////////////////////////////////////////////// + +#pragma mark - +#pragma mark AccelAmplitude + +@implementation CCAccelAmplitude + +@synthesize rate=rate_; + ++(id)actionWithAction:(CCAction*)action duration:(ccTime)d +{ + return [[[self alloc] initWithAction:action duration:d ] autorelease]; +} + +-(id)initWithAction:(CCAction *)action duration:(ccTime)d +{ + if ( (self = [super initWithDuration:d]) ) + { + rate_ = 1.0f; + other_ = (CCActionInterval*)[action retain]; + } + + return self; +} + +-(void)dealloc +{ + [other_ release]; + [super dealloc]; +} + +-(void)startWithTarget:(id)aTarget +{ + [super startWithTarget:aTarget]; + [other_ startWithTarget:target_]; +} + +-(void) update: (ccTime) time +{ + [other_ setAmplitudeRate:powf(time, rate_)]; + [other_ update:time]; +} + +- (CCActionInterval*) reverse +{ + return [CCAccelAmplitude actionWithAction:[other_ reverse] duration:self.duration]; +} + +@end + +//////////////////////////////////////////////////////////// + +#pragma mark - +#pragma mark DeccelAmplitude + +@implementation CCDeccelAmplitude + +@synthesize rate=rate_; + ++(id)actionWithAction:(CCAction*)action duration:(ccTime)d +{ + return [[[self alloc] initWithAction:action duration:d ] autorelease]; +} + +-(id)initWithAction:(CCAction *)action duration:(ccTime)d +{ + if ( (self = [super initWithDuration:d]) ) + { + rate_ = 1.0f; + other_ = (CCActionInterval*)[action retain]; + } + + return self; +} + +-(void)dealloc +{ + [other_ release]; + [super dealloc]; +} + +-(void)startWithTarget:(id)aTarget +{ + [super startWithTarget:aTarget]; + [other_ startWithTarget:target_]; +} + +-(void) update: (ccTime) time +{ + [other_ setAmplitudeRate:powf((1-time), rate_)]; + [other_ update:time]; +} + +- (CCActionInterval*) reverse +{ + return [CCDeccelAmplitude actionWithAction:[other_ reverse] duration:self.duration]; +} + +@end + +//////////////////////////////////////////////////////////// + +#pragma mark - +#pragma mark StopGrid + +@implementation CCStopGrid + +-(void)startWithTarget:(id)aTarget +{ + [super startWithTarget:aTarget]; + + if ( [[self target] grid] && [[[self target] grid] active] ) { + [[[self target] grid] setActive: NO]; + +// [[self target] setGrid: nil]; + } +} + +@end + +//////////////////////////////////////////////////////////// + +#pragma mark - +#pragma mark ReuseGrid + +@implementation CCReuseGrid + ++(id)actionWithTimes:(int)times +{ + return [[[self alloc] initWithTimes:times ] autorelease]; +} + +-(id)initWithTimes:(int)times +{ + if ( (self = [super init]) ) + t_ = times; + + return self; +} + +-(void)startWithTarget:(id)aTarget +{ + [super startWithTarget:aTarget]; + + CCNode *myTarget = (CCNode*) [self target]; + if ( myTarget.grid && myTarget.grid.active ) + myTarget.grid.reuseGrid += t_; +} + +@end diff --git a/libs/cocos2d/CCActionGrid3D.h b/libs/cocos2d/CCActionGrid3D.h new file mode 100755 index 0000000..a8003f4 --- /dev/null +++ b/libs/cocos2d/CCActionGrid3D.h @@ -0,0 +1,208 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2009 On-Core + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + + +#import "CCActionGrid.h" + +/** CCWaves3D action */ +@interface CCWaves3D : CCGrid3DAction +{ + int waves; + float amplitude; + float amplitudeRate; +} + +/** amplitude of the wave */ +@property (nonatomic,readwrite) float amplitude; +/** amplitude rate of the wave */ +@property (nonatomic,readwrite) float amplitudeRate; + ++(id)actionWithWaves:(int)wav amplitude:(float)amp grid:(ccGridSize)gridSize duration:(ccTime)d; +-(id)initWithWaves:(int)wav amplitude:(float)amp grid:(ccGridSize)gridSize duration:(ccTime)d; + +@end + +//////////////////////////////////////////////////////////// + +/** CCFlipX3D action */ +@interface CCFlipX3D : CCGrid3DAction +{ +} + +/** creates the action with duration */ ++(id) actionWithDuration:(ccTime)d; +/** initizlies the action with duration */ +-(id) initWithDuration:(ccTime)d; + +@end + +//////////////////////////////////////////////////////////// + +/** CCFlipY3D action */ +@interface CCFlipY3D : CCFlipX3D +{ +} + +@end + +//////////////////////////////////////////////////////////// + +/** CCLens3D action */ +@interface CCLens3D : CCGrid3DAction +{ + CGPoint position_; + CGPoint positionInPixels_; + float radius_; + float lensEffect_; + BOOL dirty_; +} + +/** lens effect. Defaults to 0.7 - 0 means no effect, 1 is very strong effect */ +@property (nonatomic,readwrite) float lensEffect; +/** lens center position in Points */ +@property (nonatomic,readwrite) CGPoint position; + +/** creates the action with center position in Points, radius, a grid size and duration */ ++(id)actionWithPosition:(CGPoint)pos radius:(float)r grid:(ccGridSize)gridSize duration:(ccTime)d; +/** initializes the action with center position in Points, radius, a grid size and duration */ +-(id)initWithPosition:(CGPoint)pos radius:(float)r grid:(ccGridSize)gridSize duration:(ccTime)d; + +@end + +//////////////////////////////////////////////////////////// + +/** CCRipple3D action */ +@interface CCRipple3D : CCGrid3DAction +{ + CGPoint position_; + CGPoint positionInPixels_; + float radius_; + int waves_; + float amplitude_; + float amplitudeRate_; +} + +/** center position in Points */ +@property (nonatomic,readwrite) CGPoint position; +/** amplitude */ +@property (nonatomic,readwrite) float amplitude; +/** amplitude rate */ +@property (nonatomic,readwrite) float amplitudeRate; + +/** creates the action with a position in points, radius, number of waves, amplitude, a grid size and duration */ ++(id)actionWithPosition:(CGPoint)pos radius:(float)r waves:(int)wav amplitude:(float)amp grid:(ccGridSize)gridSize duration:(ccTime)d; +/** initializes the action with a position in points, radius, number of waves, amplitude, a grid size and duration */ +-(id)initWithPosition:(CGPoint)pos radius:(float)r waves:(int)wav amplitude:(float)amp grid:(ccGridSize)gridSize duration:(ccTime)d; + +@end + +//////////////////////////////////////////////////////////// + +/** CCShaky3D action */ +@interface CCShaky3D : CCGrid3DAction +{ + int randrange; + BOOL shakeZ; +} + +/** creates the action with a range, shake Z vertices, a grid and duration */ ++(id)actionWithRange:(int)range shakeZ:(BOOL)shakeZ grid:(ccGridSize)gridSize duration:(ccTime)d; +/** initializes the action with a range, shake Z vertices, a grid and duration */ +-(id)initWithRange:(int)range shakeZ:(BOOL)shakeZ grid:(ccGridSize)gridSize duration:(ccTime)d; + +@end + +//////////////////////////////////////////////////////////// + +/** CCLiquid action */ +@interface CCLiquid : CCGrid3DAction +{ + int waves; + float amplitude; + float amplitudeRate; + +} + +/** amplitude */ +@property (nonatomic,readwrite) float amplitude; +/** amplitude rate */ +@property (nonatomic,readwrite) float amplitudeRate; + +/** creates the action with amplitude, a grid and duration */ ++(id)actionWithWaves:(int)wav amplitude:(float)amp grid:(ccGridSize)gridSize duration:(ccTime)d; +/** initializes the action with amplitude, a grid and duration */ +-(id)initWithWaves:(int)wav amplitude:(float)amp grid:(ccGridSize)gridSize duration:(ccTime)d; + +@end + +//////////////////////////////////////////////////////////// + +/** CCWaves action */ +@interface CCWaves : CCGrid3DAction +{ + int waves; + float amplitude; + float amplitudeRate; + BOOL vertical; + BOOL horizontal; +} + +/** amplitude */ +@property (nonatomic,readwrite) float amplitude; +/** amplitude rate */ +@property (nonatomic,readwrite) float amplitudeRate; + +/** initializes the action with amplitude, horizontal sin, vertical sin, a grid and duration */ ++(id)actionWithWaves:(int)wav amplitude:(float)amp horizontal:(BOOL)h vertical:(BOOL)v grid:(ccGridSize)gridSize duration:(ccTime)d; +/** creates the action with amplitude, horizontal sin, vertical sin, a grid and duration */ +-(id)initWithWaves:(int)wav amplitude:(float)amp horizontal:(BOOL)h vertical:(BOOL)v grid:(ccGridSize)gridSize duration:(ccTime)d; + +@end + +//////////////////////////////////////////////////////////// + +/** CCTwirl action */ +@interface CCTwirl : CCGrid3DAction +{ + CGPoint position_; + CGPoint positionInPixels_; + int twirls_; + float amplitude_; + float amplitudeRate_; +} + +/** twirl center */ +@property (nonatomic,readwrite) CGPoint position; +/** amplitude */ +@property (nonatomic,readwrite) float amplitude; +/** amplitude rate */ +@property (nonatomic,readwrite) float amplitudeRate; + +/** creates the action with center position, number of twirls, amplitude, a grid size and duration */ ++(id)actionWithPosition:(CGPoint)pos twirls:(int)t amplitude:(float)amp grid:(ccGridSize)gridSize duration:(ccTime)d; +/** initializes the action with center position, number of twirls, amplitude, a grid size and duration */ +-(id)initWithPosition:(CGPoint)pos twirls:(int)t amplitude:(float)amp grid:(ccGridSize)gridSize duration:(ccTime)d; + +@end diff --git a/libs/cocos2d/CCActionGrid3D.m b/libs/cocos2d/CCActionGrid3D.m new file mode 100755 index 0000000..1d4a783 --- /dev/null +++ b/libs/cocos2d/CCActionGrid3D.m @@ -0,0 +1,659 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2009 On-Core + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + + +#import "CCActionGrid3D.h" +#import "ccMacros.h" +#import "Support/CGPointExtension.h" + +#pragma mark - +#pragma mark Waves3D + +@implementation CCWaves3D + +@synthesize amplitude; +@synthesize amplitudeRate; + ++(id)actionWithWaves:(int)wav amplitude:(float)amp grid:(ccGridSize)gridSize duration:(ccTime)d +{ + return [[[self alloc] initWithWaves:wav amplitude:amp grid:gridSize duration:d] autorelease]; +} + +-(id)initWithWaves:(int)wav amplitude:(float)amp grid:(ccGridSize)gSize duration:(ccTime)d +{ + if ( (self = [super initWithSize:gSize duration:d]) ) + { + waves = wav; + amplitude = amp; + amplitudeRate = 1.0f; + } + + return self; +} + +-(id) copyWithZone: (NSZone*) zone +{ + CCGridAction *copy = [[[self class] allocWithZone:zone] initWithWaves:waves amplitude:amplitude grid:gridSize_ duration:duration_]; + return copy; +} + + +-(void)update:(ccTime)time +{ + int i, j; + + for( i = 0; i < (gridSize_.x+1); i++ ) + { + for( j = 0; j < (gridSize_.y+1); j++ ) + { + ccVertex3F v = [self originalVertex:ccg(i,j)]; + v.z += (sinf((CGFloat)M_PI*time*waves*2 + (v.y+v.x) * .01f) * amplitude * amplitudeRate); + [self setVertex:ccg(i,j) vertex:v]; + } + } +} +@end + +//////////////////////////////////////////////////////////// + +#pragma mark - +#pragma mark FlipX3D + +@implementation CCFlipX3D + ++(id) actionWithDuration:(ccTime)d +{ + return [[[self alloc] initWithSize:ccg(1,1) duration:d] autorelease]; +} + +-(id) initWithDuration:(ccTime)d +{ + return [super initWithSize:ccg(1,1) duration:d]; +} + +-(id)initWithSize:(ccGridSize)gSize duration:(ccTime)d +{ + if ( gSize.x != 1 || gSize.y != 1 ) + { + [NSException raise:@"FlipX3D" format:@"Grid size must be (1,1)"]; + } + + return [super initWithSize:gSize duration:d]; +} + +-(id) copyWithZone: (NSZone*) zone +{ + CCGridAction *copy = [[[self class] allocWithZone:zone] initWithSize:gridSize_ duration:duration_]; + return copy; +} + + +-(void)update:(ccTime)time +{ + CGFloat angle = (CGFloat)M_PI * time; // 180 degrees + CGFloat mz = sinf( angle ); + angle = angle / 2.0f; // x calculates degrees from 0 to 90 + CGFloat mx = cosf( angle ); + + ccVertex3F v0, v1, v, diff; + + v0 = [self originalVertex:ccg(1,1)]; + v1 = [self originalVertex:ccg(0,0)]; + + CGFloat x0 = v0.x; + CGFloat x1 = v1.x; + CGFloat x; + ccGridSize a, b, c, d; + + if ( x0 > x1 ) + { + // Normal Grid + a = ccg(0,0); + b = ccg(0,1); + c = ccg(1,0); + d = ccg(1,1); + x = x0; + } + else + { + // Reversed Grid + c = ccg(0,0); + d = ccg(0,1); + a = ccg(1,0); + b = ccg(1,1); + x = x1; + } + + diff.x = ( x - x * mx ); + diff.z = fabsf( floorf( (x * mz) / 4.0f ) ); + +// bottom-left + v = [self originalVertex:a]; + v.x = diff.x; + v.z += diff.z; + [self setVertex:a vertex:v]; + +// upper-left + v = [self originalVertex:b]; + v.x = diff.x; + v.z += diff.z; + [self setVertex:b vertex:v]; + +// bottom-right + v = [self originalVertex:c]; + v.x -= diff.x; + v.z -= diff.z; + [self setVertex:c vertex:v]; + +// upper-right + v = [self originalVertex:d]; + v.x -= diff.x; + v.z -= diff.z; + [self setVertex:d vertex:v]; +} + +@end + +//////////////////////////////////////////////////////////// + +#pragma mark - +#pragma mark FlipY3D + +@implementation CCFlipY3D + +-(void)update:(ccTime)time +{ + CGFloat angle = (CGFloat)M_PI * time; // 180 degrees + CGFloat mz = sinf( angle ); + angle = angle / 2.0f; // x calculates degrees from 0 to 90 + CGFloat my = cosf( angle ); + + ccVertex3F v0, v1, v, diff; + + v0 = [self originalVertex:ccg(1,1)]; + v1 = [self originalVertex:ccg(0,0)]; + + CGFloat y0 = v0.y; + CGFloat y1 = v1.y; + CGFloat y; + ccGridSize a, b, c, d; + + if ( y0 > y1 ) + { + // Normal Grid + a = ccg(0,0); + b = ccg(0,1); + c = ccg(1,0); + d = ccg(1,1); + y = y0; + } + else + { + // Reversed Grid + b = ccg(0,0); + a = ccg(0,1); + d = ccg(1,0); + c = ccg(1,1); + y = y1; + } + + diff.y = y - y * my; + diff.z = fabsf( floorf( (y * mz) / 4.0f ) ); + + // bottom-left + v = [self originalVertex:a]; + v.y = diff.y; + v.z += diff.z; + [self setVertex:a vertex:v]; + + // upper-left + v = [self originalVertex:b]; + v.y -= diff.y; + v.z -= diff.z; + [self setVertex:b vertex:v]; + + // bottom-right + v = [self originalVertex:c]; + v.y = diff.y; + v.z += diff.z; + [self setVertex:c vertex:v]; + + // upper-right + v = [self originalVertex:d]; + v.y -= diff.y; + v.z -= diff.z; + [self setVertex:d vertex:v]; +} + +@end + +//////////////////////////////////////////////////////////// + +#pragma mark - +#pragma mark Lens3D + +@implementation CCLens3D + +@synthesize lensEffect=lensEffect_; + ++(id)actionWithPosition:(CGPoint)pos radius:(float)r grid:(ccGridSize)gridSize duration:(ccTime)d +{ + return [[[self alloc] initWithPosition:pos radius:r grid:gridSize duration:d] autorelease]; +} + +-(id)initWithPosition:(CGPoint)pos radius:(float)r grid:(ccGridSize)gSize duration:(ccTime)d +{ + if ( (self = [super initWithSize:gSize duration:d]) ) + { + position_ = ccp(-1,-1); + self.position = pos; + radius_ = r; + lensEffect_ = 0.7f; + dirty_ = YES; + } + + return self; +} + +-(id) copyWithZone: (NSZone*) zone +{ + CCGridAction *copy = [[[self class] allocWithZone:zone] initWithPosition:position_ radius:radius_ grid:gridSize_ duration:duration_]; + return copy; +} + +-(void) setPosition:(CGPoint)pos +{ + if( ! CGPointEqualToPoint(pos, position_) ) { + position_ = pos; + positionInPixels_.x = pos.x * CC_CONTENT_SCALE_FACTOR(); + positionInPixels_.y = pos.y * CC_CONTENT_SCALE_FACTOR(); + + dirty_ = YES; + } +} + +-(CGPoint) position +{ + return position_; +} + +-(void)update:(ccTime)time +{ + if ( dirty_ ) + { + int i, j; + + for( i = 0; i < gridSize_.x+1; i++ ) + { + for( j = 0; j < gridSize_.y+1; j++ ) + { + ccVertex3F v = [self originalVertex:ccg(i,j)]; + CGPoint vect = ccpSub(positionInPixels_, ccp(v.x,v.y)); + CGFloat r = ccpLength(vect); + + if ( r < radius_ ) + { + r = radius_ - r; + CGFloat pre_log = r / radius_; + if ( pre_log == 0 ) pre_log = 0.001f; + float l = logf(pre_log) * lensEffect_; + float new_r = expf( l ) * radius_; + + if ( ccpLength(vect) > 0 ) + { + vect = ccpNormalize(vect); + CGPoint new_vect = ccpMult(vect, new_r); + v.z += ccpLength(new_vect) * lensEffect_; + } + } + + [self setVertex:ccg(i,j) vertex:v]; + } + } + + dirty_ = NO; + } +} + +@end + +//////////////////////////////////////////////////////////// + +#pragma mark - +#pragma mark Ripple3D + +@implementation CCRipple3D + +@synthesize amplitude = amplitude_; +@synthesize amplitudeRate = amplitudeRate_; + ++(id)actionWithPosition:(CGPoint)pos radius:(float)r waves:(int)wav amplitude:(float)amp grid:(ccGridSize)gridSize duration:(ccTime)d +{ + return [[[self alloc] initWithPosition:pos radius:r waves:wav amplitude:amp grid:gridSize duration:d] autorelease]; +} + +-(id)initWithPosition:(CGPoint)pos radius:(float)r waves:(int)wav amplitude:(float)amp grid:(ccGridSize)gSize duration:(ccTime)d +{ + if ( (self = [super initWithSize:gSize duration:d]) ) + { + self.position = pos; + radius_ = r; + waves_ = wav; + amplitude_ = amp; + amplitudeRate_ = 1.0f; + } + + return self; +} + +-(CGPoint) position +{ + return position_; +} + +-(void) setPosition:(CGPoint)pos +{ + position_ = pos; + positionInPixels_.x = pos.x * CC_CONTENT_SCALE_FACTOR(); + positionInPixels_.y = pos.y * CC_CONTENT_SCALE_FACTOR(); +} + +-(id) copyWithZone: (NSZone*) zone +{ + CCGridAction *copy = [[[self class] allocWithZone:zone] initWithPosition:position_ radius:radius_ waves:waves_ amplitude:amplitude_ grid:gridSize_ duration:duration_]; + return copy; +} + + +-(void)update:(ccTime)time +{ + int i, j; + + for( i = 0; i < (gridSize_.x+1); i++ ) + { + for( j = 0; j < (gridSize_.y+1); j++ ) + { + ccVertex3F v = [self originalVertex:ccg(i,j)]; + CGPoint vect = ccpSub(positionInPixels_, ccp(v.x,v.y)); + CGFloat r = ccpLength(vect); + + if ( r < radius_ ) + { + r = radius_ - r; + CGFloat rate = powf( r / radius_, 2); + v.z += (sinf( time*(CGFloat)M_PI*waves_*2 + r * 0.1f) * amplitude_ * amplitudeRate_ * rate ); + } + + [self setVertex:ccg(i,j) vertex:v]; + } + } +} + +@end + +//////////////////////////////////////////////////////////// + +#pragma mark - +#pragma mark Shaky3D + +@implementation CCShaky3D + ++(id)actionWithRange:(int)range shakeZ:(BOOL)sz grid:(ccGridSize)gridSize duration:(ccTime)d +{ + return [[[self alloc] initWithRange:range shakeZ:sz grid:gridSize duration:d] autorelease]; +} + +-(id)initWithRange:(int)range shakeZ:(BOOL)sz grid:(ccGridSize)gSize duration:(ccTime)d +{ + if ( (self = [super initWithSize:gSize duration:d]) ) + { + randrange = range; + shakeZ = sz; + } + + return self; +} + +-(id) copyWithZone: (NSZone*) zone +{ + CCGridAction *copy = [[[self class] allocWithZone:zone] initWithRange:randrange shakeZ:shakeZ grid:gridSize_ duration:duration_]; + return copy; +} + +-(void)update:(ccTime)time +{ + int i, j; + + for( i = 0; i < (gridSize_.x+1); i++ ) + { + for( j = 0; j < (gridSize_.y+1); j++ ) + { + ccVertex3F v = [self originalVertex:ccg(i,j)]; + v.x += ( rand() % (randrange*2) ) - randrange; + v.y += ( rand() % (randrange*2) ) - randrange; + if( shakeZ ) + v.z += ( rand() % (randrange*2) ) - randrange; + + [self setVertex:ccg(i,j) vertex:v]; + } + } +} + +@end + +//////////////////////////////////////////////////////////// + +#pragma mark - +#pragma mark Liquid + +@implementation CCLiquid + +@synthesize amplitude; +@synthesize amplitudeRate; + ++(id)actionWithWaves:(int)wav amplitude:(float)amp grid:(ccGridSize)gridSize duration:(ccTime)d +{ + return [[[self alloc] initWithWaves:wav amplitude:amp grid:gridSize duration:d] autorelease]; +} + +-(id)initWithWaves:(int)wav amplitude:(float)amp grid:(ccGridSize)gSize duration:(ccTime)d +{ + if ( (self = [super initWithSize:gSize duration:d]) ) + { + waves = wav; + amplitude = amp; + amplitudeRate = 1.0f; + } + + return self; +} + +-(void)update:(ccTime)time +{ + int i, j; + + for( i = 1; i < gridSize_.x; i++ ) + { + for( j = 1; j < gridSize_.y; j++ ) + { + ccVertex3F v = [self originalVertex:ccg(i,j)]; + v.x = (v.x + (sinf(time*(CGFloat)M_PI*waves*2 + v.x * .01f) * amplitude * amplitudeRate)); + v.y = (v.y + (sinf(time*(CGFloat)M_PI*waves*2 + v.y * .01f) * amplitude * amplitudeRate)); + [self setVertex:ccg(i,j) vertex:v]; + } + } +} + +-(id) copyWithZone: (NSZone*) zone +{ + CCGridAction *copy = [[[self class] allocWithZone:zone] initWithWaves:waves amplitude:amplitude grid:gridSize_ duration:duration_]; + return copy; +} + +@end + +//////////////////////////////////////////////////////////// + +#pragma mark - +#pragma mark Waves + +@implementation CCWaves + +@synthesize amplitude; +@synthesize amplitudeRate; + ++(id)actionWithWaves:(int)wav amplitude:(float)amp horizontal:(BOOL)h vertical:(BOOL)v grid:(ccGridSize)gridSize duration:(ccTime)d +{ + return [[[self alloc] initWithWaves:wav amplitude:amp horizontal:h vertical:v grid:gridSize duration:d] autorelease]; +} + +-(id)initWithWaves:(int)wav amplitude:(float)amp horizontal:(BOOL)h vertical:(BOOL)v grid:(ccGridSize)gSize duration:(ccTime)d +{ + if ( (self = [super initWithSize:gSize duration:d]) ) + { + waves = wav; + amplitude = amp; + amplitudeRate = 1.0f; + horizontal = h; + vertical = v; + } + + return self; +} + +-(void)update:(ccTime)time +{ + int i, j; + + for( i = 0; i < (gridSize_.x+1); i++ ) + { + for( j = 0; j < (gridSize_.y+1); j++ ) + { + ccVertex3F v = [self originalVertex:ccg(i,j)]; + + if ( vertical ) + v.x = (v.x + (sinf(time*(CGFloat)M_PI*waves*2 + v.y * .01f) * amplitude * amplitudeRate)); + + if ( horizontal ) + v.y = (v.y + (sinf(time*(CGFloat)M_PI*waves*2 + v.x * .01f) * amplitude * amplitudeRate)); + + [self setVertex:ccg(i,j) vertex:v]; + } + } +} + +-(id) copyWithZone: (NSZone*) zone +{ + CCGridAction *copy = [[[self class] allocWithZone:zone] initWithWaves:waves amplitude:amplitude horizontal:horizontal vertical:vertical grid:gridSize_ duration:duration_]; + return copy; +} + +@end + +//////////////////////////////////////////////////////////// + +#pragma mark - +#pragma mark Twirl + +@implementation CCTwirl + +@synthesize amplitude = amplitude_; +@synthesize amplitudeRate = amplitudeRate_; + ++(id)actionWithPosition:(CGPoint)pos twirls:(int)t amplitude:(float)amp grid:(ccGridSize)gridSize duration:(ccTime)d +{ + return [[[self alloc] initWithPosition:pos twirls:t amplitude:amp grid:gridSize duration:d] autorelease]; +} + +-(id)initWithPosition:(CGPoint)pos twirls:(int)t amplitude:(float)amp grid:(ccGridSize)gSize duration:(ccTime)d +{ + if ( (self = [super initWithSize:gSize duration:d]) ) + { + self.position = pos; + twirls_ = t; + amplitude_ = amp; + amplitudeRate_ = 1.0f; + } + + return self; +} + +-(void) setPosition:(CGPoint)pos +{ + position_ = pos; + positionInPixels_.x = pos.x * CC_CONTENT_SCALE_FACTOR(); + positionInPixels_.y = pos.y * CC_CONTENT_SCALE_FACTOR(); +} + +-(CGPoint) position +{ + return position_; +} + +-(void)update:(ccTime)time +{ + int i, j; + CGPoint c = positionInPixels_; + + for( i = 0; i < (gridSize_.x+1); i++ ) + { + for( j = 0; j < (gridSize_.y+1); j++ ) + { + ccVertex3F v = [self originalVertex:ccg(i,j)]; + + CGPoint avg = ccp(i-(gridSize_.x/2.0f), j-(gridSize_.y/2.0f)); + CGFloat r = ccpLength( avg ); + + CGFloat amp = 0.1f * amplitude_ * amplitudeRate_; + CGFloat a = r * cosf( (CGFloat)M_PI/2.0f + time * (CGFloat)M_PI * twirls_ * 2 ) * amp; + + float cosA = cosf(a); + float sinA = sinf(a); + + CGPoint d = { + sinA * (v.y-c.y) + cosA * (v.x-c.x), + cosA * (v.y-c.y) - sinA * (v.x-c.x) + }; + + v.x = c.x + d.x; + v.y = c.y + d.y; + + [self setVertex:ccg(i,j) vertex:v]; + } + } +} + +-(id) copyWithZone: (NSZone*) zone +{ + CCGridAction *copy = [[[self class] allocWithZone:zone] initWithPosition:position_ + twirls:twirls_ + amplitude:amplitude_ + grid:gridSize_ + duration:duration_]; + return copy; +} + + +@end diff --git a/libs/cocos2d/CCActionInstant.h b/libs/cocos2d/CCActionInstant.h new file mode 100755 index 0000000..5a1bc2d --- /dev/null +++ b/libs/cocos2d/CCActionInstant.h @@ -0,0 +1,205 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2008-2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + + +#import "CCAction.h" + +/** Instant actions are immediate actions. They don't have a duration like + the CCIntervalAction actions. +*/ +@interface CCActionInstant : CCFiniteTimeAction +{ +} +@end + +/** Show the node + */ + @interface CCShow : CCActionInstant +{ +} +@end + +/** Hide the node + */ +@interface CCHide : CCActionInstant +{ +} +@end + +/** Toggles the visibility of a node + */ +@interface CCToggleVisibility : CCActionInstant +{ +} +@end + +/** Flips the sprite horizontally + @since v0.99.0 + */ +@interface CCFlipX : CCActionInstant +{ + BOOL flipX; +} ++(id) actionWithFlipX:(BOOL)x; +-(id) initWithFlipX:(BOOL)x; +@end + +/** Flips the sprite vertically + @since v0.99.0 + */ +@interface CCFlipY : CCActionInstant +{ + BOOL flipY; +} ++(id) actionWithFlipY:(BOOL)y; +-(id) initWithFlipY:(BOOL)y; +@end + +/** Places the node in a certain position + */ +@interface CCPlace : CCActionInstant +{ + CGPoint position; +} +/** creates a Place action with a position */ ++(id) actionWithPosition: (CGPoint) pos; +/** Initializes a Place action with a position */ +-(id) initWithPosition: (CGPoint) pos; +@end + +/** Calls a 'callback' + */ +@interface CCCallFunc : CCActionInstant +{ + id targetCallback_; + SEL selector_; +} + +/** Target that will be called */ +@property (nonatomic, readwrite, retain) id targetCallback; + +/** creates the action with the callback */ ++(id) actionWithTarget: (id) t selector:(SEL) s; +/** initializes the action with the callback */ +-(id) initWithTarget: (id) t selector:(SEL) s; +/** exeuctes the callback */ +-(void) execute; +@end + +/** Calls a 'callback' with the node as the first argument. + N means Node + */ +@interface CCCallFuncN : CCCallFunc +{ +} +@end + +typedef void (*CC_CALLBACK_ND)(id, SEL, id, void *); +/** Calls a 'callback' with the node as the first argument and the 2nd argument is data. + * ND means: Node and Data. Data is void *, so it could be anything. + */ +@interface CCCallFuncND : CCCallFuncN +{ + void *data_; + CC_CALLBACK_ND callbackMethod_; +} + +/** Invocation object that has the target#selector and the parameters */ +@property (nonatomic,readwrite) CC_CALLBACK_ND callbackMethod; + +/** creates the action with the callback and the data to pass as an argument */ ++(id) actionWithTarget: (id) t selector:(SEL) s data:(void*)d; +/** initializes the action with the callback and the data to pass as an argument */ +-(id) initWithTarget:(id) t selector:(SEL) s data:(void*) d; +@end + +/** Calls a 'callback' with an object as the first argument. + O means Object. + @since v0.99.5 + */ +@interface CCCallFuncO : CCCallFunc +{ + id object_; +} +/** object to be passed as argument */ +@property (nonatomic, readwrite, retain) id object; + +/** creates the action with the callback and the object to pass as an argument */ ++(id) actionWithTarget: (id) t selector:(SEL) s object:(id)object; +/** initializes the action with the callback and the object to pass as an argument */ +-(id) initWithTarget:(id) t selector:(SEL) s object:(id)object; + +@end + +#pragma mark Blocks Support + +#if NS_BLOCKS_AVAILABLE + +/** Executes a callback using a block. + */ +@interface CCCallBlock : CCActionInstant +{ + void (^block_)(); +} + +/** creates the action with the specified block, to be used as a callback. + The block will be "copied". + */ ++(id) actionWithBlock:(void(^)())block; + +/** initialized the action with the specified block, to be used as a callback. + The block will be "copied". + */ +-(id) initWithBlock:(void(^)())block; + +/** executes the callback */ +-(void) execute; +@end + +@class CCNode; + +/** Executes a callback using a block with a single CCNode parameter. + */ +@interface CCCallBlockN : CCActionInstant +{ + void (^block_)(CCNode *); +} + +/** creates the action with the specified block, to be used as a callback. + The block will be "copied". + */ ++(id) actionWithBlock:(void(^)(CCNode *node))block; + +/** initialized the action with the specified block, to be used as a callback. + The block will be "copied". + */ +-(id) initWithBlock:(void(^)(CCNode *node))block; + +/** executes the callback */ +-(void) execute; +@end + +#endif diff --git a/libs/cocos2d/CCActionInstant.m b/libs/cocos2d/CCActionInstant.m new file mode 100755 index 0000000..e7f6fad --- /dev/null +++ b/libs/cocos2d/CCActionInstant.m @@ -0,0 +1,477 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2008-2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + + +#import "CCBlockSupport.h" +#import "CCActionInstant.h" +#import "CCNode.h" +#import "CCSprite.h" + + +// +// InstantAction +// +#pragma mark CCActionInstant + +@implementation CCActionInstant + +-(id) init +{ + if( (self=[super init]) ) + duration_ = 0; + + return self; +} + +-(id) copyWithZone: (NSZone*) zone +{ + CCActionInstant *copy = [[[self class] allocWithZone: zone] init]; + return copy; +} + +- (BOOL) isDone +{ + return YES; +} + +-(void) step: (ccTime) dt +{ + [self update: 1]; +} + +-(void) update: (ccTime) t +{ + // ignore +} + +-(CCFiniteTimeAction*) reverse +{ + return [[self copy] autorelease]; +} +@end + +// +// Show +// +#pragma mark CCShow + +@implementation CCShow +-(void) startWithTarget:(id)aTarget +{ + [super startWithTarget:aTarget]; + ((CCNode *)target_).visible = YES; +} + +-(CCFiniteTimeAction*) reverse +{ + return [CCHide action]; +} +@end + +// +// Hide +// +#pragma mark CCHide + +@implementation CCHide +-(void) startWithTarget:(id)aTarget +{ + [super startWithTarget:aTarget]; + ((CCNode *)target_).visible = NO; +} + +-(CCFiniteTimeAction*) reverse +{ + return [CCShow action]; +} +@end + +// +// ToggleVisibility +// +#pragma mark CCToggleVisibility + +@implementation CCToggleVisibility +-(void) startWithTarget:(id)aTarget +{ + [super startWithTarget:aTarget]; + ((CCNode *)target_).visible = !((CCNode *)target_).visible; +} +@end + +// +// FlipX +// +#pragma mark CCFlipX + +@implementation CCFlipX ++(id) actionWithFlipX:(BOOL)x +{ + return [[[self alloc] initWithFlipX:x] autorelease]; +} + +-(id) initWithFlipX:(BOOL)x +{ + if(( self=[super init])) + flipX = x; + + return self; +} + +-(void) startWithTarget:(id)aTarget +{ + [super startWithTarget:aTarget]; + [(CCSprite*)aTarget setFlipX:flipX]; +} + +-(CCFiniteTimeAction*) reverse +{ + return [CCFlipX actionWithFlipX:!flipX]; +} + +-(id) copyWithZone: (NSZone*) zone +{ + CCActionInstant *copy = [[[self class] allocWithZone: zone] initWithFlipX:flipX]; + return copy; +} +@end + +// +// FlipY +// +#pragma mark CCFlipY + +@implementation CCFlipY ++(id) actionWithFlipY:(BOOL)y +{ + return [[[self alloc] initWithFlipY:y] autorelease]; +} + +-(id) initWithFlipY:(BOOL)y +{ + if(( self=[super init])) + flipY = y; + + return self; +} + +-(void) startWithTarget:(id)aTarget +{ + [super startWithTarget:aTarget]; + [(CCSprite*)aTarget setFlipY:flipY]; +} + +-(CCFiniteTimeAction*) reverse +{ + return [CCFlipY actionWithFlipY:!flipY]; +} + +-(id) copyWithZone: (NSZone*) zone +{ + CCActionInstant *copy = [[[self class] allocWithZone: zone] initWithFlipY:flipY]; + return copy; +} +@end + + +// +// Place +// +#pragma mark CCPlace + +@implementation CCPlace ++(id) actionWithPosition: (CGPoint) pos +{ + return [[[self alloc]initWithPosition:pos]autorelease]; +} + +-(id) initWithPosition: (CGPoint) pos +{ + if( (self=[super init]) ) + position = pos; + + return self; +} + +-(id) copyWithZone: (NSZone*) zone +{ + CCActionInstant *copy = [[[self class] allocWithZone: zone] initWithPosition: position]; + return copy; +} + +-(void) startWithTarget:(id)aTarget +{ + [super startWithTarget:aTarget]; + ((CCNode *)target_).position = position; +} + +@end + +// +// CallFunc +// +#pragma mark CCCallFunc + +@implementation CCCallFunc + +@synthesize targetCallback = targetCallback_; + ++(id) actionWithTarget: (id) t selector:(SEL) s +{ + return [[[self alloc] initWithTarget: t selector: s] autorelease]; +} + +-(id) initWithTarget: (id) t selector:(SEL) s +{ + if( (self=[super init]) ) { + self.targetCallback = t; + selector_ = s; + } + return self; +} + +-(NSString*) description +{ + return [NSString stringWithFormat:@"<%@ = %08X | Tag = %i | target = %@ | selector = %@>", + [self class], + self, + tag_, + [targetCallback_ class], + NSStringFromSelector(selector_) + ]; +} + +-(void) dealloc +{ + [targetCallback_ release]; + [super dealloc]; +} + +-(id) copyWithZone: (NSZone*) zone +{ + CCActionInstant *copy = [[[self class] allocWithZone: zone] initWithTarget:targetCallback_ selector:selector_]; + return copy; +} + +-(void) startWithTarget:(id)aTarget +{ + [super startWithTarget:aTarget]; + [self execute]; +} + +-(void) execute +{ + [targetCallback_ performSelector:selector_]; +} +@end + +// +// CallFuncN +// +#pragma mark CCCallFuncN + +@implementation CCCallFuncN + +-(void) execute +{ + [targetCallback_ performSelector:selector_ withObject:target_]; +} +@end + +// +// CallFuncND +// +#pragma mark CCCallFuncND + +@implementation CCCallFuncND + +@synthesize callbackMethod = callbackMethod_; + ++(id) actionWithTarget:(id)t selector:(SEL)s data:(void*)d +{ + return [[[self alloc] initWithTarget:t selector:s data:d] autorelease]; +} + +-(id) initWithTarget:(id)t selector:(SEL)s data:(void*)d +{ + if( (self=[super initWithTarget:t selector:s]) ) { + data_ = d; + +#if COCOS2D_DEBUG + NSMethodSignature * sig = [t methodSignatureForSelector:s]; // added + NSAssert(sig !=0 , @"Signature not found for selector - does it have the following form? -(void)name:(id)sender data:(void*)data"); +#endif + callbackMethod_ = (CC_CALLBACK_ND) [t methodForSelector:s]; + } + return self; +} + +-(id) copyWithZone: (NSZone*) zone +{ + CCActionInstant *copy = [[[self class] allocWithZone: zone] initWithTarget:targetCallback_ selector:selector_ data:data_]; + return copy; +} + +-(void) dealloc +{ + // nothing to dealloc really. Everything is dealloc on super (CCCallFuncN) + [super dealloc]; +} + +-(void) execute +{ + callbackMethod_(targetCallback_,selector_,target_, data_); +} +@end + +@implementation CCCallFuncO +@synthesize object = object_; + ++(id) actionWithTarget: (id) t selector:(SEL) s object:(id)object +{ + return [[[self alloc] initWithTarget:t selector:s object:object] autorelease]; +} + +-(id) initWithTarget:(id) t selector:(SEL) s object:(id)object +{ + if( (self=[super initWithTarget:t selector:s] ) ) + self.object = object; + + return self; +} + +- (void) dealloc +{ + [object_ release]; + [super dealloc]; +} + +-(id) copyWithZone: (NSZone*) zone +{ + CCActionInstant *copy = [[[self class] allocWithZone: zone] initWithTarget:targetCallback_ selector:selector_ object:object_]; + return copy; +} + + +-(void) execute +{ + [targetCallback_ performSelector:selector_ withObject:object_]; +} + +@end + + +#pragma mark - +#pragma mark Blocks + +#if NS_BLOCKS_AVAILABLE + +#pragma mark CCCallBlock + +@implementation CCCallBlock + ++(id) actionWithBlock:(void(^)())block +{ + return [[[self alloc] initWithBlock:block] autorelease]; +} + +-(id) initWithBlock:(void(^)())block +{ + if ((self = [super init])) + block_ = [block copy]; + + return self; +} + +-(id) copyWithZone: (NSZone*) zone +{ + CCActionInstant *copy = [[[self class] allocWithZone: zone] initWithBlock:block_]; + return copy; +} + +-(void) startWithTarget:(id)aTarget +{ + [super startWithTarget:aTarget]; + [self execute]; +} + +-(void) execute +{ + block_(); +} + +-(void) dealloc +{ + [block_ release]; + [super dealloc]; +} + +@end + +#pragma mark CCCallBlockN + +@implementation CCCallBlockN + ++(id) actionWithBlock:(void(^)(CCNode *node))block +{ + return [[[self alloc] initWithBlock:block] autorelease]; +} + +-(id) initWithBlock:(void(^)(CCNode *node))block +{ + if ((self = [super init])) + block_ = [block copy]; + + return self; +} + +-(id) copyWithZone: (NSZone*) zone +{ + CCActionInstant *copy = [[[self class] allocWithZone: zone] initWithBlock:block_]; + return copy; +} + +-(void) startWithTarget:(id)aTarget +{ + [super startWithTarget:aTarget]; + [self execute]; +} + +-(void) execute +{ + block_(target_); +} + +-(void) dealloc +{ + [block_ release]; + [super dealloc]; +} + +@end + + +#endif // NS_BLOCKS_AVAILABLE diff --git a/libs/cocos2d/CCActionInterval.h b/libs/cocos2d/CCActionInterval.h new file mode 100755 index 0000000..c667963 --- /dev/null +++ b/libs/cocos2d/CCActionInterval.h @@ -0,0 +1,421 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2008-2011 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + + +#import "CCNode.h" +#import "CCAction.h" +#import "CCProtocols.h" + +#include + +/** An interval action is an action that takes place within a certain period of time. +It has an start time, and a finish time. The finish time is the parameter +duration plus the start time. + +These CCActionInterval actions have some interesting properties, like: + - They can run normally (default) + - They can run reversed with the reverse method + - They can run with the time altered with the Accelerate, AccelDeccel and Speed actions. + +For example, you can simulate a Ping Pong effect running the action normally and +then running it again in Reverse mode. + +Example: + + CCAction * pingPongAction = [CCSequence actions: action, [action reverse], nil]; +*/ +@interface CCActionInterval: CCFiniteTimeAction +{ + ccTime elapsed_; + BOOL firstTick_; +} + +/** how many seconds had elapsed since the actions started to run. */ +@property (nonatomic,readonly) ccTime elapsed; + +/** creates the action */ ++(id) actionWithDuration: (ccTime) d; +/** initializes the action */ +-(id) initWithDuration: (ccTime) d; +/** returns YES if the action has finished */ +-(BOOL) isDone; +/** returns a reversed action */ +- (CCActionInterval*) reverse; +@end + +/** Runs actions sequentially, one after another + */ +@interface CCSequence : CCActionInterval +{ + CCFiniteTimeAction *actions_[2]; + ccTime split_; + int last_; +} +/** helper contructor to create an array of sequenceable actions */ ++(id) actions: (CCFiniteTimeAction*) action1, ... NS_REQUIRES_NIL_TERMINATION; +/** helper contructor to create an array of sequenceable actions given an array */ ++(id) actionsWithArray: (NSArray*) actions; +/** creates the action */ ++(id) actionOne:(CCFiniteTimeAction*)actionOne two:(CCFiniteTimeAction*)actionTwo; +/** initializes the action */ +-(id) initOne:(CCFiniteTimeAction*)actionOne two:(CCFiniteTimeAction*)actionTwo; +@end + + +/** Repeats an action a number of times. + * To repeat an action forever use the CCRepeatForever action. + */ +@interface CCRepeat : CCActionInterval +{ + NSUInteger times_; + NSUInteger total_; + CCFiniteTimeAction *innerAction_; +} + +/** Inner action */ +@property (nonatomic,readwrite,retain) CCFiniteTimeAction *innerAction; + +/** creates a CCRepeat action. Times is an unsigned integer between 1 and MAX_UINT */ ++(id) actionWithAction:(CCFiniteTimeAction*)action times: (NSUInteger)times; +/** initializes a CCRepeat action. Times is an unsigned integer between 1 and MAX_UINT */ +-(id) initWithAction:(CCFiniteTimeAction*)action times: (NSUInteger)times; +@end + +/** Spawn a new action immediately + */ +@interface CCSpawn : CCActionInterval +{ + CCFiniteTimeAction *one_; + CCFiniteTimeAction *two_; +} +/** helper constructor to create an array of spawned actions */ ++(id) actions: (CCFiniteTimeAction*) action1, ... NS_REQUIRES_NIL_TERMINATION; +/** helper contructor to create an array of spawned actions given an array */ ++(id) actionsWithArray: (NSArray*) actions; +/** creates the Spawn action */ ++(id) actionOne: (CCFiniteTimeAction*) one two:(CCFiniteTimeAction*) two; +/** initializes the Spawn action with the 2 actions to spawn */ +-(id) initOne: (CCFiniteTimeAction*) one two:(CCFiniteTimeAction*) two; +@end + +/** Rotates a CCNode object to a certain angle by modifying it's + rotation attribute. + The direction will be decided by the shortest angle. +*/ +@interface CCRotateTo : CCActionInterval +{ + float dstAngle_; + float startAngle_; + float diffAngle_; +} +/** creates the action */ ++(id) actionWithDuration:(ccTime)duration angle:(float)angle; +/** initializes the action */ +-(id) initWithDuration:(ccTime)duration angle:(float)angle; +@end + +/** Rotates a CCNode object clockwise a number of degrees by modiying it's rotation attribute. +*/ +@interface CCRotateBy : CCActionInterval +{ + float angle_; + float startAngle_; +} +/** creates the action */ ++(id) actionWithDuration:(ccTime)duration angle:(float)deltaAngle; +/** initializes the action */ +-(id) initWithDuration:(ccTime)duration angle:(float)deltaAngle; +@end + +/** Moves a CCNode object to the position x,y. x and y are absolute coordinates by modifying it's position attribute. +*/ +@interface CCMoveTo : CCActionInterval +{ + CGPoint endPosition_; + CGPoint startPosition_; + CGPoint delta_; +} +/** creates the action */ ++(id) actionWithDuration:(ccTime)duration position:(CGPoint)position; +/** initializes the action */ +-(id) initWithDuration:(ccTime)duration position:(CGPoint)position; +@end + +/** Moves a CCNode object x,y pixels by modifying it's position attribute. + x and y are relative to the position of the object. + Duration is is seconds. +*/ +@interface CCMoveBy : CCMoveTo +{ +} +/** creates the action */ ++(id) actionWithDuration: (ccTime)duration position:(CGPoint)deltaPosition; +/** initializes the action */ +-(id) initWithDuration: (ccTime)duration position:(CGPoint)deltaPosition; +@end + +/** Skews a CCNode object to given angles by modifying it's skewX and skewY attributes + @since v1.0 + */ +@interface CCSkewTo : CCActionInterval +{ + float skewX_; + float skewY_; + float startSkewX_; + float startSkewY_; + float endSkewX_; + float endSkewY_; + float deltaX_; + float deltaY_; +} +/** creates the action */ ++(id) actionWithDuration:(ccTime)t skewX:(float)sx skewY:(float)sy; +/** initializes the action */ +-(id) initWithDuration:(ccTime)t skewX:(float)sx skewY:(float)sy; +@end + +/** Skews a CCNode object by skewX and skewY degrees + @since v1.0 + */ +@interface CCSkewBy : CCSkewTo +{ +} +@end + +/** Moves a CCNode object simulating a parabolic jump movement by modifying it's position attribute. +*/ + @interface CCJumpBy : CCActionInterval +{ + CGPoint startPosition_; + CGPoint delta_; + ccTime height_; + NSUInteger jumps_; +} +/** creates the action */ ++(id) actionWithDuration: (ccTime)duration position:(CGPoint)position height:(ccTime)height jumps:(NSUInteger)jumps; +/** initializes the action */ +-(id) initWithDuration: (ccTime)duration position:(CGPoint)position height:(ccTime)height jumps:(NSUInteger)jumps; +@end + +/** Moves a CCNode object to a parabolic position simulating a jump movement by modifying it's position attribute. +*/ + @interface CCJumpTo : CCJumpBy +{ +} +@end + +/** bezier configuration structure + */ +typedef struct _ccBezierConfig { + //! end position of the bezier + CGPoint endPosition; + //! Bezier control point 1 + CGPoint controlPoint_1; + //! Bezier control point 2 + CGPoint controlPoint_2; +} ccBezierConfig; + +/** An action that moves the target with a cubic Bezier curve by a certain distance. + */ +@interface CCBezierBy : CCActionInterval +{ + ccBezierConfig config_; + CGPoint startPosition_; +} + +/** creates the action with a duration and a bezier configuration */ ++(id) actionWithDuration: (ccTime) t bezier:(ccBezierConfig) c; + +/** initializes the action with a duration and a bezier configuration */ +-(id) initWithDuration: (ccTime) t bezier:(ccBezierConfig) c; +@end + +/** An action that moves the target with a cubic Bezier curve to a destination point. + @since v0.8.2 + */ +@interface CCBezierTo : CCBezierBy +{ +} +@end + +/** Scales a CCNode object to a zoom factor by modifying it's scale attribute. + @warning This action doesn't support "reverse" + */ +@interface CCScaleTo : CCActionInterval +{ + float scaleX_; + float scaleY_; + float startScaleX_; + float startScaleY_; + float endScaleX_; + float endScaleY_; + float deltaX_; + float deltaY_; +} +/** creates the action with the same scale factor for X and Y */ ++(id) actionWithDuration: (ccTime)duration scale:(float) s; +/** initializes the action with the same scale factor for X and Y */ +-(id) initWithDuration: (ccTime)duration scale:(float) s; +/** creates the action with and X factor and a Y factor */ ++(id) actionWithDuration: (ccTime)duration scaleX:(float) sx scaleY:(float)sy; +/** initializes the action with and X factor and a Y factor */ +-(id) initWithDuration: (ccTime)duration scaleX:(float) sx scaleY:(float)sy; +@end + +/** Scales a CCNode object a zoom factor by modifying it's scale attribute. +*/ +@interface CCScaleBy : CCScaleTo +{ +} +@end + +/** Blinks a CCNode object by modifying it's visible attribute +*/ +@interface CCBlink : CCActionInterval +{ + NSUInteger times_; +} +/** creates the action */ ++(id) actionWithDuration: (ccTime)duration blinks:(NSUInteger)blinks; +/** initilizes the action */ +-(id) initWithDuration: (ccTime)duration blinks:(NSUInteger)blinks; +@end + +/** Fades In an object that implements the CCRGBAProtocol protocol. It modifies the opacity from 0 to 255. + The "reverse" of this action is FadeOut + */ +@interface CCFadeIn : CCActionInterval +{ +} +@end + +/** Fades Out an object that implements the CCRGBAProtocol protocol. It modifies the opacity from 255 to 0. + The "reverse" of this action is FadeIn +*/ +@interface CCFadeOut : CCActionInterval +{ +} +@end + +/** Fades an object that implements the CCRGBAProtocol protocol. It modifies the opacity from the current value to a custom one. + @warning This action doesn't support "reverse" + */ +@interface CCFadeTo : CCActionInterval +{ + GLubyte toOpacity_; + GLubyte fromOpacity_; +} +/** creates an action with duration and opactiy */ ++(id) actionWithDuration:(ccTime)duration opacity:(GLubyte)opactiy; +/** initializes the action with duration and opacity */ +-(id) initWithDuration:(ccTime)duration opacity:(GLubyte)opacity; +@end + +/** Tints a CCNode that implements the CCNodeRGB protocol from current tint to a custom one. + @warning This action doesn't support "reverse" + @since v0.7.2 +*/ +@interface CCTintTo : CCActionInterval +{ + ccColor3B to_; + ccColor3B from_; +} +/** creates an action with duration and color */ ++(id) actionWithDuration:(ccTime)duration red:(GLubyte)red green:(GLubyte)green blue:(GLubyte)blue; +/** initializes the action with duration and color */ +-(id) initWithDuration:(ccTime)duration red:(GLubyte)red green:(GLubyte)green blue:(GLubyte)blue; +@end + +/** Tints a CCNode that implements the CCNodeRGB protocol from current tint to a custom one. + @since v0.7.2 + */ +@interface CCTintBy : CCActionInterval +{ + GLshort deltaR_, deltaG_, deltaB_; + GLshort fromR_, fromG_, fromB_; +} +/** creates an action with duration and color */ ++(id) actionWithDuration:(ccTime)duration red:(GLshort)deltaRed green:(GLshort)deltaGreen blue:(GLshort)deltaBlue; +/** initializes the action with duration and color */ +-(id) initWithDuration:(ccTime)duration red:(GLshort)deltaRed green:(GLshort)deltaGreen blue:(GLshort)deltaBlue; +@end + +/** Delays the action a certain amount of seconds +*/ +@interface CCDelayTime : CCActionInterval +{ +} +@end + +/** Executes an action in reverse order, from time=duration to time=0 + + @warning Use this action carefully. This action is not + sequenceable. Use it as the default "reversed" method + of your own actions, but using it outside the "reversed" + scope is not recommended. +*/ +@interface CCReverseTime : CCActionInterval +{ + CCFiniteTimeAction * other_; +} +/** creates the action */ ++(id) actionWithAction: (CCFiniteTimeAction*) action; +/** initializes the action */ +-(id) initWithAction: (CCFiniteTimeAction*) action; +@end + + +@class CCAnimation; +@class CCTexture2D; +/** Animates a sprite given the name of an Animation */ +@interface CCAnimate : CCActionInterval +{ + CCAnimation *animation_; + id origFrame_; + BOOL restoreOriginalFrame_; +} +/** animation used for the animage */ +@property (readwrite,nonatomic,retain) CCAnimation * animation; + +/** creates the action with an Animation and will restore the original frame when the animation is over */ ++(id) actionWithAnimation:(CCAnimation*) a; +/** initializes the action with an Animation and will restore the original frame when the animtion is over */ +-(id) initWithAnimation:(CCAnimation*) a; +/** creates the action with an Animation */ ++(id) actionWithAnimation:(CCAnimation*) a restoreOriginalFrame:(BOOL)b; +/** initializes the action with an Animation */ +-(id) initWithAnimation:(CCAnimation*) a restoreOriginalFrame:(BOOL)b; +/** creates an action with a duration, animation and depending of the restoreOriginalFrame, it will restore the original frame or not. + The 'delay' parameter of the animation will be overrided by the duration parameter. + @since v0.99.0 + */ ++(id) actionWithDuration:(ccTime)duration animation:(CCAnimation*)animation restoreOriginalFrame:(BOOL)b; +/** initializes an action with a duration, animation and depending of the restoreOriginalFrame, it will restore the original frame or not. + The 'delay' parameter of the animation will be overrided by the duration parameter. + @since v0.99.0 + */ +-(id) initWithDuration:(ccTime)duration animation:(CCAnimation*)animation restoreOriginalFrame:(BOOL)b; +@end diff --git a/libs/cocos2d/CCActionInterval.m b/libs/cocos2d/CCActionInterval.m new file mode 100755 index 0000000..17bef40 --- /dev/null +++ b/libs/cocos2d/CCActionInterval.m @@ -0,0 +1,1355 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2008-2011 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + + + +#import "CCActionInterval.h" +#import "CCSprite.h" +#import "CCSpriteFrame.h" +#import "CCAnimation.h" +#import "CCNode.h" +#import "Support/CGPointExtension.h" + +// +// IntervalAction +// +#pragma mark - +#pragma mark IntervalAction +@implementation CCActionInterval + +@synthesize elapsed = elapsed_; + +-(id) init +{ + NSAssert(NO, @"IntervalActionInit: Init not supported. Use InitWithDuration"); + [self release]; + return nil; +} + ++(id) actionWithDuration: (ccTime) d +{ + return [[[self alloc] initWithDuration:d ] autorelease]; +} + +-(id) initWithDuration: (ccTime) d +{ + if( (self=[super init]) ) { + duration_ = d; + + // prevent division by 0 + // This comparison could be in step:, but it might decrease the performance + // by 3% in heavy based action games. + if( duration_ == 0 ) + duration_ = FLT_EPSILON; + elapsed_ = 0; + firstTick_ = YES; + } + return self; +} + +-(id) copyWithZone: (NSZone*) zone +{ + CCAction *copy = [[[self class] allocWithZone: zone] initWithDuration: [self duration] ]; + return copy; +} + +- (BOOL) isDone +{ + return (elapsed_ >= duration_); +} + +-(void) step: (ccTime) dt +{ + if( firstTick_ ) { + firstTick_ = NO; + elapsed_ = 0; + } else + elapsed_ += dt; + + [self update: MIN(1, elapsed_/duration_)]; +} + +-(void) startWithTarget:(id)aTarget +{ + [super startWithTarget:aTarget]; + elapsed_ = 0.0f; + firstTick_ = YES; +} + +- (CCActionInterval*) reverse +{ + NSAssert(NO, @"CCIntervalAction: reverse not implemented."); + return nil; +} +@end + +// +// Sequence +// +#pragma mark - +#pragma mark Sequence +@implementation CCSequence ++(id) actions: (CCFiniteTimeAction*) action1, ... +{ + va_list params; + va_start(params,action1); + + CCFiniteTimeAction *now; + CCFiniteTimeAction *prev = action1; + + while( action1 ) { + now = va_arg(params,CCFiniteTimeAction*); + if ( now ) + prev = [self actionOne: prev two: now]; + else + break; + } + va_end(params); + return prev; +} + ++(id) actionsWithArray: (NSArray*) actions +{ + CCFiniteTimeAction *prev = [actions objectAtIndex:0]; + + for (NSUInteger i = 1; i < [actions count]; i++) + prev = [self actionOne:prev two:[actions objectAtIndex:i]]; + + return prev; +} + ++(id) actionOne: (CCFiniteTimeAction*) one two: (CCFiniteTimeAction*) two +{ + return [[[self alloc] initOne:one two:two ] autorelease]; +} + +-(id) initOne: (CCFiniteTimeAction*) one two: (CCFiniteTimeAction*) two +{ + NSAssert( one!=nil && two!=nil, @"Sequence: arguments must be non-nil"); + NSAssert( one!=actions_[0] && one!=actions_[1], @"Sequence: re-init using the same parameters is not supported"); + NSAssert( two!=actions_[1] && two!=actions_[0], @"Sequence: re-init using the same parameters is not supported"); + + ccTime d = [one duration] + [two duration]; + + if( (self=[super initWithDuration: d]) ) { + + // XXX: Supports re-init without leaking. Fails if one==one_ || two==two_ + [actions_[0] release]; + [actions_[1] release]; + + actions_[0] = [one retain]; + actions_[1] = [two retain]; + } + + return self; +} + +-(id) copyWithZone: (NSZone*) zone +{ + CCAction *copy = [[[self class] allocWithZone:zone] initOne:[[actions_[0] copy] autorelease] two:[[actions_[1] copy] autorelease] ]; + return copy; +} + +-(void) dealloc +{ + [actions_[0] release]; + [actions_[1] release]; + [super dealloc]; +} + +-(void) startWithTarget:(id)aTarget +{ + [super startWithTarget:aTarget]; + split_ = [actions_[0] duration] / duration_; + last_ = -1; +} + +-(void) stop +{ + [actions_[0] stop]; + [actions_[1] stop]; + [super stop]; +} + +-(void) update: (ccTime) t +{ + int found = 0; + ccTime new_t = 0.0f; + + if( t >= split_ ) { + found = 1; + if ( split_ == 1 ) + new_t = 1; + else + new_t = (t-split_) / (1 - split_ ); + } else { + found = 0; + if( split_ != 0 ) + new_t = t / split_; + else + new_t = 1; + } + + if (last_ == -1 && found==1) { + [actions_[0] startWithTarget:target_]; + [actions_[0] update:1.0f]; + [actions_[0] stop]; + } + + if (last_ != found ) { + if( last_ != -1 ) { + [actions_[last_] update: 1.0f]; + [actions_[last_] stop]; + } + [actions_[found] startWithTarget:target_]; + } + [actions_[found] update: new_t]; + last_ = found; +} + +- (CCActionInterval *) reverse +{ + return [[self class] actionOne: [actions_[1] reverse] two: [actions_[0] reverse ] ]; +} +@end + +// +// Repeat +// +#pragma mark - +#pragma mark CCRepeat +@implementation CCRepeat +@synthesize innerAction=innerAction_; + ++(id) actionWithAction:(CCFiniteTimeAction*)action times:(NSUInteger)times +{ + return [[[self alloc] initWithAction:action times:times] autorelease]; +} + +-(id) initWithAction:(CCFiniteTimeAction*)action times:(NSUInteger)times +{ + ccTime d = [action duration] * times; + + if( (self=[super initWithDuration: d ]) ) { + times_ = times; + self.innerAction = action; + + total_ = 0; + } + return self; +} + +-(id) copyWithZone: (NSZone*) zone +{ + CCAction *copy = [[[self class] allocWithZone:zone] initWithAction:[[innerAction_ copy] autorelease] times:times_]; + return copy; +} + +-(void) dealloc +{ + [innerAction_ release]; + [super dealloc]; +} + +-(void) startWithTarget:(id)aTarget +{ + total_ = 0; + [super startWithTarget:aTarget]; + [innerAction_ startWithTarget:aTarget]; +} + +-(void) stop +{ + [innerAction_ stop]; + [super stop]; +} + + +// issue #80. Instead of hooking step:, hook update: since it can be called by any +// container action like Repeat, Sequence, AccelDeccel, etc.. +-(void) update:(ccTime) dt +{ + ccTime t = dt * times_; + if( t > total_+1 ) { + [innerAction_ update:1.0f]; + total_++; + [innerAction_ stop]; + [innerAction_ startWithTarget:target_]; + + // repeat is over ? + if( total_== times_ ) + // so, set it in the original position + [innerAction_ update:0]; + else { + // no ? start next repeat with the right update + // to prevent jerk (issue #390) + [innerAction_ update: t-total_]; + } + + } else { + + float r = fmodf(t, 1.0f); + + // fix last repeat position + // else it could be 0. + if( dt== 1.0f) { + r = 1.0f; + total_++; // this is the added line + } + [innerAction_ update: MIN(r,1)]; + } +} + +-(BOOL) isDone +{ + return ( total_ == times_ ); +} + +- (CCActionInterval *) reverse +{ + return [[self class] actionWithAction:[innerAction_ reverse] times:times_]; +} +@end + +// +// Spawn +// +#pragma mark - +#pragma mark Spawn + +@implementation CCSpawn ++(id) actions: (CCFiniteTimeAction*) action1, ... +{ + va_list params; + va_start(params,action1); + + CCFiniteTimeAction *now; + CCFiniteTimeAction *prev = action1; + + while( action1 ) { + now = va_arg(params,CCFiniteTimeAction*); + if ( now ) + prev = [self actionOne: prev two: now]; + else + break; + } + va_end(params); + return prev; +} + ++(id) actionsWithArray: (NSArray*) actions +{ + CCFiniteTimeAction *prev = [actions objectAtIndex:0]; + + for (NSUInteger i = 1; i < [actions count]; i++) + prev = [self actionOne:prev two:[actions objectAtIndex:i]]; + + return prev; +} + ++(id) actionOne: (CCFiniteTimeAction*) one two: (CCFiniteTimeAction*) two +{ + return [[[self alloc] initOne:one two:two ] autorelease]; +} + +-(id) initOne: (CCFiniteTimeAction*) one two: (CCFiniteTimeAction*) two +{ + NSAssert( one!=nil && two!=nil, @"Spawn: arguments must be non-nil"); + NSAssert( one!=one_ && one!=two_, @"Spawn: reinit using same parameters is not supported"); + NSAssert( two!=two_ && two!=one_, @"Spawn: reinit using same parameters is not supported"); + + ccTime d1 = [one duration]; + ccTime d2 = [two duration]; + + if( (self=[super initWithDuration: MAX(d1,d2)] ) ) { + + // XXX: Supports re-init without leaking. Fails if one==one_ || two==two_ + [one_ release]; + [two_ release]; + + one_ = one; + two_ = two; + + if( d1 > d2 ) + two_ = [CCSequence actionOne:two two:[CCDelayTime actionWithDuration: (d1-d2)] ]; + else if( d1 < d2) + one_ = [CCSequence actionOne:one two: [CCDelayTime actionWithDuration: (d2-d1)] ]; + + [one_ retain]; + [two_ retain]; + } + return self; +} + +-(id) copyWithZone: (NSZone*) zone +{ + CCAction *copy = [[[self class] allocWithZone: zone] initOne: [[one_ copy] autorelease] two: [[two_ copy] autorelease] ]; + return copy; +} + +-(void) dealloc +{ + [one_ release]; + [two_ release]; + [super dealloc]; +} + +-(void) startWithTarget:(id)aTarget +{ + [super startWithTarget:aTarget]; + [one_ startWithTarget:target_]; + [two_ startWithTarget:target_]; +} + +-(void) stop +{ + [one_ stop]; + [two_ stop]; + [super stop]; +} + +-(void) update: (ccTime) t +{ + [one_ update:t]; + [two_ update:t]; +} + +- (CCActionInterval *) reverse +{ + return [[self class] actionOne: [one_ reverse] two: [two_ reverse ] ]; +} +@end + +// +// RotateTo +// +#pragma mark - +#pragma mark RotateTo + +@implementation CCRotateTo ++(id) actionWithDuration: (ccTime) t angle:(float) a +{ + return [[[self alloc] initWithDuration:t angle:a ] autorelease]; +} + +-(id) initWithDuration: (ccTime) t angle:(float) a +{ + if( (self=[super initWithDuration: t]) ) + dstAngle_ = a; + + return self; +} + +-(id) copyWithZone: (NSZone*) zone +{ + CCAction *copy = [[[self class] allocWithZone: zone] initWithDuration:[self duration] angle:dstAngle_]; + return copy; +} + +-(void) startWithTarget:(CCNode *)aTarget +{ + [super startWithTarget:aTarget]; + + startAngle_ = [target_ rotation]; + if (startAngle_ > 0) + startAngle_ = fmodf(startAngle_, 360.0f); + else + startAngle_ = fmodf(startAngle_, -360.0f); + + diffAngle_ =dstAngle_ - startAngle_; + if (diffAngle_ > 180) + diffAngle_ -= 360; + if (diffAngle_ < -180) + diffAngle_ += 360; +} +-(void) update: (ccTime) t +{ + [target_ setRotation: startAngle_ + diffAngle_ * t]; +} +@end + + +// +// RotateBy +// +#pragma mark - +#pragma mark RotateBy + +@implementation CCRotateBy ++(id) actionWithDuration: (ccTime) t angle:(float) a +{ + return [[[self alloc] initWithDuration:t angle:a ] autorelease]; +} + +-(id) initWithDuration: (ccTime) t angle:(float) a +{ + if( (self=[super initWithDuration: t]) ) + angle_ = a; + + return self; +} + +-(id) copyWithZone: (NSZone*) zone +{ + CCAction *copy = [[[self class] allocWithZone: zone] initWithDuration: [self duration] angle: angle_]; + return copy; +} + +-(void) startWithTarget:(id)aTarget +{ + [super startWithTarget:aTarget]; + startAngle_ = [target_ rotation]; +} + +-(void) update: (ccTime) t +{ + // XXX: shall I add % 360 + [target_ setRotation: (startAngle_ +angle_ * t )]; +} + +-(CCActionInterval*) reverse +{ + return [[self class] actionWithDuration:duration_ angle:-angle_]; +} + +@end + +// +// MoveTo +// +#pragma mark - +#pragma mark MoveTo + +@implementation CCMoveTo ++(id) actionWithDuration: (ccTime) t position: (CGPoint) p +{ + return [[[self alloc] initWithDuration:t position:p ] autorelease]; +} + +-(id) initWithDuration: (ccTime) t position: (CGPoint) p +{ + if( (self=[super initWithDuration: t]) ) + endPosition_ = p; + + return self; +} + +-(id) copyWithZone: (NSZone*) zone +{ + CCAction *copy = [[[self class] allocWithZone: zone] initWithDuration: [self duration] position: endPosition_]; + return copy; +} + +-(void) startWithTarget:(CCNode *)aTarget +{ + [super startWithTarget:aTarget]; + startPosition_ = [(CCNode*)target_ position]; + delta_ = ccpSub( endPosition_, startPosition_ ); +} + +-(void) update: (ccTime) t +{ + [target_ setPosition: ccp( (startPosition_.x + delta_.x * t ), (startPosition_.y + delta_.y * t ) )]; +} +@end + +// +// MoveBy +// +#pragma mark - +#pragma mark MoveBy + +@implementation CCMoveBy ++(id) actionWithDuration: (ccTime) t position: (CGPoint) p +{ + return [[[self alloc] initWithDuration:t position:p ] autorelease]; +} + +-(id) initWithDuration: (ccTime) t position: (CGPoint) p +{ + if( (self=[super initWithDuration: t]) ) + delta_ = p; + + return self; +} + +-(id) copyWithZone: (NSZone*) zone +{ + CCAction *copy = [[[self class] allocWithZone: zone] initWithDuration: [self duration] position: delta_]; + return copy; +} + +-(void) startWithTarget:(CCNode *)aTarget +{ + CGPoint dTmp = delta_; + [super startWithTarget:aTarget]; + delta_ = dTmp; +} + +-(CCActionInterval*) reverse +{ + return [[self class] actionWithDuration:duration_ position:ccp( -delta_.x, -delta_.y)]; +} +@end + + +// +// SkewTo +// +#pragma mark - +#pragma mark SkewTo + +@implementation CCSkewTo ++(id) actionWithDuration:(ccTime)t skewX:(float)sx skewY:(float)sy +{ + return [[[self alloc] initWithDuration: t skewX:sx skewY:sy] autorelease]; +} + +-(id) initWithDuration:(ccTime)t skewX:(float)sx skewY:(float)sy +{ + if( (self=[super initWithDuration:t]) ) { + endSkewX_ = sx; + endSkewY_ = sy; + } + return self; +} + +-(id) copyWithZone: (NSZone*) zone +{ + CCAction *copy = [[[self class] allocWithZone: zone] initWithDuration:[self duration] skewX:endSkewX_ skewY:endSkewY_]; + return copy; +} + +-(void) startWithTarget:(CCNode *)aTarget +{ + [super startWithTarget:aTarget]; + + startSkewX_ = [target_ skewX]; + + if (startSkewX_ > 0) + startSkewX_ = fmodf(startSkewX_, 180.0f); + else + startSkewX_ = fmodf(startSkewX_, -180.0f); + + deltaX_ = endSkewX_ - startSkewX_; + + if ( deltaX_ > 180 ) { + deltaX_ -= 360; + } + if ( deltaX_ < -180 ) { + deltaX_ += 360; + } + + startSkewY_ = [target_ skewY]; + + if (startSkewY_ > 0) + startSkewY_ = fmodf(startSkewY_, 360.0f); + else + startSkewY_ = fmodf(startSkewY_, -360.0f); + + deltaY_ = endSkewY_ - startSkewY_; + + if ( deltaY_ > 180 ) { + deltaY_ -= 360; + } + if ( deltaY_ < -180 ) { + deltaY_ += 360; + } +} + +-(void) update: (ccTime) t +{ + [target_ setSkewX: (startSkewX_ + deltaX_ * t ) ]; + [target_ setSkewY: (startSkewY_ + deltaY_ * t ) ]; +} + +@end + +// +// CCSkewBy +// +@implementation CCSkewBy + +-(id) initWithDuration:(ccTime)t skewX:(float)deltaSkewX skewY:(float)deltaSkewY +{ + if( (self=[super initWithDuration:t skewX:deltaSkewX skewY:deltaSkewY]) ) { + skewX_ = deltaSkewX; + skewY_ = deltaSkewY; + } + return self; +} + +-(void) startWithTarget:(CCNode *)aTarget +{ + [super startWithTarget:aTarget]; + deltaX_ = skewX_; + deltaY_ = skewY_; + endSkewX_ = startSkewX_ + deltaX_; + endSkewY_ = startSkewY_ + deltaY_; +} + +-(CCActionInterval*) reverse +{ + return [[self class] actionWithDuration:duration_ skewX:-skewX_ skewY:-skewY_]; +} +@end + + +// +// JumpBy +// +#pragma mark - +#pragma mark JumpBy + +@implementation CCJumpBy ++(id) actionWithDuration: (ccTime) t position: (CGPoint) pos height: (ccTime) h jumps:(NSUInteger)j +{ + return [[[self alloc] initWithDuration: t position: pos height: h jumps:j] autorelease]; +} + +-(id) initWithDuration: (ccTime) t position: (CGPoint) pos height: (ccTime) h jumps:(NSUInteger)j +{ + if( (self=[super initWithDuration:t]) ) { + delta_ = pos; + height_ = h; + jumps_ = j; + } + return self; +} + +-(id) copyWithZone: (NSZone*) zone +{ + CCAction *copy = [[[self class] allocWithZone: zone] initWithDuration:[self duration] position:delta_ height:height_ jumps:jumps_]; + return copy; +} + +-(void) startWithTarget:(id)aTarget +{ + [super startWithTarget:aTarget]; + startPosition_ = [(CCNode*)target_ position]; +} + +-(void) update: (ccTime) t +{ + // Sin jump. Less realistic +// ccTime y = height * fabsf( sinf(t * (CGFloat)M_PI * jumps ) ); +// y += delta.y * t; +// ccTime x = delta.x * t; +// [target setPosition: ccp( startPosition.x + x, startPosition.y + y )]; + + // parabolic jump (since v0.8.2) + ccTime frac = fmodf( t * jumps_, 1.0f ); + ccTime y = height_ * 4 * frac * (1 - frac); + y += delta_.y * t; + ccTime x = delta_.x * t; + [target_ setPosition: ccp( startPosition_.x + x, startPosition_.y + y )]; + +} + +-(CCActionInterval*) reverse +{ + return [[self class] actionWithDuration:duration_ position: ccp(-delta_.x,-delta_.y) height:height_ jumps:jumps_]; +} +@end + +// +// JumpTo +// +#pragma mark - +#pragma mark JumpTo + +@implementation CCJumpTo +-(void) startWithTarget:(CCNode *)aTarget +{ + [super startWithTarget:aTarget]; + delta_ = ccp( delta_.x - startPosition_.x, delta_.y - startPosition_.y ); +} +@end + + +#pragma mark - +#pragma mark BezierBy + +// Bezier cubic formula: +// ((1 - t) + t)3 = 1 +// Expands to… +// (1 - t)3 + 3t(1-t)2 + 3t2(1 - t) + t3 = 1 +static inline float bezierat( float a, float b, float c, float d, ccTime t ) +{ + return (powf(1-t,3) * a + + 3*t*(powf(1-t,2))*b + + 3*powf(t,2)*(1-t)*c + + powf(t,3)*d ); +} + +// +// BezierBy +// +@implementation CCBezierBy ++(id) actionWithDuration: (ccTime) t bezier:(ccBezierConfig) c +{ + return [[[self alloc] initWithDuration:t bezier:c ] autorelease]; +} + +-(id) initWithDuration: (ccTime) t bezier:(ccBezierConfig) c +{ + if( (self=[super initWithDuration: t]) ) { + config_ = c; + } + return self; +} + +-(id) copyWithZone: (NSZone*) zone +{ + CCAction *copy = [[[self class] allocWithZone: zone] initWithDuration:[self duration] bezier:config_]; + return copy; +} + +-(void) startWithTarget:(id)aTarget +{ + [super startWithTarget:aTarget]; + startPosition_ = [(CCNode*)target_ position]; +} + +-(void) update: (ccTime) t +{ + float xa = 0; + float xb = config_.controlPoint_1.x; + float xc = config_.controlPoint_2.x; + float xd = config_.endPosition.x; + + float ya = 0; + float yb = config_.controlPoint_1.y; + float yc = config_.controlPoint_2.y; + float yd = config_.endPosition.y; + + float x = bezierat(xa, xb, xc, xd, t); + float y = bezierat(ya, yb, yc, yd, t); + [target_ setPosition: ccpAdd( startPosition_, ccp(x,y))]; +} + +- (CCActionInterval*) reverse +{ + ccBezierConfig r; + + r.endPosition = ccpNeg(config_.endPosition); + r.controlPoint_1 = ccpAdd(config_.controlPoint_2, ccpNeg(config_.endPosition)); + r.controlPoint_2 = ccpAdd(config_.controlPoint_1, ccpNeg(config_.endPosition)); + + CCBezierBy *action = [[self class] actionWithDuration:[self duration] bezier:r]; + return action; +} +@end + +// +// BezierTo +// +#pragma mark - +#pragma mark BezierTo +@implementation CCBezierTo +-(void) startWithTarget:(id)aTarget +{ + [super startWithTarget:aTarget]; + config_.controlPoint_1 = ccpSub(config_.controlPoint_1, startPosition_); + config_.controlPoint_2 = ccpSub(config_.controlPoint_2, startPosition_); + config_.endPosition = ccpSub(config_.endPosition, startPosition_); +} +@end + + +// +// ScaleTo +// +#pragma mark - +#pragma mark ScaleTo +@implementation CCScaleTo ++(id) actionWithDuration: (ccTime) t scale:(float) s +{ + return [[[self alloc] initWithDuration: t scale:s] autorelease]; +} + +-(id) initWithDuration: (ccTime) t scale:(float) s +{ + if( (self=[super initWithDuration: t]) ) { + endScaleX_ = s; + endScaleY_ = s; + } + return self; +} + ++(id) actionWithDuration: (ccTime) t scaleX:(float)sx scaleY:(float)sy +{ + return [[[self alloc] initWithDuration: t scaleX:sx scaleY:sy] autorelease]; +} + +-(id) initWithDuration: (ccTime) t scaleX:(float)sx scaleY:(float)sy +{ + if( (self=[super initWithDuration: t]) ) { + endScaleX_ = sx; + endScaleY_ = sy; + } + return self; +} + +-(id) copyWithZone: (NSZone*) zone +{ + CCAction *copy = [[[self class] allocWithZone: zone] initWithDuration:[self duration] scaleX:endScaleX_ scaleY:endScaleY_]; + return copy; +} + +-(void) startWithTarget:(CCNode *)aTarget +{ + [super startWithTarget:aTarget]; + startScaleX_ = [target_ scaleX]; + startScaleY_ = [target_ scaleY]; + deltaX_ = endScaleX_ - startScaleX_; + deltaY_ = endScaleY_ - startScaleY_; +} + +-(void) update: (ccTime) t +{ + [target_ setScaleX: (startScaleX_ + deltaX_ * t ) ]; + [target_ setScaleY: (startScaleY_ + deltaY_ * t ) ]; +} +@end + +// +// ScaleBy +// +#pragma mark - +#pragma mark ScaleBy +@implementation CCScaleBy +-(void) startWithTarget:(CCNode *)aTarget +{ + [super startWithTarget:aTarget]; + deltaX_ = startScaleX_ * endScaleX_ - startScaleX_; + deltaY_ = startScaleY_ * endScaleY_ - startScaleY_; +} + +-(CCActionInterval*) reverse +{ + return [[self class] actionWithDuration:duration_ scaleX:1/endScaleX_ scaleY:1/endScaleY_]; +} +@end + +// +// Blink +// +#pragma mark - +#pragma mark Blink +@implementation CCBlink ++(id) actionWithDuration: (ccTime) t blinks: (NSUInteger) b +{ + return [[[ self alloc] initWithDuration: t blinks: b] autorelease]; +} + +-(id) initWithDuration: (ccTime) t blinks: (NSUInteger) b +{ + if( (self=[super initWithDuration: t] ) ) + times_ = b; + + return self; +} + +-(id) copyWithZone: (NSZone*) zone +{ + CCAction *copy = [[[self class] allocWithZone: zone] initWithDuration: [self duration] blinks: times_]; + return copy; +} + +-(void) update: (ccTime) t +{ + if( ! [self isDone] ) { + ccTime slice = 1.0f / times_; + ccTime m = fmodf(t, slice); + [target_ setVisible: (m > slice/2) ? YES : NO]; + } +} + +-(CCActionInterval*) reverse +{ + // return 'self' + return [[self class] actionWithDuration:duration_ blinks: times_]; +} +@end + +// +// FadeIn +// +#pragma mark - +#pragma mark FadeIn +@implementation CCFadeIn +-(void) update: (ccTime) t +{ + [(id) target_ setOpacity: 255 *t]; +} + +-(CCActionInterval*) reverse +{ + return [CCFadeOut actionWithDuration:duration_]; +} +@end + +// +// FadeOut +// +#pragma mark - +#pragma mark FadeOut +@implementation CCFadeOut +-(void) update: (ccTime) t +{ + [(id) target_ setOpacity: 255 *(1-t)]; +} + +-(CCActionInterval*) reverse +{ + return [CCFadeIn actionWithDuration:duration_]; +} +@end + +// +// FadeTo +// +#pragma mark - +#pragma mark FadeTo +@implementation CCFadeTo ++(id) actionWithDuration: (ccTime) t opacity: (GLubyte) o +{ + return [[[ self alloc] initWithDuration: t opacity: o] autorelease]; +} + +-(id) initWithDuration: (ccTime) t opacity: (GLubyte) o +{ + if( (self=[super initWithDuration: t] ) ) + toOpacity_ = o; + + return self; +} + +-(id) copyWithZone: (NSZone*) zone +{ + CCAction *copy = [[[self class] allocWithZone: zone] initWithDuration:[self duration] opacity:toOpacity_]; + return copy; +} + +-(void) startWithTarget:(CCNode *)aTarget +{ + [super startWithTarget:aTarget]; + fromOpacity_ = [(id)target_ opacity]; +} + +-(void) update: (ccTime) t +{ + [(id)target_ setOpacity:fromOpacity_ + ( toOpacity_ - fromOpacity_ ) * t]; +} +@end + +// +// TintTo +// +#pragma mark - +#pragma mark TintTo +@implementation CCTintTo ++(id) actionWithDuration:(ccTime)t red:(GLubyte)r green:(GLubyte)g blue:(GLubyte)b +{ + return [[(CCTintTo*)[ self alloc] initWithDuration:t red:r green:g blue:b] autorelease]; +} + +-(id) initWithDuration: (ccTime) t red:(GLubyte)r green:(GLubyte)g blue:(GLubyte)b +{ + if( (self=[super initWithDuration:t] ) ) + to_ = ccc3(r,g,b); + + return self; +} + +-(id) copyWithZone: (NSZone*) zone +{ + CCAction *copy = [(CCTintTo*)[[self class] allocWithZone: zone] initWithDuration:[self duration] red:to_.r green:to_.g blue:to_.b]; + return copy; +} + +-(void) startWithTarget:(id)aTarget +{ + [super startWithTarget:aTarget]; + + id tn = (id) target_; + from_ = [tn color]; +} + +-(void) update: (ccTime) t +{ + id tn = (id) target_; + [tn setColor:ccc3(from_.r + (to_.r - from_.r) * t, from_.g + (to_.g - from_.g) * t, from_.b + (to_.b - from_.b) * t)]; +} +@end + +// +// TintBy +// +#pragma mark - +#pragma mark TintBy +@implementation CCTintBy ++(id) actionWithDuration:(ccTime)t red:(GLshort)r green:(GLshort)g blue:(GLshort)b +{ + return [[(CCTintBy*)[ self alloc] initWithDuration:t red:r green:g blue:b] autorelease]; +} + +-(id) initWithDuration:(ccTime)t red:(GLshort)r green:(GLshort)g blue:(GLshort)b +{ + if( (self=[super initWithDuration: t] ) ) { + deltaR_ = r; + deltaG_ = g; + deltaB_ = b; + } + return self; +} + +-(id) copyWithZone: (NSZone*) zone +{ + return[(CCTintBy*)[[self class] allocWithZone: zone] initWithDuration: [self duration] red:deltaR_ green:deltaG_ blue:deltaB_]; +} + +-(void) startWithTarget:(id)aTarget +{ + [super startWithTarget:aTarget]; + + id tn = (id) target_; + ccColor3B color = [tn color]; + fromR_ = color.r; + fromG_ = color.g; + fromB_ = color.b; +} + +-(void) update: (ccTime) t +{ + id tn = (id) target_; + [tn setColor:ccc3( fromR_ + deltaR_ * t, fromG_ + deltaG_ * t, fromB_ + deltaB_ * t)]; +} + +- (CCActionInterval*) reverse +{ + return [CCTintBy actionWithDuration:duration_ red:-deltaR_ green:-deltaG_ blue:-deltaB_]; +} +@end + +// +// DelayTime +// +#pragma mark - +#pragma mark DelayTime +@implementation CCDelayTime +-(void) update: (ccTime) t +{ + return; +} + +-(id)reverse +{ + return [[self class] actionWithDuration:duration_]; +} +@end + +// +// ReverseTime +// +#pragma mark - +#pragma mark ReverseTime +@implementation CCReverseTime ++(id) actionWithAction: (CCFiniteTimeAction*) action +{ + // casting to prevent warnings + CCReverseTime *a = [super alloc]; + return [[a initWithAction:action] autorelease]; +} + +-(id) initWithAction: (CCFiniteTimeAction*) action +{ + NSAssert(action != nil, @"CCReverseTime: action should not be nil"); + NSAssert(action != other_, @"CCReverseTime: re-init doesn't support using the same arguments"); + + if( (self=[super initWithDuration: [action duration]]) ) { + // Don't leak if action is reused + [other_ release]; + other_ = [action retain]; + } + + return self; +} + +-(id) copyWithZone: (NSZone*) zone +{ + return [[[self class] allocWithZone: zone] initWithAction:[[other_ copy] autorelease] ]; +} + +-(void) dealloc +{ + [other_ release]; + [super dealloc]; +} + +-(void) startWithTarget:(id)aTarget +{ + [super startWithTarget:aTarget]; + [other_ startWithTarget:target_]; +} + +-(void) stop +{ + [other_ stop]; + [super stop]; +} + +-(void) update:(ccTime)t +{ + [other_ update:1-t]; +} + +-(CCActionInterval*) reverse +{ + return [[other_ copy] autorelease]; +} +@end + +// +// Animate +// + +#pragma mark - +#pragma mark Animate +@implementation CCAnimate + +@synthesize animation = animation_; + ++(id) actionWithAnimation: (CCAnimation*)anim +{ + return [[[self alloc] initWithAnimation:anim restoreOriginalFrame:YES] autorelease]; +} + ++(id) actionWithAnimation: (CCAnimation*)anim restoreOriginalFrame:(BOOL)b +{ + return [[[self alloc] initWithAnimation:anim restoreOriginalFrame:b] autorelease]; +} + ++(id) actionWithDuration:(ccTime)duration animation: (CCAnimation*)anim restoreOriginalFrame:(BOOL)b +{ + return [[[self alloc] initWithDuration:duration animation:anim restoreOriginalFrame:b] autorelease]; +} + +-(id) initWithAnimation: (CCAnimation*)anim +{ + NSAssert( anim!=nil, @"Animate: argument Animation must be non-nil"); + return [self initWithAnimation:anim restoreOriginalFrame:YES]; +} + +-(id) initWithAnimation: (CCAnimation*)anim restoreOriginalFrame:(BOOL) b +{ + NSAssert( anim!=nil, @"Animate: argument Animation must be non-nil"); + + if( (self=[super initWithDuration: [[anim frames] count] * [anim delay]]) ) { + + restoreOriginalFrame_ = b; + self.animation = anim; + origFrame_ = nil; + } + return self; +} + +-(id) initWithDuration:(ccTime)aDuration animation: (CCAnimation*)anim restoreOriginalFrame:(BOOL) b +{ + NSAssert( anim!=nil, @"Animate: argument Animation must be non-nil"); + + if( (self=[super initWithDuration:aDuration] ) ) { + + restoreOriginalFrame_ = b; + self.animation = anim; + origFrame_ = nil; + } + return self; +} + + +-(id) copyWithZone: (NSZone*) zone +{ + return [[[self class] allocWithZone: zone] initWithDuration:duration_ animation:animation_ restoreOriginalFrame:restoreOriginalFrame_]; +} + +-(void) dealloc +{ + [animation_ release]; + [origFrame_ release]; + [super dealloc]; +} + +-(void) startWithTarget:(id)aTarget +{ + [super startWithTarget:aTarget]; + CCSprite *sprite = target_; + + [origFrame_ release]; + + if( restoreOriginalFrame_ ) + origFrame_ = [[sprite displayedFrame] retain]; +} + +-(void) stop +{ + if( restoreOriginalFrame_ ) { + CCSprite *sprite = target_; + [sprite setDisplayFrame:origFrame_]; + } + + [super stop]; +} + +-(void) update: (ccTime) t +{ + NSArray *frames = [animation_ frames]; + NSUInteger numberOfFrames = [frames count]; + + NSUInteger idx = t * numberOfFrames; + + if( idx >= numberOfFrames ) + idx = numberOfFrames -1; + + CCSprite *sprite = target_; + if (! [sprite isFrameDisplayed: [frames objectAtIndex: idx]] ) + [sprite setDisplayFrame: [frames objectAtIndex:idx]]; +} + +- (CCActionInterval *) reverse +{ + NSArray *oldArray = [animation_ frames]; + NSMutableArray *newArray = [NSMutableArray arrayWithCapacity:[oldArray count]]; + NSEnumerator *enumerator = [oldArray reverseObjectEnumerator]; + for (id element in enumerator) + [newArray addObject:[[element copy] autorelease]]; + + CCAnimation *newAnim = [CCAnimation animationWithFrames:newArray delay:animation_.delay]; + return [[self class] actionWithDuration:duration_ animation:newAnim restoreOriginalFrame:restoreOriginalFrame_]; +} + +@end diff --git a/libs/cocos2d/CCActionManager.h b/libs/cocos2d/CCActionManager.h new file mode 100755 index 0000000..0eeda91 --- /dev/null +++ b/libs/cocos2d/CCActionManager.h @@ -0,0 +1,111 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2009 Valentin Milea + * + * Copyright (c) 2008-2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + + +#import "CCAction.h" +#import "Support/ccCArray.h" +#import "Support/uthash.h" + +typedef struct _hashElement +{ + struct ccArray *actions; + id target; + NSUInteger actionIndex; + CCAction *currentAction; + BOOL currentActionSalvaged; + BOOL paused; + UT_hash_handle hh; +} tHashElement; + + +/** CCActionManager is a singleton that manages all the actions. + Normally you won't need to use this singleton directly. 99% of the cases you will use the CCNode interface, + which uses this singleton. + But there are some cases where you might need to use this singleton. + Examples: + - When you want to run an action where the target is different from a CCNode. + - When you want to pause / resume the actions + + @since v0.8 + */ +@interface CCActionManager : NSObject +{ + tHashElement *targets; + tHashElement *currentTarget; + BOOL currentTargetSalvaged; +} + +/** returns a shared instance of the CCActionManager */ ++ (CCActionManager *)sharedManager; + +/** purges the shared action manager. It releases the retained instance. + @since v0.99.0 + */ ++(void)purgeSharedManager; + +// actions + +/** Adds an action with a target. + If the target is already present, then the action will be added to the existing target. + If the target is not present, a new instance of this target will be created either paused or paused, and the action will be added to the newly created target. + When the target is paused, the queued actions won't be 'ticked'. + */ +-(void) addAction: (CCAction*) action target:(id)target paused:(BOOL)paused; +/** Removes all actions from all the targers. + */ +-(void) removeAllActions; + +/** Removes all actions from a certain target. + All the actions that belongs to the target will be removed. + */ +-(void) removeAllActionsFromTarget:(id)target; +/** Removes an action given an action reference. + */ +-(void) removeAction: (CCAction*) action; +/** Removes an action given its tag and the target */ +-(void) removeActionByTag:(NSInteger)tag target:(id)target; +/** Gets an action given its tag an a target + @return the Action the with the given tag + */ +-(CCAction*) getActionByTag:(NSInteger) tag target:(id)target; +/** Returns the numbers of actions that are running in a certain target + * Composable actions are counted as 1 action. Example: + * If you are running 1 Sequence of 7 actions, it will return 1. + * If you are running 7 Sequences of 2 actions, it will return 7. + */ +-(NSUInteger) numberOfRunningActionsInTarget:(id)target; + +/** Pauses the target: all running actions and newly added actions will be paused. + */ +-(void) pauseTarget:(id)target; +/** Resumes the target. All queued actions will be resumed. + */ +-(void) resumeTarget:(id)target; + +@end + diff --git a/libs/cocos2d/CCActionManager.m b/libs/cocos2d/CCActionManager.m new file mode 100755 index 0000000..8bdfbb7 --- /dev/null +++ b/libs/cocos2d/CCActionManager.m @@ -0,0 +1,345 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2009 Valentin Milea + * + * Copyright (c) 2008-2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + + +#import "CCActionManager.h" +#import "CCScheduler.h" +#import "ccMacros.h" + + +// +// singleton stuff +// +static CCActionManager *sharedManager_ = nil; + +@interface CCActionManager (Private) +-(void) removeActionAtIndex:(NSUInteger)index hashElement:(tHashElement*)element; +-(void) deleteHashElement:(tHashElement*)element; +-(void) actionAllocWithHashElement:(tHashElement*)element; +@end + + +@implementation CCActionManager + +#pragma mark ActionManager - init ++ (CCActionManager *)sharedManager +{ + if (!sharedManager_) + sharedManager_ = [[self alloc] init]; + + return sharedManager_; +} + ++(id)alloc +{ + NSAssert(sharedManager_ == nil, @"Attempted to allocate a second instance of a singleton."); + return [super alloc]; +} + ++(void)purgeSharedManager +{ + [[CCScheduler sharedScheduler] unscheduleUpdateForTarget:self]; + [sharedManager_ release]; + sharedManager_ = nil; +} + +-(id) init +{ + if ((self=[super init]) ) { + [[CCScheduler sharedScheduler] scheduleUpdateForTarget:self priority:0 paused:NO]; + targets = NULL; + } + + return self; +} + +- (void) dealloc +{ + CCLOGINFO( @"cocos2d: deallocing %@", self); + + [self removeAllActions]; + + sharedManager_ = nil; + + [super dealloc]; +} + +#pragma mark ActionManager - Private + +-(void) deleteHashElement:(tHashElement*)element +{ + ccArrayFree(element->actions); + HASH_DEL(targets, element); +// CCLOG(@"cocos2d: ---- buckets: %d/%d - %@", targets->entries, targets->size, element->target); + [element->target release]; + free(element); +} + +-(void) actionAllocWithHashElement:(tHashElement*)element +{ + // 4 actions per Node by default + if( element->actions == nil ) + element->actions = ccArrayNew(4); + else if( element->actions->num == element->actions->max ) + ccArrayDoubleCapacity(element->actions); +} + +-(void) removeActionAtIndex:(NSUInteger)index hashElement:(tHashElement*)element +{ + id action = element->actions->arr[index]; + + if( action == element->currentAction && !element->currentActionSalvaged ) { + [element->currentAction retain]; + element->currentActionSalvaged = YES; + } + + ccArrayRemoveObjectAtIndex(element->actions, index); + + // update actionIndex in case we are in tick:, looping over the actions + if( element->actionIndex >= index ) + element->actionIndex--; + + if( element->actions->num == 0 ) { + if( currentTarget == element ) + currentTargetSalvaged = YES; + else + [self deleteHashElement: element]; + } +} + +#pragma mark ActionManager - Pause / Resume + +-(void) pauseTarget:(id)target +{ + tHashElement *element = NULL; + HASH_FIND_INT(targets, &target, element); + if( element ) + element->paused = YES; +// else +// CCLOG(@"cocos2d: pauseAllActions: Target not found"); +} + +-(void) resumeTarget:(id)target +{ + tHashElement *element = NULL; + HASH_FIND_INT(targets, &target, element); + if( element ) + element->paused = NO; +// else +// CCLOG(@"cocos2d: resumeAllActions: Target not found"); +} + +#pragma mark ActionManager - run + +-(void) addAction:(CCAction*)action target:(id)target paused:(BOOL)paused +{ + NSAssert( action != nil, @"Argument action must be non-nil"); + NSAssert( target != nil, @"Argument target must be non-nil"); + + tHashElement *element = NULL; + HASH_FIND_INT(targets, &target, element); + if( ! element ) { + element = calloc( sizeof( *element ), 1 ); + element->paused = paused; + element->target = [target retain]; + HASH_ADD_INT(targets, target, element); +// CCLOG(@"cocos2d: ---- buckets: %d/%d - %@", targets->entries, targets->size, element->target); + + } + + [self actionAllocWithHashElement:element]; + + NSAssert( !ccArrayContainsObject(element->actions, action), @"runAction: Action already running"); + ccArrayAppendObject(element->actions, action); + + [action startWithTarget:target]; +} + +#pragma mark ActionManager - remove + +-(void) removeAllActions +{ + for(tHashElement *element=targets; element != NULL; ) { + id target = element->target; + element = element->hh.next; + [self removeAllActionsFromTarget:target]; + } +} +-(void) removeAllActionsFromTarget:(id)target +{ + // explicit nil handling + if( target == nil ) + return; + + tHashElement *element = NULL; + HASH_FIND_INT(targets, &target, element); + if( element ) { + if( ccArrayContainsObject(element->actions, element->currentAction) && !element->currentActionSalvaged ) { + [element->currentAction retain]; + element->currentActionSalvaged = YES; + } + ccArrayRemoveAllObjects(element->actions); + if( currentTarget == element ) + currentTargetSalvaged = YES; + else + [self deleteHashElement:element]; + } +// else { +// CCLOG(@"cocos2d: removeAllActionsFromTarget: Target not found"); +// } +} + +-(void) removeAction: (CCAction*) action +{ + // explicit nil handling + if (action == nil) + return; + + tHashElement *element = NULL; + id target = [action originalTarget]; + HASH_FIND_INT(targets, &target, element ); + if( element ) { + NSUInteger i = ccArrayGetIndexOfObject(element->actions, action); + if( i != NSNotFound ) + [self removeActionAtIndex:i hashElement:element]; + } +// else { +// CCLOG(@"cocos2d: removeAction: Target not found"); +// } +} + +-(void) removeActionByTag:(NSInteger)aTag target:(id)target +{ + NSAssert( aTag != kCCActionTagInvalid, @"Invalid tag"); + NSAssert( target != nil, @"Target should be ! nil"); + + tHashElement *element = NULL; + HASH_FIND_INT(targets, &target, element); + + if( element ) { + NSUInteger limit = element->actions->num; + for( NSUInteger i = 0; i < limit; i++) { + CCAction *a = element->actions->arr[i]; + + if( a.tag == aTag && [a originalTarget]==target) { + [self removeActionAtIndex:i hashElement:element]; + break; + } + } + + } +} + +#pragma mark ActionManager - get + +-(CCAction*) getActionByTag:(NSInteger)aTag target:(id)target +{ + NSAssert( aTag != kCCActionTagInvalid, @"Invalid tag"); + + tHashElement *element = NULL; + HASH_FIND_INT(targets, &target, element); + + if( element ) { + if( element->actions != nil ) { + NSUInteger limit = element->actions->num; + for( NSUInteger i = 0; i < limit; i++) { + CCAction *a = element->actions->arr[i]; + + if( a.tag == aTag ) + return a; + } + } +// CCLOG(@"cocos2d: getActionByTag: Action not found"); + } +// else { +// CCLOG(@"cocos2d: getActionByTag: Target not found"); +// } + return nil; +} + +-(NSUInteger) numberOfRunningActionsInTarget:(id) target +{ + tHashElement *element = NULL; + HASH_FIND_INT(targets, &target, element); + if( element ) + return element->actions ? element->actions->num : 0; + +// CCLOG(@"cocos2d: numberOfRunningActionsInTarget: Target not found"); + return 0; +} + +#pragma mark ActionManager - main loop + +-(void) update: (ccTime) dt +{ + for(tHashElement *elt = targets; elt != NULL; ) { + + currentTarget = elt; + currentTargetSalvaged = NO; + + if( ! currentTarget->paused ) { + + // The 'actions' ccArray may change while inside this loop. + for( currentTarget->actionIndex = 0; currentTarget->actionIndex < currentTarget->actions->num; currentTarget->actionIndex++) { + currentTarget->currentAction = currentTarget->actions->arr[currentTarget->actionIndex]; + currentTarget->currentActionSalvaged = NO; + + [currentTarget->currentAction step: dt]; + + if( currentTarget->currentActionSalvaged ) { + // The currentAction told the node to remove it. To prevent the action from + // accidentally deallocating itself before finishing its step, we retained + // it. Now that step is done, it's safe to release it. + [currentTarget->currentAction release]; + + } else if( [currentTarget->currentAction isDone] ) { + [currentTarget->currentAction stop]; + + CCAction *a = currentTarget->currentAction; + // Make currentAction nil to prevent removeAction from salvaging it. + currentTarget->currentAction = nil; + [self removeAction:a]; + } + + currentTarget->currentAction = nil; + } + } + + // elt, at this moment, is still valid + // so it is safe to ask this here (issue #490) + elt = elt->hh.next; + + // only delete currentTarget if no actions were scheduled during the cycle (issue #481) + if( currentTargetSalvaged && currentTarget->actions->num == 0 ) + [self deleteHashElement:currentTarget]; + } + + // issue #635 + currentTarget = nil; +} +@end diff --git a/libs/cocos2d/CCActionPageTurn3D.h b/libs/cocos2d/CCActionPageTurn3D.h new file mode 100755 index 0000000..39eb31d --- /dev/null +++ b/libs/cocos2d/CCActionPageTurn3D.h @@ -0,0 +1,42 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2009 Sindesso Pty Ltd http://www.sindesso.com/ + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + + +#import "CCActionGrid3D.h" + +/** + * This action simulates a page turn from the bottom right hand corner of the screen + * It's not much use by itself but is used by the PageTurnTransition. + * + * Based on an original paper by L Hong et al. + * http://www.parc.com/publication/1638/turning-pages-of-3d-electronic-books.html + * + * @since v0.8.2 + */ +@interface CCPageTurn3D : CCGrid3DAction +{ +} + +@end diff --git a/libs/cocos2d/CCActionPageTurn3D.m b/libs/cocos2d/CCActionPageTurn3D.m new file mode 100755 index 0000000..ee59500 --- /dev/null +++ b/libs/cocos2d/CCActionPageTurn3D.m @@ -0,0 +1,86 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2009 Sindesso Pty Ltd http://www.sindesso.com/ + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + +#import "CCActionPageTurn3D.h" + +@implementation CCPageTurn3D + +/* + * Update each tick + * Time is the percentage of the way through the duration + */ +-(void)update:(ccTime)time +{ + float tt = MAX( 0, time - 0.25f ); + float deltaAy = ( tt * tt * 500); + float ay = -100 - deltaAy; + + float deltaTheta = - (float) M_PI_2 * sqrtf( time) ; + float theta = /*0.01f*/ + (float) M_PI_2 +deltaTheta; + + float sinTheta = sinf(theta); + float cosTheta = cosf(theta); + + for( int i = 0; i <=gridSize_.x; i++ ) + { + for( int j = 0; j <= gridSize_.y; j++ ) + { + // Get original vertex + ccVertex3F p = [self originalVertex:ccg(i,j)]; + + float R = sqrtf(p.x*p.x + (p.y - ay) * (p.y - ay)); + float r = R * sinTheta; + float alpha = asinf( p.x / R ); + float beta = alpha / sinTheta; + float cosBeta = cosf( beta ); + + // If beta > PI then we've wrapped around the cone + // Reduce the radius to stop these points interfering with others + if( beta <= M_PI) + p.x = ( r * sinf(beta)); + else + { + // Force X = 0 to stop wrapped + // points + p.x = 0; + } + + p.y = ( R + ay - ( r*(1 - cosBeta)*sinTheta)); + + // We scale z here to avoid the animation being + // too much bigger than the screen due to perspectve transform + p.z = (r * ( 1 - cosBeta ) * cosTheta) / 7; // "100" didn't work for + + // Stop z coord from dropping beneath underlying page in a transition + // issue #751 + if( p.z<0.5f ) + p.z = 0.5f; + + // Set new coords + [self setVertex:ccg(i,j) vertex:p]; + } + } +} +@end diff --git a/libs/cocos2d/CCActionProgressTimer.h b/libs/cocos2d/CCActionProgressTimer.h new file mode 100755 index 0000000..500631b --- /dev/null +++ b/libs/cocos2d/CCActionProgressTimer.h @@ -0,0 +1,59 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (C) 2010 Lam Pham + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + + +#import +#import "CCProgressTimer.h" +#import "CCActionInterval.h" + +/** + Progress to percentage +@since v0.99.1 +*/ +@interface CCProgressTo : CCActionInterval +{ + float to_; + float from_; +} +/** Creates and initializes with a duration and a percent */ ++(id) actionWithDuration:(ccTime)duration percent:(float)percent; +/** Initializes with a duration and a percent */ +-(id) initWithDuration:(ccTime)duration percent:(float)percent; +@end + +/** + Progress from a percentage to another percentage + @since v0.99.1 + */ +@interface CCProgressFromTo : CCActionInterval +{ + float to_; + float from_; +} +/** Creates and initializes the action with a duration, a "from" percentage and a "to" percentage */ ++(id) actionWithDuration:(ccTime)duration from:(float)fromPercentage to:(float) toPercentage; +/** Initializes the action with a duration, a "from" percentage and a "to" percentage */ +-(id) initWithDuration:(ccTime)duration from:(float)fromPercentage to:(float) toPercentage; +@end diff --git a/libs/cocos2d/CCActionProgressTimer.m b/libs/cocos2d/CCActionProgressTimer.m new file mode 100755 index 0000000..c242570 --- /dev/null +++ b/libs/cocos2d/CCActionProgressTimer.m @@ -0,0 +1,103 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (C) 2010 Lam Pham + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + + +#import "CCActionProgressTimer.h" + +#define kProgressTimerCast CCProgressTimer* + +@implementation CCProgressTo ++(id) actionWithDuration: (ccTime) t percent: (float) v +{ + return [[[ self alloc] initWithDuration: t percent: v] autorelease]; +} + +-(id) initWithDuration: (ccTime) t percent: (float) v +{ + if( (self=[super initWithDuration: t] ) ) + to_ = v; + + return self; +} + +-(id) copyWithZone: (NSZone*) zone +{ + CCAction *copy = [[[self class] allocWithZone: zone] initWithDuration:duration_ percent:to_]; + return copy; +} + +-(void) startWithTarget:(id) aTarget; +{ + [super startWithTarget:aTarget]; + from_ = [(kProgressTimerCast)target_ percentage]; + + // XXX: Is this correct ? + // Adding it to support CCRepeat + if( from_ == 100) + from_ = 0; +} + +-(void) update: (ccTime) t +{ + [(kProgressTimerCast)target_ setPercentage: from_ + ( to_ - from_ ) * t]; +} +@end + +@implementation CCProgressFromTo ++(id) actionWithDuration: (ccTime) t from:(float)fromPercentage to:(float) toPercentage +{ + return [[[self alloc] initWithDuration: t from: fromPercentage to: toPercentage] autorelease]; +} + +-(id) initWithDuration: (ccTime) t from:(float)fromPercentage to:(float) toPercentage +{ + if( (self=[super initWithDuration: t] ) ){ + to_ = toPercentage; + from_ = fromPercentage; + } + return self; +} + +-(id) copyWithZone: (NSZone*) zone +{ + CCAction *copy = [[[self class] allocWithZone: zone] initWithDuration:duration_ from:from_ to:to_]; + return copy; +} + +- (CCActionInterval *) reverse +{ + return [[self class] actionWithDuration:duration_ from:to_ to:from_]; +} + +-(void) startWithTarget:(id) aTarget; +{ + [super startWithTarget:aTarget]; +} + +-(void) update: (ccTime) t +{ + [(kProgressTimerCast)target_ setPercentage: from_ + ( to_ - from_ ) * t]; +} +@end diff --git a/libs/cocos2d/CCActionTiledGrid.h b/libs/cocos2d/CCActionTiledGrid.h new file mode 100755 index 0000000..d66132d --- /dev/null +++ b/libs/cocos2d/CCActionTiledGrid.h @@ -0,0 +1,211 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2009 On-Core + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + +#import "CCActionGrid.h" + +/** CCShakyTiles3D action */ +@interface CCShakyTiles3D : CCTiledGrid3DAction +{ + int randrange; + BOOL shakeZ; +} + +/** creates the action with a range, whether or not to shake Z vertices, a grid size, and duration */ ++(id)actionWithRange:(int)range shakeZ:(BOOL)shakeZ grid:(ccGridSize)gridSize duration:(ccTime)d; +/** initializes the action with a range, whether or not to shake Z vertices, a grid size, and duration */ +-(id)initWithRange:(int)range shakeZ:(BOOL)shakeZ grid:(ccGridSize)gridSize duration:(ccTime)d; + +@end + +//////////////////////////////////////////////////////////// + +/** CCShatteredTiles3D action */ +@interface CCShatteredTiles3D : CCTiledGrid3DAction +{ + int randrange; + BOOL once; + BOOL shatterZ; +} + +/** creates the action with a range, whether of not to shatter Z vertices, a grid size and duration */ ++(id)actionWithRange:(int)range shatterZ:(BOOL)shatterZ grid:(ccGridSize)gridSize duration:(ccTime)d; +/** initializes the action with a range, whether or not to shatter Z vertices, a grid size and duration */ +-(id)initWithRange:(int)range shatterZ:(BOOL)shatterZ grid:(ccGridSize)gridSize duration:(ccTime)d; + +@end + +//////////////////////////////////////////////////////////// + +/** CCShuffleTiles action + Shuffle the tiles in random order + */ +@interface CCShuffleTiles : CCTiledGrid3DAction +{ + int seed; + NSUInteger tilesCount; + int *tilesOrder; + void *tiles; +} + +/** creates the action with a random seed, the grid size and the duration */ ++(id)actionWithSeed:(int)s grid:(ccGridSize)gridSize duration:(ccTime)d; +/** initializes the action with a random seed, the grid size and the duration */ +-(id)initWithSeed:(int)s grid:(ccGridSize)gridSize duration:(ccTime)d; + +@end + +//////////////////////////////////////////////////////////// + +/** CCFadeOutTRTiles action + Fades out the tiles in a Top-Right direction + */ +@interface CCFadeOutTRTiles : CCTiledGrid3DAction +{ +} +@end + +//////////////////////////////////////////////////////////// + +/** CCFadeOutBLTiles action. + Fades out the tiles in a Bottom-Left direction + */ +@interface CCFadeOutBLTiles : CCFadeOutTRTiles +{ +} +@end + +//////////////////////////////////////////////////////////// + +/** CCFadeOutUpTiles action. + Fades out the tiles in upwards direction + */ +@interface CCFadeOutUpTiles : CCFadeOutTRTiles +{ +} +@end + +//////////////////////////////////////////////////////////// + +/** CCFadeOutDownTiles action. + Fades out the tiles in downwards direction + */ +@interface CCFadeOutDownTiles : CCFadeOutUpTiles +{ +} +@end + +//////////////////////////////////////////////////////////// + +/** CCTurnOffTiles action. + Turn off the files in random order + */ +@interface CCTurnOffTiles : CCTiledGrid3DAction +{ + int seed; + NSUInteger tilesCount; + int *tilesOrder; +} + +/** creates the action with a random seed, the grid size and the duration */ ++(id)actionWithSeed:(int)s grid:(ccGridSize)gridSize duration:(ccTime)d; +/** initializes the action with a random seed, the grid size and the duration */ +-(id)initWithSeed:(int)s grid:(ccGridSize)gridSize duration:(ccTime)d; +@end + +//////////////////////////////////////////////////////////// + +/** CCWavesTiles3D action. */ +@interface CCWavesTiles3D : CCTiledGrid3DAction +{ + int waves; + float amplitude; + float amplitudeRate; +} + +/** waves amplitude */ +@property (nonatomic,readwrite) float amplitude; +/** waves amplitude rate */ +@property (nonatomic,readwrite) float amplitudeRate; + +/** creates the action with a number of waves, the waves amplitude, the grid size and the duration */ ++(id)actionWithWaves:(int)wav amplitude:(float)amp grid:(ccGridSize)gridSize duration:(ccTime)d; +/** initializes the action with a number of waves, the waves amplitude, the grid size and the duration */ +-(id)initWithWaves:(int)wav amplitude:(float)amp grid:(ccGridSize)gridSize duration:(ccTime)d; + +@end + +//////////////////////////////////////////////////////////// + +/** CCJumpTiles3D action. + A sin function is executed to move the tiles across the Z axis + */ +@interface CCJumpTiles3D : CCTiledGrid3DAction +{ + int jumps; + float amplitude; + float amplitudeRate; +} + +/** amplitude of the sin*/ +@property (nonatomic,readwrite) float amplitude; +/** amplitude rate */ +@property (nonatomic,readwrite) float amplitudeRate; + +/** creates the action with the number of jumps, the sin amplitude, the grid size and the duration */ ++(id)actionWithJumps:(int)j amplitude:(float)amp grid:(ccGridSize)gridSize duration:(ccTime)d; +/** initializes the action with the number of jumps, the sin amplitude, the grid size and the duration */ +-(id)initWithJumps:(int)j amplitude:(float)amp grid:(ccGridSize)gridSize duration:(ccTime)d; + +@end + +//////////////////////////////////////////////////////////// + +/** CCSplitRows action */ +@interface CCSplitRows : CCTiledGrid3DAction +{ + int rows; + CGSize winSize; +} +/** creates the action with the number of rows to split and the duration */ ++(id)actionWithRows:(int)rows duration:(ccTime)duration; +/** initializes the action with the number of rows to split and the duration */ +-(id)initWithRows:(int)rows duration:(ccTime)duration; + +@end + +//////////////////////////////////////////////////////////// + +/** CCSplitCols action */ +@interface CCSplitCols : CCTiledGrid3DAction +{ + int cols; + CGSize winSize; +} +/** creates the action with the number of columns to split and the duration */ ++(id)actionWithCols:(int)cols duration:(ccTime)duration; +/** initializes the action with the number of columns to split and the duration */ +-(id)initWithCols:(int)cols duration:(ccTime)duration; + +@end diff --git a/libs/cocos2d/CCActionTiledGrid.m b/libs/cocos2d/CCActionTiledGrid.m new file mode 100755 index 0000000..75965ec --- /dev/null +++ b/libs/cocos2d/CCActionTiledGrid.m @@ -0,0 +1,768 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2009 On-Core + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + + +#import "CCActionTiledGrid.h" +#import "CCDirector.h" +#import "ccMacros.h" +#import "Support/CGPointExtension.h" + +typedef struct +{ + CGPoint position; + CGPoint startPosition; + ccGridSize delta; +} Tile; + +#pragma mark - +#pragma mark ShakyTiles3D + +@implementation CCShakyTiles3D + ++(id)actionWithRange:(int)range shakeZ:(BOOL)shakeZ grid:(ccGridSize)gridSize duration:(ccTime)d +{ + return [[[self alloc] initWithRange:range shakeZ:shakeZ grid:gridSize duration:d] autorelease]; +} + +-(id)initWithRange:(int)range shakeZ:(BOOL)sz grid:(ccGridSize)gSize duration:(ccTime)d +{ + if ( (self = [super initWithSize:gSize duration:d]) ) + { + randrange = range; + shakeZ = sz; + } + + return self; +} + +-(id) copyWithZone: (NSZone*) zone +{ + CCGridAction *copy = [[[self class] allocWithZone:zone] initWithRange:randrange shakeZ:shakeZ grid:gridSize_ duration:duration_]; + return copy; +} + + +-(void)update:(ccTime)time +{ + int i, j; + + for( i = 0; i < gridSize_.x; i++ ) + { + for( j = 0; j < gridSize_.y; j++ ) + { + ccQuad3 coords = [self originalTile:ccg(i,j)]; + + // X + coords.bl.x += ( rand() % (randrange*2) ) - randrange; + coords.br.x += ( rand() % (randrange*2) ) - randrange; + coords.tl.x += ( rand() % (randrange*2) ) - randrange; + coords.tr.x += ( rand() % (randrange*2) ) - randrange; + + // Y + coords.bl.y += ( rand() % (randrange*2) ) - randrange; + coords.br.y += ( rand() % (randrange*2) ) - randrange; + coords.tl.y += ( rand() % (randrange*2) ) - randrange; + coords.tr.y += ( rand() % (randrange*2) ) - randrange; + + if( shakeZ ) { + coords.bl.z += ( rand() % (randrange*2) ) - randrange; + coords.br.z += ( rand() % (randrange*2) ) - randrange; + coords.tl.z += ( rand() % (randrange*2) ) - randrange; + coords.tr.z += ( rand() % (randrange*2) ) - randrange; + } + + [self setTile:ccg(i,j) coords:coords]; + } + } +} + +@end + +//////////////////////////////////////////////////////////// + +#pragma mark - +#pragma mark CCShatteredTiles3D + +@implementation CCShatteredTiles3D + ++(id)actionWithRange:(int)range shatterZ:(BOOL)sz grid:(ccGridSize)gridSize duration:(ccTime)d +{ + return [[[self alloc] initWithRange:range shatterZ:sz grid:gridSize duration:d] autorelease]; +} + +-(id)initWithRange:(int)range shatterZ:(BOOL)sz grid:(ccGridSize)gSize duration:(ccTime)d +{ + if ( (self = [super initWithSize:gSize duration:d]) ) + { + once = NO; + randrange = range; + shatterZ = sz; + } + + return self; +} + +-(id) copyWithZone: (NSZone*) zone +{ + CCGridAction *copy = [[[self class] allocWithZone:zone] initWithRange:randrange shatterZ:shatterZ grid:gridSize_ duration:duration_]; + return copy; +} + + +-(void)update:(ccTime)time +{ + int i, j; + + if ( once == NO ) + { + for( i = 0; i < gridSize_.x; i++ ) + { + for( j = 0; j < gridSize_.y; j++ ) + { + ccQuad3 coords = [self originalTile:ccg(i,j)]; + + // X + coords.bl.x += ( rand() % (randrange*2) ) - randrange; + coords.br.x += ( rand() % (randrange*2) ) - randrange; + coords.tl.x += ( rand() % (randrange*2) ) - randrange; + coords.tr.x += ( rand() % (randrange*2) ) - randrange; + + // Y + coords.bl.y += ( rand() % (randrange*2) ) - randrange; + coords.br.y += ( rand() % (randrange*2) ) - randrange; + coords.tl.y += ( rand() % (randrange*2) ) - randrange; + coords.tr.y += ( rand() % (randrange*2) ) - randrange; + + if( shatterZ ) { + coords.bl.z += ( rand() % (randrange*2) ) - randrange; + coords.br.z += ( rand() % (randrange*2) ) - randrange; + coords.tl.z += ( rand() % (randrange*2) ) - randrange; + coords.tr.z += ( rand() % (randrange*2) ) - randrange; + } + + [self setTile:ccg(i,j) coords:coords]; + } + } + + once = YES; + } +} + +@end + +//////////////////////////////////////////////////////////// + +#pragma mark - +#pragma mark CCShuffleTiles + +@implementation CCShuffleTiles + ++(id)actionWithSeed:(int)s grid:(ccGridSize)gridSize duration:(ccTime)d +{ + return [[[self alloc] initWithSeed:s grid:gridSize duration:d] autorelease]; +} + +-(id)initWithSeed:(int)s grid:(ccGridSize)gSize duration:(ccTime)d +{ + if ( (self = [super initWithSize:gSize duration:d]) ) + { + seed = s; + tilesOrder = nil; + tiles = nil; + } + + return self; +} + +-(id) copyWithZone: (NSZone*) zone +{ + CCGridAction *copy = [[[self class] allocWithZone:zone] initWithSeed:seed grid:gridSize_ duration:duration_]; + return copy; +} + + +-(void)dealloc +{ + if ( tilesOrder ) free(tilesOrder); + if ( tiles ) free(tiles); + [super dealloc]; +} + +-(void)shuffle:(int*)array count:(NSUInteger)len +{ + NSInteger i; + for( i = len - 1; i >= 0; i-- ) + { + NSInteger j = rand() % (i+1); + int v = array[i]; + array[i] = array[j]; + array[j] = v; + } +} + +-(ccGridSize)getDelta:(ccGridSize)pos +{ + CGPoint pos2; + + NSInteger idx = pos.x * gridSize_.y + pos.y; + + pos2.x = tilesOrder[idx] / (int)gridSize_.y; + pos2.y = tilesOrder[idx] % (int)gridSize_.y; + + return ccg(pos2.x - pos.x, pos2.y - pos.y); +} + +-(void)placeTile:(ccGridSize)pos tile:(Tile)t +{ + ccQuad3 coords = [self originalTile:pos]; + + CGPoint step = [[target_ grid] step]; + coords.bl.x += (int)(t.position.x * step.x); + coords.bl.y += (int)(t.position.y * step.y); + + coords.br.x += (int)(t.position.x * step.x); + coords.br.y += (int)(t.position.y * step.y); + + coords.tl.x += (int)(t.position.x * step.x); + coords.tl.y += (int)(t.position.y * step.y); + + coords.tr.x += (int)(t.position.x * step.x); + coords.tr.y += (int)(t.position.y * step.y); + + [self setTile:pos coords:coords]; +} + +-(void)startWithTarget:(id)aTarget +{ + [super startWithTarget:aTarget]; + + if ( seed != -1 ) + srand(seed); + + tilesCount = gridSize_.x * gridSize_.y; + tilesOrder = (int*)malloc(tilesCount*sizeof(int)); + int i, j; + + for( i = 0; i < tilesCount; i++ ) + tilesOrder[i] = i; + + [self shuffle:tilesOrder count:tilesCount]; + + tiles = malloc(tilesCount*sizeof(Tile)); + Tile *tileArray = (Tile*)tiles; + + for( i = 0; i < gridSize_.x; i++ ) + { + for( j = 0; j < gridSize_.y; j++ ) + { + tileArray->position = ccp(i,j); + tileArray->startPosition = ccp(i,j); + tileArray->delta = [self getDelta:ccg(i,j)]; + tileArray++; + } + } +} + +-(void)update:(ccTime)time +{ + int i, j; + + Tile *tileArray = (Tile*)tiles; + + for( i = 0; i < gridSize_.x; i++ ) + { + for( j = 0; j < gridSize_.y; j++ ) + { + tileArray->position = ccpMult( ccp(tileArray->delta.x, tileArray->delta.y), time); + [self placeTile:ccg(i,j) tile:*tileArray]; + tileArray++; + } + } +} + +@end + +//////////////////////////////////////////////////////////// + +#pragma mark - +#pragma mark CCFadeOutTRTiles + +@implementation CCFadeOutTRTiles + +-(float)testFunc:(ccGridSize)pos time:(ccTime)time +{ + CGPoint n = ccpMult( ccp(gridSize_.x,gridSize_.y), time); + if ( (n.x+n.y) == 0.0f ) + return 1.0f; + + return powf( (pos.x+pos.y) / (n.x+n.y), 6 ); +} + +-(void)turnOnTile:(ccGridSize)pos +{ + [self setTile:pos coords:[self originalTile:pos]]; +} + +-(void)turnOffTile:(ccGridSize)pos +{ + ccQuad3 coords; + bzero(&coords, sizeof(ccQuad3)); + [self setTile:pos coords:coords]; +} + +-(void)transformTile:(ccGridSize)pos distance:(float)distance +{ + ccQuad3 coords = [self originalTile:pos]; + CGPoint step = [[target_ grid] step]; + + coords.bl.x += (step.x / 2) * (1.0f - distance); + coords.bl.y += (step.y / 2) * (1.0f - distance); + + coords.br.x -= (step.x / 2) * (1.0f - distance); + coords.br.y += (step.y / 2) * (1.0f - distance); + + coords.tl.x += (step.x / 2) * (1.0f - distance); + coords.tl.y -= (step.y / 2) * (1.0f - distance); + + coords.tr.x -= (step.x / 2) * (1.0f - distance); + coords.tr.y -= (step.y / 2) * (1.0f - distance); + + [self setTile:pos coords:coords]; +} + +-(void)update:(ccTime)time +{ + int i, j; + + for( i = 0; i < gridSize_.x; i++ ) + { + for( j = 0; j < gridSize_.y; j++ ) + { + float distance = [self testFunc:ccg(i,j) time:time]; + if ( distance == 0 ) + [self turnOffTile:ccg(i,j)]; + else if ( distance < 1 ) + [self transformTile:ccg(i,j) distance:distance]; + else + [self turnOnTile:ccg(i,j)]; + } + } +} + +@end + +//////////////////////////////////////////////////////////// + +#pragma mark - +#pragma mark CCFadeOutBLTiles + +@implementation CCFadeOutBLTiles + +-(float)testFunc:(ccGridSize)pos time:(ccTime)time +{ + CGPoint n = ccpMult(ccp(gridSize_.x, gridSize_.y), (1.0f-time)); + if ( (pos.x+pos.y) == 0 ) + return 1.0f; + + return powf( (n.x+n.y) / (pos.x+pos.y), 6 ); +} + +@end + +//////////////////////////////////////////////////////////// + +#pragma mark - +#pragma mark CCFadeOutUpTiles + +@implementation CCFadeOutUpTiles + +-(float)testFunc:(ccGridSize)pos time:(ccTime)time +{ + CGPoint n = ccpMult(ccp(gridSize_.x, gridSize_.y), time); + if ( n.y == 0 ) + return 1.0f; + + return powf( pos.y / n.y, 6 ); +} + +-(void)transformTile:(ccGridSize)pos distance:(float)distance +{ + ccQuad3 coords = [self originalTile:pos]; + CGPoint step = [[target_ grid] step]; + + coords.bl.y += (step.y / 2) * (1.0f - distance); + coords.br.y += (step.y / 2) * (1.0f - distance); + coords.tl.y -= (step.y / 2) * (1.0f - distance); + coords.tr.y -= (step.y / 2) * (1.0f - distance); + + [self setTile:pos coords:coords]; +} + +@end + +//////////////////////////////////////////////////////////// + +#pragma mark - +#pragma mark CCFadeOutDownTiles + +@implementation CCFadeOutDownTiles + +-(float)testFunc:(ccGridSize)pos time:(ccTime)time +{ + CGPoint n = ccpMult(ccp(gridSize_.x,gridSize_.y), (1.0f - time)); + if ( pos.y == 0 ) + return 1.0f; + + return powf( n.y / pos.y, 6 ); +} + +@end + +//////////////////////////////////////////////////////////// + +#pragma mark - +#pragma mark TurnOffTiles + +@implementation CCTurnOffTiles + ++(id)actionWithSeed:(int)s grid:(ccGridSize)gridSize duration:(ccTime)d +{ + return [[[self alloc] initWithSeed:s grid:gridSize duration:d] autorelease]; +} + +-(id)initWithSeed:(int)s grid:(ccGridSize)gSize duration:(ccTime)d +{ + if ( (self = [super initWithSize:gSize duration:d]) ) + { + seed = s; + tilesOrder = nil; + } + + return self; +} + +-(id) copyWithZone: (NSZone*) zone +{ + CCGridAction *copy = [[[self class] allocWithZone:zone] initWithSeed:seed grid:gridSize_ duration:duration_]; + return copy; +} + +-(void)dealloc +{ + if ( tilesOrder ) free(tilesOrder); + [super dealloc]; +} + +-(void)shuffle:(int*)array count:(NSUInteger)len +{ + NSInteger i; + for( i = len - 1; i >= 0; i-- ) + { + NSInteger j = rand() % (i+1); + int v = array[i]; + array[i] = array[j]; + array[j] = v; + } +} + +-(void)turnOnTile:(ccGridSize)pos +{ + [self setTile:pos coords:[self originalTile:pos]]; +} + +-(void)turnOffTile:(ccGridSize)pos +{ + ccQuad3 coords; + + bzero(&coords, sizeof(ccQuad3)); + [self setTile:pos coords:coords]; +} + +-(void)startWithTarget:(id)aTarget +{ + int i; + + [super startWithTarget:aTarget]; + + if ( seed != -1 ) + srand(seed); + + tilesCount = gridSize_.x * gridSize_.y; + tilesOrder = (int*)malloc(tilesCount*sizeof(int)); + + for( i = 0; i < tilesCount; i++ ) + tilesOrder[i] = i; + + [self shuffle:tilesOrder count:tilesCount]; +} + +-(void)update:(ccTime)time +{ + int i, l, t; + + l = (int)(time * (float)tilesCount); + + for( i = 0; i < tilesCount; i++ ) + { + t = tilesOrder[i]; + ccGridSize tilePos = ccg( t / gridSize_.y, t % gridSize_.y ); + + if ( i < l ) + [self turnOffTile:tilePos]; + else + [self turnOnTile:tilePos]; + } +} + +@end + +//////////////////////////////////////////////////////////// + +#pragma mark - +#pragma mark CCWavesTiles3D + +@implementation CCWavesTiles3D + +@synthesize amplitude; +@synthesize amplitudeRate; + ++(id)actionWithWaves:(int)wav amplitude:(float)amp grid:(ccGridSize)gridSize duration:(ccTime)d +{ + return [[[self alloc] initWithWaves:wav amplitude:amp grid:gridSize duration:d] autorelease]; +} + +-(id)initWithWaves:(int)wav amplitude:(float)amp grid:(ccGridSize)gSize duration:(ccTime)d +{ + if ( (self = [super initWithSize:gSize duration:d]) ) + { + waves = wav; + amplitude = amp; + amplitudeRate = 1.0f; + } + + return self; +} + +-(id) copyWithZone: (NSZone*) zone +{ + CCGridAction *copy = [[[self class] allocWithZone:zone] initWithWaves:waves amplitude:amplitude grid:gridSize_ duration:duration_]; + return copy; +} + + +-(void)update:(ccTime)time +{ + int i, j; + + for( i = 0; i < gridSize_.x; i++ ) + { + for( j = 0; j < gridSize_.y; j++ ) + { + ccQuad3 coords = [self originalTile:ccg(i,j)]; + + coords.bl.z = (sinf(time*(CGFloat)M_PI*waves*2 + (coords.bl.y+coords.bl.x) * .01f) * amplitude * amplitudeRate ); + coords.br.z = coords.bl.z; + coords.tl.z = coords.bl.z; + coords.tr.z = coords.bl.z; + + [self setTile:ccg(i,j) coords:coords]; + } + } +} +@end + +//////////////////////////////////////////////////////////// + +#pragma mark - +#pragma mark CCJumpTiles3D + +@implementation CCJumpTiles3D + +@synthesize amplitude; +@synthesize amplitudeRate; + ++(id)actionWithJumps:(int)j amplitude:(float)amp grid:(ccGridSize)gridSize duration:(ccTime)d +{ + return [[[self alloc] initWithJumps:j amplitude:amp grid:gridSize duration:d] autorelease]; +} + +-(id)initWithJumps:(int)j amplitude:(float)amp grid:(ccGridSize)gSize duration:(ccTime)d +{ + if ( (self = [super initWithSize:gSize duration:d]) ) + { + jumps = j; + amplitude = amp; + amplitudeRate = 1.0f; + } + + return self; +} + +-(id) copyWithZone: (NSZone*) zone +{ + CCGridAction *copy = [[[self class] allocWithZone:zone] initWithJumps:jumps amplitude:amplitude grid:gridSize_ duration:duration_]; + return copy; +} + + +-(void)update:(ccTime)time +{ + int i, j; + + float sinz = (sinf((CGFloat)M_PI*time*jumps*2) * amplitude * amplitudeRate ); + float sinz2 = (sinf((CGFloat)M_PI*(time*jumps*2 + 1)) * amplitude * amplitudeRate ); + + for( i = 0; i < gridSize_.x; i++ ) + { + for( j = 0; j < gridSize_.y; j++ ) + { + ccQuad3 coords = [self originalTile:ccg(i,j)]; + + if ( ((i+j) % 2) == 0 ) + { + coords.bl.z += sinz; + coords.br.z += sinz; + coords.tl.z += sinz; + coords.tr.z += sinz; + } + else + { + coords.bl.z += sinz2; + coords.br.z += sinz2; + coords.tl.z += sinz2; + coords.tr.z += sinz2; + } + + [self setTile:ccg(i,j) coords:coords]; + } + } +} +@end + +//////////////////////////////////////////////////////////// + +#pragma mark - +#pragma mark SplitRows + +@implementation CCSplitRows + ++(id)actionWithRows:(int)r duration:(ccTime)d +{ + return [[[self alloc] initWithRows:r duration:d] autorelease]; +} + +-(id)initWithRows:(int)r duration:(ccTime)d +{ + rows = r; + return [super initWithSize:ccg(1,r) duration:d]; +} + +-(id) copyWithZone: (NSZone*) zone +{ + CCGridAction *copy = [[[self class] allocWithZone:zone] initWithRows:rows duration:duration_]; + return copy; +} + +-(void)startWithTarget:(id)aTarget +{ + [super startWithTarget:aTarget]; + winSize = [[CCDirector sharedDirector] winSizeInPixels]; +} + +-(void)update:(ccTime)time +{ + int j; + + for( j = 0; j < gridSize_.y; j++ ) + { + ccQuad3 coords = [self originalTile:ccg(0,j)]; + float direction = 1; + + if ( (j % 2 ) == 0 ) + direction = -1; + + coords.bl.x += direction * winSize.width * time; + coords.br.x += direction * winSize.width * time; + coords.tl.x += direction * winSize.width * time; + coords.tr.x += direction * winSize.width * time; + + [self setTile:ccg(0,j) coords:coords]; + } +} + +@end + +//////////////////////////////////////////////////////////// + +#pragma mark - +#pragma mark CCSplitCols + +@implementation CCSplitCols + ++(id)actionWithCols:(int)c duration:(ccTime)d +{ + return [[[self alloc] initWithCols:c duration:d] autorelease]; +} + +-(id)initWithCols:(int)c duration:(ccTime)d +{ + cols = c; + return [super initWithSize:ccg(c,1) duration:d]; +} + +-(id) copyWithZone: (NSZone*) zone +{ + CCGridAction *copy = [[[self class] allocWithZone:zone] initWithCols:cols duration:duration_]; + return copy; +} + +-(void)startWithTarget:(id)aTarget +{ + [super startWithTarget:aTarget]; + winSize = [[CCDirector sharedDirector] winSizeInPixels]; +} + +-(void)update:(ccTime)time +{ + int i; + + for( i = 0; i < gridSize_.x; i++ ) + { + ccQuad3 coords = [self originalTile:ccg(i,0)]; + float direction = 1; + + if ( (i % 2 ) == 0 ) + direction = -1; + + coords.bl.y += direction * winSize.height * time; + coords.br.y += direction * winSize.height * time; + coords.tl.y += direction * winSize.height * time; + coords.tr.y += direction * winSize.height * time; + + [self setTile:ccg(i,0) coords:coords]; + } +} + +@end diff --git a/libs/cocos2d/CCActionTween.h b/libs/cocos2d/CCActionTween.h new file mode 100755 index 0000000..69fdea5 --- /dev/null +++ b/libs/cocos2d/CCActionTween.h @@ -0,0 +1,62 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright 2009 lhunath (Maarten Billemont) + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + + +#import +#import "CCActionInterval.h" + +/** CCActionTween + + CCActionTween is an action that lets you update any property of an object. + For example, if you want to modify the "width" property of a target from 200 to 300 in 2 senconds, then: + + id modifyWidth = [CCActionTween actionWithDuration:2 key:@"width" from:200 to:300]; + [target runAction:modifyWidth]; + + + Another example: CCScaleTo action could be rewriten using CCPropertyAction: + + // scaleA and scaleB are equivalents + id scaleA = [CCScaleTo actionWithDuration:2 scale:3]; + id scaleB = [CCActionTween actionWithDuration:2 key:@"scale" from:1 to:3]; + + + @since v0.99.2 + */ +@interface CCActionTween : CCActionInterval +{ + NSString *key_; + + float from_, to_; + float delta_; +} + +/** creates an initializes the action with the property name (key), and the from and to parameters. */ ++ (id)actionWithDuration:(ccTime)aDuration key:(NSString *)key from:(float)from to:(float)to; + +/** initializes the action with the property name (key), and the from and to parameters. */ +- (id)initWithDuration:(ccTime)aDuration key:(NSString *)key from:(float)from to:(float)to; + +@end diff --git a/libs/cocos2d/CCActionTween.m b/libs/cocos2d/CCActionTween.m new file mode 100755 index 0000000..95ae572 --- /dev/null +++ b/libs/cocos2d/CCActionTween.m @@ -0,0 +1,72 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright 2009 lhunath (Maarten Billemont) + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + +#import "CCActionTween.h" + + +@implementation CCActionTween + ++ (id)actionWithDuration:(ccTime)aDuration key:(NSString *)aKey from:(float)aFrom to:(float)aTo { + + return [[[[self class] alloc] initWithDuration:aDuration key:aKey from:aFrom to:aTo] autorelease]; +} + +- (id)initWithDuration:(ccTime)aDuration key:(NSString *)key from:(float)from to:(float)to { + + if ((self = [super initWithDuration:aDuration])) { + + key_ = [key copy]; + to_ = to; + from_ = from; + + } + + return self; +} + +- (void) dealloc +{ + [key_ release]; + [super dealloc]; +} + +- (void)startWithTarget:aTarget +{ + [super startWithTarget:aTarget]; + delta_ = to_ - from_; +} + +- (void) update:(ccTime) dt +{ + [target_ setValue:[NSNumber numberWithFloat:to_ - delta_ * (1 - dt)] forKey:key_]; +} + +- (CCActionInterval *) reverse +{ + return [[self class] actionWithDuration:duration_ key:key_ from:to_ to:from_]; +} + + +@end diff --git a/libs/cocos2d/CCAnimation.h b/libs/cocos2d/CCAnimation.h new file mode 100755 index 0000000..24b3d96 --- /dev/null +++ b/libs/cocos2d/CCAnimation.h @@ -0,0 +1,136 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2008-2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + +#import +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED +#import +#endif // IPHONE + +@class CCSpriteFrame; +@class CCTexture2D; + +/** A CCAnimation object is used to perform animations on the CCSprite objects. + + The CCAnimation object contains CCSpriteFrame objects, and a possible delay between the frames. + You can animate a CCAnimation object by using the CCAnimate action. Example: + + [sprite runAction:[CCAnimate actionWithAnimation:animation]]; + + */ +@interface CCAnimation : NSObject +{ + NSString *name_; + float delay_; + NSMutableArray *frames_; +} + +/** name of the animation */ +@property (nonatomic,readwrite,retain) NSString *name; +/** delay between frames in seconds. */ +@property (nonatomic,readwrite,assign) float delay; +/** array of frames */ +@property (nonatomic,readwrite,retain) NSMutableArray *frames; + +/** Creates an animation + @since v0.99.5 + */ ++(id) animation; + +/** Creates an animation with frames. + @since v0.99.5 + */ ++(id) animationWithFrames:(NSArray*)frames; + +/* Creates an animation with frames and a delay between frames. + @since v0.99.5 + */ ++(id) animationWithFrames:(NSArray*)frames delay:(float)delay; + +/** Creates a CCAnimation with a name + @since v0.99.3 + @deprecated Will be removed in 1.0.1. Use "animation" instead. + */ ++(id) animationWithName:(NSString*)name DEPRECATED_ATTRIBUTE; + +/** Creates a CCAnimation with a name and frames + @since v0.99.3 + @deprecated Will be removed in 1.0.1. Use "animationWithFrames" instead. + */ ++(id) animationWithName:(NSString*)name frames:(NSArray*)frames DEPRECATED_ATTRIBUTE; + +/** Creates a CCAnimation with a name and delay between frames. */ ++(id) animationWithName:(NSString*)name delay:(float)delay DEPRECATED_ATTRIBUTE; + +/** Creates a CCAnimation with a name, delay and an array of CCSpriteFrames. */ ++(id) animationWithName:(NSString*)name delay:(float)delay frames:(NSArray*)frames DEPRECATED_ATTRIBUTE; + + +/** Initializes a CCAnimation with frames. + @since v0.99.5 +*/ +-(id) initWithFrames:(NSArray*)frames; + +/** Initializes a CCAnimation with frames and a delay between frames + @since v0.99.5 + */ +-(id) initWithFrames:(NSArray *)frames delay:(float)delay; + +/** Initializes a CCAnimation with a name + @since v0.99.3 + @deprecated Will be removed in 1.0.1. Use "init" instead. + */ +-(id) initWithName:(NSString*)name DEPRECATED_ATTRIBUTE; + +/** Initializes a CCAnimation with a name and frames + @since v0.99.3 + @deprecated Will be removed in 1.0.1. Use "initWithFrames" instead. + */ +-(id) initWithName:(NSString*)name frames:(NSArray*)frames DEPRECATED_ATTRIBUTE; + +/** Initializes a CCAnimation with a name and delay between frames. + @deprecated Will be removed in 1.0.1. Use "initWithFrames:nil delay:delay" instead. +*/ +-(id) initWithName:(NSString*)name delay:(float)delay DEPRECATED_ATTRIBUTE; + +/** Initializes a CCAnimation with a name, delay and an array of CCSpriteFrames. + @deprecated Will be removed in 1.0.1. Use "initWithFrames:frames delay:delay" instead. +*/ +-(id) initWithName:(NSString*)name delay:(float)delay frames:(NSArray*)frames DEPRECATED_ATTRIBUTE; + +/** Adds a frame to a CCAnimation. */ +-(void) addFrame:(CCSpriteFrame*)frame; + +/** Adds a frame with an image filename. Internally it will create a CCSpriteFrame and it will add it. + Added to facilitate the migration from v0.8 to v0.9. + */ +-(void) addFrameWithFilename:(NSString*)filename; + +/** Adds a frame with a texture and a rect. Internally it will create a CCSpriteFrame and it will add it. + Added to facilitate the migration from v0.8 to v0.9. + */ +-(void) addFrameWithTexture:(CCTexture2D*)texture rect:(CGRect)rect; + +@end diff --git a/libs/cocos2d/CCAnimation.m b/libs/cocos2d/CCAnimation.m new file mode 100755 index 0000000..eb674c6 --- /dev/null +++ b/libs/cocos2d/CCAnimation.m @@ -0,0 +1,153 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2008-2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + +#import "ccMacros.h" +#import "CCAnimation.h" +#import "CCSpriteFrame.h" +#import "CCTexture2D.h" +#import "CCTextureCache.h" + +@implementation CCAnimation +@synthesize name = name_, delay = delay_, frames = frames_; + ++(id) animation +{ + return [[[self alloc] init] autorelease]; +} + ++(id) animationWithFrames:(NSArray*)frames +{ + return [[[self alloc] initWithFrames:frames] autorelease]; +} + ++(id) animationWithFrames:(NSArray*)frames delay:(float)delay +{ + return [[[self alloc] initWithFrames:frames delay:delay] autorelease]; +} + ++(id) animationWithName:(NSString*)name +{ + return [[[self alloc] initWithName:name] autorelease]; +} + ++(id) animationWithName:(NSString*)name frames:(NSArray*)frames +{ + return [[[self alloc] initWithName:name frames:frames] autorelease]; +} + ++(id) animationWithName:(NSString*)aname delay:(float)d frames:(NSArray*)array +{ + return [[[self alloc] initWithName:aname delay:d frames:array] autorelease]; +} + ++(id) animationWithName:(NSString*)aname delay:(float)d +{ + return [[[self alloc] initWithName:aname delay:d] autorelease]; +} + +-(id) init +{ + return [self initWithFrames:nil delay:0]; +} + +-(id) initWithFrames:(NSArray*)frames +{ + return [self initWithFrames:frames delay:0]; +} + +-(id) initWithFrames:(NSArray*)array delay:(float)delay +{ + if( (self=[super init]) ) { + + delay_ = delay; + self.frames = [NSMutableArray arrayWithArray:array]; + } + return self; +} + +-(id) initWithName:(NSString*)name +{ + return [self initWithName:name delay:0 frames:nil]; +} + +-(id) initWithName:(NSString*)name frames:(NSArray*)frames +{ + return [self initWithName:name delay:0 frames:frames]; +} + +-(id) initWithName:(NSString*)t delay:(float)d +{ + return [self initWithName:t delay:d frames:nil]; +} + +-(id) initWithName:(NSString*)name delay:(float)delay frames:(NSArray*)array +{ + if( (self=[super init]) ) { + + delay_ = delay; + self.name = name; + self.frames = [NSMutableArray arrayWithArray:array]; + } + return self; +} + +- (NSString*) description +{ + return [NSString stringWithFormat:@"<%@ = %08X | frames=%d, delay:%f>", [self class], self, + [frames_ count], + delay_ + ]; +} + +-(void) dealloc +{ + CCLOGINFO( @"cocos2d: deallocing %@",self); + [name_ release]; + [frames_ release]; + [super dealloc]; +} + +-(void) addFrame:(CCSpriteFrame*)frame +{ + [frames_ addObject:frame]; +} + +-(void) addFrameWithFilename:(NSString*)filename +{ + CCTexture2D *texture = [[CCTextureCache sharedTextureCache] addImage:filename]; + CGRect rect = CGRectZero; + rect.size = texture.contentSize; + CCSpriteFrame *frame = [CCSpriteFrame frameWithTexture:texture rect:rect]; + [frames_ addObject:frame]; +} + +-(void) addFrameWithTexture:(CCTexture2D*)texture rect:(CGRect)rect +{ + CCSpriteFrame *frame = [CCSpriteFrame frameWithTexture:texture rect:rect]; + [frames_ addObject:frame]; +} + +@end diff --git a/libs/cocos2d/CCAnimationCache.h b/libs/cocos2d/CCAnimationCache.h new file mode 100755 index 0000000..075c836 --- /dev/null +++ b/libs/cocos2d/CCAnimationCache.h @@ -0,0 +1,64 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + +#import + +@class CCAnimation; + +/** Singleton that manages the Animations. + It saves in a cache the animations. You should use this class if you want to save your animations in a cache. + + Before v0.99.5, the recommend way was to save them on the CCSprite. Since v0.99.5, you should use this class instead. + + @since v0.99.5 + */ +@interface CCAnimationCache : NSObject +{ + NSMutableDictionary *animations_; +} + +/** Retruns ths shared instance of the Animation cache */ ++ (CCAnimationCache *) sharedAnimationCache; + +/** Purges the cache. It releases all the CCAnimation objects and the shared instance. + */ ++(void)purgeSharedAnimationCache; + +/** Adds a CCAnimation with a name. + */ +-(void) addAnimation:(CCAnimation*)animation name:(NSString*)name; + +/** Deletes a CCAnimation from the cache. + */ +-(void) removeAnimationByName:(NSString*)name; + +/** Returns a CCAnimation that was previously added. + If the name is not found it will return nil. + You should retain the returned copy if you are going to use it. + */ +-(CCAnimation*) animationByName:(NSString*)name; + +@end diff --git a/libs/cocos2d/CCAnimationCache.m b/libs/cocos2d/CCAnimationCache.m new file mode 100755 index 0000000..f508227 --- /dev/null +++ b/libs/cocos2d/CCAnimationCache.m @@ -0,0 +1,101 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + +#import "ccMacros.h" +#import "CCAnimationCache.h" +#import "CCAnimation.h" +#import "CCSprite.h" + + +@implementation CCAnimationCache + +#pragma mark CCAnimationCache - Alloc, Init & Dealloc + +static CCAnimationCache *sharedAnimationCache_=nil; + ++ (CCAnimationCache *)sharedAnimationCache +{ + if (!sharedAnimationCache_) + sharedAnimationCache_ = [[CCAnimationCache alloc] init]; + + return sharedAnimationCache_; +} + ++(id)alloc +{ + NSAssert(sharedAnimationCache_ == nil, @"Attempted to allocate a second instance of a singleton."); + return [super alloc]; +} + ++(void)purgeSharedAnimationCache +{ + [sharedAnimationCache_ release]; + sharedAnimationCache_ = nil; +} + +-(id) init +{ + if( (self=[super init]) ) { + animations_ = [[NSMutableDictionary alloc] initWithCapacity: 20]; + } + + return self; +} + +- (NSString*) description +{ + return [NSString stringWithFormat:@"<%@ = %08X | num of animations = %i>", [self class], self, [animations_ count]]; +} + +-(void) dealloc +{ + CCLOGINFO(@"cocos2d: deallocing %@", self); + + [animations_ release]; + [super dealloc]; +} + +#pragma mark CCAnimationCache - load/get/del + +-(void) addAnimation:(CCAnimation*)animation name:(NSString*)name +{ + [animations_ setObject:animation forKey:name]; +} + +-(void) removeAnimationByName:(NSString*)name +{ + if( ! name ) + return; + + [animations_ removeObjectForKey:name]; +} + +-(CCAnimation*) animationByName:(NSString*)name +{ + return [animations_ objectForKey:name]; +} + +@end diff --git a/libs/cocos2d/CCAtlasNode.h b/libs/cocos2d/CCAtlasNode.h new file mode 100755 index 0000000..43e57c2 --- /dev/null +++ b/libs/cocos2d/CCAtlasNode.h @@ -0,0 +1,93 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2008-2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ + + +#import "CCTextureAtlas.h" +#import "CCNode.h" +#import "CCProtocols.h" + +/** CCAtlasNode is a subclass of CCNode that implements the CCRGBAProtocol and + CCTextureProtocol protocol + + It knows how to render a TextureAtlas object. + If you are going to render a TextureAtlas consider subclassing CCAtlasNode (or a subclass of CCAtlasNode) + + All features from CCNode are valid, plus the following features: + - opacity and RGB colors + */ +@interface CCAtlasNode : CCNode +{ + // texture atlas + CCTextureAtlas *textureAtlas_; + + // chars per row + NSUInteger itemsPerRow_; + // chars per column + NSUInteger itemsPerColumn_; + + // width of each char + NSUInteger itemWidth_; + // height of each char + NSUInteger itemHeight_; + + // quads to draw + NSUInteger quadsToDraw_; + + // blend function + ccBlendFunc blendFunc_; + + // texture RGBA. + GLubyte opacity_; + ccColor3B color_; + ccColor3B colorUnmodified_; + BOOL opacityModifyRGB_; +} + +/** conforms to CCTextureProtocol protocol */ +@property (nonatomic,readwrite,retain) CCTextureAtlas *textureAtlas; + +/** conforms to CCTextureProtocol protocol */ +@property (nonatomic,readwrite) ccBlendFunc blendFunc; + +/** conforms to CCRGBAProtocol protocol */ +@property (nonatomic,readwrite) GLubyte opacity; +/** conforms to CCRGBAProtocol protocol */ +@property (nonatomic,readwrite) ccColor3B color; + +/** how many quads to draw */ +@property (readwrite) NSUInteger quadsToDraw; + +/** creates a CCAtlasNode with an Atlas file the width and height of each item measured in points and the quantity of items to render*/ ++(id) atlasWithTileFile:(NSString*)tile tileWidth:(NSUInteger)w tileHeight:(NSUInteger)h itemsToRender: (NSUInteger) c; + +/** initializes an CCAtlasNode with an Atlas file the width and height of each item measured in points and the quantity of items to render*/ +-(id) initWithTileFile:(NSString*)tile tileWidth:(NSUInteger)w tileHeight:(NSUInteger)h itemsToRender: (NSUInteger) c; + +/** updates the Atlas (indexed vertex array). + * Shall be overriden in subclasses + */ +-(void) updateAtlasValues; +@end diff --git a/libs/cocos2d/CCAtlasNode.m b/libs/cocos2d/CCAtlasNode.m new file mode 100755 index 0000000..3f44633 --- /dev/null +++ b/libs/cocos2d/CCAtlasNode.m @@ -0,0 +1,211 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2008-2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ + + +#import "CCAtlasNode.h" +#import "ccMacros.h" + + +@interface CCAtlasNode () +-(void) calculateMaxItems; +-(void) updateBlendFunc; +-(void) updateOpacityModifyRGB; +@end + +@implementation CCAtlasNode + +@synthesize textureAtlas = textureAtlas_; +@synthesize blendFunc = blendFunc_; +@synthesize quadsToDraw = quadsToDraw_; + +#pragma mark CCAtlasNode - Creation & Init ++(id) atlasWithTileFile:(NSString*)tile tileWidth:(NSUInteger)w tileHeight:(NSUInteger)h itemsToRender: (NSUInteger) c +{ + return [[[self alloc] initWithTileFile:tile tileWidth:w tileHeight:h itemsToRender:c] autorelease]; +} + +-(id) initWithTileFile:(NSString*)tile tileWidth:(NSUInteger)w tileHeight:(NSUInteger)h itemsToRender: (NSUInteger) c +{ + if( (self=[super init]) ) { + + itemWidth_ = w * CC_CONTENT_SCALE_FACTOR(); + itemHeight_ = h * CC_CONTENT_SCALE_FACTOR(); + + opacity_ = 255; + color_ = colorUnmodified_ = ccWHITE; + opacityModifyRGB_ = YES; + + blendFunc_.src = CC_BLEND_SRC; + blendFunc_.dst = CC_BLEND_DST; + + // double retain to avoid the autorelease pool + // also, using: self.textureAtlas supports re-initialization without leaking + self.textureAtlas = [[CCTextureAtlas alloc] initWithFile:tile capacity:c]; + [textureAtlas_ release]; + + if( ! textureAtlas_ ) { + CCLOG(@"cocos2d: Could not initialize CCAtlasNode. Invalid Texture"); + [self release]; + return nil; + } + + [self updateBlendFunc]; + [self updateOpacityModifyRGB]; + + [self calculateMaxItems]; + + self.quadsToDraw = c; + + } + return self; +} + +-(void) dealloc +{ + [textureAtlas_ release]; + + [super dealloc]; +} + +#pragma mark CCAtlasNode - Atlas generation + +-(void) calculateMaxItems +{ + CGSize s = [[textureAtlas_ texture] contentSizeInPixels]; + itemsPerColumn_ = s.height / itemHeight_; + itemsPerRow_ = s.width / itemWidth_; +} + +-(void) updateAtlasValues +{ + [NSException raise:@"CCAtlasNode:Abstract" format:@"updateAtlasValue not overriden"]; +} + +#pragma mark CCAtlasNode - draw +- (void) draw +{ + [super draw]; + + // Default GL states: GL_TEXTURE_2D, GL_VERTEX_ARRAY, GL_COLOR_ARRAY, GL_TEXTURE_COORD_ARRAY + // Needed states: GL_TEXTURE_2D, GL_VERTEX_ARRAY, GL_TEXTURE_COORD_ARRAY + // Unneeded states: GL_COLOR_ARRAY + glDisableClientState(GL_COLOR_ARRAY); + + glColor4ub( color_.r, color_.g, color_.b, opacity_); + + BOOL newBlend = blendFunc_.src != CC_BLEND_SRC || blendFunc_.dst != CC_BLEND_DST; + if( newBlend ) + glBlendFunc( blendFunc_.src, blendFunc_.dst ); + + [textureAtlas_ drawNumberOfQuads:quadsToDraw_ fromIndex:0]; + + if( newBlend ) + glBlendFunc(CC_BLEND_SRC, CC_BLEND_DST); + + // is this chepear than saving/restoring color state ? + // XXX: There is no need to restore the color to (255,255,255,255). Objects should use the color + // XXX: that they need +// glColor4ub( 255, 255, 255, 255); + + // restore default GL state + glEnableClientState(GL_COLOR_ARRAY); + +} + +#pragma mark CCAtlasNode - RGBA protocol + +- (ccColor3B) color +{ + if(opacityModifyRGB_) + return colorUnmodified_; + + return color_; +} + +-(void) setColor:(ccColor3B)color3 +{ + color_ = colorUnmodified_ = color3; + + if( opacityModifyRGB_ ){ + color_.r = color3.r * opacity_/255; + color_.g = color3.g * opacity_/255; + color_.b = color3.b * opacity_/255; + } +} + +-(GLubyte) opacity +{ + return opacity_; +} + +-(void) setOpacity:(GLubyte) anOpacity +{ + opacity_ = anOpacity; + + // special opacity for premultiplied textures + if( opacityModifyRGB_ ) + [self setColor: colorUnmodified_]; +} + +-(void) setOpacityModifyRGB:(BOOL)modify +{ + ccColor3B oldColor = self.color; + opacityModifyRGB_ = modify; + self.color = oldColor; +} + +-(BOOL) doesOpacityModifyRGB +{ + return opacityModifyRGB_; +} + +-(void) updateOpacityModifyRGB +{ + opacityModifyRGB_ = [textureAtlas_.texture hasPremultipliedAlpha]; +} + +#pragma mark CCAtlasNode - CocosNodeTexture protocol + +-(void) updateBlendFunc +{ + if( ! [textureAtlas_.texture hasPremultipliedAlpha] ) { + blendFunc_.src = GL_SRC_ALPHA; + blendFunc_.dst = GL_ONE_MINUS_SRC_ALPHA; + } +} + +-(void) setTexture:(CCTexture2D*)texture +{ + textureAtlas_.texture = texture; + [self updateBlendFunc]; + [self updateOpacityModifyRGB]; +} + +-(CCTexture2D*) texture +{ + return textureAtlas_.texture; +} + +@end diff --git a/libs/cocos2d/CCBlockSupport.h b/libs/cocos2d/CCBlockSupport.h new file mode 100755 index 0000000..339d5aa --- /dev/null +++ b/libs/cocos2d/CCBlockSupport.h @@ -0,0 +1,51 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2010 Stuart Carnie + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + + +#import + +/** @file + cocos2d blocks support + */ + +// To comply with Apple Objective C runtime (this is defined in NSObjCRuntime.h) +#if !defined(NS_BLOCKS_AVAILABLE) + #if __BLOCKS__ + #define NS_BLOCKS_AVAILABLE 1 + #else + #define NS_BLOCKS_AVAILABLE 0 + #endif +#endif + +#if NS_BLOCKS_AVAILABLE + +@interface NSObject(CCBlocksAdditions) + +- (void)ccCallbackBlock; +- (void)ccCallbackBlockWithSender:(id)sender; + +@end + +#endif // NS_BLOCKS_AVAILABLE diff --git a/libs/cocos2d/CCBlockSupport.m b/libs/cocos2d/CCBlockSupport.m new file mode 100755 index 0000000..9ac99b3 --- /dev/null +++ b/libs/cocos2d/CCBlockSupport.m @@ -0,0 +1,46 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2010 Stuart Carnie + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + + +#import "CCBlockSupport.h" + +#if NS_BLOCKS_AVAILABLE + +@implementation NSObject(CCBlocksAdditions) + +- (void)ccCallbackBlock { + void (^block)(void) = (id)self; + block(); +} + +- (void)ccCallbackBlockWithSender:(id)sender { + void (^block)(id) = (id)self; + block(sender); +} + + +@end + +#endif diff --git a/libs/cocos2d/CCCamera.h b/libs/cocos2d/CCCamera.h new file mode 100755 index 0000000..19a7712 --- /dev/null +++ b/libs/cocos2d/CCCamera.h @@ -0,0 +1,95 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2008-2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ + + + +#import "CCNode.h" + +/** + A CCCamera is used in every CCNode. + Useful to look at the object from different views. + The OpenGL gluLookAt() function is used to locate the + camera. + + If the object is transformed by any of the scale, rotation or + position attributes, then they will override the camera. + + IMPORTANT: Either your use the camera or the rotation/scale/position properties. You can't use both. + World coordinates won't work if you use the camera. + + Limitations: + + - Some nodes, like CCParallaxNode, CCParticle uses world node coordinates, and they won't work properly if you move them (or any of their ancestors) + using the camera. + + - It doesn't work on batched nodes like CCSprite objects when they are parented to a CCSpriteBatchNode object. + + - It is recommended to use it ONLY if you are going to create 3D effects. For 2D effecs, use the action CCFollow or position/scale/rotate. + +*/ + +@interface CCCamera : NSObject +{ + float eyeX_; + float eyeY_; + float eyeZ_; + + float centerX_; + float centerY_; + float centerZ_; + + float upX_; + float upY_; + float upZ_; + + BOOL dirty_; +} + +/** whether of not the camera is dirty */ +@property (nonatomic,readwrite) BOOL dirty; + +/** returns the Z eye */ ++(float) getZEye; + +/** sets the camera in the defaul position */ +-(void) restore; +/** Sets the camera using gluLookAt using its eye, center and up_vector */ +-(void) locate; +/** sets the eye values in points */ +-(void) setEyeX: (float)x eyeY:(float)y eyeZ:(float)z; +/** sets the center values in points */ +-(void) setCenterX: (float)x centerY:(float)y centerZ:(float)z; +/** sets the up values */ +-(void) setUpX: (float)x upY:(float)y upZ:(float)z; + +/** get the eye vector values in points */ +-(void) eyeX:(float*)x eyeY:(float*)y eyeZ:(float*)z; +/** get the center vector values in points */ +-(void) centerX:(float*)x centerY:(float*)y centerZ:(float*)z; +/** get the up vector values */ +-(void) upX:(float*)x upY:(float*)y upZ:(float*)z; + + +@end diff --git a/libs/cocos2d/CCCamera.m b/libs/cocos2d/CCCamera.m new file mode 100755 index 0000000..1ef6655 --- /dev/null +++ b/libs/cocos2d/CCCamera.m @@ -0,0 +1,131 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2008-2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ + + +#import "Platforms/CCGL.h" +#import "CCCamera.h" +#import "ccMacros.h" +#import "CCDrawingPrimitives.h" + +@implementation CCCamera + +@synthesize dirty = dirty_; + +-(id) init +{ + if( (self=[super init]) ) + [self restore]; + + return self; +} + +- (NSString*) description +{ + return [NSString stringWithFormat:@"<%@ = %08X | center = (%.2f,%.2f,%.2f)>", [self class], self, centerX_, centerY_, centerZ_]; +} + + +- (void) dealloc +{ + CCLOGINFO(@"cocos2d: deallocing %@", self); + [super dealloc]; +} + +-(void) restore +{ + eyeX_ = eyeY_ = 0; + eyeZ_ = [CCCamera getZEye]; + + centerX_ = centerY_ = centerZ_ = 0; + + upX_ = 0.0f; + upY_ = 1.0f; + upZ_ = 0.0f; + + dirty_ = NO; +} + +-(void) locate +{ + if( dirty_ ) + gluLookAt( eyeX_, eyeY_, eyeZ_, + centerX_, centerY_, centerZ_, + upX_, upY_, upZ_ + ); +} + ++(float) getZEye +{ + return FLT_EPSILON; +// CGSize s = [[CCDirector sharedDirector] displaySize]; +// return ( s.height / 1.1566f ); +} + +-(void) setEyeX: (float)x eyeY:(float)y eyeZ:(float)z +{ + eyeX_ = x * CC_CONTENT_SCALE_FACTOR(); + eyeY_ = y * CC_CONTENT_SCALE_FACTOR(); + eyeZ_ = z * CC_CONTENT_SCALE_FACTOR(); + dirty_ = YES; +} + +-(void) setCenterX: (float)x centerY:(float)y centerZ:(float)z +{ + centerX_ = x * CC_CONTENT_SCALE_FACTOR(); + centerY_ = y * CC_CONTENT_SCALE_FACTOR(); + centerZ_ = z * CC_CONTENT_SCALE_FACTOR(); + dirty_ = YES; +} + +-(void) setUpX: (float)x upY:(float)y upZ:(float)z +{ + upX_ = x; + upY_ = y; + upZ_ = z; + dirty_ = YES; +} + +-(void) eyeX: (float*)x eyeY:(float*)y eyeZ:(float*)z +{ + *x = eyeX_ / CC_CONTENT_SCALE_FACTOR(); + *y = eyeY_ / CC_CONTENT_SCALE_FACTOR(); + *z = eyeZ_ / CC_CONTENT_SCALE_FACTOR(); +} + +-(void) centerX: (float*)x centerY:(float*)y centerZ:(float*)z +{ + *x = centerX_ / CC_CONTENT_SCALE_FACTOR(); + *y = centerY_ / CC_CONTENT_SCALE_FACTOR(); + *z = centerZ_ / CC_CONTENT_SCALE_FACTOR(); +} + +-(void) upX: (float*)x upY:(float*)y upZ:(float*)z +{ + *x = upX_; + *y = upY_; + *z = upZ_; +} + +@end diff --git a/libs/cocos2d/CCConfiguration.h b/libs/cocos2d/CCConfiguration.h new file mode 100755 index 0000000..04e1b55 --- /dev/null +++ b/libs/cocos2d/CCConfiguration.h @@ -0,0 +1,116 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ + +#import + +#import "Platforms/CCGL.h" + +/** OS version definitions. Includes both iOS and Mac OS versions + */ +enum { + kCCiOSVersion_3_0 = 0x03000000, + kCCiOSVersion_3_1 = 0x03010000, + kCCiOSVersion_3_1_1 = 0x03010100, + kCCiOSVersion_3_1_2 = 0x03010200, + kCCiOSVersion_3_1_3 = 0x03010300, + kCCiOSVersion_3_2 = 0x03020000, + kCCiOSVersion_3_2_1 = 0x03020100, + kCCiOSVersion_4_0 = 0x04000000, + kCCiOSVersion_4_0_1 = 0x04000100, + kCCiOSVersion_4_1 = 0x04010000, + kCCiOSVersion_4_2 = 0x04020000, + kCCiOSVersion_4_3 = 0x04030000, + kCCiOSVersion_4_3_1 = 0x04030100, + kCCiOSVersion_4_3_2 = 0x04030200, + kCCiOSVersion_4_3_3 = 0x04030300, + + kCCMacVersion_10_5 = 0x0a050000, + kCCMacVersion_10_6 = 0x0a060000, + kCCMacVersion_10_7 = 0x0a070000, +}; + +/** + CCConfiguration contains some openGL variables + @since v0.99.0 + */ +@interface CCConfiguration : NSObject { + + GLint maxTextureSize_; + GLint maxModelviewStackDepth_; + BOOL supportsPVRTC_; + BOOL supportsNPOT_; + BOOL supportsBGRA8888_; + BOOL supportsDiscardFramebuffer_; + unsigned int OSVersion_; + GLint maxSamplesAllowed_; +} + +/** OpenGL Max texture size. */ +@property (nonatomic, readonly) GLint maxTextureSize; + +/** OpenGL Max Modelview Stack Depth. */ +@property (nonatomic, readonly) GLint maxModelviewStackDepth; + +/** Whether or not the GPU supports NPOT (Non Power Of Two) textures. + NPOT textures have the following limitations: + - They can't have mipmaps + - They only accept GL_CLAMP_TO_EDGE in GL_TEXTURE_WRAP_{S,T} + + @since v0.99.2 + */ +@property (nonatomic, readonly) BOOL supportsNPOT; + +/** Whether or not PVR Texture Compressed is supported */ +@property (nonatomic, readonly) BOOL supportsPVRTC; + +/** Whether or not BGRA8888 textures are supported. + + @since v0.99.2 + */ +@property (nonatomic, readonly) BOOL supportsBGRA8888; + +/** Whether or not glDiscardFramebufferEXT is supported + + @since v0.99.2 + */ +@property (nonatomic, readonly) BOOL supportsDiscardFramebuffer; + +/** returns the OS version. + - On iOS devices it returns the firmware version. + - On Mac returns the OS version + + @since v0.99.5 + */ +@property (nonatomic, readonly) unsigned int OSVersion; + +/** returns a shared instance of the CCConfiguration */ ++(CCConfiguration *) sharedConfiguration; + +/** returns whether or not an OpenGL is supported */ +- (BOOL) checkForGLExtension:(NSString *)searchName; + + + +@end diff --git a/libs/cocos2d/CCConfiguration.m b/libs/cocos2d/CCConfiguration.m new file mode 100755 index 0000000..d51cd58 --- /dev/null +++ b/libs/cocos2d/CCConfiguration.m @@ -0,0 +1,193 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ + +#import + +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED +#import // Needed for UIDevice +#endif + +#import "Platforms/CCGL.h" +#import "CCBlockSupport.h" +#import "CCConfiguration.h" +#import "ccMacros.h" +#import "ccConfig.h" +#import "Support/OpenGL_Internal.h" + +@implementation CCConfiguration + +@synthesize maxTextureSize = maxTextureSize_; +@synthesize supportsPVRTC = supportsPVRTC_; +@synthesize maxModelviewStackDepth = maxModelviewStackDepth_; +@synthesize supportsNPOT = supportsNPOT_; +@synthesize supportsBGRA8888 = supportsBGRA8888_; +@synthesize supportsDiscardFramebuffer = supportsDiscardFramebuffer_; +@synthesize OSVersion = OSVersion_; + +// +// singleton stuff +// +static CCConfiguration *_sharedConfiguration = nil; + +static char * glExtensions; + ++ (CCConfiguration *)sharedConfiguration +{ + if (!_sharedConfiguration) + _sharedConfiguration = [[self alloc] init]; + + return _sharedConfiguration; +} + ++(id)alloc +{ + NSAssert(_sharedConfiguration == nil, @"Attempted to allocate a second instance of a singleton."); + return [super alloc]; +} + + +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED +#elif defined(__MAC_OS_X_VERSION_MAX_ALLOWED) +- (NSString*)getMacVersion +{ + SInt32 versionMajor, versionMinor, versionBugFix; + Gestalt(gestaltSystemVersionMajor, &versionMajor); + Gestalt(gestaltSystemVersionMinor, &versionMinor); + Gestalt(gestaltSystemVersionBugFix, &versionBugFix); + + return [NSString stringWithFormat:@"%d.%d.%d", versionMajor, versionMinor, versionBugFix]; +} +#endif // __MAC_OS_X_VERSION_MAX_ALLOWED + +-(id) init +{ + if( (self=[super init])) { + + // Obtain iOS version + OSVersion_ = 0; +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED + NSString *OSVer = [[UIDevice currentDevice] systemVersion]; +#elif defined(__MAC_OS_X_VERSION_MAX_ALLOWED) + NSString *OSVer = [self getMacVersion]; +#endif + NSArray *arr = [OSVer componentsSeparatedByString:@"."]; + int idx=0x01000000; + for( NSString *str in arr ) { + int value = [str intValue]; + OSVersion_ += value * idx; + idx = idx >> 8; + } + CCLOG(@"cocos2d: OS version: %@ (0x%08x)", OSVer, OSVersion_); + + CCLOG(@"cocos2d: GL_VENDOR: %s", glGetString(GL_VENDOR) ); + CCLOG(@"cocos2d: GL_RENDERER: %s", glGetString ( GL_RENDERER ) ); + CCLOG(@"cocos2d: GL_VERSION: %s", glGetString ( GL_VERSION ) ); + + glExtensions = (char*) glGetString(GL_EXTENSIONS); + + glGetIntegerv(GL_MAX_TEXTURE_SIZE, &maxTextureSize_); + glGetIntegerv(GL_MAX_MODELVIEW_STACK_DEPTH, &maxModelviewStackDepth_); +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED + if( OSVersion_ >= kCCiOSVersion_4_0 ) + glGetIntegerv(GL_MAX_SAMPLES_APPLE, &maxSamplesAllowed_); + else + maxSamplesAllowed_ = 0; +#elif defined(__MAC_OS_X_VERSION_MAX_ALLOWED) + glGetIntegerv(GL_MAX_SAMPLES, &maxSamplesAllowed_); +#endif + + supportsPVRTC_ = [self checkForGLExtension:@"GL_IMG_texture_compression_pvrtc"]; +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED + supportsNPOT_ = [self checkForGLExtension:@"GL_APPLE_texture_2D_limited_npot"]; +#elif defined(__MAC_OS_X_VERSION_MAX_ALLOWED) + supportsNPOT_ = [self checkForGLExtension:@"GL_ARB_texture_non_power_of_two"]; +#endif + // It seems that somewhere between firmware iOS 3.0 and 4.2 Apple renamed + // GL_IMG_... to GL_APPLE.... So we should check both names + +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED + BOOL bgra8a = [self checkForGLExtension:@"GL_IMG_texture_format_BGRA8888"]; + BOOL bgra8b = [self checkForGLExtension:@"GL_APPLE_texture_format_BGRA8888"]; + supportsBGRA8888_ = bgra8a | bgra8b; +#elif defined(__MAC_OS_X_VERSION_MAX_ALLOWED) + supportsBGRA8888_ = [self checkForGLExtension:@"GL_EXT_bgra"]; +#endif + + supportsDiscardFramebuffer_ = [self checkForGLExtension:@"GL_EXT_discard_framebuffer"]; + + CCLOG(@"cocos2d: GL_MAX_TEXTURE_SIZE: %d", maxTextureSize_); + CCLOG(@"cocos2d: GL_MAX_MODELVIEW_STACK_DEPTH: %d",maxModelviewStackDepth_); + CCLOG(@"cocos2d: GL_MAX_SAMPLES: %d", maxSamplesAllowed_); + CCLOG(@"cocos2d: GL supports PVRTC: %s", (supportsPVRTC_ ? "YES" : "NO") ); + CCLOG(@"cocos2d: GL supports BGRA8888 textures: %s", (supportsBGRA8888_ ? "YES" : "NO") ); + CCLOG(@"cocos2d: GL supports NPOT textures: %s", (supportsNPOT_ ? "YES" : "NO") ); + CCLOG(@"cocos2d: GL supports discard_framebuffer: %s", (supportsDiscardFramebuffer_ ? "YES" : "NO") ); + CCLOG(@"cocos2d: compiled with NPOT support: %s", +#if CC_TEXTURE_NPOT_SUPPORT + "YES" +#else + "NO" +#endif + ); + CCLOG(@"cocos2d: compiled with VBO support in TextureAtlas : %s", +#if CC_USES_VBO + "YES" +#else + "NO" +#endif + ); + + CCLOG(@"cocos2d: compiled with Affine Matrix transformation in CCNode : %s", +#if CC_NODE_TRANSFORM_USING_AFFINE_MATRIX + "YES" +#else + "NO" +#endif + ); + + CCLOG(@"cocos2d: compiled with Profiling Support: %s", +#if CC_ENABLE_PROFILERS + + "YES - *** Disable it when you finish profiling ***" +#else + "NO" +#endif + ); + + CHECK_GL_ERROR(); + } + + return self; +} + +- (BOOL) checkForGLExtension:(NSString *)searchName +{ + // For best results, extensionsNames should be stored in your renderer so that it does not + // need to be recreated on each invocation. + NSString *extensionsString = [NSString stringWithCString:glExtensions encoding: NSASCIIStringEncoding]; + NSArray *extensionsNames = [extensionsString componentsSeparatedByString:@" "]; + return [extensionsNames containsObject: searchName]; +} +@end diff --git a/libs/cocos2d/CCDirector.h b/libs/cocos2d/CCDirector.h new file mode 100755 index 0000000..9c3f3fe --- /dev/null +++ b/libs/cocos2d/CCDirector.h @@ -0,0 +1,307 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2008-2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ + + +#import "ccConfig.h" +#import "ccTypes.h" + +// OpenGL related +#import "Platforms/CCGL.h" +#import "CCProtocols.h" + +/** @typedef ccDirectorProjection + Possible OpenGL projections used by director + */ +typedef enum { + /// sets a 2D projection (orthogonal projection). + kCCDirectorProjection2D, + + /// sets a 3D projection with a fovy=60, znear=0.5f and zfar=1500. + kCCDirectorProjection3D, + + /// it calls "updateProjection" on the projection delegate. + kCCDirectorProjectionCustom, + + /// Detault projection is 3D projection + kCCDirectorProjectionDefault = kCCDirectorProjection3D, + + // backward compatibility stuff + CCDirectorProjection2D = kCCDirectorProjection2D, + CCDirectorProjection3D = kCCDirectorProjection3D, + CCDirectorProjectionCustom = kCCDirectorProjectionCustom, + +} ccDirectorProjection; + + +@class CCLabelAtlas; +@class CCScene; + +/**Class that creates and handle the main Window and manages how +and when to execute the Scenes. + + The CCDirector is also resposible for: + - initializing the OpenGL ES context + - setting the OpenGL pixel format (default on is RGB565) + - setting the OpenGL buffer depth (default one is 0-bit) + - setting the projection (default one is 3D) + - setting the orientation (default one is Protrait) + + Since the CCDirector is a singleton, the standard way to use it is by calling: + - [[CCDirector sharedDirector] methodName]; + + The CCDirector also sets the default OpenGL context: + - GL_TEXTURE_2D is enabled + - GL_VERTEX_ARRAY is enabled + - GL_COLOR_ARRAY is enabled + - GL_TEXTURE_COORD_ARRAY is enabled +*/ +@interface CCDirector : NSObject +{ + CC_GLVIEW *openGLView_; + + // internal timer + NSTimeInterval animationInterval_; + NSTimeInterval oldAnimationInterval_; + + /* display FPS ? */ + BOOL displayFPS_; + + NSUInteger frames_; + ccTime accumDt_; + ccTime frameRate_; +#if CC_DIRECTOR_FAST_FPS + CCLabelAtlas *FPSLabel_; +#endif + + /* is the running scene paused */ + BOOL isPaused_; + + /* The running scene */ + CCScene *runningScene_; + + /* This object will be visited after the scene. Useful to hook a notification node */ + id notificationNode_; + + /* will be the next 'runningScene' in the next frame + nextScene is a weak reference. */ + CCScene *nextScene_; + + /* If YES, then "old" scene will receive the cleanup message */ + BOOL sendCleanupToScene_; + + /* scheduled scenes */ + NSMutableArray *scenesStack_; + + /* last time the main loop was updated */ + struct timeval lastUpdate_; + /* delta time since last tick to main loop */ + ccTime dt; + /* whether or not the next delta time will be zero */ + BOOL nextDeltaTimeZero_; + + /* projection used */ + ccDirectorProjection projection_; + + /* Projection protocol delegate */ + id projectionDelegate_; + + /* window size in points */ + CGSize winSizeInPoints_; + + /* window size in pixels */ + CGSize winSizeInPixels_; + + /* the cocos2d running thread */ + NSThread *runningThread_; + + // profiler +#if CC_ENABLE_PROFILERS + ccTime accumDtForProfiler_; +#endif +} + +/** returns the cocos2d thread. + If you want to run any cocos2d task, run it in this thread. + On iOS usually it is the main thread. + @since v0.99.5 + */ +@property (readonly, nonatomic ) NSThread *runningThread; +/** The current running Scene. Director can only run one Scene at the time */ +@property (nonatomic,readonly) CCScene* runningScene; +/** The FPS value */ +@property (nonatomic,readwrite, assign) NSTimeInterval animationInterval; +/** Whether or not to display the FPS on the bottom-left corner */ +@property (nonatomic,readwrite, assign) BOOL displayFPS; +/** The OpenGLView, where everything is rendered */ +@property (nonatomic,readwrite,retain) CC_GLVIEW *openGLView; +/** whether or not the next delta time will be zero */ +@property (nonatomic,readwrite,assign) BOOL nextDeltaTimeZero; +/** Whether or not the Director is paused */ +@property (nonatomic,readonly) BOOL isPaused; +/** Sets an OpenGL projection + @since v0.8.2 + */ +@property (nonatomic,readwrite) ccDirectorProjection projection; +/** How many frames were called since the director started */ +@property (readonly) NSUInteger frames; + +/** Whether or not the replaced scene will receive the cleanup message. + If the new scene is pushed, then the old scene won't receive the "cleanup" message. + If the new scene replaces the old one, the it will receive the "cleanup" message. + @since v0.99.0 + */ +@property (nonatomic, readonly) BOOL sendCleanupToScene; + +/** This object will be visited after the main scene is visited. + This object MUST implement the "visit" selector. + Useful to hook a notification object, like CCNotifications (http://github.com/manucorporat/CCNotifications) + @since v0.99.5 + */ +@property (nonatomic, readwrite, retain) id notificationNode; + +/** This object will be called when the OpenGL projection is udpated and only when the kCCDirectorProjectionCustom projection is used. + @since v0.99.5 + */ +@property (nonatomic, readwrite, retain) id projectionDelegate; + +/** returns a shared instance of the director */ ++(CCDirector *)sharedDirector; + + + +// Window size + +/** returns the size of the OpenGL view in points. + It takes into account any possible rotation (device orientation) of the window + */ +- (CGSize) winSize; + +/** returns the size of the OpenGL view in pixels. + It takes into account any possible rotation (device orientation) of the window. + On Mac winSize and winSizeInPixels return the same value. + */ +- (CGSize) winSizeInPixels; +/** returns the display size of the OpenGL view in pixels. + It doesn't take into account any possible rotation of the window. + */ +-(CGSize) displaySizeInPixels; +/** changes the projection size */ +-(void) reshapeProjection:(CGSize)newWindowSize; + +/** converts a UIKit coordinate to an OpenGL coordinate + Useful to convert (multi) touchs coordinates to the current layout (portrait or landscape) + */ +-(CGPoint) convertToGL: (CGPoint) p; +/** converts an OpenGL coordinate to a UIKit coordinate + Useful to convert node points to window points for calls such as glScissor + */ +-(CGPoint) convertToUI:(CGPoint)p; + +/// XXX: missing description +-(float) getZEye; + +// Scene Management + +/**Enters the Director's main loop with the given Scene. + * Call it to run only your FIRST scene. + * Don't call it if there is already a running scene. + */ +- (void) runWithScene:(CCScene*) scene; + +/**Suspends the execution of the running scene, pushing it on the stack of suspended scenes. + * The new scene will be executed. + * Try to avoid big stacks of pushed scenes to reduce memory allocation. + * ONLY call it if there is a running scene. + */ +- (void) pushScene:(CCScene*) scene; + +/**Pops out a scene from the queue. + * This scene will replace the running one. + * The running scene will be deleted. If there are no more scenes in the stack the execution is terminated. + * ONLY call it if there is a running scene. + */ +- (void) popScene; + +/** Replaces the running scene with a new one. The running scene is terminated. + * ONLY call it if there is a running scene. + */ +-(void) replaceScene: (CCScene*) scene; + +/** Ends the execution, releases the running scene. + It doesn't remove the OpenGL view from its parent. You have to do it manually. + */ +-(void) end; + +/** Pauses the running scene. + The running scene will be _drawed_ but all scheduled timers will be paused + While paused, the draw rate will be 4 FPS to reduce CPU consuption + */ +-(void) pause; + +/** Resumes the paused scene + The scheduled timers will be activated again. + The "delta time" will be 0 (as if the game wasn't paused) + */ +-(void) resume; + +/** Stops the animation. Nothing will be drawn. The main loop won't be triggered anymore. + If you wan't to pause your animation call [pause] instead. + */ +-(void) stopAnimation; + +/** The main loop is triggered again. + Call this function only if [stopAnimation] was called earlier + @warning Dont' call this function to start the main loop. To run the main loop call runWithScene + */ +-(void) startAnimation; + +/** Draw the scene. + This method is called every frame. Don't call it manually. + */ +-(void) drawScene; + +// Memory Helper + +/** Removes all the cocos2d data that was cached automatically. + It will purge the CCTextureCache, CCLabelBMFont cache. + IMPORTANT: The CCSpriteFrameCache won't be purged. If you want to purge it, you have to purge it manually. + @since v0.99.3 + */ +-(void) purgeCachedData; + +// OpenGL Helper + +/** sets the OpenGL default values */ +-(void) setGLDefaultValues; + +/** enables/disables OpenGL alpha blending */ +- (void) setAlphaBlending: (BOOL) on; +/** enables/disables OpenGL depth test */ +- (void) setDepthTest: (BOOL) on; + +// Profiler +-(void) showProfilers; + +@end diff --git a/libs/cocos2d/CCDirector.m b/libs/cocos2d/CCDirector.m new file mode 100755 index 0000000..292bc28 --- /dev/null +++ b/libs/cocos2d/CCDirector.m @@ -0,0 +1,565 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2008-2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ + + +/* Idea of decoupling Window from Director taken from OC3D project: http://code.google.com/p/oc3d/ + */ + +#import +#import + +// cocos2d imports +#import "CCDirector.h" +#import "CCScheduler.h" +#import "CCActionManager.h" +#import "CCTextureCache.h" +#import "CCAnimationCache.h" +#import "CCLabelAtlas.h" +#import "ccMacros.h" +#import "CCTransition.h" +#import "CCScene.h" +#import "CCSpriteFrameCache.h" +#import "CCTexture2D.h" +#import "CCLabelBMFont.h" +#import "CCLayer.h" + +// support imports +#import "Platforms/CCGL.h" +#import "Platforms/CCNS.h" + +#import "Support/OpenGL_Internal.h" +#import "Support/CGPointExtension.h" + +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED +#import "Platforms/iOS/CCDirectorIOS.h" +#define CC_DIRECTOR_DEFAULT CCDirectorTimer +#elif defined(__MAC_OS_X_VERSION_MAX_ALLOWED) +#import "Platforms/Mac/CCDirectorMac.h" +#define CC_DIRECTOR_DEFAULT CCDirectorDisplayLink +#endif + +#import "Support/CCProfiling.h" + +#define kDefaultFPS 60.0 // 60 frames per second + +extern NSString * cocos2dVersion(void); + + +@interface CCDirector (Private) +-(void) setNextScene; +// shows the FPS in the screen +-(void) showFPS; +// calculates delta time since last time it was called +-(void) calculateDeltaTime; +@end + +@implementation CCDirector + +@synthesize animationInterval = animationInterval_; +@synthesize runningScene = runningScene_; +@synthesize displayFPS = displayFPS_; +@synthesize nextDeltaTimeZero = nextDeltaTimeZero_; +@synthesize isPaused = isPaused_; +@synthesize sendCleanupToScene = sendCleanupToScene_; +@synthesize runningThread = runningThread_; +@synthesize notificationNode = notificationNode_; +@synthesize projectionDelegate = projectionDelegate_; +@synthesize frames = frames_; +// +// singleton stuff +// +static CCDirector *_sharedDirector = nil; + ++ (CCDirector *)sharedDirector +{ + if (!_sharedDirector) { + + // + // Default Director is TimerDirector + // + if( [ [CCDirector class] isEqual:[self class]] ) + _sharedDirector = [[CC_DIRECTOR_DEFAULT alloc] init]; + else + _sharedDirector = [[self alloc] init]; + } + + return _sharedDirector; +} + ++(id)alloc +{ + NSAssert(_sharedDirector == nil, @"Attempted to allocate a second instance of a singleton."); + return [super alloc]; +} + +- (id) init +{ + CCLOG(@"cocos2d: %@", cocos2dVersion() ); + + if( (self=[super init]) ) { + + CCLOG(@"cocos2d: Using Director Type:%@", [self class]); + + // scenes + runningScene_ = nil; + nextScene_ = nil; + + notificationNode_ = nil; + + oldAnimationInterval_ = animationInterval_ = 1.0 / kDefaultFPS; + scenesStack_ = [[NSMutableArray alloc] initWithCapacity:10]; + + // Set default projection (3D) + projection_ = kCCDirectorProjectionDefault; + + // projection delegate if "Custom" projection is used + projectionDelegate_ = nil; + + // FPS + displayFPS_ = NO; + frames_ = 0; + + // paused ? + isPaused_ = NO; + + // running thread + runningThread_ = nil; + + winSizeInPixels_ = winSizeInPoints_ = CGSizeZero; + } + + return self; +} + +- (void) dealloc +{ + CCLOGINFO(@"cocos2d: deallocing %@", self); + +#if CC_DIRECTOR_FAST_FPS + [FPSLabel_ release]; +#endif + [runningScene_ release]; + [notificationNode_ release]; + [scenesStack_ release]; + + [projectionDelegate_ release]; + + _sharedDirector = nil; + + [super dealloc]; +} + +-(void) setGLDefaultValues +{ + // This method SHOULD be called only after openGLView_ was initialized + NSAssert( openGLView_, @"openGLView_ must be initialized"); + + [self setAlphaBlending: YES]; + [self setDepthTest: YES]; + [self setProjection: projection_]; + + // set other opengl default values + glClearColor(0.0f, 0.0f, 0.0f, 1.0f); + +#if CC_DIRECTOR_FAST_FPS + if (!FPSLabel_) { + CCTexture2DPixelFormat currentFormat = [CCTexture2D defaultAlphaPixelFormat]; + [CCTexture2D setDefaultAlphaPixelFormat:kCCTexture2DPixelFormat_RGBA4444]; + FPSLabel_ = [[CCLabelAtlas labelWithString:@"00.0" charMapFile:@"fps_images.png" itemWidth:16 itemHeight:24 startCharMap:'.'] retain]; + [CCTexture2D setDefaultAlphaPixelFormat:currentFormat]; + } +#endif // CC_DIRECTOR_FAST_FPS +} + +// +// Draw the Scene +// +- (void) drawScene +{ + // Override me +} + +-(void) calculateDeltaTime +{ + struct timeval now; + + if( gettimeofday( &now, NULL) != 0 ) { + CCLOG(@"cocos2d: error in gettimeofday"); + dt = 0; + return; + } + + // new delta time + if( nextDeltaTimeZero_ ) { + dt = 0; + nextDeltaTimeZero_ = NO; + } else { + dt = (now.tv_sec - lastUpdate_.tv_sec) + (now.tv_usec - lastUpdate_.tv_usec) / 1000000.0f; + dt = MAX(0,dt); + } + +#ifdef DEBUG + // If we are debugging our code, prevent big delta time + if( dt > 0.2f ) + dt = 1/60.0f; +#endif + + lastUpdate_ = now; +} + +#pragma mark Director - Memory Helper + +-(void) purgeCachedData +{ + [CCLabelBMFont purgeCachedData]; + [[CCTextureCache sharedTextureCache] removeUnusedTextures]; +} + +#pragma mark Director - Scene OpenGL Helper + +-(ccDirectorProjection) projection +{ + return projection_; +} + +-(float) getZEye +{ + return ( winSizeInPixels_.height / 1.1566f ); +} + +-(void) setProjection:(ccDirectorProjection)projection +{ + CCLOG(@"cocos2d: override me"); +} + +- (void) setAlphaBlending: (BOOL) on +{ + if (on) { + glEnable(GL_BLEND); + glBlendFunc(CC_BLEND_SRC, CC_BLEND_DST); + + } else + glDisable(GL_BLEND); +} + +- (void) setDepthTest: (BOOL) on +{ + if (on) { + ccglClearDepth(1.0f); + glEnable(GL_DEPTH_TEST); + glDepthFunc(GL_LEQUAL); +// glHint(GL_PERSPECTIVE_CORRECTION_HINT, GL_NICEST); + } else + glDisable( GL_DEPTH_TEST ); +} + +#pragma mark Director Integration with a UIKit view + +-(CC_GLVIEW*) openGLView +{ + return openGLView_; +} + +-(void) setOpenGLView:(CC_GLVIEW *)view +{ + NSAssert( view, @"OpenGLView must be non-nil"); + + if( view != openGLView_ ) { + [openGLView_ release]; + openGLView_ = [view retain]; + + // set size + winSizeInPixels_ = winSizeInPoints_ = CCNSSizeToCGSize( [view bounds].size ); + + [self setGLDefaultValues]; + } +} + +#pragma mark Director Scene Landscape + +-(CGPoint)convertToGL:(CGPoint)uiPoint +{ + CCLOG(@"CCDirector#convertToGL: OVERRIDE ME."); + return CGPointZero; +} + +-(CGPoint)convertToUI:(CGPoint)glPoint +{ + CCLOG(@"CCDirector#convertToUI: OVERRIDE ME."); + return CGPointZero; +} + +-(CGSize)winSize +{ + return winSizeInPoints_; +} + +-(CGSize)winSizeInPixels +{ + return winSizeInPixels_; +} + +-(CGSize)displaySizeInPixels +{ + return winSizeInPixels_; +} + +-(void) reshapeProjection:(CGSize)newWindowSize +{ + winSizeInPixels_ = winSizeInPoints_ = newWindowSize; + [self setProjection:projection_]; +} + +#pragma mark Director Scene Management + +- (void)runWithScene:(CCScene*) scene +{ + NSAssert( scene != nil, @"Argument must be non-nil"); + NSAssert( runningScene_ == nil, @"You can't run an scene if another Scene is running. Use replaceScene or pushScene instead"); + + [self pushScene:scene]; + [self startAnimation]; +} + +-(void) replaceScene: (CCScene*) scene +{ + NSAssert( scene != nil, @"Argument must be non-nil"); + + NSUInteger index = [scenesStack_ count]; + + sendCleanupToScene_ = YES; + [scenesStack_ replaceObjectAtIndex:index-1 withObject:scene]; + nextScene_ = scene; // nextScene_ is a weak ref +} + +- (void) pushScene: (CCScene*) scene +{ + NSAssert( scene != nil, @"Argument must be non-nil"); + + sendCleanupToScene_ = NO; + + [scenesStack_ addObject: scene]; + nextScene_ = scene; // nextScene_ is a weak ref +} + +-(void) popScene +{ + NSAssert( runningScene_ != nil, @"A running Scene is needed"); + + [scenesStack_ removeLastObject]; + NSUInteger c = [scenesStack_ count]; + + if( c == 0 ) + [self end]; + else { + sendCleanupToScene_ = YES; + nextScene_ = [scenesStack_ objectAtIndex:c-1]; + } +} + +-(void) end +{ + [runningScene_ onExit]; + [runningScene_ cleanup]; + [runningScene_ release]; + + runningScene_ = nil; + nextScene_ = nil; + + // remove all objects, but don't release it. + // runWithScene might be executed after 'end'. + [scenesStack_ removeAllObjects]; + + [self stopAnimation]; + +#if CC_DIRECTOR_FAST_FPS + [FPSLabel_ release]; + FPSLabel_ = nil; +#endif + + [projectionDelegate_ release]; + projectionDelegate_ = nil; + + // Purge bitmap cache + [CCLabelBMFont purgeCachedData]; + + // Purge all managers + [CCAnimationCache purgeSharedAnimationCache]; + [CCSpriteFrameCache purgeSharedSpriteFrameCache]; + [CCScheduler purgeSharedScheduler]; + [CCActionManager purgeSharedManager]; + [CCTextureCache purgeSharedTextureCache]; + + + // OpenGL view + + // Since the director doesn't attach the openglview to the window + // it shouldn't remove it from the window too. +// [openGLView_ removeFromSuperview]; + + [openGLView_ release]; + openGLView_ = nil; +} + +-(void) setNextScene +{ + Class transClass = [CCTransitionScene class]; + BOOL runningIsTransition = [runningScene_ isKindOfClass:transClass]; + BOOL newIsTransition = [nextScene_ isKindOfClass:transClass]; + + // If it is not a transition, call onExit/cleanup + if( ! newIsTransition ) { + [runningScene_ onExit]; + + // issue #709. the root node (scene) should receive the cleanup message too + // otherwise it might be leaked. + if( sendCleanupToScene_) + [runningScene_ cleanup]; + } + + [runningScene_ release]; + + runningScene_ = [nextScene_ retain]; + nextScene_ = nil; + + if( ! runningIsTransition ) { + [runningScene_ onEnter]; + [runningScene_ onEnterTransitionDidFinish]; + } +} + +-(void) pause +{ + if( isPaused_ ) + return; + + oldAnimationInterval_ = animationInterval_; + + // when paused, don't consume CPU + [self setAnimationInterval:1/4.0]; + isPaused_ = YES; +} + +-(void) resume +{ + if( ! isPaused_ ) + return; + + [self setAnimationInterval: oldAnimationInterval_]; + + if( gettimeofday( &lastUpdate_, NULL) != 0 ) { + CCLOG(@"cocos2d: Director: Error in gettimeofday"); + } + + isPaused_ = NO; + dt = 0; +} + +- (void)startAnimation +{ + CCLOG(@"cocos2d: Director#startAnimation. Override me"); +} + +- (void)stopAnimation +{ + CCLOG(@"cocos2d: Director#stopAnimation. Override me"); +} + +- (void)setAnimationInterval:(NSTimeInterval)interval +{ + CCLOG(@"cocos2d: Director#setAnimationInterval. Override me"); +} + +#if CC_DIRECTOR_FAST_FPS + +// display the FPS using a LabelAtlas +// updates the FPS every frame +-(void) showFPS +{ + frames_++; + accumDt_ += dt; + + if ( accumDt_ > CC_DIRECTOR_FPS_INTERVAL) { + frameRate_ = frames_/accumDt_; + frames_ = 0; + accumDt_ = 0; + +// sprintf(format,"%.1f",frameRate); +// [FPSLabel setCString:format]; + + NSString *str = [[NSString alloc] initWithFormat:@"%.1f", frameRate_]; + [FPSLabel_ setString:str]; + [str release]; + } + + [FPSLabel_ draw]; +} +#else +// display the FPS using a manually generated Texture (very slow) +// updates the FPS 3 times per second aprox. +-(void) showFPS +{ + frames_++; + accumDt_ += dt; + + if ( accumDt_ > CC_DIRECTOR_FPS_INTERVAL) { + frameRate_ = frames_/accumDt_; + frames_ = 0; + accumDt_ = 0; + } + + NSString *str = [NSString stringWithFormat:@"%.2f",frameRate_]; + CCTexture2D *texture = [[CCTexture2D alloc] initWithString:str dimensions:CGSizeMake(100,30) alignment:CCTextAlignmentLeft fontName:@"Arial" fontSize:24]; + + // Default GL states: GL_TEXTURE_2D, GL_VERTEX_ARRAY, GL_COLOR_ARRAY, GL_TEXTURE_COORD_ARRAY + // Needed states: GL_TEXTURE_2D, GL_VERTEX_ARRAY, GL_TEXTURE_COORD_ARRAY + // Unneeded states: GL_COLOR_ARRAY + glDisableClientState(GL_COLOR_ARRAY); + + glBlendFunc(GL_SRC_ALPHA, GL_ONE_MINUS_SRC_ALPHA); + + glColor4ub(224,224,244,200); + [texture drawAtPoint: ccp(5,2)]; + [texture release]; + + glBlendFunc(CC_BLEND_SRC, CC_BLEND_DST); + + // restore default GL state + glEnableClientState(GL_COLOR_ARRAY); +} +#endif + +- (void) showProfilers { +#if CC_ENABLE_PROFILERS + accumDtForProfiler_ += dt; + if (accumDtForProfiler_ > 1.0f) { + accumDtForProfiler_ = 0; + [[CCProfiler sharedProfiler] displayTimers]; + } +#endif // CC_ENABLE_PROFILERS +} + +@end + diff --git a/libs/cocos2d/CCDrawingPrimitives.h b/libs/cocos2d/CCDrawingPrimitives.h new file mode 100755 index 0000000..8d1dbe5 --- /dev/null +++ b/libs/cocos2d/CCDrawingPrimitives.h @@ -0,0 +1,92 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2008-2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ + + +#ifndef __CC_DRAWING_PRIMITIVES_H +#define __CC_DRAWING_PRIMITIVES_H + +#import +#import + +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED +#import // for CGPoint +#endif + + +#ifdef __cplusplus +extern "C" { +#endif + +/** + @file + Drawing OpenGL ES primitives. + - ccDrawPoint + - ccDrawLine + - ccDrawPoly + - ccDrawCircle + - ccDrawQuadBezier + - ccDrawCubicBezier + + You can change the color, width and other property by calling the + glColor4ub(), glLineWidth(), glPointSize(). + + @warning These functions draws the Line, Point, Polygon, immediately. They aren't batched. If you are going to make a game that depends on these primitives, I suggest creating a batch. + */ + + +/** draws a point given x and y coordinate measured in points. */ +void ccDrawPoint( CGPoint point ); + +/** draws an array of points. + @since v0.7.2 + */ +void ccDrawPoints( const CGPoint *points, NSUInteger numberOfPoints ); + +/** draws a line given the origin and destination point measured in points. */ +void ccDrawLine( CGPoint origin, CGPoint destination ); + +/** draws a poligon given a pointer to CGPoint coordiantes and the number of vertices measured in points. + The polygon can be closed or open + */ +void ccDrawPoly( const CGPoint *vertices, NSUInteger numOfVertices, BOOL closePolygon ); + +/** draws a circle given the center, radius and number of segments measured in points */ +void ccDrawCircle( CGPoint center, float radius, float angle, NSUInteger segments, BOOL drawLineToCenter); + +/** draws a quad bezier path measured in points. + @since v0.8 + */ +void ccDrawQuadBezier(CGPoint origin, CGPoint control, CGPoint destination, NSUInteger segments); + +/** draws a cubic bezier path measured in points. + @since v0.8 + */ +void ccDrawCubicBezier(CGPoint origin, CGPoint control1, CGPoint control2, CGPoint destination, NSUInteger segments); + +#ifdef __cplusplus +} +#endif + +#endif // __CC_DRAWING_PRIMITIVES_H diff --git a/libs/cocos2d/CCDrawingPrimitives.m b/libs/cocos2d/CCDrawingPrimitives.m new file mode 100755 index 0000000..f7df2b6 --- /dev/null +++ b/libs/cocos2d/CCDrawingPrimitives.m @@ -0,0 +1,272 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2008-2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ + +#import +#import +#import + +#import "CCDrawingPrimitives.h" +#import "ccTypes.h" +#import "ccMacros.h" +#import "Platforms/CCGL.h" + +void ccDrawPoint( CGPoint point ) +{ + ccVertex2F p = (ccVertex2F) {point.x * CC_CONTENT_SCALE_FACTOR(), point.y * CC_CONTENT_SCALE_FACTOR() }; + + // Default GL states: GL_TEXTURE_2D, GL_VERTEX_ARRAY, GL_COLOR_ARRAY, GL_TEXTURE_COORD_ARRAY + // Needed states: GL_VERTEX_ARRAY, + // Unneeded states: GL_TEXTURE_2D, GL_TEXTURE_COORD_ARRAY, GL_COLOR_ARRAY + glDisable(GL_TEXTURE_2D); + glDisableClientState(GL_TEXTURE_COORD_ARRAY); + glDisableClientState(GL_COLOR_ARRAY); + + glVertexPointer(2, GL_FLOAT, 0, &p); + glDrawArrays(GL_POINTS, 0, 1); + + // restore default state + glEnableClientState(GL_COLOR_ARRAY); + glEnableClientState(GL_TEXTURE_COORD_ARRAY); + glEnable(GL_TEXTURE_2D); +} + +void ccDrawPoints( const CGPoint *points, NSUInteger numberOfPoints ) +{ + // Default GL states: GL_TEXTURE_2D, GL_VERTEX_ARRAY, GL_COLOR_ARRAY, GL_TEXTURE_COORD_ARRAY + // Needed states: GL_VERTEX_ARRAY, + // Unneeded states: GL_TEXTURE_2D, GL_TEXTURE_COORD_ARRAY, GL_COLOR_ARRAY + glDisable(GL_TEXTURE_2D); + glDisableClientState(GL_TEXTURE_COORD_ARRAY); + glDisableClientState(GL_COLOR_ARRAY); + + ccVertex2F newPoints[numberOfPoints]; + + // iPhone and 32-bit machines optimization + if( sizeof(CGPoint) == sizeof(ccVertex2F) ) { + + // points ? + if( CC_CONTENT_SCALE_FACTOR() != 1 ) { + for( NSUInteger i=0; i + +@class CCTexture2D; + +/** FBO class that grabs the the contents of the screen */ +@interface CCGrabber : NSObject +{ + GLuint fbo; + GLint oldFBO; +} + +-(void)grab:(CCTexture2D*)texture; +-(void)beforeRender:(CCTexture2D*)texture; +-(void)afterRender:(CCTexture2D*)texture; + +@end diff --git a/libs/cocos2d/CCGrabber.m b/libs/cocos2d/CCGrabber.m new file mode 100755 index 0000000..a259091 --- /dev/null +++ b/libs/cocos2d/CCGrabber.m @@ -0,0 +1,95 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2009 On-Core + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + + +#import "Platforms/CCGL.h" +#import "CCGrabber.h" +#import "ccMacros.h" +#import "CCTexture2D.h" +#import "Support/OpenGL_Internal.h" + +@implementation CCGrabber + +-(id) init +{ + if(( self = [super init] )) { + // generate FBO + ccglGenFramebuffers(1, &fbo); + } + return self; +} + +-(void)grab:(CCTexture2D*)texture +{ + glGetIntegerv(CC_GL_FRAMEBUFFER_BINDING, &oldFBO); + + // bind + ccglBindFramebuffer(CC_GL_FRAMEBUFFER, fbo); + + // associate texture with FBO + ccglFramebufferTexture2D(CC_GL_FRAMEBUFFER, CC_GL_COLOR_ATTACHMENT0, GL_TEXTURE_2D, texture.name, 0); + + // check if it worked (probably worth doing :) ) + GLuint status = ccglCheckFramebufferStatus(CC_GL_FRAMEBUFFER); + if (status != CC_GL_FRAMEBUFFER_COMPLETE) + [NSException raise:@"Frame Grabber" format:@"Could not attach texture to framebuffer"]; + + ccglBindFramebuffer(CC_GL_FRAMEBUFFER, oldFBO); +} + +-(void)beforeRender:(CCTexture2D*)texture +{ + glGetIntegerv(CC_GL_FRAMEBUFFER_BINDING, &oldFBO); + ccglBindFramebuffer(CC_GL_FRAMEBUFFER, fbo); + + // BUG XXX: doesn't work with RGB565. + + + glClearColor(0,0,0,0); + + // BUG #631: To fix #631, uncomment the lines with #631 + // Warning: But it CCGrabber won't work with 2 effects at the same time +// glClearColor(0.0f,0.0f,0.0f,1.0f); // #631 + + glClear(GL_COLOR_BUFFER_BIT | GL_DEPTH_BUFFER_BIT); + +// glColorMask(TRUE, TRUE, TRUE, FALSE); // #631 + +} + +-(void)afterRender:(CCTexture2D*)texture +{ + ccglBindFramebuffer(CC_GL_FRAMEBUFFER, oldFBO); +// glColorMask(TRUE, TRUE, TRUE, TRUE); // #631 +} + +- (void) dealloc +{ + CCLOGINFO(@"cocos2d: deallocing %@", self); + ccglDeleteFramebuffers(1, &fbo); + [super dealloc]; +} + +@end diff --git a/libs/cocos2d/CCGrid.h b/libs/cocos2d/CCGrid.h new file mode 100755 index 0000000..e5e77e8 --- /dev/null +++ b/libs/cocos2d/CCGrid.h @@ -0,0 +1,121 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2009 On-Core + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + + +#import + +#import "CCNode.h" +#import "CCCamera.h" +#import "ccTypes.h" + +@class CCTexture2D; +@class CCGrabber; + +/** Base class for other + */ +@interface CCGridBase : NSObject +{ + BOOL active_; + int reuseGrid_; + ccGridSize gridSize_; + CCTexture2D *texture_; + CGPoint step_; + CCGrabber *grabber_; + BOOL isTextureFlipped_; +} + +/** wheter or not the grid is active */ +@property (nonatomic,readwrite) BOOL active; +/** number of times that the grid will be reused */ +@property (nonatomic,readwrite) int reuseGrid; +/** size of the grid */ +@property (nonatomic,readonly) ccGridSize gridSize; +/** pixels between the grids */ +@property (nonatomic,readwrite) CGPoint step; +/** texture used */ +@property (nonatomic, retain) CCTexture2D *texture; +/** grabber used */ +@property (nonatomic, retain) CCGrabber *grabber; +/** is texture flipped */ +@property (nonatomic, readwrite) BOOL isTextureFlipped; + ++(id) gridWithSize:(ccGridSize)gridSize texture:(CCTexture2D*)texture flippedTexture:(BOOL)flipped; ++(id) gridWithSize:(ccGridSize)gridSize; + +-(id) initWithSize:(ccGridSize)gridSize texture:(CCTexture2D*)texture flippedTexture:(BOOL)flipped; +-(id)initWithSize:(ccGridSize)gridSize; +-(void)beforeDraw; +-(void)afterDraw:(CCNode*)target; +-(void)blit; +-(void)reuse; + +-(void)calculateVertexPoints; + +@end + +//////////////////////////////////////////////////////////// + +/** + CCGrid3D is a 3D grid implementation. Each vertex has 3 dimensions: x,y,z + */ +@interface CCGrid3D : CCGridBase +{ + GLvoid *texCoordinates; + GLvoid *vertices; + GLvoid *originalVertices; + GLushort *indices; +} + +/** returns the vertex at a given position */ +-(ccVertex3F)vertex:(ccGridSize)pos; +/** returns the original (non-transformed) vertex at a given position */ +-(ccVertex3F)originalVertex:(ccGridSize)pos; +/** sets a new vertex at a given position */ +-(void)setVertex:(ccGridSize)pos vertex:(ccVertex3F)vertex; + +@end + +//////////////////////////////////////////////////////////// + +/** + CCTiledGrid3D is a 3D grid implementation. It differs from Grid3D in that + the tiles can be separated from the grid. +*/ +@interface CCTiledGrid3D : CCGridBase +{ + GLvoid *texCoordinates; + GLvoid *vertices; + GLvoid *originalVertices; + GLushort *indices; +} + +/** returns the tile at the given position */ +-(ccQuad3)tile:(ccGridSize)pos; +/** returns the original tile (untransformed) at the given position */ +-(ccQuad3)originalTile:(ccGridSize)pos; +/** sets a new tile */ +-(void)setTile:(ccGridSize)pos coords:(ccQuad3)coords; + +@end diff --git a/libs/cocos2d/CCGrid.m b/libs/cocos2d/CCGrid.m new file mode 100755 index 0000000..c2ed19d --- /dev/null +++ b/libs/cocos2d/CCGrid.m @@ -0,0 +1,571 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2009 On-Core + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + + +#import + +#import "ccMacros.h" +#import "CCGrid.h" +#import "CCTexture2D.h" +#import "CCDirector.h" +#import "CCGrabber.h" + +#import "Platforms/CCGL.h" +#import "Support/CGPointExtension.h" +#import "Support/ccUtils.h" + +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED +#import "Platforms/iOS/CCDirectorIOS.h" +#endif // __IPHONE_OS_VERSION_MAX_ALLOWED + +#pragma mark - +#pragma mark CCGridBase + +@implementation CCGridBase + +@synthesize reuseGrid = reuseGrid_; +@synthesize texture = texture_; +@synthesize grabber = grabber_; +@synthesize gridSize = gridSize_; +@synthesize step = step_; + ++(id) gridWithSize:(ccGridSize)gridSize texture:(CCTexture2D*)texture flippedTexture:(BOOL)flipped +{ + return [[[self alloc] initWithSize:gridSize texture:texture flippedTexture:flipped] autorelease]; +} + ++(id) gridWithSize:(ccGridSize)gridSize +{ + return [[(CCGridBase*)[self alloc] initWithSize:gridSize] autorelease]; +} + +-(id) initWithSize:(ccGridSize)gridSize texture:(CCTexture2D*)texture flippedTexture:(BOOL)flipped +{ + if( (self=[super init]) ) { + + active_ = NO; + reuseGrid_ = 0; + gridSize_ = gridSize; + + self.texture = texture; + isTextureFlipped_ = flipped; + + CGSize texSize = [texture_ contentSizeInPixels]; + step_.x = texSize.width / gridSize_.x; + step_.y = texSize.height / gridSize_.y; + + grabber_ = [[CCGrabber alloc] init]; + [grabber_ grab:texture_]; + + [self calculateVertexPoints]; + } + return self; +} + +-(id)initWithSize:(ccGridSize)gSize +{ + CCDirector *director = [CCDirector sharedDirector]; + CGSize s = [director winSizeInPixels]; + + unsigned long POTWide = ccNextPOT(s.width); + unsigned long POTHigh = ccNextPOT(s.height); + +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED + EAGLView *glview = [[CCDirector sharedDirector] openGLView]; + NSString *pixelFormat = [glview pixelFormat]; + + CCTexture2DPixelFormat format = [pixelFormat isEqualToString: kEAGLColorFormatRGB565] ? kCCTexture2DPixelFormat_RGB565 : kCCTexture2DPixelFormat_RGBA8888; +#else + CCTexture2DPixelFormat format = kCCTexture2DPixelFormat_RGBA8888; +#endif + + void *data = calloc((int)(POTWide * POTHigh * 4), 1); + if( ! data ) { + CCLOG(@"cocos2d: CCGrid: not enough memory"); + [self release]; + return nil; + } + + CCTexture2D *texture = [[CCTexture2D alloc] initWithData:data pixelFormat:format pixelsWide:POTWide pixelsHigh:POTHigh contentSize:s]; + free( data ); + + if( ! texture ) { + CCLOG(@"cocos2d: CCGrid: error creating texture"); + [self release]; + return nil; + } + + self = [self initWithSize:gSize texture:texture flippedTexture:NO]; + + [texture release]; + + return self; +} +- (NSString*) description +{ + return [NSString stringWithFormat:@"<%@ = %08X | Dimensions = %ix%i>", [self class], self, gridSize_.x, gridSize_.y]; +} + +- (void) dealloc +{ + CCLOGINFO(@"cocos2d: deallocing %@", self); + + [self setActive: NO]; + + [texture_ release]; + [grabber_ release]; + [super dealloc]; +} + +// properties +-(BOOL) active +{ + return active_; +} + +-(void) setActive:(BOOL)active +{ + active_ = active; + if( ! active ) { + CCDirector *director = [CCDirector sharedDirector]; + ccDirectorProjection proj = [director projection]; + [director setProjection:proj]; + } +} + +-(BOOL) isTextureFlipped +{ + return isTextureFlipped_; +} + +-(void) setIsTextureFlipped:(BOOL)flipped +{ + if( isTextureFlipped_ != flipped ) { + isTextureFlipped_ = flipped; + [self calculateVertexPoints]; + } +} + +// This routine can be merged with Director +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED +-(void)applyLandscape +{ + CCDirector *director = [CCDirector sharedDirector]; + + CGSize winSize = [director displaySizeInPixels]; + float w = winSize.width / 2; + float h = winSize.height / 2; + + ccDeviceOrientation orientation = [director deviceOrientation]; + + switch (orientation) { + case CCDeviceOrientationLandscapeLeft: + glTranslatef(w,h,0); + glRotatef(-90,0,0,1); + glTranslatef(-h,-w,0); + break; + case CCDeviceOrientationLandscapeRight: + glTranslatef(w,h,0); + glRotatef(90,0,0,1); + glTranslatef(-h,-w,0); + break; + case CCDeviceOrientationPortraitUpsideDown: + glTranslatef(w,h,0); + glRotatef(180,0,0,1); + glTranslatef(-w,-h,0); + break; + default: + break; + } +} +#endif + +-(void)set2DProjection +{ + CGSize winSize = [[CCDirector sharedDirector] winSizeInPixels]; + + glLoadIdentity(); + glViewport(0, 0, winSize.width, winSize.height); + glMatrixMode(GL_PROJECTION); + glLoadIdentity(); + ccglOrtho(0, winSize.width, 0, winSize.height, -1024, 1024); + glMatrixMode(GL_MODELVIEW); +} + +// This routine can be merged with Director +-(void)set3DProjection +{ + CCDirector *director = [CCDirector sharedDirector]; + + CGSize winSize = [director displaySizeInPixels]; + + glViewport(0, 0, winSize.width, winSize.height); + glMatrixMode(GL_PROJECTION); + glLoadIdentity(); + gluPerspective(60, (GLfloat)winSize.width/winSize.height, 0.5f, 1500.0f); + + glMatrixMode(GL_MODELVIEW); + glLoadIdentity(); + gluLookAt( winSize.width/2, winSize.height/2, [director getZEye], + winSize.width/2, winSize.height/2, 0, + 0.0f, 1.0f, 0.0f + ); +} + +-(void)beforeDraw +{ + [self set2DProjection]; + [grabber_ beforeRender:texture_]; +} + +-(void)afterDraw:(CCNode *)target +{ + [grabber_ afterRender:texture_]; + + [self set3DProjection]; +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED + [self applyLandscape]; +#endif + + if( target.camera.dirty ) { + + CGPoint offset = [target anchorPointInPixels]; + + // + // XXX: Camera should be applied in the AnchorPoint + // + ccglTranslate(offset.x, offset.y, 0); + [target.camera locate]; + ccglTranslate(-offset.x, -offset.y, 0); + } + + glBindTexture(GL_TEXTURE_2D, texture_.name); + + [self blit]; +} + +-(void)blit +{ + [NSException raise:@"GridBase" format:@"Abstract class needs implementation"]; +} + +-(void)reuse +{ + [NSException raise:@"GridBase" format:@"Abstract class needs implementation"]; +} + +-(void)calculateVertexPoints +{ + [NSException raise:@"GridBase" format:@"Abstract class needs implementation"]; +} + +@end + +//////////////////////////////////////////////////////////// + +#pragma mark - +#pragma mark CCGrid3D +@implementation CCGrid3D + +-(void)dealloc +{ + free(texCoordinates); + free(vertices); + free(indices); + free(originalVertices); + [super dealloc]; +} + +-(void)blit +{ + NSInteger n = gridSize_.x * gridSize_.y; + + // Default GL states: GL_TEXTURE_2D, GL_VERTEX_ARRAY, GL_COLOR_ARRAY, GL_TEXTURE_COORD_ARRAY + // Needed states: GL_TEXTURE_2D, GL_VERTEX_ARRAY, GL_TEXTURE_COORD_ARRAY + // Unneeded states: GL_COLOR_ARRAY + glDisableClientState(GL_COLOR_ARRAY); + + glVertexPointer(3, GL_FLOAT, 0, vertices); + glTexCoordPointer(2, GL_FLOAT, 0, texCoordinates); + glDrawElements(GL_TRIANGLES, (GLsizei) n*6, GL_UNSIGNED_SHORT, indices); + + // restore GL default state + glEnableClientState(GL_COLOR_ARRAY); +} + +-(void)calculateVertexPoints +{ + float width = (float)texture_.pixelsWide; + float height = (float)texture_.pixelsHigh; + float imageH = texture_.contentSizeInPixels.height; + + int x, y, i; + + vertices = malloc((gridSize_.x+1)*(gridSize_.y+1)*sizeof(ccVertex3F)); + originalVertices = malloc((gridSize_.x+1)*(gridSize_.y+1)*sizeof(ccVertex3F)); + texCoordinates = malloc((gridSize_.x+1)*(gridSize_.y+1)*sizeof(CGPoint)); + indices = malloc(gridSize_.x*gridSize_.y*sizeof(GLushort)*6); + + float *vertArray = (float*)vertices; + float *texArray = (float*)texCoordinates; + GLushort *idxArray = (GLushort *)indices; + + for( x = 0; x < gridSize_.x; x++ ) + { + for( y = 0; y < gridSize_.y; y++ ) + { + NSInteger idx = (y * gridSize_.x) + x; + + float x1 = x * step_.x; + float x2 = x1 + step_.x; + float y1 = y * step_.y; + float y2 = y1 + step_.y; + + GLushort a = x * (gridSize_.y+1) + y; + GLushort b = (x+1) * (gridSize_.y+1) + y; + GLushort c = (x+1) * (gridSize_.y+1) + (y+1); + GLushort d = x * (gridSize_.y+1) + (y+1); + + GLushort tempidx[6] = { a, b, d, b, c, d }; + + memcpy(&idxArray[6*idx], tempidx, 6*sizeof(GLushort)); + + int l1[4] = { a*3, b*3, c*3, d*3 }; + ccVertex3F e = {x1,y1,0}; + ccVertex3F f = {x2,y1,0}; + ccVertex3F g = {x2,y2,0}; + ccVertex3F h = {x1,y2,0}; + + ccVertex3F l2[4] = { e, f, g, h }; + + int tex1[4] = { a*2, b*2, c*2, d*2 }; + CGPoint tex2[4] = { ccp(x1, y1), ccp(x2, y1), ccp(x2, y2), ccp(x1, y2) }; + + for( i = 0; i < 4; i++ ) + { + vertArray[ l1[i] ] = l2[i].x; + vertArray[ l1[i] + 1 ] = l2[i].y; + vertArray[ l1[i] + 2 ] = l2[i].z; + + texArray[ tex1[i] ] = tex2[i].x / width; + if( isTextureFlipped_ ) + texArray[ tex1[i] + 1 ] = (imageH - tex2[i].y) / height; + else + texArray[ tex1[i] + 1 ] = tex2[i].y / height; + } + } + } + + memcpy(originalVertices, vertices, (gridSize_.x+1)*(gridSize_.y+1)*sizeof(ccVertex3F)); +} + +-(ccVertex3F)vertex:(ccGridSize)pos +{ + NSInteger index = (pos.x * (gridSize_.y+1) + pos.y) * 3; + float *vertArray = (float *)vertices; + + ccVertex3F vert = { vertArray[index], vertArray[index+1], vertArray[index+2] }; + + return vert; +} + +-(ccVertex3F)originalVertex:(ccGridSize)pos +{ + NSInteger index = (pos.x * (gridSize_.y+1) + pos.y) * 3; + float *vertArray = (float *)originalVertices; + + ccVertex3F vert = { vertArray[index], vertArray[index+1], vertArray[index+2] }; + + return vert; +} + +-(void)setVertex:(ccGridSize)pos vertex:(ccVertex3F)vertex +{ + NSInteger index = (pos.x * (gridSize_.y+1) + pos.y) * 3; + float *vertArray = (float *)vertices; + vertArray[index] = vertex.x; + vertArray[index+1] = vertex.y; + vertArray[index+2] = vertex.z; +} + +-(void)reuse +{ + if ( reuseGrid_ > 0 ) + { + memcpy(originalVertices, vertices, (gridSize_.x+1)*(gridSize_.y+1)*sizeof(ccVertex3F)); + reuseGrid_--; + } +} + +@end + +//////////////////////////////////////////////////////////// + +#pragma mark - +#pragma mark CCTiledGrid3D + +@implementation CCTiledGrid3D + +-(void)dealloc +{ + free(texCoordinates); + free(vertices); + free(indices); + free(originalVertices); + [super dealloc]; +} + +-(void)blit +{ + NSInteger n = gridSize_.x * gridSize_.y; + + // Default GL states: GL_TEXTURE_2D, GL_VERTEX_ARRAY, GL_COLOR_ARRAY, GL_TEXTURE_COORD_ARRAY + // Needed states: GL_TEXTURE_2D, GL_VERTEX_ARRAY, GL_TEXTURE_COORD_ARRAY + // Unneeded states: GL_COLOR_ARRAY + glDisableClientState(GL_COLOR_ARRAY); + + glVertexPointer(3, GL_FLOAT, 0, vertices); + glTexCoordPointer(2, GL_FLOAT, 0, texCoordinates); + glDrawElements(GL_TRIANGLES, (GLsizei) n*6, GL_UNSIGNED_SHORT, indices); + + // restore default GL state + glEnableClientState(GL_COLOR_ARRAY); +} + +-(void)calculateVertexPoints +{ + float width = (float)texture_.pixelsWide; + float height = (float)texture_.pixelsHigh; + float imageH = texture_.contentSizeInPixels.height; + + NSInteger numQuads = gridSize_.x * gridSize_.y; + + vertices = malloc(numQuads*12*sizeof(GLfloat)); + originalVertices = malloc(numQuads*12*sizeof(GLfloat)); + texCoordinates = malloc(numQuads*8*sizeof(GLfloat)); + indices = malloc(numQuads*6*sizeof(GLushort)); + + float *vertArray = (float*)vertices; + float *texArray = (float*)texCoordinates; + GLushort *idxArray = (GLushort *)indices; + + int x, y; + + for( x = 0; x < gridSize_.x; x++ ) + { + for( y = 0; y < gridSize_.y; y++ ) + { + float x1 = x * step_.x; + float x2 = x1 + step_.x; + float y1 = y * step_.y; + float y2 = y1 + step_.y; + + *vertArray++ = x1; + *vertArray++ = y1; + *vertArray++ = 0; + *vertArray++ = x2; + *vertArray++ = y1; + *vertArray++ = 0; + *vertArray++ = x1; + *vertArray++ = y2; + *vertArray++ = 0; + *vertArray++ = x2; + *vertArray++ = y2; + *vertArray++ = 0; + + float newY1 = y1; + float newY2 = y2; + + if( isTextureFlipped_ ) { + newY1 = imageH - y1; + newY2 = imageH - y2; + } + + *texArray++ = x1 / width; + *texArray++ = newY1 / height; + *texArray++ = x2 / width; + *texArray++ = newY1 / height; + *texArray++ = x1 / width; + *texArray++ = newY2 / height; + *texArray++ = x2 / width; + *texArray++ = newY2 / height; + } + } + + for( x = 0; x < numQuads; x++) + { + idxArray[x*6+0] = x*4+0; + idxArray[x*6+1] = x*4+1; + idxArray[x*6+2] = x*4+2; + + idxArray[x*6+3] = x*4+1; + idxArray[x*6+4] = x*4+2; + idxArray[x*6+5] = x*4+3; + } + + memcpy(originalVertices, vertices, numQuads*12*sizeof(GLfloat)); +} + +-(void)setTile:(ccGridSize)pos coords:(ccQuad3)coords +{ + NSInteger idx = (gridSize_.y * pos.x + pos.y) * 4 * 3; + float *vertArray = (float*)vertices; + memcpy(&vertArray[idx], &coords, sizeof(ccQuad3)); +} + +-(ccQuad3)originalTile:(ccGridSize)pos +{ + NSInteger idx = (gridSize_.y * pos.x + pos.y) * 4 * 3; + float *vertArray = (float*)originalVertices; + + ccQuad3 ret; + memcpy(&ret, &vertArray[idx], sizeof(ccQuad3)); + + return ret; +} + +-(ccQuad3)tile:(ccGridSize)pos +{ + NSInteger idx = (gridSize_.y * pos.x + pos.y) * 4 * 3; + float *vertArray = (float*)vertices; + + ccQuad3 ret; + memcpy(&ret, &vertArray[idx], sizeof(ccQuad3)); + + return ret; +} + +-(void)reuse +{ + if ( reuseGrid_ > 0 ) + { + NSInteger numQuads = gridSize_.x * gridSize_.y; + + memcpy(originalVertices, vertices, numQuads*12*sizeof(GLfloat)); + reuseGrid_--; + } +} + +@end diff --git a/libs/cocos2d/CCLabelAtlas.h b/libs/cocos2d/CCLabelAtlas.h new file mode 100755 index 0000000..f7781a4 --- /dev/null +++ b/libs/cocos2d/CCLabelAtlas.h @@ -0,0 +1,62 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2008-2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + + +#import "CCAtlasNode.h" +#import "CCTextureAtlas.h" + +/** CCLabelAtlas is a subclass of CCAtlasNode. + + It can be as a replacement of CCLabel since it is MUCH faster. + + CCLabelAtlas versus CCLabel: + - CCLabelAtlas is MUCH faster than CCLabel + - CCLabelAtlas "characters" have a fixed height and width + - CCLabelAtlas "characters" can be anything you want since they are taken from an image file + + A more flexible class is CCLabelBMFont. It supports variable width characters and it also has a nice editor. + */ +@interface CCLabelAtlas : CCAtlasNode +{ + // string to render + NSString *string_; + + // the first char in the charmap + unsigned char mapStartChar_; +} + + +/** creates the CCLabelAtlas with a string, a char map file(the atlas), the width and height of each element in points and the starting char of the atlas */ ++(id) labelWithString:(NSString*) string charMapFile: (NSString*) charmapfile itemWidth:(NSUInteger)w itemHeight:(NSUInteger)h startCharMap:(unsigned char)c; + +/** creates the CCLabelAtlas with a string, a char map file(the atlas), the width and height of each element in points and the starting char of the atlas. + @deprecated Will be removed in 1.0.1. Use "labelWithString:" instead + */ ++(id) labelAtlasWithString:(NSString*) string charMapFile: (NSString*) charmapfile itemWidth:(NSUInteger)w itemHeight:(NSUInteger)h startCharMap:(unsigned char)c DEPRECATED_ATTRIBUTE; + +/** initializes the CCLabelAtlas with a string, a char map file(the atlas), the width and height in points of each element and the starting char of the atlas */ +-(id) initWithString:(NSString*) string charMapFile: (NSString*) charmapfile itemWidth:(NSUInteger)w itemHeight:(NSUInteger)h startCharMap:(unsigned char)c; +@end diff --git a/libs/cocos2d/CCLabelAtlas.m b/libs/cocos2d/CCLabelAtlas.m new file mode 100755 index 0000000..386f8c3 --- /dev/null +++ b/libs/cocos2d/CCLabelAtlas.m @@ -0,0 +1,170 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2008-2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + + +#import "ccConfig.h" +#import "ccMacros.h" +#import "CCDrawingPrimitives.h" +#import "CCLabelAtlas.h" +#import "Support/CGPointExtension.h" + + + +@implementation CCLabelAtlas + +#pragma mark CCLabelAtlas - Creation & Init ++(id) labelWithString:(NSString*)string charMapFile:(NSString*)charmapfile itemWidth:(NSUInteger)w itemHeight:(NSUInteger)h startCharMap:(unsigned char)c +{ + return [[[self alloc] initWithString:string charMapFile:charmapfile itemWidth:w itemHeight:h startCharMap:c] autorelease]; +} + +// XXX DEPRECATED. Remove it in 1.0.1 ++(id) labelAtlasWithString:(NSString*) string charMapFile: (NSString*) charmapfile itemWidth:(NSUInteger)w itemHeight:(NSUInteger)h startCharMap:(unsigned char)c +{ + return [self labelWithString:string charMapFile:charmapfile itemWidth:w itemHeight:h startCharMap:c]; +} + + +-(id) initWithString:(NSString*) theString charMapFile: (NSString*) charmapfile itemWidth:(NSUInteger)w itemHeight:(NSUInteger)h startCharMap:(unsigned char)c +{ + + if ((self=[super initWithTileFile:charmapfile tileWidth:w tileHeight:h itemsToRender:[theString length] ]) ) { + + mapStartChar_ = c; + [self setString: theString]; + } + + return self; +} + +-(void) dealloc +{ + [string_ release]; + + [super dealloc]; +} + +#pragma mark CCLabelAtlas - Atlas generation + +-(void) updateAtlasValues +{ + NSUInteger n = [string_ length]; + + ccV3F_C4B_T2F_Quad quad; + + const unsigned char *s = (unsigned char*) [string_ UTF8String]; + + CCTexture2D *texture = [textureAtlas_ texture]; + float textureWide = [texture pixelsWide]; + float textureHigh = [texture pixelsHigh]; + + for( NSUInteger i=0; i textureAtlas_.capacity ) + [textureAtlas_ resizeCapacity:len]; + + [string_ release]; + string_ = [newString copy]; + [self updateAtlasValues]; + + CGSize s; + s.width = len * itemWidth_; + s.height = itemHeight_; + [self setContentSizeInPixels:s]; + + self.quadsToDraw = len; +} + +-(NSString*) string +{ + return string_; +} + +#pragma mark CCLabelAtlas - DebugDraw + +#if CC_LABELATLAS_DEBUG_DRAW +- (void) draw +{ + [super draw]; + + CGSize s = [self contentSize]; + CGPoint vertices[4]={ + ccp(0,0),ccp(s.width,0), + ccp(s.width,s.height),ccp(0,s.height), + }; + ccDrawPoly(vertices, 4, YES); + +} +#endif // CC_LABELATLAS_DEBUG_DRAW + +@end diff --git a/libs/cocos2d/CCLabelBMFont.h b/libs/cocos2d/CCLabelBMFont.h new file mode 100755 index 0000000..c839ad1 --- /dev/null +++ b/libs/cocos2d/CCLabelBMFont.h @@ -0,0 +1,190 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2008-2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + * Portions of this code are based and inspired on: + * http://www.71squared.co.uk/2009/04/iphone-game-programming-tutorial-4-bitmap-font-class + * by Michael Daley + * + * Use any of these editors to generate BMFonts: + * http://glyphdesigner.71squared.com/ (Commercial, Mac OS X) + * http://www.n4te.com/hiero/hiero.jnlp (Free, Java) + * http://slick.cokeandcode.com/demos/hiero.jnlp (Free, Java) + * http://www.angelcode.com/products/bmfont/ (Free, Windows only) + */ + +#import "CCSpriteBatchNode.h" +#import "Support/uthash.h" + +struct _KerningHashElement; + +/** @struct ccBMFontDef + BMFont definition + */ +typedef struct _BMFontDef { + //! ID of the character + unsigned int charID; + //! origin and size of the font + CGRect rect; + //! The X amount the image should be offset when drawing the image (in pixels) + int xOffset; + //! The Y amount the image should be offset when drawing the image (in pixels) + int yOffset; + //! The amount to move the current position after drawing the character (in pixels) + int xAdvance; +} ccBMFontDef; + +/** @struct ccBMFontPadding + BMFont padding + @since v0.8.2 + */ +typedef struct _BMFontPadding { + /// padding left + int left; + /// padding top + int top; + /// padding right + int right; + /// padding bottom + int bottom; +} ccBMFontPadding; + +enum { + // how many characters are supported + kCCBMFontMaxChars = 2048, //256, +}; + +/** CCBMFontConfiguration has parsed configuration of the the .fnt file + @since v0.8 + */ +@interface CCBMFontConfiguration : NSObject +{ +// XXX: Creating a public interface so that the bitmapFontArray[] is accesible +@public + // The characters building up the font + ccBMFontDef BMFontArray_[kCCBMFontMaxChars]; + + // FNTConfig: Common Height + NSUInteger commonHeight_; + + // Padding + ccBMFontPadding padding_; + + // atlas name + NSString *atlasName_; + + // values for kerning + struct _KerningHashElement *kerningDictionary_; +} + +/** allocates a CCBMFontConfiguration with a FNT file */ ++(id) configurationWithFNTFile:(NSString*)FNTfile; +/** initializes a CCBMFontConfiguration with a FNT file */ +-(id) initWithFNTfile:(NSString*)FNTfile; +@end + + +/** CCLabelBMFont is a subclass of CCSpriteBatchNode + + Features: + - Treats each character like a CCSprite. This means that each individual character can be: + - rotated + - scaled + - translated + - tinted + - chage the opacity + - It can be used as part of a menu item. + - anchorPoint can be used to align the "label" + - Supports AngelCode text format + + Limitations: + - All inner characters are using an anchorPoint of (0.5f, 0.5f) and it is not recommend to change it + because it might affect the rendering + + CCLabelBMFont implements the protocol CCLabelProtocol, like CCLabel and CCLabelAtlas. + CCLabelBMFont has the flexibility of CCLabel, the speed of CCLabelAtlas and all the features of CCSprite. + If in doubt, use CCLabelBMFont instead of CCLabelAtlas / CCLabel. + + Supported editors: + - http://www.n4te.com/hiero/hiero.jnlp + - http://slick.cokeandcode.com/demos/hiero.jnlp + - http://www.angelcode.com/products/bmfont/ + + @since v0.8 + */ + +@interface CCLabelBMFont : CCSpriteBatchNode +{ + // string to render + NSString *string_; + + CCBMFontConfiguration *configuration_; + + // texture RGBA + GLubyte opacity_; + ccColor3B color_; + BOOL opacityModifyRGB_; +} + +/** Purges the cached data. + Removes from memory the cached configurations and the atlas name dictionary. + @since v0.99.3 + */ ++(void) purgeCachedData; + +/** conforms to CCRGBAProtocol protocol */ +@property (nonatomic,readwrite) GLubyte opacity; +/** conforms to CCRGBAProtocol protocol */ +@property (nonatomic,readwrite) ccColor3B color; + + +/** creates a BMFont label with an initial string and the FNT file */ ++(id) labelWithString:(NSString*)string fntFile:(NSString*)fntFile; + +/** creates a BMFont label with an initial string and the FNT file + @deprecated Will be removed in 1.0.1. Use "labelWithString" instead. + */ ++(id) bitmapFontAtlasWithString:(NSString*)string fntFile:(NSString*)fntFile DEPRECATED_ATTRIBUTE; + +/** init a BMFont label with an initial string and the FNT file */ +-(id) initWithString:(NSString*)string fntFile:(NSString*)fntFile; + +/** updates the font chars based on the string to render */ +-(void) createFontChars; +@end + +/** Free function that parses a FNT file a place it on the cache +*/ +CCBMFontConfiguration * FNTConfigLoadFile( NSString *file ); +/** Purges the FNT config cache + */ +void FNTConfigRemoveCache( void ); + + + +/** CCBitmapFontAtlas + @deprecated Use CCLabelBMFont instead. Will be removed 1.0.1 + */ +DEPRECATED_ATTRIBUTE @interface CCBitmapFontAtlas : CCLabelBMFont +@end + diff --git a/libs/cocos2d/CCLabelBMFont.m b/libs/cocos2d/CCLabelBMFont.m new file mode 100755 index 0000000..614cd6e --- /dev/null +++ b/libs/cocos2d/CCLabelBMFont.m @@ -0,0 +1,675 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2008-2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + * Portions of this code are based and inspired on: + * http://www.71squared.co.uk/2009/04/iphone-game-programming-tutorial-4-bitmap-font-class + * by Michael Daley + * + * + * Use any of these editors to generate BMFonts: + * http://glyphdesigner.71squared.com/ (Commercial, Mac OS X) + * http://www.n4te.com/hiero/hiero.jnlp (Free, Java) + * http://slick.cokeandcode.com/demos/hiero.jnlp (Free, Java) + * http://www.angelcode.com/products/bmfont/ (Free, Windows only) + */ + +#import "ccConfig.h" +#import "CCLabelBMFont.h" +#import "CCSprite.h" +#import "CCDrawingPrimitives.h" +#import "CCConfiguration.h" +#import "Support/CCFileUtils.h" +#import "Support/CGPointExtension.h" +#import "Support/uthash.h" + +#pragma mark - +#pragma mark FNTConfig Cache - free functions + +NSMutableDictionary *configurations = nil; +CCBMFontConfiguration* FNTConfigLoadFile( NSString *fntFile) +{ + CCBMFontConfiguration *ret = nil; + + if( configurations == nil ) + configurations = [[NSMutableDictionary dictionaryWithCapacity:3] retain]; + + ret = [configurations objectForKey:fntFile]; + if( ret == nil ) { + ret = [CCBMFontConfiguration configurationWithFNTFile:fntFile]; + [configurations setObject:ret forKey:fntFile]; + } + + return ret; +} + +void FNTConfigRemoveCache( void ) +{ + [configurations removeAllObjects]; +} + +#pragma mark - Hash Element + +// Equal function for targetSet. +typedef struct _KerningHashElement +{ + int key; // key for the hash. 16-bit for 1st element, 16-bit for 2nd element + int amount; + UT_hash_handle hh; +} tKerningHashElement; + +#pragma mark - +#pragma mark BitmapFontConfiguration + + +@interface CCBMFontConfiguration (Private) +-(void) parseConfigFile:(NSString*)controlFile; +-(void) parseCharacterDefinition:(NSString*)line charDef:(ccBMFontDef*)characterDefinition; +-(void) parseInfoArguments:(NSString*)line; +-(void) parseCommonArguments:(NSString*)line; +-(void) parseImageFileName:(NSString*)line fntFile:(NSString*)fntFile; +-(void) parseKerningCapacity:(NSString*)line; +-(void) parseKerningEntry:(NSString*)line; +-(void) purgeKerningDictionary; +@end + +@implementation CCBMFontConfiguration + ++(id) configurationWithFNTFile:(NSString*)FNTfile +{ + return [[[self alloc] initWithFNTfile:FNTfile] autorelease]; +} + +-(id) initWithFNTfile:(NSString*)fntFile +{ + if((self=[super init])) { + + kerningDictionary_ = NULL; + + [self parseConfigFile:fntFile]; + } + return self; +} + +- (void) dealloc +{ + CCLOGINFO( @"cocos2d: deallocing %@", self); + [self purgeKerningDictionary]; + [atlasName_ release]; + [super dealloc]; +} + +- (NSString*) description +{ + return [NSString stringWithFormat:@"<%@ = %08X | Kernings:%d | Image = %@>", [self class], self, + HASH_COUNT(kerningDictionary_), + atlasName_]; +} + + +-(void) purgeKerningDictionary +{ + tKerningHashElement *current; + + while(kerningDictionary_) { + current = kerningDictionary_; + HASH_DEL(kerningDictionary_,current); + free(current); + } +} + +- (void)parseConfigFile:(NSString*)fntFile +{ + NSString *fullpath = [CCFileUtils fullPathFromRelativePath:fntFile]; + NSError *error; + NSString *contents = [NSString stringWithContentsOfFile:fullpath encoding:NSUTF8StringEncoding error:&error]; + + NSAssert1( contents, @"cocos2d: Error parsing FNTfile: %@", error); + + + // Move all lines in the string, which are denoted by \n, into an array + NSArray *lines = [[NSArray alloc] initWithArray:[contents componentsSeparatedByString:@"\n"]]; + + // Create an enumerator which we can use to move through the lines read from the control file + NSEnumerator *nse = [lines objectEnumerator]; + + // Create a holder for each line we are going to work with + NSString *line; + + // Loop through all the lines in the lines array processing each one + while( (line = [nse nextObject]) ) { + // parse spacing / padding + if([line hasPrefix:@"info face"]) { + // XXX: info parsing is incomplete + // Not needed for the Hiero editors, but needed for the AngelCode editor +// [self parseInfoArguments:line]; + } + // Check to see if the start of the line is something we are interested in + else if([line hasPrefix:@"common lineHeight"]) { + [self parseCommonArguments:line]; + } + else if([line hasPrefix:@"page id"]) { + [self parseImageFileName:line fntFile:fntFile]; + } + else if([line hasPrefix:@"chars c"]) { + // Ignore this line + } + else if([line hasPrefix:@"char"]) { + // Parse the current line and create a new CharDef + ccBMFontDef characterDefinition; + [self parseCharacterDefinition:line charDef:&characterDefinition]; + + // Add the CharDef returned to the charArray + BMFontArray_[ characterDefinition.charID ] = characterDefinition; + } + else if([line hasPrefix:@"kernings count"]) { + [self parseKerningCapacity:line]; + } + else if([line hasPrefix:@"kerning first"]) { + [self parseKerningEntry:line]; + } + } + // Finished with lines so release it + [lines release]; +} + +-(void) parseImageFileName:(NSString*)line fntFile:(NSString*)fntFile +{ + NSString *propertyValue = nil; + + // Break the values for this line up using = + NSArray *values = [line componentsSeparatedByString:@"="]; + + // Get the enumerator for the array of components which has been created + NSEnumerator *nse = [values objectEnumerator]; + + // We need to move past the first entry in the array before we start assigning values + [nse nextObject]; + + // page ID. Sanity check + propertyValue = [nse nextObject]; + NSAssert( [propertyValue intValue] == 0, @"XXX: LabelBMFont only supports 1 page"); + + // file + propertyValue = [nse nextObject]; + NSArray *array = [propertyValue componentsSeparatedByString:@"\""]; + propertyValue = [array objectAtIndex:1]; + NSAssert(propertyValue,@"LabelBMFont file could not be found"); + + // Supports subdirectories + NSString *dir = [fntFile stringByDeletingLastPathComponent]; + atlasName_ = [dir stringByAppendingPathComponent:propertyValue]; + + [atlasName_ retain]; +} + +-(void) parseInfoArguments:(NSString*)line +{ + // + // possible lines to parse: + // info face="Script" size=32 bold=0 italic=0 charset="" unicode=1 stretchH=100 smooth=1 aa=1 padding=1,4,3,2 spacing=0,0 outline=0 + // info face="Cracked" size=36 bold=0 italic=0 charset="" unicode=0 stretchH=100 smooth=1 aa=1 padding=0,0,0,0 spacing=1,1 + // + NSArray *values = [line componentsSeparatedByString:@"="]; + NSEnumerator *nse = [values objectEnumerator]; + NSString *propertyValue = nil; + + // We need to move past the first entry in the array before we start assigning values + [nse nextObject]; + + // face (ignore) + [nse nextObject]; + + // size (ignore) + [nse nextObject]; + + // bold (ignore) + [nse nextObject]; + + // italic (ignore) + [nse nextObject]; + + // charset (ignore) + [nse nextObject]; + + // unicode (ignore) + [nse nextObject]; + + // strechH (ignore) + [nse nextObject]; + + // smooth (ignore) + [nse nextObject]; + + // aa (ignore) + [nse nextObject]; + + // padding (ignore) + propertyValue = [nse nextObject]; + { + + NSArray *paddingValues = [propertyValue componentsSeparatedByString:@","]; + NSEnumerator *paddingEnum = [paddingValues objectEnumerator]; + // padding top + propertyValue = [paddingEnum nextObject]; + padding_.top = [propertyValue intValue]; + + // padding right + propertyValue = [paddingEnum nextObject]; + padding_.right = [propertyValue intValue]; + + // padding bottom + propertyValue = [paddingEnum nextObject]; + padding_.bottom = [propertyValue intValue]; + + // padding left + propertyValue = [paddingEnum nextObject]; + padding_.left = [propertyValue intValue]; + + CCLOG(@"cocos2d: padding: %d,%d,%d,%d", padding_.left, padding_.top, padding_.right, padding_.bottom); + } + + // spacing (ignore) + [nse nextObject]; +} + +-(void) parseCommonArguments:(NSString*)line +{ + // + // line to parse: + // common lineHeight=104 base=26 scaleW=1024 scaleH=512 pages=1 packed=0 + // + NSArray *values = [line componentsSeparatedByString:@"="]; + NSEnumerator *nse = [values objectEnumerator]; + NSString *propertyValue = nil; + + // We need to move past the first entry in the array before we start assigning values + [nse nextObject]; + + // Character ID + propertyValue = [nse nextObject]; + commonHeight_ = [propertyValue intValue]; + + // base (ignore) + [nse nextObject]; + + + // scaleW. sanity check + propertyValue = [nse nextObject]; + NSAssert( [propertyValue intValue] <= [[CCConfiguration sharedConfiguration] maxTextureSize], @"CCLabelBMFont: page can't be larger than supported"); + + // scaleH. sanity check + propertyValue = [nse nextObject]; + NSAssert( [propertyValue intValue] <= [[CCConfiguration sharedConfiguration] maxTextureSize], @"CCLabelBMFont: page can't be larger than supported"); + + // pages. sanity check + propertyValue = [nse nextObject]; + NSAssert( [propertyValue intValue] == 1, @"CCBitfontAtlas: only supports 1 page"); + + // packed (ignore) What does this mean ?? +} +- (void)parseCharacterDefinition:(NSString*)line charDef:(ccBMFontDef*)characterDefinition +{ + // Break the values for this line up using = + NSArray *values = [line componentsSeparatedByString:@"="]; + NSEnumerator *nse = [values objectEnumerator]; + NSString *propertyValue; + + // We need to move past the first entry in the array before we start assigning values + [nse nextObject]; + + // Character ID + propertyValue = [nse nextObject]; + propertyValue = [propertyValue substringToIndex: [propertyValue rangeOfString: @" "].location]; + characterDefinition->charID = [propertyValue intValue]; + NSAssert(characterDefinition->charID < kCCBMFontMaxChars, @"BitmpaFontAtlas: CharID bigger than supported"); + + // Character x + propertyValue = [nse nextObject]; + characterDefinition->rect.origin.x = [propertyValue intValue]; + // Character y + propertyValue = [nse nextObject]; + characterDefinition->rect.origin.y = [propertyValue intValue]; + // Character width + propertyValue = [nse nextObject]; + characterDefinition->rect.size.width = [propertyValue intValue]; + // Character height + propertyValue = [nse nextObject]; + characterDefinition->rect.size.height = [propertyValue intValue]; + // Character xoffset + propertyValue = [nse nextObject]; + characterDefinition->xOffset = [propertyValue intValue]; + // Character yoffset + propertyValue = [nse nextObject]; + characterDefinition->yOffset = [propertyValue intValue]; + // Character xadvance + propertyValue = [nse nextObject]; + characterDefinition->xAdvance = [propertyValue intValue]; +} + +-(void) parseKerningCapacity:(NSString*) line +{ + // When using uthash there is not need to parse the capacity. + +// NSAssert(!kerningDictionary, @"dictionary already initialized"); +// +// // Break the values for this line up using = +// NSArray *values = [line componentsSeparatedByString:@"="]; +// NSEnumerator *nse = [values objectEnumerator]; +// NSString *propertyValue; +// +// // We need to move past the first entry in the array before we start assigning values +// [nse nextObject]; +// +// // count +// propertyValue = [nse nextObject]; +// int capacity = [propertyValue intValue]; +// +// if( capacity != -1 ) +// kerningDictionary = ccHashSetNew(capacity, targetSetEql); +} + +-(void) parseKerningEntry:(NSString*) line +{ + NSArray *values = [line componentsSeparatedByString:@"="]; + NSEnumerator *nse = [values objectEnumerator]; + NSString *propertyValue; + + // We need to move past the first entry in the array before we start assigning values + [nse nextObject]; + + // first + propertyValue = [nse nextObject]; + int first = [propertyValue intValue]; + + // second + propertyValue = [nse nextObject]; + int second = [propertyValue intValue]; + + // second + propertyValue = [nse nextObject]; + int amount = [propertyValue intValue]; + + tKerningHashElement *element = calloc( sizeof( *element ), 1 ); + element->amount = amount; + element->key = (first<<16) | (second&0xffff); + HASH_ADD_INT(kerningDictionary_,key, element); +} + +@end + +#pragma mark - +#pragma mark CCLabelBMFont + +@interface CCLabelBMFont (Private) +-(NSString*) atlasNameFromFntFile:(NSString*)fntFile; + +-(int) kerningAmountForFirst:(unichar)first second:(unichar)second; + +@end + +@implementation CCLabelBMFont + +@synthesize opacity = opacity_, color = color_; + +#pragma mark LabelBMFont - Purge Cache ++(void) purgeCachedData +{ + FNTConfigRemoveCache(); +} + +#pragma mark LabelBMFont - Creation & Init + ++(id) labelWithString:(NSString *)string fntFile:(NSString *)fntFile +{ + return [[[self alloc] initWithString:string fntFile:fntFile] autorelease]; +} + +// XXX - deprecated - Will be removed in 1.0.1 ++(id) bitmapFontAtlasWithString:(NSString*)string fntFile:(NSString*)fntFile +{ + return [self labelWithString:string fntFile:fntFile]; +} + +-(id) initWithString:(NSString*)theString fntFile:(NSString*)fntFile +{ + + [configuration_ release]; // allow re-init + + configuration_ = FNTConfigLoadFile(fntFile); + [configuration_ retain]; + + NSAssert( configuration_, @"Error creating config for LabelBMFont"); + + + if ((self=[super initWithFile:configuration_->atlasName_ capacity:[theString length]])) { + + opacity_ = 255; + color_ = ccWHITE; + + contentSize_ = CGSizeZero; + + opacityModifyRGB_ = [[textureAtlas_ texture] hasPremultipliedAlpha]; + + anchorPoint_ = ccp(0.5f, 0.5f); + + [self setString:theString]; + } + + return self; +} + +-(void) dealloc +{ + [string_ release]; + [configuration_ release]; + [super dealloc]; +} + +#pragma mark LabelBMFont - Atlas generation + +-(int) kerningAmountForFirst:(unichar)first second:(unichar)second +{ + int ret = 0; + unsigned int key = (first<<16) | (second & 0xffff); + + if( configuration_->kerningDictionary_ ) { + tKerningHashElement *element = NULL; + HASH_FIND_INT(configuration_->kerningDictionary_, &key, element); + if(element) + ret = element->amount; + } + + return ret; +} + +-(void) createFontChars +{ + NSInteger nextFontPositionX = 0; + NSInteger nextFontPositionY = 0; + unichar prev = -1; + NSInteger kerningAmount = 0; + + CGSize tmpSize = CGSizeZero; + + NSInteger longestLine = 0; + NSUInteger totalHeight = 0; + + NSUInteger quantityOfLines = 1; + + NSUInteger stringLen = [string_ length]; + if( ! stringLen ) + return; + + // quantity of lines NEEDS to be calculated before parsing the lines, + // since the Y position needs to be calcualted before hand + for(NSUInteger i=0; i < stringLen-1;i++) { + unichar c = [string_ characterAtIndex:i]; + if( c=='\n') + quantityOfLines++; + } + + totalHeight = configuration_->commonHeight_ * quantityOfLines; + nextFontPositionY = -(configuration_->commonHeight_ - configuration_->commonHeight_*quantityOfLines); + + for(NSUInteger i=0; icommonHeight_; + continue; + } + + kerningAmount = [self kerningAmountForFirst:prev second:c]; + + ccBMFontDef fontDef = configuration_->BMFontArray_[c]; + + CGRect rect = fontDef.rect; + + CCSprite *fontChar; + + fontChar = (CCSprite*) [self getChildByTag:i]; + if( ! fontChar ) { + fontChar = [[CCSprite alloc] initWithBatchNode:self rectInPixels:rect]; + [self addChild:fontChar z:0 tag:i]; + [fontChar release]; + } + else { + // reusing fonts + [fontChar setTextureRectInPixels:rect rotated:NO untrimmedSize:rect.size]; + + // restore to default in case they were modified + fontChar.visible = YES; + fontChar.opacity = 255; + } + + float yOffset = configuration_->commonHeight_ - fontDef.yOffset; + fontChar.positionInPixels = ccp( (float)nextFontPositionX + fontDef.xOffset + fontDef.rect.size.width*0.5f + kerningAmount, + (float)nextFontPositionY + yOffset - rect.size.height*0.5f ); + + // update kerning + nextFontPositionX += configuration_->BMFontArray_[c].xAdvance + kerningAmount; + prev = c; + + // Apply label properties + [fontChar setOpacityModifyRGB:opacityModifyRGB_]; + // Color MUST be set before opacity, since opacity might change color if OpacityModifyRGB is on + [fontChar setColor:color_]; + + // only apply opacity if it is different than 255 ) + // to prevent modifying the color too (issue #610) + if( opacity_ != 255 ) + [fontChar setOpacity: opacity_]; + + if (longestLine < nextFontPositionX) + longestLine = nextFontPositionX; + } + + tmpSize.width = longestLine; + tmpSize.height = totalHeight; + + [self setContentSizeInPixels:tmpSize]; +} + +#pragma mark LabelBMFont - CCLabelProtocol protocol +- (void) setString:(NSString*) newString +{ + [string_ release]; + string_ = [newString copy]; + + CCNode *child; + CCARRAY_FOREACH(children_, child) + child.visible = NO; + + [self createFontChars]; +} + +-(NSString*) string +{ + return string_; +} + +-(void) setCString:(char*)label +{ + [self setString:[NSString stringWithUTF8String:label]]; +} + +#pragma mark LabelBMFont - CCRGBAProtocol protocol + +-(void) setColor:(ccColor3B)color +{ + color_ = color; + + CCSprite *child; + CCARRAY_FOREACH(children_, child) + [child setColor:color_]; +} + +-(void) setOpacity:(GLubyte)opacity +{ + opacity_ = opacity; + + id child; + CCARRAY_FOREACH(children_, child) + [child setOpacity:opacity_]; +} +-(void) setOpacityModifyRGB:(BOOL)modify +{ + opacityModifyRGB_ = modify; + + id child; + CCARRAY_FOREACH(children_, child) + [child setOpacityModifyRGB:modify]; +} + +-(BOOL) doesOpacityModifyRGB +{ + return opacityModifyRGB_; +} + +#pragma mark LabelBMFont - AnchorPoint +-(void) setAnchorPoint:(CGPoint)point +{ + if( ! CGPointEqualToPoint(point, anchorPoint_) ) { + [super setAnchorPoint:point]; + [self createFontChars]; + } +} + +#pragma mark LabelBMFont - Debug draw +#if CC_LABELBMFONT_DEBUG_DRAW +-(void) draw +{ + [super draw]; + + CGSize s = [self contentSize]; + CGPoint vertices[4]={ + ccp(0,0),ccp(s.width,0), + ccp(s.width,s.height),ccp(0,s.height), + }; + ccDrawPoly(vertices, 4, YES); +} +#endif // CC_LABELBMFONT_DEBUG_DRAW +@end diff --git a/libs/cocos2d/CCLabelTTF.h b/libs/cocos2d/CCLabelTTF.h new file mode 100755 index 0000000..8e48ce1 --- /dev/null +++ b/libs/cocos2d/CCLabelTTF.h @@ -0,0 +1,78 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2008-2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + + +#import "CCTexture2D.h" +#import "CCSprite.h" +#import "Platforms/CCNS.h" + + +/** CCLabel is a subclass of CCTextureNode that knows how to render text labels + * + * All features from CCTextureNode are valid in CCLabel + * + * CCLabel objects are slow. Consider using CCLabelAtlas or CCLabelBMFont instead. + */ + +@interface CCLabelTTF : CCSprite +{ + CGSize dimensions_; + CCTextAlignment alignment_; + NSString * fontName_; + CGFloat fontSize_; + CCLineBreakMode lineBreakMode_; + NSString *string_; +} + +/** creates a CCLabel from a fontname, alignment, dimension in points, line break mode, and font size in points. + Supported lineBreakModes: + - iOS: all UILineBreakMode supported modes + - Mac: Only NSLineBreakByWordWrapping is supported. + @since v1.0 + */ ++ (id) labelWithString:(NSString*)string dimensions:(CGSize)dimensions alignment:(CCTextAlignment)alignment lineBreakMode:(CCLineBreakMode)lineBreakMode fontName:(NSString*)name fontSize:(CGFloat)size; +/** creates a CCLabel from a fontname, alignment, dimension in points and font size in points*/ ++ (id) labelWithString:(NSString*)string dimensions:(CGSize)dimensions alignment:(CCTextAlignment)alignment fontName:(NSString*)name fontSize:(CGFloat)size; +/** creates a CCLabel from a fontname and font size in points*/ ++ (id) labelWithString:(NSString*)string fontName:(NSString*)name fontSize:(CGFloat)size; +/** initializes the CCLabel with a font name, alignment, dimension in points, line brea mode and font size in points. + Supported lineBreakModes: + - iOS: all UILineBreakMode supported modes + - Mac: Only NSLineBreakByWordWrapping is supported. + @since v1.0 + */ +- (id) initWithString:(NSString*)str dimensions:(CGSize)dimensions alignment:(CCTextAlignment)alignment lineBreakMode:(CCLineBreakMode)lineBreakMode fontName:(NSString*)name fontSize:(CGFloat)size; +/** initializes the CCLabel with a font name, alignment, dimension in points and font size in points */ +- (id) initWithString:(NSString*)string dimensions:(CGSize)dimensions alignment:(CCTextAlignment)alignment fontName:(NSString*)name fontSize:(CGFloat)size; +/** initializes the CCLabel with a font name and font size in points */ +- (id) initWithString:(NSString*)string fontName:(NSString*)name fontSize:(CGFloat)size; + +/** changes the string to render + * @warning Changing the string is as expensive as creating a new CCLabel. To obtain better performance use CCLabelAtlas + */ +- (void) setString:(NSString*)str; + +@end diff --git a/libs/cocos2d/CCLabelTTF.m b/libs/cocos2d/CCLabelTTF.m new file mode 100755 index 0000000..24602ec --- /dev/null +++ b/libs/cocos2d/CCLabelTTF.m @@ -0,0 +1,138 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2008-2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + + +#import + +#import "CCLabelTTF.h" +#import "Support/CGPointExtension.h" +#import "ccMacros.h" + +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED +#import "Platforms/iOS/CCDirectorIOS.h" +#endif + +@implementation CCLabelTTF + +- (id) init +{ + NSAssert(NO, @"CCLabelTTF: Init not supported. Use initWithString"); + [self release]; + return nil; +} + ++ (id) labelWithString:(NSString*)string dimensions:(CGSize)dimensions alignment:(CCTextAlignment)alignment lineBreakMode:(CCLineBreakMode)lineBreakMode fontName:(NSString*)name fontSize:(CGFloat)size; +{ + return [[[self alloc] initWithString: string dimensions:dimensions alignment:alignment lineBreakMode:lineBreakMode fontName:name fontSize:size]autorelease]; +} + ++ (id) labelWithString:(NSString*)string dimensions:(CGSize)dimensions alignment:(CCTextAlignment)alignment fontName:(NSString*)name fontSize:(CGFloat)size +{ + return [[[self alloc] initWithString: string dimensions:dimensions alignment:alignment fontName:name fontSize:size]autorelease]; +} + ++ (id) labelWithString:(NSString*)string fontName:(NSString*)name fontSize:(CGFloat)size +{ + return [[[self alloc] initWithString: string fontName:name fontSize:size]autorelease]; +} + + +- (id) initWithString:(NSString*)str dimensions:(CGSize)dimensions alignment:(CCTextAlignment)alignment lineBreakMode:(CCLineBreakMode)lineBreakMode fontName:(NSString*)name fontSize:(CGFloat)size +{ + if( (self=[super init]) ) { + + dimensions_ = CGSizeMake( dimensions.width * CC_CONTENT_SCALE_FACTOR(), dimensions.height * CC_CONTENT_SCALE_FACTOR() ); + alignment_ = alignment; + fontName_ = [name retain]; + fontSize_ = size * CC_CONTENT_SCALE_FACTOR(); + lineBreakMode_ = lineBreakMode; + + [self setString:str]; + } + return self; +} + +- (id) initWithString:(NSString*)str dimensions:(CGSize)dimensions alignment:(CCTextAlignment)alignment fontName:(NSString*)name fontSize:(CGFloat)size +{ + return [self initWithString:str dimensions:dimensions alignment:alignment lineBreakMode:CCLineBreakModeWordWrap fontName:name fontSize:size]; +} + +- (id) initWithString:(NSString*)str fontName:(NSString*)name fontSize:(CGFloat)size +{ + if( (self=[super init]) ) { + + dimensions_ = CGSizeZero; + fontName_ = [name retain]; + fontSize_ = size * CC_CONTENT_SCALE_FACTOR(); + + [self setString:str]; + } + return self; +} + +- (void) setString:(NSString*)str +{ + [string_ release]; + string_ = [str copy]; + + CCTexture2D *tex; + if( CGSizeEqualToSize( dimensions_, CGSizeZero ) ) + tex = [[CCTexture2D alloc] initWithString:str + fontName:fontName_ + fontSize:fontSize_]; + else + tex = [[CCTexture2D alloc] initWithString:str + dimensions:dimensions_ + alignment:alignment_ + lineBreakMode:lineBreakMode_ + fontName:fontName_ + fontSize:fontSize_]; + + [self setTexture:tex]; + [tex release]; + + CGRect rect = CGRectZero; + rect.size = [texture_ contentSize]; + [self setTextureRect: rect]; +} + +-(NSString*) string +{ + return string_; +} + +- (void) dealloc +{ + [string_ release]; + [fontName_ release]; + [super dealloc]; +} + +- (NSString*) description +{ + return [NSString stringWithFormat:@"<%@ = %08X | Label = %@, FontName = %@, FontSize = %.1f>", [self class], self, string_, fontName_, fontSize_]; +} +@end diff --git a/libs/cocos2d/CCLayer.h b/libs/cocos2d/CCLayer.h new file mode 100755 index 0000000..f4c9860 --- /dev/null +++ b/libs/cocos2d/CCLayer.h @@ -0,0 +1,293 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2008-2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + + + +#import +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED +#import // Needed for UIAccelerometerDelegate +#import "Platforms/iOS/CCTouchDelegateProtocol.h" // Touches only supported on iOS +#elif defined(__MAC_OS_X_VERSION_MAX_ALLOWED) +#import "Platforms/Mac/CCEventDispatcher.h" +#endif + +#import "CCProtocols.h" +#import "CCNode.h" + +#pragma mark - +#pragma mark CCLayer + +/** CCLayer is a subclass of CCNode that implements the TouchEventsDelegate protocol. + + All features from CCNode are valid, plus the following new features: + - It can receive iPhone Touches + - It can receive Accelerometer input +*/ +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED +@interface CCLayer : CCNode +{ + BOOL isTouchEnabled_; + BOOL isAccelerometerEnabled_; +} +/** If isTouchEnabled, this method is called onEnter. Override it to change the + way CCLayer receives touch events. + ( Default: [[TouchDispatcher sharedDispatcher] addStandardDelegate:self priority:0] ) + Example: + -(void) registerWithTouchDispatcher + { + [[TouchDispatcher sharedDispatcher] addTargetedDelegate:self priority:INT_MIN+1 swallowsTouches:YES]; + } + + Valid only on iOS. Not valid on Mac. + + @since v0.8.0 + */ +-(void) registerWithTouchDispatcher; + +/** whether or not it will receive Touch events. + You can enable / disable touch events with this property. + Only the touches of this node will be affected. This "method" is not propagated to it's children. + + Valid on iOS and Mac OS X v10.6 and later. + + @since v0.8.1 + */ +@property(nonatomic,assign) BOOL isTouchEnabled; +/** whether or not it will receive Accelerometer events + You can enable / disable accelerometer events with this property. + + Valid only on iOS. Not valid on Mac. + + @since v0.8.1 + */ +@property(nonatomic,assign) BOOL isAccelerometerEnabled; + +#elif defined(__MAC_OS_X_VERSION_MAX_ALLOWED) + + +@interface CCLayer : CCNode +{ + BOOL isMouseEnabled_; + BOOL isKeyboardEnabled_; + BOOL isTouchEnabled_; +} + +/** whether or not it will receive mouse events. + + Valind only Mac. Not valid on iOS + */ +@property (nonatomic, readwrite) BOOL isMouseEnabled; + +/** whether or not it will receive keyboard events. + + Valind only Mac. Not valid on iOS + */ +@property (nonatomic, readwrite) BOOL isKeyboardEnabled; + +/** whether or not it will receive touch events. + + Valid on iOS and Mac OS X v10.6 and later. + */ +@property (nonatomic, readwrite) BOOL isTouchEnabled; + +/** priority of the mouse event delegate. + Default 0. + Override this method to set another priority. + + Valind only Mac. Not valid on iOS + */ +-(NSInteger) mouseDelegatePriority; + +/** priority of the keyboard event delegate. + Default 0. + Override this method to set another priority. + + Valind only Mac. Not valid on iOS + */ +-(NSInteger) keyboardDelegatePriority; + +/** priority of the touch event delegate. + Default 0. + Override this method to set another priority. + + Valind only Mac. Not valid on iOS + */ +-(NSInteger) touchDelegatePriority; + +#endif // mac + + +@end + +#pragma mark - +#pragma mark CCLayerColor + +/** CCLayerColor is a subclass of CCLayer that implements the CCRGBAProtocol protocol. + + All features from CCLayer are valid, plus the following new features: + - opacity + - RGB colors + */ +@interface CCLayerColor : CCLayer +{ + GLubyte opacity_; + ccColor3B color_; + ccVertex2F squareVertices_[4]; + ccColor4B squareColors_[4]; + + ccBlendFunc blendFunc_; +} + +/** creates a CCLayer with color, width and height in Points*/ ++ (id) layerWithColor: (ccColor4B)color width:(GLfloat)w height:(GLfloat)h; +/** creates a CCLayer with color. Width and height are the window size. */ ++ (id) layerWithColor: (ccColor4B)color; + +/** initializes a CCLayer with color, width and height in Points */ +- (id) initWithColor:(ccColor4B)color width:(GLfloat)w height:(GLfloat)h; +/** initializes a CCLayer with color. Width and height are the window size. */ +- (id) initWithColor:(ccColor4B)color; + +/** change width in Points */ +-(void) changeWidth: (GLfloat)w; +/** change height in Points */ +-(void) changeHeight: (GLfloat)h; +/** change width and height in Points + @since v0.8 + */ +-(void) changeWidth:(GLfloat)w height:(GLfloat)h; + +/** Opacity: conforms to CCRGBAProtocol protocol */ +@property (nonatomic,readonly) GLubyte opacity; +/** Opacity: conforms to CCRGBAProtocol protocol */ +@property (nonatomic,readonly) ccColor3B color; +/** BlendFunction. Conforms to CCBlendProtocol protocol */ +@property (nonatomic,readwrite) ccBlendFunc blendFunc; +@end + +/** CCColorLayer + It is the same as CCLayerColor. + + @deprecated Use CCLayerColor instead. This class will be removed in v1.0.1 + */ +DEPRECATED_ATTRIBUTE @interface CCColorLayer : CCLayerColor +@end + +#pragma mark - +#pragma mark CCLayerGradient + +/** CCLayerGradient is a subclass of CCLayerColor that draws gradients across +the background. + + All features from CCLayerColor are valid, plus the following new features: + - direction + - final color + - interpolation mode + + Color is interpolated between the startColor and endColor along the given + vector (starting at the origin, ending at the terminus). If no vector is + supplied, it defaults to (0, -1) -- a fade from top to bottom. + + If 'compressedInterpolation' is disabled, you will not see either the start or end color for + non-cardinal vectors; a smooth gradient implying both end points will be still + be drawn, however. + + If ' compressedInterpolation' is enabled (default mode) you will see both the start and end colors of the gradient. + + @since v0.99.5 + */ +@interface CCLayerGradient : CCLayerColor +{ + ccColor3B endColor_; + GLubyte startOpacity_; + GLubyte endOpacity_; + CGPoint vector_; + BOOL compressedInterpolation_; +} + +/** Creates a full-screen CCLayer with a gradient between start and end. */ ++ (id) layerWithColor: (ccColor4B) start fadingTo: (ccColor4B) end; +/** Creates a full-screen CCLayer with a gradient between start and end in the direction of v. */ ++ (id) layerWithColor: (ccColor4B) start fadingTo: (ccColor4B) end alongVector: (CGPoint) v; + +/** Initializes the CCLayer with a gradient between start and end. */ +- (id) initWithColor: (ccColor4B) start fadingTo: (ccColor4B) end; +/** Initializes the CCLayer with a gradient between start and end in the direction of v. */ +- (id) initWithColor: (ccColor4B) start fadingTo: (ccColor4B) end alongVector: (CGPoint) v; + +/** The starting color. */ +@property (nonatomic, readwrite) ccColor3B startColor; +/** The ending color. */ +@property (nonatomic, readwrite) ccColor3B endColor; +/** The starting opacity. */ +@property (nonatomic, readwrite) GLubyte startOpacity; +/** The ending color. */ +@property (nonatomic, readwrite) GLubyte endOpacity; +/** The vector along which to fade color. */ +@property (nonatomic, readwrite) CGPoint vector; +/** Whether or not the interpolation will be compressed in order to display all the colors of the gradient both in canonical and non canonical vectors + Default: YES + */ +@property (nonatomic, readwrite) BOOL compressedInterpolation; + +@end + +#pragma mark - +#pragma mark CCLayerMultiplex + +/** CCLayerMultiplex is a CCLayer with the ability to multiplex it's children. + Features: + - It supports one or more children + - Only one children will be active a time + */ +@interface CCLayerMultiplex : CCLayer +{ + unsigned int enabledLayer_; + NSMutableArray *layers_; +} + +/** creates a CCMultiplexLayer with one or more layers using a variable argument list. */ ++(id) layerWithLayers: (CCLayer*) layer, ... NS_REQUIRES_NIL_TERMINATION; +/** initializes a MultiplexLayer with one or more layers using a variable argument list. */ +-(id) initWithLayers: (CCLayer*) layer vaList:(va_list) params; +/** switches to a certain layer indexed by n. + The current (old) layer will be removed from it's parent with 'cleanup:YES'. + */ +-(void) switchTo: (unsigned int) n; +/** release the current layer and switches to another layer indexed by n. + The current (old) layer will be removed from it's parent with 'cleanup:YES'. + */ +-(void) switchToAndReleaseMe: (unsigned int) n; +@end + +/** CCMultiplexLayer + It is the same as CCLayerMultiplex. + + @deprecated Use CCLayerMultiplex instead. This class will be removed in v1.0.1 + */ +DEPRECATED_ATTRIBUTE @interface CCMultiplexLayer : CCLayerMultiplex +@end + diff --git a/libs/cocos2d/CCLayer.m b/libs/cocos2d/CCLayer.m new file mode 100755 index 0000000..fe5a72d --- /dev/null +++ b/libs/cocos2d/CCLayer.m @@ -0,0 +1,621 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2008-2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + + +#import + +#import "Platforms/CCGL.h" + +#import "CCLayer.h" +#import "CCDirector.h" +#import "ccMacros.h" +#import "Support/CGPointExtension.h" + +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED +#import "Platforms/iOS/CCTouchDispatcher.h" +#import "Platforms/iOS/CCDirectorIOS.h" +#elif defined(__MAC_OS_X_VERSION_MAX_ALLOWED) +#import "Platforms/Mac/CCEventDispatcher.h" +#endif + +#pragma mark - +#pragma mark Layer + +@implementation CCLayer + +#pragma mark Layer - Init +-(id) init +{ + if( (self=[super init]) ) { + + CGSize s = [[CCDirector sharedDirector] winSize]; + anchorPoint_ = ccp(0.5f, 0.5f); + [self setContentSize:s]; + self.isRelativeAnchorPoint = NO; + + isTouchEnabled_ = NO; + +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED + isAccelerometerEnabled_ = NO; +#elif defined(__MAC_OS_X_VERSION_MAX_ALLOWED) + isMouseEnabled_ = NO; + isKeyboardEnabled_ = NO; +#endif + } + + return self; +} + +#pragma mark Layer - Touch and Accelerometer related + +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED +-(void) registerWithTouchDispatcher +{ + [[CCTouchDispatcher sharedDispatcher] addStandardDelegate:self priority:0]; +} + +-(BOOL) isAccelerometerEnabled +{ + return isAccelerometerEnabled_; +} + +-(void) setIsAccelerometerEnabled:(BOOL)enabled +{ + if( enabled != isAccelerometerEnabled_ ) { + isAccelerometerEnabled_ = enabled; + if( isRunning_ ) { + if( enabled ) + [[UIAccelerometer sharedAccelerometer] setDelegate:self]; + else + [[UIAccelerometer sharedAccelerometer] setDelegate:nil]; + } + } +} + +-(BOOL) isTouchEnabled +{ + return isTouchEnabled_; +} + +-(void) setIsTouchEnabled:(BOOL)enabled +{ + if( isTouchEnabled_ != enabled ) { + isTouchEnabled_ = enabled; + if( isRunning_ ) { + if( enabled ) + [self registerWithTouchDispatcher]; + else + [[CCTouchDispatcher sharedDispatcher] removeDelegate:self]; + } + } +} + +#elif defined(__MAC_OS_X_VERSION_MAX_ALLOWED) + +#pragma mark CCLayer - Mouse, Keyboard & Touch events + +-(NSInteger) mouseDelegatePriority +{ + return 0; +} + +-(BOOL) isMouseEnabled +{ + return isMouseEnabled_; +} + +-(void) setIsMouseEnabled:(BOOL)enabled +{ + if( isMouseEnabled_ != enabled ) { + isMouseEnabled_ = enabled; + + if( isRunning_ ) { + if( enabled ) + [[CCEventDispatcher sharedDispatcher] addMouseDelegate:self priority:[self mouseDelegatePriority]]; + else + [[CCEventDispatcher sharedDispatcher] removeMouseDelegate:self]; + } + } +} + +-(NSInteger) keyboardDelegatePriority +{ + return 0; +} + +-(BOOL) isKeyboardEnabled +{ + return isKeyboardEnabled_; +} + +-(void) setIsKeyboardEnabled:(BOOL)enabled +{ + if( isKeyboardEnabled_ != enabled ) { + isKeyboardEnabled_ = enabled; + + if( isRunning_ ) { + if( enabled ) + [[CCEventDispatcher sharedDispatcher] addKeyboardDelegate:self priority:[self keyboardDelegatePriority] ]; + else + [[CCEventDispatcher sharedDispatcher] removeKeyboardDelegate:self]; + } + } +} + +-(NSInteger) touchDelegatePriority +{ + return 0; +} + +-(BOOL) isTouchEnabled +{ + return isTouchEnabled_; +} + +-(void) setIsTouchEnabled:(BOOL)enabled +{ + if( isTouchEnabled_ != enabled ) { + isTouchEnabled_ = enabled; + if( isRunning_ ) { + if( enabled ) + [[CCEventDispatcher sharedDispatcher] addTouchDelegate:self priority:[self touchDelegatePriority]]; + else + [[CCEventDispatcher sharedDispatcher] removeTouchDelegate:self]; + } + } +} + + +#endif // Mac + + +#pragma mark Layer - Callbacks +-(void) onEnter +{ +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED + // register 'parent' nodes first + // since events are propagated in reverse order + if (isTouchEnabled_) + [self registerWithTouchDispatcher]; + +#elif defined(__MAC_OS_X_VERSION_MAX_ALLOWED) + if( isMouseEnabled_ ) + [[CCEventDispatcher sharedDispatcher] addMouseDelegate:self priority:[self mouseDelegatePriority]]; + + if( isKeyboardEnabled_) + [[CCEventDispatcher sharedDispatcher] addKeyboardDelegate:self priority:[self keyboardDelegatePriority]]; + + if( isTouchEnabled_) + [[CCEventDispatcher sharedDispatcher] addTouchDelegate:self priority:[self touchDelegatePriority]]; + +#endif + + // then iterate over all the children + [super onEnter]; +} + +// issue #624. +// Can't register mouse, touches here because of #issue #1018, and #1021 +-(void) onEnterTransitionDidFinish +{ +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED + if( isAccelerometerEnabled_ ) + [[UIAccelerometer sharedAccelerometer] setDelegate:self]; +#endif + + [super onEnterTransitionDidFinish]; +} + + +-(void) onExit +{ +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED + if( isTouchEnabled_ ) + [[CCTouchDispatcher sharedDispatcher] removeDelegate:self]; + + if( isAccelerometerEnabled_ ) + [[UIAccelerometer sharedAccelerometer] setDelegate:nil]; + +#elif defined(__MAC_OS_X_VERSION_MAX_ALLOWED) + if( isMouseEnabled_ ) + [[CCEventDispatcher sharedDispatcher] removeMouseDelegate:self]; + + if( isKeyboardEnabled_ ) + [[CCEventDispatcher sharedDispatcher] removeKeyboardDelegate:self]; + + if( isTouchEnabled_ ) + [[CCEventDispatcher sharedDispatcher] removeTouchDelegate:self]; + +#endif + + [super onExit]; +} + +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED +-(BOOL) ccTouchBegan:(UITouch *)touch withEvent:(UIEvent *)event +{ + NSAssert(NO, @"Layer#ccTouchBegan override me"); + return YES; +} +#endif +@end + +#pragma mark - +#pragma mark LayerColor + +@interface CCLayerColor (Private) +-(void) updateColor; +@end + +@implementation CCLayerColor + +// Opacity and RGB color protocol +@synthesize opacity = opacity_, color = color_; +@synthesize blendFunc = blendFunc_; + + ++ (id) layerWithColor:(ccColor4B)color width:(GLfloat)w height:(GLfloat) h +{ + return [[[self alloc] initWithColor:color width:w height:h] autorelease]; +} + ++ (id) layerWithColor:(ccColor4B)color +{ + return [[(CCLayerColor*)[self alloc] initWithColor:color] autorelease]; +} + +- (id) initWithColor:(ccColor4B)color width:(GLfloat)w height:(GLfloat) h +{ + if( (self=[super init]) ) { + + // default blend function + blendFunc_ = (ccBlendFunc) { CC_BLEND_SRC, CC_BLEND_DST }; + + color_.r = color.r; + color_.g = color.g; + color_.b = color.b; + opacity_ = color.a; + + for (NSUInteger i = 0; i +{ + tCCMenuState state_; + CCMenuItem *selectedItem_; + GLubyte opacity_; + ccColor3B color_; +} + +/** creates a CCMenu with it's items */ ++ (id) menuWithItems: (CCMenuItem*) item, ... NS_REQUIRES_NIL_TERMINATION; + +/** initializes a CCMenu with it's items */ +- (id) initWithItems: (CCMenuItem*) item vaList: (va_list) args; + +/** align items vertically */ +-(void) alignItemsVertically; +/** align items vertically with padding + @since v0.7.2 + */ +-(void) alignItemsVerticallyWithPadding:(float) padding; + +/** align items horizontally */ +-(void) alignItemsHorizontally; +/** align items horizontally with padding + @since v0.7.2 + */ +-(void) alignItemsHorizontallyWithPadding: (float) padding; + + +/** align items in rows of columns */ +-(void) alignItemsInColumns: (NSNumber *) columns, ... NS_REQUIRES_NIL_TERMINATION; +-(void) alignItemsInColumns: (NSNumber *) columns vaList: (va_list) args; + +/** align items in columns of rows */ +-(void) alignItemsInRows: (NSNumber *) rows, ... NS_REQUIRES_NIL_TERMINATION; +-(void) alignItemsInRows: (NSNumber *) rows vaList: (va_list) args; + + +/** conforms to CCRGBAProtocol protocol */ +@property (nonatomic,readonly) GLubyte opacity; +/** conforms to CCRGBAProtocol protocol */ +@property (nonatomic,readonly) ccColor3B color; + +@end diff --git a/libs/cocos2d/CCMenu.m b/libs/cocos2d/CCMenu.m new file mode 100755 index 0000000..c3cb8f2 --- /dev/null +++ b/libs/cocos2d/CCMenu.m @@ -0,0 +1,523 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2008-2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + + + +#import "CCMenu.h" +#import "CCDirector.h" +#import "Support/CGPointExtension.h" +#import "ccMacros.h" + +#import +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED +#import "Platforms/iOS/CCDirectorIOS.h" +#import "Platforms/iOS/CCTouchDispatcher.h" +#elif defined(__MAC_OS_X_VERSION_MAX_ALLOWED) +#import "Platforms/Mac/MacGLView.h" +#import "Platforms/Mac/CCDirectorMac.h" +#endif + +enum { + kDefaultPadding = 5, +}; + +@implementation CCMenu + +@synthesize opacity = opacity_, color = color_; + +- (id) init +{ + NSAssert(NO, @"CCMenu: Init not supported."); + [self release]; + return nil; +} + ++(id) menuWithItems: (CCMenuItem*) item, ... +{ + va_list args; + va_start(args,item); + + id s = [[[self alloc] initWithItems: item vaList:args] autorelease]; + + va_end(args); + return s; +} + +-(id) initWithItems: (CCMenuItem*) item vaList: (va_list) args +{ + if( (self=[super init]) ) { + +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED + self.isTouchEnabled = YES; +#elif defined(__MAC_OS_X_VERSION_MAX_ALLOWED) + self.isMouseEnabled = YES; +#endif + + // menu in the center of the screen + CGSize s = [[CCDirector sharedDirector] winSize]; + + self.isRelativeAnchorPoint = NO; + anchorPoint_ = ccp(0.5f, 0.5f); + [self setContentSize:s]; + + // XXX: in v0.7, winSize should return the visible size + // XXX: so the bar calculation should be done there +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED + CGRect r = [[UIApplication sharedApplication] statusBarFrame]; + ccDeviceOrientation orientation = [[CCDirector sharedDirector] deviceOrientation]; + if( orientation == CCDeviceOrientationLandscapeLeft || orientation == CCDeviceOrientationLandscapeRight ) + s.height -= r.size.width; + else + s.height -= r.size.height; +#endif + self.position = ccp(s.width/2, s.height/2); + + int z=0; + + if (item) { + [self addChild: item z:z]; + CCMenuItem *i = va_arg(args, CCMenuItem*); + while(i) { + z++; + [self addChild: i z:z]; + i = va_arg(args, CCMenuItem*); + } + } + // [self alignItemsVertically]; + + selectedItem_ = nil; + state_ = kCCMenuStateWaiting; + } + + return self; +} + +-(void) dealloc +{ + [super dealloc]; +} + +/* + * override add: + */ +-(void) addChild:(CCMenuItem*)child z:(NSInteger)z tag:(NSInteger) aTag +{ + NSAssert( [child isKindOfClass:[CCMenuItem class]], @"Menu only supports MenuItem objects as children"); + [super addChild:child z:z tag:aTag]; +} + +- (void) onExit +{ + if(state_ == kCCMenuStateTrackingTouch) + { + [selectedItem_ unselected]; + state_ = kCCMenuStateWaiting; + selectedItem_ = nil; + } + [super onExit]; +} + +#pragma mark Menu - Touches + +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED +-(void) registerWithTouchDispatcher +{ + [[CCTouchDispatcher sharedDispatcher] addTargetedDelegate:self priority:kCCMenuTouchPriority swallowsTouches:YES]; +} + +-(CCMenuItem *) itemForTouch: (UITouch *) touch +{ + CGPoint touchLocation = [touch locationInView: [touch view]]; + touchLocation = [[CCDirector sharedDirector] convertToGL: touchLocation]; + + CCMenuItem* item; + CCARRAY_FOREACH(children_, item){ + // ignore invisible and disabled items: issue #779, #866 + if ( [item visible] && [item isEnabled] ) { + + CGPoint local = [item convertToNodeSpace:touchLocation]; + CGRect r = [item rect]; + r.origin = CGPointZero; + + if( CGRectContainsPoint( r, local ) ) + return item; + } + } + return nil; +} + +-(BOOL) ccTouchBegan:(UITouch *)touch withEvent:(UIEvent *)event +{ + if( state_ != kCCMenuStateWaiting || !visible_ ) + return NO; + + selectedItem_ = [self itemForTouch:touch]; + [selectedItem_ selected]; + + if( selectedItem_ ) { + state_ = kCCMenuStateTrackingTouch; + return YES; + } + return NO; +} + +-(void) ccTouchEnded:(UITouch *)touch withEvent:(UIEvent *)event +{ + NSAssert(state_ == kCCMenuStateTrackingTouch, @"[Menu ccTouchEnded] -- invalid state"); + + [selectedItem_ unselected]; + [selectedItem_ activate]; + + state_ = kCCMenuStateWaiting; +} + +-(void) ccTouchCancelled:(UITouch *)touch withEvent:(UIEvent *)event +{ + NSAssert(state_ == kCCMenuStateTrackingTouch, @"[Menu ccTouchCancelled] -- invalid state"); + + [selectedItem_ unselected]; + + state_ = kCCMenuStateWaiting; +} + +-(void) ccTouchMoved:(UITouch *)touch withEvent:(UIEvent *)event +{ + NSAssert(state_ == kCCMenuStateTrackingTouch, @"[Menu ccTouchMoved] -- invalid state"); + + CCMenuItem *currentItem = [self itemForTouch:touch]; + + if (currentItem != selectedItem_) { + [selectedItem_ unselected]; + selectedItem_ = currentItem; + [selectedItem_ selected]; + } +} + +#pragma mark Menu - Mouse + +#elif defined(__MAC_OS_X_VERSION_MAX_ALLOWED) + +-(NSInteger) mouseDelegatePriority +{ + return kCCMenuMousePriority+1; +} + +-(CCMenuItem *) itemForMouseEvent: (NSEvent *) event +{ + CGPoint location = [(CCDirectorMac*)[CCDirector sharedDirector] convertEventToGL:event]; + + CCMenuItem* item; + CCARRAY_FOREACH(children_, item){ + // ignore invisible and disabled items: issue #779, #866 + if ( [item visible] && [item isEnabled] ) { + + CGPoint local = [item convertToNodeSpace:location]; + + CGRect r = [item rect]; + r.origin = CGPointZero; + + if( CGRectContainsPoint( r, local ) ) + return item; + } + } + return nil; +} + +-(BOOL) ccMouseUp:(NSEvent *)event +{ + if( ! visible_ ) + return NO; + + if(state_ == kCCMenuStateTrackingTouch) { + if( selectedItem_ ) { + [selectedItem_ unselected]; + [selectedItem_ activate]; + } + state_ = kCCMenuStateWaiting; + + return YES; + } + return NO; +} + +-(BOOL) ccMouseDown:(NSEvent *)event +{ + if( ! visible_ ) + return NO; + + selectedItem_ = [self itemForMouseEvent:event]; + [selectedItem_ selected]; + + if( selectedItem_ ) { + state_ = kCCMenuStateTrackingTouch; + return YES; + } + + return NO; +} + +-(BOOL) ccMouseDragged:(NSEvent *)event +{ + if( ! visible_ ) + return NO; + + if(state_ == kCCMenuStateTrackingTouch) { + CCMenuItem *currentItem = [self itemForMouseEvent:event]; + + if (currentItem != selectedItem_) { + [selectedItem_ unselected]; + selectedItem_ = currentItem; + [selectedItem_ selected]; + } + + return YES; + } + return NO; +} + +#endif // Mac Mouse support + +#pragma mark Menu - Alignment +-(void) alignItemsVertically +{ + [self alignItemsVerticallyWithPadding:kDefaultPadding]; +} +-(void) alignItemsVerticallyWithPadding:(float)padding +{ + float height = -padding; + + CCMenuItem *item; + CCARRAY_FOREACH(children_, item) + height += item.contentSize.height * item.scaleY + padding; + + float y = height / 2.0f; + + CCARRAY_FOREACH(children_, item) { + CGSize itemSize = item.contentSize; + [item setPosition:ccp(0, y - itemSize.height * item.scaleY / 2.0f)]; + y -= itemSize.height * item.scaleY + padding; + } +} + +-(void) alignItemsHorizontally +{ + [self alignItemsHorizontallyWithPadding:kDefaultPadding]; +} + +-(void) alignItemsHorizontallyWithPadding:(float)padding +{ + + float width = -padding; + CCMenuItem *item; + CCARRAY_FOREACH(children_, item) + width += item.contentSize.width * item.scaleX + padding; + + float x = -width / 2.0f; + + CCARRAY_FOREACH(children_, item){ + CGSize itemSize = item.contentSize; + [item setPosition:ccp(x + itemSize.width * item.scaleX / 2.0f, 0)]; + x += itemSize.width * item.scaleX + padding; + } +} + +-(void) alignItemsInColumns: (NSNumber *) columns, ... +{ + va_list args; + va_start(args, columns); + + [self alignItemsInColumns:columns vaList:args]; + + va_end(args); +} + +-(void) alignItemsInColumns: (NSNumber *) columns vaList: (va_list) args +{ + NSMutableArray *rows = [[NSMutableArray alloc] initWithObjects:columns, nil]; + columns = va_arg(args, NSNumber*); + while(columns) { + [rows addObject:columns]; + columns = va_arg(args, NSNumber*); + } + + int height = -5; + NSUInteger row = 0, rowHeight = 0, columnsOccupied = 0, rowColumns; + CCMenuItem *item; + CCARRAY_FOREACH(children_, item){ + NSAssert( row < [rows count], @"Too many menu items for the amount of rows/columns."); + + rowColumns = [(NSNumber *) [rows objectAtIndex:row] unsignedIntegerValue]; + NSAssert( rowColumns, @"Can't have zero columns on a row"); + + rowHeight = fmaxf(rowHeight, item.contentSize.height); + ++columnsOccupied; + + if(columnsOccupied >= rowColumns) { + height += rowHeight + 5; + + columnsOccupied = 0; + rowHeight = 0; + ++row; + } + } + NSAssert( !columnsOccupied, @"Too many rows/columns for available menu items." ); + + CGSize winSize = [[CCDirector sharedDirector] winSize]; + + row = 0; rowHeight = 0; rowColumns = 0; + float w, x, y = height / 2; + CCARRAY_FOREACH(children_, item) { + if(rowColumns == 0) { + rowColumns = [(NSNumber *) [rows objectAtIndex:row] unsignedIntegerValue]; + w = winSize.width / (1 + rowColumns); + x = w; + } + + CGSize itemSize = item.contentSize; + rowHeight = fmaxf(rowHeight, itemSize.height); + [item setPosition:ccp(x - winSize.width / 2, + y - itemSize.height / 2)]; + + x += w; + ++columnsOccupied; + + if(columnsOccupied >= rowColumns) { + y -= rowHeight + 5; + + columnsOccupied = 0; + rowColumns = 0; + rowHeight = 0; + ++row; + } + } + + [rows release]; +} + +-(void) alignItemsInRows: (NSNumber *) rows, ... +{ + va_list args; + va_start(args, rows); + + [self alignItemsInRows:rows vaList:args]; + + va_end(args); +} + +-(void) alignItemsInRows: (NSNumber *) rows vaList: (va_list) args +{ + NSMutableArray *columns = [[NSMutableArray alloc] initWithObjects:rows, nil]; + rows = va_arg(args, NSNumber*); + while(rows) { + [columns addObject:rows]; + rows = va_arg(args, NSNumber*); + } + + NSMutableArray *columnWidths = [[NSMutableArray alloc] init]; + NSMutableArray *columnHeights = [[NSMutableArray alloc] init]; + + int width = -10, columnHeight = -5; + NSUInteger column = 0, columnWidth = 0, rowsOccupied = 0, columnRows; + CCMenuItem *item; + CCARRAY_FOREACH(children_, item){ + NSAssert( column < [columns count], @"Too many menu items for the amount of rows/columns."); + + columnRows = [(NSNumber *) [columns objectAtIndex:column] unsignedIntegerValue]; + NSAssert( columnRows, @"Can't have zero rows on a column"); + + CGSize itemSize = item.contentSize; + columnWidth = fmaxf(columnWidth, itemSize.width); + columnHeight += itemSize.height + 5; + ++rowsOccupied; + + if(rowsOccupied >= columnRows) { + [columnWidths addObject:[NSNumber numberWithUnsignedInteger:columnWidth]]; + [columnHeights addObject:[NSNumber numberWithUnsignedInteger:columnHeight]]; + width += columnWidth + 10; + + rowsOccupied = 0; + columnWidth = 0; + columnHeight = -5; + ++column; + } + } + NSAssert( !rowsOccupied, @"Too many rows/columns for available menu items."); + + CGSize winSize = [[CCDirector sharedDirector] winSize]; + + column = 0; columnWidth = 0; columnRows = 0; + float x = -width / 2, y; + + CCARRAY_FOREACH(children_, item){ + if(columnRows == 0) { + columnRows = [(NSNumber *) [columns objectAtIndex:column] unsignedIntegerValue]; + y = ([(NSNumber *) [columnHeights objectAtIndex:column] intValue] + winSize.height) / 2; + } + + CGSize itemSize = item.contentSize; + columnWidth = fmaxf(columnWidth, itemSize.width); + [item setPosition:ccp(x + [(NSNumber *) [columnWidths objectAtIndex:column] unsignedIntegerValue] / 2, + y - winSize.height / 2)]; + + y -= itemSize.height + 10; + ++rowsOccupied; + + if(rowsOccupied >= columnRows) { + x += columnWidth + 5; + + rowsOccupied = 0; + columnRows = 0; + columnWidth = 0; + ++column; + } + } + + [columns release]; + [columnWidths release]; + [columnHeights release]; +} + +#pragma mark Menu - Opacity Protocol + +/** Override synthesized setOpacity to recurse items */ +- (void) setOpacity:(GLubyte)newOpacity +{ + opacity_ = newOpacity; + + id item; + CCARRAY_FOREACH(children_, item) + [item setOpacity:opacity_]; +} + +-(void) setColor:(ccColor3B)color +{ + color_ = color; + + id item; + CCARRAY_FOREACH(children_, item) + [item setColor:color_]; +} +@end diff --git a/libs/cocos2d/CCMenuItem.h b/libs/cocos2d/CCMenuItem.h new file mode 100755 index 0000000..2437394 --- /dev/null +++ b/libs/cocos2d/CCMenuItem.h @@ -0,0 +1,377 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2008-2011 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + +#import "CCBlockSupport.h" + +#import "CCNode.h" +#import "CCProtocols.h" + +@class CCSprite; + +#define kCCItemSize 32 + +#pragma mark - +#pragma mark CCMenuItem +/** CCMenuItem base class + * + * Subclass CCMenuItem (or any subclass) to create your custom CCMenuItem objects. + */ +@interface CCMenuItem : CCNode +{ + NSInvocation *invocation_; +#if NS_BLOCKS_AVAILABLE + // used for menu items using a block + void (^block_)(id sender); +#endif + + BOOL isEnabled_; + BOOL isSelected_; +} + +/** returns whether or not the item is selected +@since v0.8.2 +*/ +@property (nonatomic,readonly) BOOL isSelected; + +/** Creates a CCMenuItem with a target/selector */ ++(id) itemWithTarget:(id)target selector:(SEL)selector; + +/** Initializes a CCMenuItem with a target/selector */ +-(id) initWithTarget:(id)target selector:(SEL)selector; + +#if NS_BLOCKS_AVAILABLE +/** Creates a CCMenuItem with the specified block. + The block will be "copied". + */ ++(id) itemWithBlock:(void(^)(id sender))block; + +/** Initializes a CCMenuItem with the specified block. + The block will be "copied". +*/ +-(id) initWithBlock:(void(^)(id sender))block; +#endif + +/** Returns the outside box in points */ +-(CGRect) rect; + +/** Activate the item */ +-(void) activate; + +/** The item was selected (not activated), similar to "mouse-over" */ +-(void) selected; + +/** The item was unselected */ +-(void) unselected; + +/** Enable or disabled the CCMenuItem */ +-(void) setIsEnabled:(BOOL)enabled; +/** Returns whether or not the CCMenuItem is enabled */ +-(BOOL) isEnabled; +@end + +#pragma mark - +#pragma mark CCMenuItemLabel + +/** An abstract class for "label" CCMenuItemLabel items + Any CCNode that supports the CCLabelProtocol protocol can be added. + Supported nodes: + - CCLabelBMFont + - CCLabelAtlas + - CCLabelTTF + */ +@interface CCMenuItemLabel : CCMenuItem +{ + CCNode *label_; + ccColor3B colorBackup; + ccColor3B disabledColor_; + float originalScale_; +} + +/** the color that will be used to disable the item */ +@property (nonatomic,readwrite) ccColor3B disabledColor; + +/** Label that is rendered. It can be any CCNode that implements the CCLabelProtocol */ +@property (nonatomic,readwrite,assign) CCNode* label; + +/** creates a CCMenuItemLabel with a Label. Target and selector will be nill */ ++(id) itemWithLabel:(CCNode*)label; + +/** creates a CCMenuItemLabel with a Label, target and selector */ ++(id) itemWithLabel:(CCNode*)label target:(id)target selector:(SEL)selector; + +/** initializes a CCMenuItemLabel with a Label, target and selector */ +-(id) initWithLabel:(CCNode*)label target:(id)target selector:(SEL)selector; + +#if NS_BLOCKS_AVAILABLE +/** creates a CCMenuItemLabel with a Label and a block to execute. + The block will be "copied". + */ ++(id) itemWithLabel:(CCNode*)label block:(void(^)(id sender))block; + +/** initializes a CCMenuItemLabel with a Label and a block to execute. + The block will be "copied". + */ +-(id) initWithLabel:(CCNode*)label block:(void(^)(id sender))block; +#endif + +/** sets a new string to the inner label */ +-(void) setString:(NSString*)label; + +/** Enable or disabled the CCMenuItemFont + @warning setIsEnabled changes the RGB color of the font + */ +-(void) setIsEnabled: (BOOL)enabled; +@end + +#pragma mark - +#pragma mark CCMenuItemAtlasFont + +/** A CCMenuItemAtlasFont + Helper class that creates a MenuItemLabel class with a LabelAtlas + */ +@interface CCMenuItemAtlasFont : CCMenuItemLabel +{ +} + +/** creates a menu item from a string and atlas with a target/selector */ ++(id) itemFromString: (NSString*) value charMapFile:(NSString*) charMapFile itemWidth:(int)itemWidth itemHeight:(int)itemHeight startCharMap:(char)startCharMap; + +/** creates a menu item from a string and atlas. Use it with MenuItemToggle */ ++(id) itemFromString: (NSString*) value charMapFile:(NSString*) charMapFile itemWidth:(int)itemWidth itemHeight:(int)itemHeight startCharMap:(char)startCharMap target:(id) rec selector:(SEL) cb; + +/** initializes a menu item from a string and atlas with a target/selector */ +-(id) initFromString: (NSString*) value charMapFile:(NSString*) charMapFile itemWidth:(int)itemWidth itemHeight:(int)itemHeight startCharMap:(char)startCharMap target:(id) rec selector:(SEL) cb; + +#if NS_BLOCKS_AVAILABLE +/** creates a menu item from a string and atlas. Use it with MenuItemToggle. + The block will be "copied". + */ ++(id) itemFromString: (NSString*) value charMapFile:(NSString*) charMapFile itemWidth:(int)itemWidth itemHeight:(int)itemHeight startCharMap:(char)startCharMap block:(void(^)(id sender))block; + +/** initializes a menu item from a string and atlas with a block. + The block will be "copied". + */ +-(id) initFromString: (NSString*) value charMapFile:(NSString*) charMapFile itemWidth:(int)itemWidth itemHeight:(int)itemHeight startCharMap:(char)startCharMap block:(void(^)(id sender))block; +#endif + +@end + +#pragma mark - +#pragma mark CCMenuItemFont + +/** A CCMenuItemFont + Helper class that creates a CCMenuItemLabel class with a Label + */ +@interface CCMenuItemFont : CCMenuItemLabel +{ + NSUInteger fontSize_; + NSString *fontName_; +} +/** set default font size */ ++(void) setFontSize: (NSUInteger) s; + +/** get default font size */ ++(NSUInteger) fontSize; + +/** set default font name */ ++(void) setFontName: (NSString*) n; + +/** get default font name */ ++(NSString*) fontName; + +/** creates a menu item from a string without target/selector. To be used with CCMenuItemToggle */ ++(id) itemFromString: (NSString*) value; + +/** creates a menu item from a string with a target/selector */ ++(id) itemFromString: (NSString*) value target:(id) r selector:(SEL) s; + +/** initializes a menu item from a string with a target/selector */ +-(id) initFromString: (NSString*) value target:(id) r selector:(SEL) s; + +/** set font size */ +-(void) setFontSize: (NSUInteger) s; + +/** get font size */ +-(NSUInteger) fontSize; + +/** set the font name */ +-(void) setFontName: (NSString*) n; + +/** get the font name */ +-(NSString*) fontName; + +#if NS_BLOCKS_AVAILABLE +/** creates a menu item from a string with the specified block. + The block will be "copied". + */ ++(id) itemFromString: (NSString*) value block:(void(^)(id sender))block; + +/** initializes a menu item from a string with the specified block. + The block will be "copied". + */ +-(id) initFromString: (NSString*) value block:(void(^)(id sender))block; +#endif +@end + +#pragma mark - +#pragma mark CCMenuItemSprite + +/** CCMenuItemSprite accepts CCNode objects as items. + The images has 3 different states: + - unselected image + - selected image + - disabled image + + @since v0.8.0 + */ +@interface CCMenuItemSprite : CCMenuItem +{ + CCNode *normalImage_, *selectedImage_, *disabledImage_; +} + +// weak references + +/** the image used when the item is not selected */ +@property (nonatomic,readwrite,assign) CCNode *normalImage; +/** the image used when the item is selected */ +@property (nonatomic,readwrite,assign) CCNode *selectedImage; +/** the image used when the item is disabled */ +@property (nonatomic,readwrite,assign) CCNode *disabledImage; + +/** creates a menu item with a normal and selected image*/ ++(id) itemFromNormalSprite:(CCNode*)normalSprite selectedSprite:(CCNode*)selectedSprite; +/** creates a menu item with a normal and selected image with target/selector */ ++(id) itemFromNormalSprite:(CCNode*)normalSprite selectedSprite:(CCNode*)selectedSprite target:(id)target selector:(SEL)selector; +/** creates a menu item with a normal,selected and disabled image with target/selector */ ++(id) itemFromNormalSprite:(CCNode*)normalSprite selectedSprite:(CCNode*)selectedSprite disabledSprite:(CCNode*)disabledSprite target:(id)target selector:(SEL)selector; +/** initializes a menu item with a normal, selected and disabled image with target/selector */ +-(id) initFromNormalSprite:(CCNode*)normalSprite selectedSprite:(CCNode*)selectedSprite disabledSprite:(CCNode*)disabledSprite target:(id)target selector:(SEL)selector; + +#if NS_BLOCKS_AVAILABLE +/** creates a menu item with a normal and selected image with a block. + The block will be "copied". + */ ++(id) itemFromNormalSprite:(CCNode*)normalSprite selectedSprite:(CCNode*)selectedSprite block:(void(^)(id sender))block; +/** creates a menu item with a normal,selected and disabled image with a block. + The block will be "copied". + */ ++(id) itemFromNormalSprite:(CCNode*)normalSprite selectedSprite:(CCNode*)selectedSprite disabledSprite:(CCNode*)disabledSprite block:(void(^)(id sender))block; +/** initializes a menu item with a normal, selected and disabled image with a block. + The block will be "copied". + */ +-(id) initFromNormalSprite:(CCNode*)normalSprite selectedSprite:(CCNode*)selectedSprite disabledSprite:(CCNode*)disabledSprite block:(void(^)(id sender))block; +#endif + +@end + +#pragma mark - +#pragma mark CCMenuItemImage + +/** CCMenuItemImage accepts images as items. + The images has 3 different states: + - unselected image + - selected image + - disabled image + + For best results try that all images are of the same size + */ +@interface CCMenuItemImage : CCMenuItemSprite +{ +} + +/** creates a menu item with a normal and selected image*/ ++(id) itemFromNormalImage: (NSString*)value selectedImage:(NSString*) value2; +/** creates a menu item with a normal and selected image with target/selector */ ++(id) itemFromNormalImage: (NSString*)value selectedImage:(NSString*) value2 target:(id) r selector:(SEL) s; +/** creates a menu item with a normal,selected and disabled image with target/selector */ ++(id) itemFromNormalImage: (NSString*)value selectedImage:(NSString*) value2 disabledImage:(NSString*) value3 target:(id) r selector:(SEL) s; +/** initializes a menu item with a normal, selected and disabled image with target/selector */ +-(id) initFromNormalImage: (NSString*) value selectedImage:(NSString*)value2 disabledImage:(NSString*) value3 target:(id) r selector:(SEL) s; +#if NS_BLOCKS_AVAILABLE +/** creates a menu item with a normal and selected image with a block. + The block will be "copied". + */ ++(id) itemFromNormalImage: (NSString*)value selectedImage:(NSString*) value2 block:(void(^)(id sender))block; +/** creates a menu item with a normal,selected and disabled image with a block. + The block will be "copied". +*/ ++(id) itemFromNormalImage: (NSString*)value selectedImage:(NSString*) value2 disabledImage:(NSString*) value3 block:(void(^)(id sender))block; +/** initializes a menu item with a normal, selected and disabled image with a block. + The block will be "copied". +*/ +-(id) initFromNormalImage: (NSString*) value selectedImage:(NSString*)value2 disabledImage:(NSString*) value3 block:(void(^)(id sender))block; +#endif +@end + +#pragma mark - +#pragma mark CCMenuItemToggle + +/** A CCMenuItemToggle + A simple container class that "toggles" it's inner items + The inner itmes can be any MenuItem + */ +@interface CCMenuItemToggle : CCMenuItem +{ + NSUInteger selectedIndex_; + NSMutableArray* subItems_; + GLubyte opacity_; + ccColor3B color_; +} + +/** conforms with CCRGBAProtocol protocol */ +@property (nonatomic,readonly) GLubyte opacity; +/** conforms with CCRGBAProtocol protocol */ +@property (nonatomic,readonly) ccColor3B color; + +/** returns the selected item */ +@property (nonatomic,readwrite) NSUInteger selectedIndex; +/** NSMutableArray that contains the subitems. You can add/remove items in runtime, and you can replace the array with a new one. + @since v0.7.2 + */ +@property (nonatomic,readwrite,retain) NSMutableArray *subItems; + +/** creates a menu item from a list of items with a target/selector */ ++(id) itemWithTarget:(id)t selector:(SEL)s items:(CCMenuItem*) item, ... NS_REQUIRES_NIL_TERMINATION; + +/** initializes a menu item from a list of items with a target selector */ +-(id) initWithTarget:(id)t selector:(SEL)s items:(CCMenuItem*) item vaList:(va_list) args; + +#if NS_BLOCKS_AVAILABLE +/** creates a menu item from a list of items and executes the given block when the item is selected. + The block will be "copied". + */ ++(id) itemWithBlock:(void(^)(id sender))block items:(CCMenuItem*)item, ... NS_REQUIRES_NIL_TERMINATION; + +/** initializes a menu item from a list of items with a block. + The block will be "copied". + */ +-(id) initWithBlock:(void (^)(id))block items:(CCMenuItem*)item vaList:(va_list)args; +#endif + +/** return the selected item */ +-(CCMenuItem*) selectedItem; +@end + diff --git a/libs/cocos2d/CCMenuItem.m b/libs/cocos2d/CCMenuItem.m new file mode 100755 index 0000000..f88c0e0 --- /dev/null +++ b/libs/cocos2d/CCMenuItem.m @@ -0,0 +1,795 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2008-2011 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + +#import "CCMenuItem.h" +#import "CCLabelTTF.h" +#import "CCLabelAtlas.h" +#import "CCActionInterval.h" +#import "CCSprite.h" +#import "Support/CGPointExtension.h" +#import "CCBlockSupport.h" + + static NSUInteger _fontSize = kCCItemSize; +static NSString *_fontName = @"Marker Felt"; +static BOOL _fontNameRelease = NO; + + +const uint32_t kCurrentItem = 0xc0c05001; +const uint32_t kZoomActionTag = 0xc0c05002; + + +#pragma mark - +#pragma mark CCMenuItem + +@implementation CCMenuItem + +@synthesize isSelected=isSelected_; +-(id) init +{ + NSAssert(NO, @"MenuItemInit: Init not supported."); + [self release]; + return nil; +} + ++(id) itemWithTarget:(id) r selector:(SEL) s +{ + return [[[self alloc] initWithTarget:r selector:s] autorelease]; +} + +-(id) initWithTarget:(id) rec selector:(SEL) cb +{ + if((self=[super init]) ) { + + anchorPoint_ = ccp(0.5f, 0.5f); + NSMethodSignature * sig = nil; + + if( rec && cb ) { + sig = [rec methodSignatureForSelector:cb]; + + invocation_ = nil; + invocation_ = [NSInvocation invocationWithMethodSignature:sig]; + [invocation_ setTarget:rec]; + [invocation_ setSelector:cb]; +#if NS_BLOCKS_AVAILABLE + if ([sig numberOfArguments] == 3) +#endif + [invocation_ setArgument:&self atIndex:2]; + + [invocation_ retain]; + } + + isEnabled_ = YES; + isSelected_ = NO; + } + + return self; +} + +#if NS_BLOCKS_AVAILABLE + ++(id) itemWithBlock:(void(^)(id sender))block { + return [[[self alloc] initWithBlock:block] autorelease]; +} + +-(id) initWithBlock:(void(^)(id sender))block { + block_ = [block copy]; + return [self initWithTarget:block_ selector:@selector(ccCallbackBlockWithSender:)]; +} + +#endif // NS_BLOCKS_AVAILABLE + +-(void) dealloc +{ + [invocation_ release]; + +#if NS_BLOCKS_AVAILABLE + [block_ release]; +#endif + + [super dealloc]; +} + +-(void) selected +{ + isSelected_ = YES; +} + +-(void) unselected +{ + isSelected_ = NO; +} + +-(void) activate +{ + if(isEnabled_) + [invocation_ invoke]; +} + +-(void) setIsEnabled: (BOOL)enabled +{ + isEnabled_ = enabled; +} + +-(BOOL) isEnabled +{ + return isEnabled_; +} + +-(CGRect) rect +{ + return CGRectMake( position_.x - contentSize_.width*anchorPoint_.x, + position_.y - contentSize_.height*anchorPoint_.y, + contentSize_.width, contentSize_.height); +} + +@end + + +#pragma mark - +#pragma mark CCMenuItemLabel + +@implementation CCMenuItemLabel + +@synthesize disabledColor = disabledColor_; + ++(id) itemWithLabel:(CCNode*)label target:(id)target selector:(SEL)selector +{ + return [[[self alloc] initWithLabel:label target:target selector:selector] autorelease]; +} + ++(id) itemWithLabel:(CCNode*)label +{ + return [[[self alloc] initWithLabel:label target:nil selector:NULL] autorelease]; +} + +-(id) initWithLabel:(CCNode*)label target:(id)target selector:(SEL)selector +{ + if( (self=[super initWithTarget:target selector:selector]) ) { + originalScale_ = 1; + colorBackup = ccWHITE; + disabledColor_ = ccc3( 126,126,126); + self.label = label; + + } + return self; +} + +#if NS_BLOCKS_AVAILABLE + ++(id) itemWithLabel:(CCNode*)label block:(void(^)(id sender))block { + return [[[self alloc] initWithLabel:label block:block] autorelease]; +} + +-(id) initWithLabel:(CCNode*)label block:(void(^)(id sender))block { + block_ = [block copy]; + return [self initWithLabel:label target:block_ selector:@selector(ccCallbackBlockWithSender:)]; +} + +#endif // NS_BLOCKS_AVAILABLE + +-(CCNode*) label +{ + return label_; +} +-(void) setLabel:(CCNode*) label +{ + if( label != label_ ) { + [self removeChild:label_ cleanup:YES]; + [self addChild:label]; + + label_ = label; + label_.anchorPoint = ccp(0,0); + + [self setContentSize:[label_ contentSize]]; + } +} + +-(void) setString:(NSString *)string +{ + [label_ setString:string]; + [self setContentSize: [label_ contentSize]]; +} + +-(void) activate { + if(isEnabled_) { + [self stopAllActions]; + + self.scale = originalScale_; + + [super activate]; + } +} + +-(void) selected +{ + // subclass to change the default action + if(isEnabled_) { + [super selected]; + + CCAction *action = [self getActionByTag:kZoomActionTag]; + if( action ) + [self stopAction:action]; + else + originalScale_ = self.scale; + + CCAction *zoomAction = [CCScaleTo actionWithDuration:0.1f scale:originalScale_ * 1.2f]; + zoomAction.tag = kZoomActionTag; + [self runAction:zoomAction]; + } +} + +-(void) unselected +{ + // subclass to change the default action + if(isEnabled_) { + [super unselected]; + [self stopActionByTag:kZoomActionTag]; + CCAction *zoomAction = [CCScaleTo actionWithDuration:0.1f scale:originalScale_]; + zoomAction.tag = kZoomActionTag; + [self runAction:zoomAction]; + } +} + +-(void) setIsEnabled: (BOOL)enabled +{ + if( isEnabled_ != enabled ) { + if(enabled == NO) { + colorBackup = [label_ color]; + [label_ setColor: disabledColor_]; + } + else + [label_ setColor:colorBackup]; + } + + [super setIsEnabled:enabled]; +} + +- (void) setOpacity: (GLubyte)opacity +{ + [label_ setOpacity:opacity]; +} +-(GLubyte) opacity +{ + return [label_ opacity]; +} +-(void) setColor:(ccColor3B)color +{ + [label_ setColor:color]; +} +-(ccColor3B) color +{ + return [label_ color]; +} +@end + +#pragma mark - +#pragma mark CCMenuItemAtlasFont + +@implementation CCMenuItemAtlasFont + ++(id) itemFromString: (NSString*) value charMapFile:(NSString*) charMapFile itemWidth:(int)itemWidth itemHeight:(int)itemHeight startCharMap:(char)startCharMap +{ + return [CCMenuItemAtlasFont itemFromString:value charMapFile:charMapFile itemWidth:itemWidth itemHeight:itemHeight startCharMap:startCharMap target:nil selector:nil]; +} + ++(id) itemFromString: (NSString*) value charMapFile:(NSString*) charMapFile itemWidth:(int)itemWidth itemHeight:(int)itemHeight startCharMap:(char)startCharMap target:(id) rec selector:(SEL) cb +{ + return [[[self alloc] initFromString:value charMapFile:charMapFile itemWidth:itemWidth itemHeight:itemHeight startCharMap:startCharMap target:rec selector:cb] autorelease]; +} + +-(id) initFromString: (NSString*) value charMapFile:(NSString*) charMapFile itemWidth:(int)itemWidth itemHeight:(int)itemHeight startCharMap:(char)startCharMap target:(id) rec selector:(SEL) cb +{ + NSAssert( [value length] != 0, @"value length must be greater than 0"); + + CCLabelAtlas *label = [[CCLabelAtlas alloc] initWithString:value charMapFile:charMapFile itemWidth:itemWidth itemHeight:itemHeight startCharMap:startCharMap]; + [label autorelease]; + + if((self=[super initWithLabel:label target:rec selector:cb]) ) { + // do something ? + } + + return self; +} + +#if NS_BLOCKS_AVAILABLE ++(id) itemFromString:(NSString*)value charMapFile:(NSString*)charMapFile itemWidth:(int)itemWidth itemHeight:(int)itemHeight startCharMap:(char)startCharMap block:(void(^)(id sender))block { + return [[[self alloc] initFromString:value charMapFile:charMapFile itemWidth:itemWidth itemHeight:itemHeight startCharMap:startCharMap block:block] autorelease]; +} + +-(id) initFromString:(NSString*)value charMapFile:(NSString*)charMapFile itemWidth:(int)itemWidth itemHeight:(int)itemHeight startCharMap:(char)startCharMap block:(void(^)(id sender))block { + block_ = [block copy]; + return [self initFromString:value charMapFile:charMapFile itemWidth:itemWidth itemHeight:itemHeight startCharMap:startCharMap target:block_ selector:@selector(ccCallbackBlockWithSender:)]; +} +#endif // NS_BLOCKS_AVAILABLE + +-(void) dealloc +{ + [super dealloc]; +} +@end + + +#pragma mark - +#pragma mark CCMenuItemFont + +@implementation CCMenuItemFont + ++(void) setFontSize: (NSUInteger) s +{ + _fontSize = s; +} + ++(NSUInteger) fontSize +{ + return _fontSize; +} + ++(void) setFontName: (NSString*) n +{ + if( _fontNameRelease ) + [_fontName release]; + + _fontName = [n retain]; + _fontNameRelease = YES; +} + ++(NSString*) fontName +{ + return _fontName; +} + ++(id) itemFromString: (NSString*) value target:(id) r selector:(SEL) s +{ + return [[[self alloc] initFromString: value target:r selector:s] autorelease]; +} + ++(id) itemFromString: (NSString*) value +{ + return [[[self alloc] initFromString: value target:nil selector:nil] autorelease]; +} + +-(id) initFromString: (NSString*) value target:(id) rec selector:(SEL) cb +{ + NSAssert( [value length] != 0, @"Value length must be greater than 0"); + + fontName_ = [_fontName copy]; + fontSize_ = _fontSize; + + CCLabelTTF *label = [CCLabelTTF labelWithString:value fontName:fontName_ fontSize:fontSize_]; + + if((self=[super initWithLabel:label target:rec selector:cb]) ) { + // do something ? + } + + return self; +} + +-(void) recreateLabel +{ + CCLabelTTF *label = [CCLabelTTF labelWithString:[label_ string] fontName:fontName_ fontSize:fontSize_]; + self.label = label; +} + +-(void) setFontSize: (NSUInteger) size +{ + fontSize_ = size; + [self recreateLabel]; +} + +-(NSUInteger) fontSize +{ + return fontSize_; +} + +-(void) setFontName: (NSString*) fontName +{ + if (fontName_) + [fontName_ release]; + + fontName_ = [fontName copy]; + [self recreateLabel]; +} + +-(NSString*) fontName +{ + return fontName_; +} + +#if NS_BLOCKS_AVAILABLE ++(id) itemFromString: (NSString*) value block:(void(^)(id sender))block +{ + return [[[self alloc] initFromString:value block:block] autorelease]; +} + +-(id) initFromString: (NSString*) value block:(void(^)(id sender))block +{ + block_ = [block copy]; + return [self initFromString:value target:block_ selector:@selector(ccCallbackBlockWithSender:)]; +} +#endif // NS_BLOCKS_AVAILABLE + +@end + +#pragma mark - +#pragma mark CCMenuItemSprite +@implementation CCMenuItemSprite + +@synthesize normalImage=normalImage_, selectedImage=selectedImage_, disabledImage=disabledImage_; + ++(id) itemFromNormalSprite:(CCNode*)normalSprite selectedSprite:(CCNode*)selectedSprite +{ + return [self itemFromNormalSprite:normalSprite selectedSprite:selectedSprite disabledSprite:nil target:nil selector:nil]; +} ++(id) itemFromNormalSprite:(CCNode*)normalSprite selectedSprite:(CCNode*)selectedSprite target:(id)target selector:(SEL)selector +{ + return [self itemFromNormalSprite:normalSprite selectedSprite:selectedSprite disabledSprite:nil target:target selector:selector]; +} ++(id) itemFromNormalSprite:(CCNode*)normalSprite selectedSprite:(CCNode*)selectedSprite disabledSprite:(CCNode*)disabledSprite target:(id)target selector:(SEL)selector +{ + return [[[self alloc] initFromNormalSprite:normalSprite selectedSprite:selectedSprite disabledSprite:disabledSprite target:target selector:selector] autorelease]; +} +-(id) initFromNormalSprite:(CCNode*)normalSprite selectedSprite:(CCNode*)selectedSprite disabledSprite:(CCNode*)disabledSprite target:(id)target selector:(SEL)selector +{ + if( (self=[super initWithTarget:target selector:selector]) ) { + + self.normalImage = normalSprite; + self.selectedImage = selectedSprite; + self.disabledImage = disabledSprite; + + [self setContentSize: [normalImage_ contentSize]]; + } + return self; +} + +#if NS_BLOCKS_AVAILABLE ++(id) itemFromNormalSprite:(CCNode*)normalSprite selectedSprite:(CCNode*)selectedSprite block:(void(^)(id sender))block { + return [self itemFromNormalSprite:normalSprite selectedSprite:selectedSprite disabledSprite:nil block:block]; +} + ++(id) itemFromNormalSprite:(CCNode*)normalSprite selectedSprite:(CCNode*)selectedSprite disabledSprite:(CCNode*)disabledSprite block:(void(^)(id sender))block { + return [[[self alloc] initFromNormalSprite:normalSprite selectedSprite:selectedSprite disabledSprite:disabledSprite block:block] autorelease]; +} + +-(id) initFromNormalSprite:(CCNode*)normalSprite selectedSprite:(CCNode*)selectedSprite disabledSprite:(CCNode*)disabledSprite block:(void(^)(id sender))block { + block_ = [block copy]; + return [self initFromNormalSprite:normalSprite selectedSprite:selectedSprite disabledSprite:disabledSprite target:block_ selector:@selector(ccCallbackBlockWithSender:)]; +} +#endif // NS_BLOCKS_AVAILABLE + + +-(void) setNormalImage:(CCNode *)image +{ + if( image != normalImage_ ) { + image.anchorPoint = ccp(0,0); + image.visible = YES; + + [self removeChild:normalImage_ cleanup:YES]; + [self addChild:image]; + + normalImage_ = image; + } +} + +-(void) setSelectedImage:(CCNode *)image +{ + if( image != selectedImage_ ) { + image.anchorPoint = ccp(0,0); + image.visible = NO; + + [self removeChild:selectedImage_ cleanup:YES]; + [self addChild:image]; + + selectedImage_ = image; + } +} + +-(void) setDisabledImage:(CCNode *)image +{ + if( image != disabledImage_ ) { + image.anchorPoint = ccp(0,0); + image.visible = NO; + + [self removeChild:disabledImage_ cleanup:YES]; + [self addChild:image]; + + disabledImage_ = image; + } +} + +#pragma mark CCMenuItemImage - CCRGBAProtocol protocol +- (void) setOpacity: (GLubyte)opacity +{ + [normalImage_ setOpacity:opacity]; + [selectedImage_ setOpacity:opacity]; + [disabledImage_ setOpacity:opacity]; +} + +-(void) setColor:(ccColor3B)color +{ + [normalImage_ setColor:color]; + [selectedImage_ setColor:color]; + [disabledImage_ setColor:color]; +} + +-(GLubyte) opacity +{ + return [normalImage_ opacity]; +} + +-(ccColor3B) color +{ + return [normalImage_ color]; +} + +-(void) selected +{ + [super selected]; + + if( selectedImage_ ) { + [normalImage_ setVisible:NO]; + [selectedImage_ setVisible:YES]; + [disabledImage_ setVisible:NO]; + + } else { // there is not selected image + + [normalImage_ setVisible:YES]; + [selectedImage_ setVisible:NO]; + [disabledImage_ setVisible:NO]; + } +} + +-(void) unselected +{ + [super unselected]; + [normalImage_ setVisible:YES]; + [selectedImage_ setVisible:NO]; + [disabledImage_ setVisible:NO]; +} + +-(void) setIsEnabled:(BOOL)enabled +{ + [super setIsEnabled:enabled]; + + if( enabled ) { + [normalImage_ setVisible:YES]; + [selectedImage_ setVisible:NO]; + [disabledImage_ setVisible:NO]; + + } else { + if( disabledImage_ ) { + [normalImage_ setVisible:NO]; + [selectedImage_ setVisible:NO]; + [disabledImage_ setVisible:YES]; + } else { + [normalImage_ setVisible:YES]; + [selectedImage_ setVisible:NO]; + [disabledImage_ setVisible:NO]; + } + } +} + +@end + +#pragma mark - +#pragma mark CCMenuItemImage + +@implementation CCMenuItemImage + ++(id) itemFromNormalImage: (NSString*)value selectedImage:(NSString*) value2 +{ + return [self itemFromNormalImage:value selectedImage:value2 disabledImage: nil target:nil selector:nil]; +} + ++(id) itemFromNormalImage: (NSString*)value selectedImage:(NSString*) value2 target:(id) t selector:(SEL) s +{ + return [self itemFromNormalImage:value selectedImage:value2 disabledImage: nil target:t selector:s]; +} + ++(id) itemFromNormalImage: (NSString*)value selectedImage:(NSString*) value2 disabledImage: (NSString*) value3 +{ + return [[[self alloc] initFromNormalImage:value selectedImage:value2 disabledImage:value3 target:nil selector:nil] autorelease]; +} + ++(id) itemFromNormalImage: (NSString*)value selectedImage:(NSString*) value2 disabledImage: (NSString*) value3 target:(id) t selector:(SEL) s +{ + return [[[self alloc] initFromNormalImage:value selectedImage:value2 disabledImage:value3 target:t selector:s] autorelease]; +} + +-(id) initFromNormalImage: (NSString*) normalI selectedImage:(NSString*)selectedI disabledImage: (NSString*) disabledI target:(id)t selector:(SEL)sel +{ + CCNode *normalImage = [CCSprite spriteWithFile:normalI]; + CCNode *selectedImage = nil; + CCNode *disabledImage = nil; + + if( selectedI ) + selectedImage = [CCSprite spriteWithFile:selectedI]; + if(disabledI) + disabledImage = [CCSprite spriteWithFile:disabledI]; + + return [self initFromNormalSprite:normalImage selectedSprite:selectedImage disabledSprite:disabledImage target:t selector:sel]; +} + +#if NS_BLOCKS_AVAILABLE + ++(id) itemFromNormalImage: (NSString*)value selectedImage:(NSString*) value2 block:(void(^)(id sender))block { + return [self itemFromNormalImage:value selectedImage:value2 disabledImage:nil block:block]; +} + ++(id) itemFromNormalImage: (NSString*)value selectedImage:(NSString*) value2 disabledImage:(NSString*) value3 block:(void(^)(id sender))block { + return [[[self alloc] initFromNormalImage:value selectedImage:value2 disabledImage:value3 block:block] autorelease]; +} + +-(id) initFromNormalImage: (NSString*) value selectedImage:(NSString*)value2 disabledImage:(NSString*) value3 block:(void(^)(id sender))block { + block_ = [block copy]; + return [self initFromNormalImage:value selectedImage:value2 disabledImage:value3 target:block_ selector:@selector(ccCallbackBlockWithSender:)]; +} + +#endif // NS_BLOCKS_AVAILABLE + +@end + +#pragma mark - +#pragma mark CCMenuItemToggle + +// +// MenuItemToggle +// +@implementation CCMenuItemToggle + +@synthesize subItems = subItems_; +@synthesize opacity = opacity_, color = color_; + ++(id) itemWithTarget: (id)t selector: (SEL)sel items: (CCMenuItem*) item, ... +{ + va_list args; + va_start(args, item); + + id s = [[[self alloc] initWithTarget: t selector:sel items: item vaList:args] autorelease]; + + va_end(args); + return s; +} + +-(id) initWithTarget: (id)t selector: (SEL)sel items:(CCMenuItem*) item vaList: (va_list) args +{ + if( (self=[super initWithTarget:t selector:sel]) ) { + + self.subItems = [NSMutableArray arrayWithCapacity:2]; + + int z = 0; + CCMenuItem *i = item; + while(i) { + z++; + [subItems_ addObject:i]; + i = va_arg(args, CCMenuItem*); + } + + selectedIndex_ = NSUIntegerMax; + [self setSelectedIndex:0]; + } + + return self; +} + +#if NS_BLOCKS_AVAILABLE + ++(id) itemWithBlock:(void(^)(id sender))block items:(CCMenuItem*)item, ... { + va_list args; + va_start(args, item); + + id s = [[[self alloc] initWithBlock:block items:item vaList:args] autorelease]; + + va_end(args); + return s; +} + +-(id) initWithBlock:(void (^)(id))block items:(CCMenuItem*)item vaList:(va_list)args { + block_ = [block copy]; + return [self initWithTarget:block_ selector:@selector(ccCallbackBlockWithSender:) items:item vaList:args]; +} + +#endif // NS_BLOCKS_AVAILABLE + +-(void) dealloc +{ + [subItems_ release]; + [super dealloc]; +} + +-(void)setSelectedIndex:(NSUInteger)index +{ + if( index != selectedIndex_ ) { + selectedIndex_=index; + [self removeChildByTag:kCurrentItem cleanup:NO]; + + CCMenuItem *item = [subItems_ objectAtIndex:selectedIndex_]; + [self addChild:item z:0 tag:kCurrentItem]; + + CGSize s = [item contentSize]; + [self setContentSize: s]; + item.position = ccp( s.width/2, s.height/2 ); + } +} + +-(NSUInteger) selectedIndex +{ + return selectedIndex_; +} + + +-(void) selected +{ + [super selected]; + [[subItems_ objectAtIndex:selectedIndex_] selected]; +} + +-(void) unselected +{ + [super unselected]; + [[subItems_ objectAtIndex:selectedIndex_] unselected]; +} + +-(void) activate +{ + // update index + if( isEnabled_ ) { + NSUInteger newIndex = (selectedIndex_ + 1) % [subItems_ count]; + [self setSelectedIndex:newIndex]; + + } + + [super activate]; +} + +-(void) setIsEnabled: (BOOL)enabled +{ + [super setIsEnabled:enabled]; + for(CCMenuItem* item in subItems_) + [item setIsEnabled:enabled]; +} + +-(CCMenuItem*) selectedItem +{ + return [subItems_ objectAtIndex:selectedIndex_]; +} + +#pragma mark CCMenuItemToggle - CCRGBAProtocol protocol + +- (void) setOpacity: (GLubyte)opacity +{ + opacity_ = opacity; + for(CCMenuItem* item in subItems_) + [item setOpacity:opacity]; +} + +- (void) setColor:(ccColor3B)color +{ + color_ = color; + for(CCMenuItem* item in subItems_) + [item setColor:color]; +} + +@end diff --git a/libs/cocos2d/CCMotionStreak.h b/libs/cocos2d/CCMotionStreak.h new file mode 100755 index 0000000..e017124 --- /dev/null +++ b/libs/cocos2d/CCMotionStreak.h @@ -0,0 +1,67 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2008, 2009 Jason Booth + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + +#import +#import "CCNode.h" +#import "CCRibbon.h" + +/** + * CCMotionStreak manages a Ribbon based on it's motion in absolute space. + * You construct it with a fadeTime, minimum segment size, texture path, texture + * length and color. The fadeTime controls how long it takes each vertex in + * the streak to fade out, the minimum segment size it how many pixels the + * streak will move before adding a new ribbon segement, and the texture + * length is the how many pixels the texture is stretched across. The texture + * is vertically aligned along the streak segemnts. + * + * Limitations: + * CCMotionStreak, by default, will use the GL_SRC_ALPHA, GL_ONE_MINUS_SRC_ALPHA blending function. + * This blending function might not be the correct one for certain textures. + * But you can change it by using: + * [obj setBlendFunc: (ccBlendfunc) {new_src_blend_func, new_dst_blend_func}]; + * + * @since v0.8.1 + */ +@interface CCMotionStreak : CCNode +{ + CCRibbon* ribbon_; + float segThreshold_; + float width_; + CGPoint lastLocation_; +} + +/** Ribbon used by MotionStreak (weak reference) */ +@property (nonatomic,readonly) CCRibbon *ribbon; + +/** creates the a MotionStreak. The image will be loaded using the TextureMgr. */ ++(id)streakWithFade:(float)fade minSeg:(float)seg image:(NSString*)path width:(float)width length:(float)length color:(ccColor4B)color; + +/** initializes a MotionStreak. The file will be loaded using the TextureMgr. */ +-(id)initWithFade:(float)fade minSeg:(float)seg image:(NSString*)path width:(float)width length:(float)length color:(ccColor4B)color; + +/** polling function */ +-(void)update:(ccTime)delta; + +@end diff --git a/libs/cocos2d/CCMotionStreak.m b/libs/cocos2d/CCMotionStreak.m new file mode 100755 index 0000000..42737b9 --- /dev/null +++ b/libs/cocos2d/CCMotionStreak.m @@ -0,0 +1,104 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2008, 2009 Jason Booth + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + * + ********************************************************* + * + * Motion Streak manages a Ribbon based on it's motion in absolute space. + * You construct it with a fadeTime, minimum segment size, texture path, texture + * length and color. The fadeTime controls how long it takes each vertex in + * the streak to fade out, the minimum segment size it how many pixels the + * streak will move before adding a new ribbon segement, and the texture + * length is the how many pixels the texture is stretched across. The texture + * is vertically aligned along the streak segemnts. + */ + +#import "CCMotionStreak.h" +#import "Support/CGPointExtension.h" + +@implementation CCMotionStreak + +@synthesize ribbon = ribbon_; + ++(id)streakWithFade:(float)fade minSeg:(float)seg image:(NSString*)path width:(float)width length:(float)length color:(ccColor4B)color +{ + return [[[self alloc] initWithFade:(float)fade minSeg:seg image:path width:width length:length color:color] autorelease]; +} + +-(id)initWithFade:(float)fade minSeg:(float)seg image:(NSString*)path width:(float)width length:(float)length color:(ccColor4B)color +{ + if( (self=[super init])) { + segThreshold_ = seg; + width_ = width; + lastLocation_ = CGPointZero; + ribbon_ = [CCRibbon ribbonWithWidth:width_ image:path length:length color:color fade:fade]; + [self addChild:ribbon_]; + + // update ribbon position. Use schedule:interval and not scheduleUpdated. issue #1075 + [self schedule:@selector(update:) interval:0]; + } + return self; +} + +-(void)update:(ccTime)delta +{ + CGPoint location = [self convertToWorldSpace:CGPointZero]; + [ribbon_ setPosition:ccp(-1*location.x, -1*location.y)]; + float len = ccpLength(ccpSub(lastLocation_, location)); + if (len > segThreshold_) + { + [ribbon_ addPointAt:location width:width_]; + lastLocation_ = location; + } + [ribbon_ update:delta]; +} + + +-(void)dealloc +{ + [super dealloc]; +} + +#pragma mark MotionStreak - CocosNodeTexture protocol + +-(void) setTexture:(CCTexture2D*) texture +{ + [ribbon_ setTexture: texture]; +} + +-(CCTexture2D*) texture +{ + return [ribbon_ texture]; +} + +-(ccBlendFunc) blendFunc +{ + return [ribbon_ blendFunc]; +} + +-(void) setBlendFunc:(ccBlendFunc)blendFunc +{ + [ribbon_ setBlendFunc:blendFunc]; +} + +@end diff --git a/libs/cocos2d/CCNode.h b/libs/cocos2d/CCNode.h new file mode 100755 index 0000000..64acdc5 --- /dev/null +++ b/libs/cocos2d/CCNode.h @@ -0,0 +1,529 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2009 Valentin Milea + * + * Copyright (c) 2008-2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ + +#import + +#import "Platforms/CCGL.h" +#import "CCAction.h" +#import "ccTypes.h" +#import "CCTexture2D.h" +#import "CCProtocols.h" +#import "ccConfig.h" +#import "Support/CCArray.h" + +enum { + kCCNodeTagInvalid = -1, +}; + +@class CCCamera; +@class CCGridBase; + +/** CCNode is the main element. Anything thats gets drawn or contains things that get drawn is a CCNode. + The most popular CCNodes are: CCScene, CCLayer, CCSprite, CCMenu. + + The main features of a CCNode are: + - They can contain other CCNode nodes (addChild, getChildByTag, removeChild, etc) + - They can schedule periodic callback (schedule, unschedule, etc) + - They can execute actions (runAction, stopAction, etc) + + Some CCNode nodes provide extra functionality for them or their children. + + Subclassing a CCNode usually means (one/all) of: + - overriding init to initialize resources and schedule callbacks + - create callbacks to handle the advancement of time + - overriding draw to render the node + + Features of CCNode: + - position + - scale (x, y) + - rotation (in degrees, clockwise) + - CCCamera (an interface to gluLookAt ) + - CCGridBase (to do mesh transformations) + - anchor point + - size + - visible + - z-order + - openGL z position + + Default values: + - rotation: 0 + - position: (x=0,y=0) + - scale: (x=1,y=1) + - contentSize: (x=0,y=0) + - anchorPoint: (x=0,y=0) + + Limitations: + - A CCNode is a "void" object. It doesn't have a texture + + Order in transformations with grid disabled + -# The node will be translated (position) + -# The node will be rotated (rotation) + -# The node will be scaled (scale) + -# The node will be moved according to the camera values (camera) + + Order in transformations with grid enabled + -# The node will be translated (position) + -# The node will be rotated (rotation) + -# The node will be scaled (scale) + -# The grid will capture the screen + -# The node will be moved according to the camera values (camera) + -# The grid will render the captured screen + + Camera: + - Each node has a camera. By default it points to the center of the CCNode. + */ +@interface CCNode : NSObject +{ + // rotation angle + float rotation_; + + // scaling factors + float scaleX_, scaleY_; + + // position of the node + CGPoint position_; + CGPoint positionInPixels_; + + // skew angles + float skewX_, skewY_; + + // is visible + BOOL visible_; + + // anchor point in pixels + CGPoint anchorPointInPixels_; + // anchor point normalized + CGPoint anchorPoint_; + // If YES the transformtions will be relative to (-transform.x, -transform.y). + // Sprites, Labels and any other "small" object uses it. + // Scenes, Layers and other "whole screen" object don't use it. + BOOL isRelativeAnchorPoint_; + + // untransformed size of the node + CGSize contentSize_; + CGSize contentSizeInPixels_; + + // transform + CGAffineTransform transform_, inverse_; +#if CC_NODE_TRANSFORM_USING_AFFINE_MATRIX + GLfloat transformGL_[16]; +#endif + + // openGL real Z vertex + float vertexZ_; + + // a Camera + CCCamera *camera_; + + // a Grid + CCGridBase *grid_; + + // z-order value + NSInteger zOrder_; + + // array of children + CCArray *children_; + + // weakref to parent + CCNode *parent_; + + // a tag. any number you want to assign to the node + NSInteger tag_; + + // user data field + void *userData_; + + // Is running + BOOL isRunning_; + + // To reduce memory, place BOOLs that are not properties here: + BOOL isTransformDirty_:1; + BOOL isInverseDirty_:1; +#if CC_NODE_TRANSFORM_USING_AFFINE_MATRIX + BOOL isTransformGLDirty_:1; +#endif +} + +/** The z order of the node relative to it's "brothers": children of the same parent */ +@property(nonatomic,readonly) NSInteger zOrder; +/** The real openGL Z vertex. + Differences between openGL Z vertex and cocos2d Z order: + - OpenGL Z modifies the Z vertex, and not the Z order in the relation between parent-children + - OpenGL Z might require to set 2D projection + - cocos2d Z order works OK if all the nodes uses the same openGL Z vertex. eg: vertexZ = 0 + @warning: Use it at your own risk since it might break the cocos2d parent-children z order + @since v0.8 + */ +@property (nonatomic,readwrite) float vertexZ; + +/** The X skew angle of the node in degrees. + This angle describes the shear distortion in the X direction. + Thus, it is the angle between the Y axis and the left edge of the shape + The default skewX angle is 0. Positive values distort the node in a CW direction. + */ +@property(nonatomic,readwrite,assign) float skewX; + +/** The Y skew angle of the node in degrees. + This angle describes the shear distortion in the Y direction. + Thus, it is the angle between the X axis and the bottom edge of the shape + The default skewY angle is 0. Positive values distort the node in a CCW direction. + */ +@property(nonatomic,readwrite,assign) float skewY; +/** The rotation (angle) of the node in degrees. 0 is the default rotation angle. Positive values rotate node CW. */ +@property(nonatomic,readwrite,assign) float rotation; +/** The scale factor of the node. 1.0 is the default scale factor. It modifies the X and Y scale at the same time. */ +@property(nonatomic,readwrite,assign) float scale; +/** The scale factor of the node. 1.0 is the default scale factor. It only modifies the X scale factor. */ +@property(nonatomic,readwrite,assign) float scaleX; +/** The scale factor of the node. 1.0 is the default scale factor. It only modifies the Y scale factor. */ +@property(nonatomic,readwrite,assign) float scaleY; +/** Position (x,y) of the node in points. (0,0) is the left-bottom corner. */ +@property(nonatomic,readwrite,assign) CGPoint position; +/** Position (x,y) of the node in points. (0,0) is the left-bottom corner. */ +@property(nonatomic,readwrite,assign) CGPoint positionInPixels; +/** A CCCamera object that lets you move the node using a gluLookAt +*/ +@property(nonatomic,readonly) CCCamera* camera; +/** Array of children */ +@property(nonatomic,readonly) CCArray *children; +/** A CCGrid object that is used when applying effects */ +@property(nonatomic,readwrite,retain) CCGridBase* grid; +/** Whether of not the node is visible. Default is YES */ +@property(nonatomic,readwrite,assign) BOOL visible; +/** anchorPoint is the point around which all transformations and positioning manipulations take place. + It's like a pin in the node where it is "attached" to its parent. + The anchorPoint is normalized, like a percentage. (0,0) means the bottom-left corner and (1,1) means the top-right corner. + But you can use values higher than (1,1) and lower than (0,0) too. + The default anchorPoint is (0,0). It starts in the bottom-left corner. CCSprite and other subclasses have a different default anchorPoint. + @since v0.8 + */ +@property(nonatomic,readwrite) CGPoint anchorPoint; +/** The anchorPoint in absolute pixels. + Since v0.8 you can only read it. If you wish to modify it, use anchorPoint instead + */ +@property(nonatomic,readonly) CGPoint anchorPointInPixels; + +/** The untransformed size of the node in Points + The contentSize remains the same no matter the node is scaled or rotated. + All nodes has a size. Layer and Scene has the same size of the screen. + @since v0.8 + */ +@property (nonatomic,readwrite) CGSize contentSize; + +/** The untransformed size of the node in Pixels + The contentSize remains the same no matter the node is scaled or rotated. + All nodes has a size. Layer and Scene has the same size of the screen. + @since v0.8 + */ +@property (nonatomic,readwrite) CGSize contentSizeInPixels; + +/** whether or not the node is running */ +@property(nonatomic,readonly) BOOL isRunning; +/** A weak reference to the parent */ +@property(nonatomic,readwrite,assign) CCNode* parent; +/** If YES the transformtions will be relative to it's anchor point. + * Sprites, Labels and any other sizeble object use it have it enabled by default. + * Scenes, Layers and other "whole screen" object don't use it, have it disabled by default. + */ +@property(nonatomic,readwrite,assign) BOOL isRelativeAnchorPoint; +/** A tag used to identify the node easily */ +@property(nonatomic,readwrite,assign) NSInteger tag; +/** A custom user data pointer */ +@property(nonatomic,readwrite,assign) void *userData; + +// initializators +/** allocates and initializes a node. + The node will be created as "autorelease". + */ ++(id) node; +/** initializes the node */ +-(id) init; + + +// scene managment + +/** callback that is called every time the CCNode enters the 'stage'. + If the CCNode enters the 'stage' with a transition, this callback is called when the transition starts. + During onEnter you can't a "sister/brother" node. + */ +-(void) onEnter; +/** callback that is called when the CCNode enters in the 'stage'. + If the CCNode enters the 'stage' with a transition, this callback is called when the transition finishes. + @since v0.8 + */ +-(void) onEnterTransitionDidFinish; +/** callback that is called every time the CCNode leaves the 'stage'. + If the CCNode leaves the 'stage' with a transition, this callback is called when the transition finishes. + During onExit you can't access a sibling node. + */ +-(void) onExit; + + +// composition: ADD + +/** Adds a child to the container with z-order as 0. + If the child is added to a 'running' node, then 'onEnter' and 'onEnterTransitionDidFinish' will be called immediately. + @since v0.7.1 + */ +-(void) addChild: (CCNode*)node; + +/** Adds a child to the container with a z-order. + If the child is added to a 'running' node, then 'onEnter' and 'onEnterTransitionDidFinish' will be called immediately. + @since v0.7.1 + */ +-(void) addChild: (CCNode*)node z:(NSInteger)z; + +/** Adds a child to the container with z order and tag. + If the child is added to a 'running' node, then 'onEnter' and 'onEnterTransitionDidFinish' will be called immediately. + @since v0.7.1 + */ +-(void) addChild: (CCNode*)node z:(NSInteger)z tag:(NSInteger)tag; + +// composition: REMOVE + +/** Remove itself from its parent node. If cleanup is YES, then also remove all actions and callbacks. + If the node orphan, then nothing happens. + @since v0.99.3 + */ +-(void) removeFromParentAndCleanup:(BOOL)cleanup; + +/** Removes a child from the container. It will also cleanup all running actions depending on the cleanup parameter. + @since v0.7.1 + */ +-(void) removeChild: (CCNode*)node cleanup:(BOOL)cleanup; + +/** Removes a child from the container by tag value. It will also cleanup all running actions depending on the cleanup parameter + @since v0.7.1 + */ +-(void) removeChildByTag:(NSInteger) tag cleanup:(BOOL)cleanup; + +/** Removes all children from the container and do a cleanup all running actions depending on the cleanup parameter. + @since v0.7.1 + */ +-(void) removeAllChildrenWithCleanup:(BOOL)cleanup; + +// composition: GET +/** Gets a child from the container given its tag + @return returns a CCNode object + @since v0.7.1 + */ +-(CCNode*) getChildByTag:(NSInteger) tag; + +/** Reorders a child according to a new z value. + * The child MUST be already added. + */ +-(void) reorderChild:(CCNode*)child z:(NSInteger)zOrder; + +/** Stops all running actions and schedulers + @since v0.8 + */ +-(void) cleanup; + +// draw + +/** Override this method to draw your own node. + The following GL states will be enabled by default: + - glEnableClientState(GL_VERTEX_ARRAY); + - glEnableClientState(GL_COLOR_ARRAY); + - glEnableClientState(GL_TEXTURE_COORD_ARRAY); + - glEnable(GL_TEXTURE_2D); + + AND YOU SHOULD NOT DISABLE THEM AFTER DRAWING YOUR NODE + + But if you enable any other GL state, you should disable it after drawing your node. + */ +-(void) draw; +/** recursive method that visit its children and draw them */ +-(void) visit; + +// transformations + +/** performs OpenGL view-matrix transformation based on position, scale, rotation and other attributes. */ +-(void) transform; + +/** performs OpenGL view-matrix transformation of it's ancestors. + Generally the ancestors are already transformed, but in certain cases (eg: attaching a FBO) + it's necessary to transform the ancestors again. + @since v0.7.2 + */ +-(void) transformAncestors; + +/** returns a "local" axis aligned bounding box of the node in points. + The returned box is relative only to its parent. + The returned box is in Points. + + @since v0.8.2 + */ +- (CGRect) boundingBox; + +/** returns a "local" axis aligned bounding box of the node in pixels. + The returned box is relative only to its parent. + The returned box is in Points. + + @since v0.99.5 + */ +- (CGRect) boundingBoxInPixels; + + +// actions + +/** Executes an action, and returns the action that is executed. + The node becomes the action's target. + @warning Starting from v0.8 actions don't retain their target anymore. + @since v0.7.1 + @return An Action pointer + */ +-(CCAction*) runAction: (CCAction*) action; +/** Removes all actions from the running action list */ +-(void) stopAllActions; +/** Removes an action from the running action list */ +-(void) stopAction: (CCAction*) action; +/** Removes an action from the running action list given its tag + @since v0.7.1 +*/ +-(void) stopActionByTag:(NSInteger) tag; +/** Gets an action from the running action list given its tag + @since v0.7.1 + @return the Action the with the given tag + */ +-(CCAction*) getActionByTag:(NSInteger) tag; +/** Returns the numbers of actions that are running plus the ones that are schedule to run (actions in actionsToAdd and actions arrays). + * Composable actions are counted as 1 action. Example: + * If you are running 1 Sequence of 7 actions, it will return 1. + * If you are running 7 Sequences of 2 actions, it will return 7. + */ +-(NSUInteger) numberOfRunningActions; + +// timers + +/** check whether a selector is scheduled. */ +//-(BOOL) isScheduled: (SEL) selector; + +/** schedules the "update" method. It will use the order number 0. This method will be called every frame. + Scheduled methods with a lower order value will be called before the ones that have a higher order value. + Only one "udpate" method could be scheduled per node. + + @since v0.99.3 + */ +-(void) scheduleUpdate; + +/** schedules the "update" selector with a custom priority. This selector will be called every frame. + Scheduled selectors with a lower priority will be called before the ones that have a higher value. + Only one "udpate" selector could be scheduled per node (You can't have 2 'update' selectors). + + @since v0.99.3 + */ +-(void) scheduleUpdateWithPriority:(NSInteger)priority; + +/* unschedules the "update" method. + + @since v0.99.3 + */ +-(void) unscheduleUpdate; + + +/** schedules a selector. + The scheduled selector will be ticked every frame + */ +-(void) schedule: (SEL) s; +/** schedules a custom selector with an interval time in seconds. + If time is 0 it will be ticked every frame. + If time is 0, it is recommended to use 'scheduleUpdate' instead. + + If the selector is already scheduled, then the interval parameter will be updated without scheduling it again. + */ +-(void) schedule: (SEL) s interval:(ccTime)seconds; +/** unschedules a custom selector.*/ +-(void) unschedule: (SEL) s; + +/** unschedule all scheduled selectors: custom selectors, and the 'update' selector. + Actions are not affected by this method. +@since v0.99.3 + */ +-(void) unscheduleAllSelectors; + +/** resumes all scheduled selectors and actions. + Called internally by onEnter + */ +-(void) resumeSchedulerAndActions; +/** pauses all scheduled selectors and actions. + Called internally by onExit + */ +-(void) pauseSchedulerAndActions; + + +// transformation methods + +/** Returns the matrix that transform the node's (local) space coordinates into the parent's space coordinates. + The matrix is in Pixels. + @since v0.7.1 + */ +- (CGAffineTransform)nodeToParentTransform; +/** Returns the matrix that transform parent's space coordinates to the node's (local) space coordinates. + The matrix is in Pixels. + @since v0.7.1 + */ +- (CGAffineTransform)parentToNodeTransform; +/** Retrusn the world affine transform matrix. The matrix is in Pixels. + @since v0.7.1 + */ +- (CGAffineTransform)nodeToWorldTransform; +/** Returns the inverse world affine transform matrix. The matrix is in Pixels. + @since v0.7.1 + */ +- (CGAffineTransform)worldToNodeTransform; +/** Converts a Point to node (local) space coordinates. The result is in Points. + @since v0.7.1 + */ +- (CGPoint)convertToNodeSpace:(CGPoint)worldPoint; +/** Converts a Point to world space coordinates. The result is in Points. + @since v0.7.1 + */ +- (CGPoint)convertToWorldSpace:(CGPoint)nodePoint; +/** Converts a Point to node (local) space coordinates. The result is in Points. + treating the returned/received node point as anchor relative. + @since v0.7.1 + */ +- (CGPoint)convertToNodeSpaceAR:(CGPoint)worldPoint; +/** Converts a local Point to world space coordinates.The result is in Points. + treating the returned/received node point as anchor relative. + @since v0.7.1 + */ +- (CGPoint)convertToWorldSpaceAR:(CGPoint)nodePoint; + +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED +/** Converts a UITouch to node (local) space coordinates. The result is in Points. + @since v0.7.1 + */ +- (CGPoint)convertTouchToNodeSpace:(UITouch *)touch; +/** Converts a UITouch to node (local) space coordinates. The result is in Points. + This method is AR (Anchor Relative).. + @since v0.7.1 + */ +- (CGPoint)convertTouchToNodeSpaceAR:(UITouch *)touch; +#endif // __IPHONE_OS_VERSION_MAX_ALLOWED +@end diff --git a/libs/cocos2d/CCNode.m b/libs/cocos2d/CCNode.m new file mode 100755 index 0000000..569cb22 --- /dev/null +++ b/libs/cocos2d/CCNode.m @@ -0,0 +1,921 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2009 Valentin Milea + * + * Copyright (c) 2008-2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ + +#import "CCNode.h" +#import "CCGrid.h" +#import "CCDirector.h" +#import "CCActionManager.h" +#import "CCCamera.h" +#import "CCScheduler.h" +#import "ccConfig.h" +#import "ccMacros.h" +#import "Support/CGPointExtension.h" +#import "Support/ccCArray.h" +#import "Support/TransformUtils.h" +#import "ccMacros.h" + +#import +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED +#import "Platforms/iOS/CCDirectorIOS.h" +#endif + + +#if CC_COCOSNODE_RENDER_SUBPIXEL +#define RENDER_IN_SUBPIXEL +#else +#define RENDER_IN_SUBPIXEL (NSInteger) +#endif + +@interface CCNode () +// lazy allocs +-(void) childrenAlloc; +// helper that reorder a child +-(void) insertChild:(CCNode*)child z:(NSInteger)z; +// used internally to alter the zOrder variable. DON'T call this method manually +-(void) _setZOrder:(NSInteger) z; +-(void) detachChild:(CCNode *)child cleanup:(BOOL)doCleanup; +@end + +@implementation CCNode + +@synthesize children = children_; +@synthesize visible = visible_; +@synthesize parent = parent_; +@synthesize grid = grid_; +@synthesize zOrder = zOrder_; +@synthesize tag = tag_; +@synthesize vertexZ = vertexZ_; +@synthesize isRunning = isRunning_; +@synthesize userData = userData_; + +#pragma mark CCNode - Transform related properties + +@synthesize rotation = rotation_, scaleX = scaleX_, scaleY = scaleY_; +@synthesize skewX = skewX_, skewY = skewY_; +@synthesize position = position_, positionInPixels = positionInPixels_; +@synthesize anchorPoint = anchorPoint_, anchorPointInPixels = anchorPointInPixels_; +@synthesize contentSize = contentSize_, contentSizeInPixels = contentSizeInPixels_; +@synthesize isRelativeAnchorPoint = isRelativeAnchorPoint_; + +// getters synthesized, setters explicit + +-(void) setSkewX:(float)newSkewX +{ + skewX_ = newSkewX; + isTransformDirty_ = isInverseDirty_ = YES; +#if CC_NODE_TRANSFORM_USING_AFFINE_MATRIX + isTransformGLDirty_ = YES; +#endif +} + +-(void) setSkewY:(float)newSkewY +{ + skewY_ = newSkewY; + isTransformDirty_ = isInverseDirty_ = YES; +#if CC_NODE_TRANSFORM_USING_AFFINE_MATRIX + isTransformGLDirty_ = YES; +#endif +} + +-(void) setRotation: (float)newRotation +{ + rotation_ = newRotation; + isTransformDirty_ = isInverseDirty_ = YES; +#if CC_NODE_TRANSFORM_USING_AFFINE_MATRIX + isTransformGLDirty_ = YES; +#endif +} + +-(void) setScaleX: (float)newScaleX +{ + scaleX_ = newScaleX; + isTransformDirty_ = isInverseDirty_ = YES; +#if CC_NODE_TRANSFORM_USING_AFFINE_MATRIX + isTransformGLDirty_ = YES; +#endif +} + +-(void) setScaleY: (float)newScaleY +{ + scaleY_ = newScaleY; + isTransformDirty_ = isInverseDirty_ = YES; +#if CC_NODE_TRANSFORM_USING_AFFINE_MATRIX + isTransformGLDirty_ = YES; +#endif +} + +-(void) setPosition: (CGPoint)newPosition +{ + position_ = newPosition; + if( CC_CONTENT_SCALE_FACTOR() == 1 ) + positionInPixels_ = position_; + else + positionInPixels_ = ccpMult( newPosition, CC_CONTENT_SCALE_FACTOR() ); + + isTransformDirty_ = isInverseDirty_ = YES; +#if CC_NODE_TRANSFORM_USING_AFFINE_MATRIX + isTransformGLDirty_ = YES; +#endif +} + +-(void) setPositionInPixels:(CGPoint)newPosition +{ + positionInPixels_ = newPosition; + + if( CC_CONTENT_SCALE_FACTOR() == 1 ) + position_ = positionInPixels_; + else + position_ = ccpMult( newPosition, 1/CC_CONTENT_SCALE_FACTOR() ); + + isTransformDirty_ = isInverseDirty_ = YES; +#if CC_NODE_TRANSFORM_USING_AFFINE_MATRIX + isTransformGLDirty_ = YES; +#endif +} + +-(void) setIsRelativeAnchorPoint: (BOOL)newValue +{ + isRelativeAnchorPoint_ = newValue; + isTransformDirty_ = isInverseDirty_ = YES; +#if CC_NODE_TRANSFORM_USING_AFFINE_MATRIX + isTransformGLDirty_ = YES; +#endif +} + +-(void) setAnchorPoint:(CGPoint)point +{ + if( ! CGPointEqualToPoint(point, anchorPoint_) ) { + anchorPoint_ = point; + anchorPointInPixels_ = ccp( contentSizeInPixels_.width * anchorPoint_.x, contentSizeInPixels_.height * anchorPoint_.y ); + isTransformDirty_ = isInverseDirty_ = YES; +#if CC_NODE_TRANSFORM_USING_AFFINE_MATRIX + isTransformGLDirty_ = YES; +#endif + } +} + +-(void) setContentSize:(CGSize)size +{ + if( ! CGSizeEqualToSize(size, contentSize_) ) { + contentSize_ = size; + + if( CC_CONTENT_SCALE_FACTOR() == 1 ) + contentSizeInPixels_ = contentSize_; + else + contentSizeInPixels_ = CGSizeMake( size.width * CC_CONTENT_SCALE_FACTOR(), size.height * CC_CONTENT_SCALE_FACTOR() ); + + anchorPointInPixels_ = ccp( contentSizeInPixels_.width * anchorPoint_.x, contentSizeInPixels_.height * anchorPoint_.y ); + isTransformDirty_ = isInverseDirty_ = YES; +#if CC_NODE_TRANSFORM_USING_AFFINE_MATRIX + isTransformGLDirty_ = YES; +#endif + } +} + +-(void) setContentSizeInPixels:(CGSize)size +{ + if( ! CGSizeEqualToSize(size, contentSizeInPixels_) ) { + contentSizeInPixels_ = size; + + if( CC_CONTENT_SCALE_FACTOR() == 1 ) + contentSize_ = contentSizeInPixels_; + else + contentSize_ = CGSizeMake( size.width / CC_CONTENT_SCALE_FACTOR(), size.height / CC_CONTENT_SCALE_FACTOR() ); + + anchorPointInPixels_ = ccp( contentSizeInPixels_.width * anchorPoint_.x, contentSizeInPixels_.height * anchorPoint_.y ); + isTransformDirty_ = isInverseDirty_ = YES; +#if CC_NODE_TRANSFORM_USING_AFFINE_MATRIX + isTransformGLDirty_ = YES; +#endif + } +} + +- (CGRect) boundingBox +{ + CGRect ret = [self boundingBoxInPixels]; + return CC_RECT_PIXELS_TO_POINTS( ret ); +} + +- (CGRect) boundingBoxInPixels +{ + CGRect rect = CGRectMake(0, 0, contentSizeInPixels_.width, contentSizeInPixels_.height); + return CGRectApplyAffineTransform(rect, [self nodeToParentTransform]); +} + +-(void) setVertexZ:(float)vertexZ +{ + vertexZ_ = vertexZ * CC_CONTENT_SCALE_FACTOR(); +} + +-(float) scale +{ + NSAssert( scaleX_ == scaleY_, @"CCNode#scale. ScaleX != ScaleY. Don't know which one to return"); + return scaleX_; +} + +-(void) setScale:(float) s +{ + scaleX_ = scaleY_ = s; + isTransformDirty_ = isInverseDirty_ = YES; +#if CC_NODE_TRANSFORM_USING_AFFINE_MATRIX + isTransformGLDirty_ = YES; +#endif +} + +#pragma mark CCNode - Init & cleanup + ++(id) node +{ + return [[[self alloc] init] autorelease]; +} + +-(id) init +{ + if ((self=[super init]) ) { + + isRunning_ = NO; + + skewX_ = skewY_ = 0.0f; + rotation_ = 0.0f; + scaleX_ = scaleY_ = 1.0f; + positionInPixels_ = position_ = CGPointZero; + anchorPointInPixels_ = anchorPoint_ = CGPointZero; + contentSizeInPixels_ = contentSize_ = CGSizeZero; + + + // "whole screen" objects. like Scenes and Layers, should set isRelativeAnchorPoint to NO + isRelativeAnchorPoint_ = YES; + + isTransformDirty_ = isInverseDirty_ = YES; +#if CC_NODE_TRANSFORM_USING_AFFINE_MATRIX + isTransformGLDirty_ = YES; +#endif + + vertexZ_ = 0; + + grid_ = nil; + + visible_ = YES; + + tag_ = kCCNodeTagInvalid; + + zOrder_ = 0; + + // lazy alloc + camera_ = nil; + + // children (lazy allocs) + children_ = nil; + + // userData is always inited as nil + userData_ = nil; + + //initialize parent to nil + parent_ = nil; + } + + return self; +} + +- (void)cleanup +{ + // actions + [self stopAllActions]; + [self unscheduleAllSelectors]; + + // timers + [children_ makeObjectsPerformSelector:@selector(cleanup)]; +} + +- (NSString*) description +{ + return [NSString stringWithFormat:@"<%@ = %08X | Tag = %i>", [self class], self, tag_]; +} + +- (void) dealloc +{ + CCLOGINFO( @"cocos2d: deallocing %@", self); + + // attributes + [camera_ release]; + + [grid_ release]; + + // children + CCNode *child; + CCARRAY_FOREACH(children_, child) + child.parent = nil; + + [children_ release]; + + [super dealloc]; +} + +#pragma mark CCNode Composition + +-(void) childrenAlloc +{ + children_ = [[CCArray alloc] initWithCapacity:4]; +} + +// camera: lazy alloc +-(CCCamera*) camera +{ + if( ! camera_ ) { + camera_ = [[CCCamera alloc] init]; + + // by default, center camera at the Sprite's anchor point + // [camera_ setCenterX:anchorPointInPixels_.x centerY:anchorPointInPixels_.y centerZ:0]; + // [camera_ setEyeX:anchorPointInPixels_.x eyeY:anchorPointInPixels_.y eyeZ:1]; + + // [camera_ setCenterX:0 centerY:0 centerZ:0]; + // [camera_ setEyeX:0 eyeY:0 eyeZ:1]; + + } + + return camera_; +} + +-(CCNode*) getChildByTag:(NSInteger) aTag +{ + NSAssert( aTag != kCCNodeTagInvalid, @"Invalid tag"); + + CCNode *node; + CCARRAY_FOREACH(children_, node){ + if( node.tag == aTag ) + return node; + } + // not found + return nil; +} + +/* "add" logic MUST only be on this method + * If a class want's to extend the 'addChild' behaviour it only needs + * to override this method + */ +-(void) addChild: (CCNode*) child z:(NSInteger)z tag:(NSInteger) aTag +{ + NSAssert( child != nil, @"Argument must be non-nil"); + NSAssert( child.parent == nil, @"child already added. It can't be added again"); + + if( ! children_ ) + [self childrenAlloc]; + + [self insertChild:child z:z]; + + child.tag = aTag; + + [child setParent: self]; + + if( isRunning_ ) { + [child onEnter]; + [child onEnterTransitionDidFinish]; + } +} + +-(void) addChild: (CCNode*) child z:(NSInteger)z +{ + NSAssert( child != nil, @"Argument must be non-nil"); + [self addChild:child z:z tag:child.tag]; +} + +-(void) addChild: (CCNode*) child +{ + NSAssert( child != nil, @"Argument must be non-nil"); + [self addChild:child z:child.zOrder tag:child.tag]; +} + +-(void) removeFromParentAndCleanup:(BOOL)cleanup +{ + [parent_ removeChild:self cleanup:cleanup]; +} + +/* "remove" logic MUST only be on this method + * If a class want's to extend the 'removeChild' behavior it only needs + * to override this method + */ +-(void) removeChild: (CCNode*)child cleanup:(BOOL)cleanup +{ + // explicit nil handling + if (child == nil) + return; + + if ( [children_ containsObject:child] ) + [self detachChild:child cleanup:cleanup]; +} + +-(void) removeChildByTag:(NSInteger)aTag cleanup:(BOOL)cleanup +{ + NSAssert( aTag != kCCNodeTagInvalid, @"Invalid tag"); + + CCNode *child = [self getChildByTag:aTag]; + + if (child == nil) + CCLOG(@"cocos2d: removeChildByTag: child not found!"); + else + [self removeChild:child cleanup:cleanup]; +} + +-(void) removeAllChildrenWithCleanup:(BOOL)cleanup +{ + // not using detachChild improves speed here + CCNode *c; + CCARRAY_FOREACH(children_, c) + { + // IMPORTANT: + // -1st do onExit + // -2nd cleanup + if (isRunning_) + [c onExit]; + + if (cleanup) + [c cleanup]; + + // set parent nil at the end (issue #476) + [c setParent:nil]; + } + + [children_ removeAllObjects]; +} + +-(void) detachChild:(CCNode *)child cleanup:(BOOL)doCleanup +{ + // IMPORTANT: + // -1st do onExit + // -2nd cleanup + if (isRunning_) + [child onExit]; + + // If you don't do cleanup, the child's actions will not get removed and the + // its scheduledSelectors_ dict will not get released! + if (doCleanup) + [child cleanup]; + + // set parent nil at the end (issue #476) + [child setParent:nil]; + + [children_ removeObject:child]; +} + +// used internally to alter the zOrder variable. DON'T call this method manually +-(void) _setZOrder:(NSInteger) z +{ + zOrder_ = z; +} + +// helper used by reorderChild & add +-(void) insertChild:(CCNode*)child z:(NSInteger)z +{ + NSUInteger index=0; + CCNode *a = [children_ lastObject]; + + // quick comparison to improve performance + if (!a || a.zOrder <= z) + [children_ addObject:child]; + + else + { + CCARRAY_FOREACH(children_, a) { + if ( a.zOrder > z ) { + [children_ insertObject:child atIndex:index]; + break; + } + index++; + } + } + + [child _setZOrder:z]; +} + +-(void) reorderChild:(CCNode*) child z:(NSInteger)z +{ + NSAssert( child != nil, @"Child must be non-nil"); + + [child retain]; + [children_ removeObject:child]; + + [self insertChild:child z:z]; + + [child release]; +} + +#pragma mark CCNode Draw + +-(void) draw +{ + // override me + // Only use this function to draw your staff. + // DON'T draw your stuff outside this method +} + +-(void) visit +{ + // quick return if not visible + if (!visible_) + return; + + glPushMatrix(); + + if ( grid_ && grid_.active) { + [grid_ beforeDraw]; + [self transformAncestors]; + } + + [self transform]; + + if(children_) { + ccArray *arrayData = children_->data; + NSUInteger i = 0; + + // draw children zOrder < 0 + for( ; i < arrayData->num; i++ ) { + CCNode *child = arrayData->arr[i]; + if ( [child zOrder] < 0 ) + [child visit]; + else + break; + } + + // self draw + [self draw]; + + // draw children zOrder >= 0 + for( ; i < arrayData->num; i++ ) { + CCNode *child = arrayData->arr[i]; + [child visit]; + } + + } else + [self draw]; + + if ( grid_ && grid_.active) + [grid_ afterDraw:self]; + + glPopMatrix(); +} + +#pragma mark CCNode - Transformations + +-(void) transformAncestors +{ + if( parent_ ) { + [parent_ transformAncestors]; + [parent_ transform]; + } +} + +-(void) transform +{ + // transformations + +#if CC_NODE_TRANSFORM_USING_AFFINE_MATRIX + // BEGIN alternative -- using cached transform + // + if( isTransformGLDirty_ ) { + CGAffineTransform t = [self nodeToParentTransform]; + CGAffineToGL(&t, transformGL_); + isTransformGLDirty_ = NO; + } + + glMultMatrixf(transformGL_); + if( vertexZ_ ) + glTranslatef(0, 0, vertexZ_); + + // XXX: Expensive calls. Camera should be integrated into the cached affine matrix + if ( camera_ && !(grid_ && grid_.active) ) + { + BOOL translate = (anchorPointInPixels_.x != 0.0f || anchorPointInPixels_.y != 0.0f); + + if( translate ) + ccglTranslate(RENDER_IN_SUBPIXEL(anchorPointInPixels_.x), RENDER_IN_SUBPIXEL(anchorPointInPixels_.y), 0); + + [camera_ locate]; + + if( translate ) + ccglTranslate(RENDER_IN_SUBPIXEL(-anchorPointInPixels_.x), RENDER_IN_SUBPIXEL(-anchorPointInPixels_.y), 0); + } + + + // END alternative + +#else + // BEGIN original implementation + // + // translate + if ( isRelativeAnchorPoint_ && (anchorPointInPixels_.x != 0 || anchorPointInPixels_.y != 0 ) ) + glTranslatef( RENDER_IN_SUBPIXEL(-anchorPointInPixels_.x), RENDER_IN_SUBPIXEL(-anchorPointInPixels_.y), 0); + + if (anchorPointInPixels_.x != 0 || anchorPointInPixels_.y != 0) + glTranslatef( RENDER_IN_SUBPIXEL(positionInPixels_.x + anchorPointInPixels_.x), RENDER_IN_SUBPIXEL(positionInPixels_.y + anchorPointInPixels_.y), vertexZ_); + else if ( positionInPixels_.x !=0 || positionInPixels_.y !=0 || vertexZ_ != 0) + glTranslatef( RENDER_IN_SUBPIXEL(positionInPixels_.x), RENDER_IN_SUBPIXEL(positionInPixels_.y), vertexZ_ ); + + // rotate + if (rotation_ != 0.0f ) + glRotatef( -rotation_, 0.0f, 0.0f, 1.0f ); + + // skew + if ( (skewX_ != 0.0f) || (skewY_ != 0.0f) ) { + CGAffineTransform skewMatrix = CGAffineTransformMake( 1.0f, tanf(CC_DEGREES_TO_RADIANS(skewY_)), tanf(CC_DEGREES_TO_RADIANS(skewX_)), 1.0f, 0.0f, 0.0f ); + GLfloat glMatrix[16]; + CGAffineToGL(&skewMatrix, glMatrix); + glMultMatrixf(glMatrix); + } + + // scale + if (scaleX_ != 1.0f || scaleY_ != 1.0f) + glScalef( scaleX_, scaleY_, 1.0f ); + + if ( camera_ && !(grid_ && grid_.active) ) + [camera_ locate]; + + // restore and re-position point + if (anchorPointInPixels_.x != 0.0f || anchorPointInPixels_.y != 0.0f) + glTranslatef(RENDER_IN_SUBPIXEL(-anchorPointInPixels_.x), RENDER_IN_SUBPIXEL(-anchorPointInPixels_.y), 0); + + // + // END original implementation +#endif + +} + +#pragma mark CCNode SceneManagement + +-(void) onEnter +{ + [children_ makeObjectsPerformSelector:@selector(onEnter)]; + [self resumeSchedulerAndActions]; + + isRunning_ = YES; +} + +-(void) onEnterTransitionDidFinish +{ + [children_ makeObjectsPerformSelector:@selector(onEnterTransitionDidFinish)]; +} + +-(void) onExit +{ + [self pauseSchedulerAndActions]; + isRunning_ = NO; + + [children_ makeObjectsPerformSelector:@selector(onExit)]; +} + +#pragma mark CCNode Actions + +-(CCAction*) runAction:(CCAction*) action +{ + NSAssert( action != nil, @"Argument must be non-nil"); + + [[CCActionManager sharedManager] addAction:action target:self paused:!isRunning_]; + return action; +} + +-(void) stopAllActions +{ + [[CCActionManager sharedManager] removeAllActionsFromTarget:self]; +} + +-(void) stopAction: (CCAction*) action +{ + [[CCActionManager sharedManager] removeAction:action]; +} + +-(void) stopActionByTag:(NSInteger)aTag +{ + NSAssert( aTag != kCCActionTagInvalid, @"Invalid tag"); + [[CCActionManager sharedManager] removeActionByTag:aTag target:self]; +} + +-(CCAction*) getActionByTag:(NSInteger) aTag +{ + NSAssert( aTag != kCCActionTagInvalid, @"Invalid tag"); + return [[CCActionManager sharedManager] getActionByTag:aTag target:self]; +} + +-(NSUInteger) numberOfRunningActions +{ + return [[CCActionManager sharedManager] numberOfRunningActionsInTarget:self]; +} + +#pragma mark CCNode - Scheduler + +-(void) scheduleUpdate +{ + [self scheduleUpdateWithPriority:0]; +} + +-(void) scheduleUpdateWithPriority:(NSInteger)priority +{ + [[CCScheduler sharedScheduler] scheduleUpdateForTarget:self priority:priority paused:!isRunning_]; +} + +-(void) unscheduleUpdate +{ + [[CCScheduler sharedScheduler] unscheduleUpdateForTarget:self]; +} + +-(void) schedule:(SEL)selector +{ + [self schedule:selector interval:0]; +} + +-(void) schedule:(SEL)selector interval:(ccTime)interval +{ + NSAssert( selector != nil, @"Argument must be non-nil"); + NSAssert( interval >=0, @"Arguemnt must be positive"); + + [[CCScheduler sharedScheduler] scheduleSelector:selector forTarget:self interval:interval paused:!isRunning_]; +} + +-(void) unschedule:(SEL)selector +{ + // explicit nil handling + if (selector == nil) + return; + + [[CCScheduler sharedScheduler] unscheduleSelector:selector forTarget:self]; +} + +-(void) unscheduleAllSelectors +{ + [[CCScheduler sharedScheduler] unscheduleAllSelectorsForTarget:self]; +} +- (void) resumeSchedulerAndActions +{ + [[CCScheduler sharedScheduler] resumeTarget:self]; + [[CCActionManager sharedManager] resumeTarget:self]; +} + +- (void) pauseSchedulerAndActions +{ + [[CCScheduler sharedScheduler] pauseTarget:self]; + [[CCActionManager sharedManager] pauseTarget:self]; +} + +#pragma mark CCNode Transform + +- (CGAffineTransform)nodeToParentTransform +{ + if ( isTransformDirty_ ) { + + transform_ = CGAffineTransformIdentity; + + if ( !isRelativeAnchorPoint_ && !CGPointEqualToPoint(anchorPointInPixels_, CGPointZero) ) + transform_ = CGAffineTransformTranslate(transform_, anchorPointInPixels_.x, anchorPointInPixels_.y); + + if( ! CGPointEqualToPoint(positionInPixels_, CGPointZero) ) + transform_ = CGAffineTransformTranslate(transform_, positionInPixels_.x, positionInPixels_.y); + + if( rotation_ != 0 ) + transform_ = CGAffineTransformRotate(transform_, -CC_DEGREES_TO_RADIANS(rotation_)); + + if( skewX_ != 0 || skewY_ != 0 ) { + // create a skewed coordinate system + CGAffineTransform skew = CGAffineTransformMake(1.0f, tanf(CC_DEGREES_TO_RADIANS(skewY_)), tanf(CC_DEGREES_TO_RADIANS(skewX_)), 1.0f, 0.0f, 0.0f); + // apply the skew to the transform + transform_ = CGAffineTransformConcat(skew, transform_); + } + + if( ! (scaleX_ == 1 && scaleY_ == 1) ) + transform_ = CGAffineTransformScale(transform_, scaleX_, scaleY_); + + if( ! CGPointEqualToPoint(anchorPointInPixels_, CGPointZero) ) + transform_ = CGAffineTransformTranslate(transform_, -anchorPointInPixels_.x, -anchorPointInPixels_.y); + + isTransformDirty_ = NO; + } + + return transform_; +} + +- (CGAffineTransform)parentToNodeTransform +{ + if ( isInverseDirty_ ) { + inverse_ = CGAffineTransformInvert([self nodeToParentTransform]); + isInverseDirty_ = NO; + } + + return inverse_; +} + +- (CGAffineTransform)nodeToWorldTransform +{ + CGAffineTransform t = [self nodeToParentTransform]; + + for (CCNode *p = parent_; p != nil; p = p.parent) + t = CGAffineTransformConcat(t, [p nodeToParentTransform]); + + return t; +} + +- (CGAffineTransform)worldToNodeTransform +{ + return CGAffineTransformInvert([self nodeToWorldTransform]); +} + +- (CGPoint)convertToNodeSpace:(CGPoint)worldPoint +{ + CGPoint ret; + if( CC_CONTENT_SCALE_FACTOR() == 1 ) + ret = CGPointApplyAffineTransform(worldPoint, [self worldToNodeTransform]); + else { + ret = ccpMult( worldPoint, CC_CONTENT_SCALE_FACTOR() ); + ret = CGPointApplyAffineTransform(ret, [self worldToNodeTransform]); + ret = ccpMult( ret, 1/CC_CONTENT_SCALE_FACTOR() ); + } + + return ret; +} + +- (CGPoint)convertToWorldSpace:(CGPoint)nodePoint +{ + CGPoint ret; + if( CC_CONTENT_SCALE_FACTOR() == 1 ) + ret = CGPointApplyAffineTransform(nodePoint, [self nodeToWorldTransform]); + else { + ret = ccpMult( nodePoint, CC_CONTENT_SCALE_FACTOR() ); + ret = CGPointApplyAffineTransform(ret, [self nodeToWorldTransform]); + ret = ccpMult( ret, 1/CC_CONTENT_SCALE_FACTOR() ); + } + + return ret; +} + +- (CGPoint)convertToNodeSpaceAR:(CGPoint)worldPoint +{ + CGPoint nodePoint = [self convertToNodeSpace:worldPoint]; + CGPoint anchorInPoints; + if( CC_CONTENT_SCALE_FACTOR() == 1 ) + anchorInPoints = anchorPointInPixels_; + else + anchorInPoints = ccpMult( anchorPointInPixels_, 1/CC_CONTENT_SCALE_FACTOR() ); + + return ccpSub(nodePoint, anchorInPoints); +} + +- (CGPoint)convertToWorldSpaceAR:(CGPoint)nodePoint +{ + CGPoint anchorInPoints; + if( CC_CONTENT_SCALE_FACTOR() == 1 ) + anchorInPoints = anchorPointInPixels_; + else + anchorInPoints = ccpMult( anchorPointInPixels_, 1/CC_CONTENT_SCALE_FACTOR() ); + + nodePoint = ccpAdd(nodePoint, anchorInPoints); + return [self convertToWorldSpace:nodePoint]; +} + +- (CGPoint)convertToWindowSpace:(CGPoint)nodePoint +{ + CGPoint worldPoint = [self convertToWorldSpace:nodePoint]; + return [[CCDirector sharedDirector] convertToUI:worldPoint]; +} + +// convenience methods which take a UITouch instead of CGPoint + +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED + +- (CGPoint)convertTouchToNodeSpace:(UITouch *)touch +{ + CGPoint point = [touch locationInView: [touch view]]; + point = [[CCDirector sharedDirector] convertToGL: point]; + return [self convertToNodeSpace:point]; +} + +- (CGPoint)convertTouchToNodeSpaceAR:(UITouch *)touch +{ + CGPoint point = [touch locationInView: [touch view]]; + point = [[CCDirector sharedDirector] convertToGL: point]; + return [self convertToNodeSpaceAR:point]; +} + +#endif // __IPHONE_OS_VERSION_MAX_ALLOWED + + +@end diff --git a/libs/cocos2d/CCParallaxNode.h b/libs/cocos2d/CCParallaxNode.h new file mode 100755 index 0000000..5728eb1 --- /dev/null +++ b/libs/cocos2d/CCParallaxNode.h @@ -0,0 +1,50 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2009-2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + +#import "CCNode.h" +#import "Support/ccCArray.h" + +/** CCParallaxNode: A node that simulates a parallax scroller + + The children will be moved faster / slower than the parent according the the parallax ratio. + + */ +@interface CCParallaxNode : CCNode +{ + ccArray *parallaxArray_; + CGPoint lastPosition; +} + +/** array that holds the offset / ratio of the children */ +@property (nonatomic,readwrite) ccArray * parallaxArray; + +/** Adds a child to the container with a z-order, a parallax ratio and a position offset + It returns self, so you can chain several addChilds. + @since v0.8 + */ +-(void) addChild: (CCNode*)node z:(NSInteger)z parallaxRatio:(CGPoint)c positionOffset:(CGPoint)positionOffset; + +@end diff --git a/libs/cocos2d/CCParallaxNode.m b/libs/cocos2d/CCParallaxNode.m new file mode 100755 index 0000000..9d39cc8 --- /dev/null +++ b/libs/cocos2d/CCParallaxNode.m @@ -0,0 +1,161 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2009-2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + +#import "CCParallaxNode.h" +#import "Support/CGPointExtension.h" +#import "Support/ccCArray.h" + +@interface CGPointObject : NSObject +{ + CGPoint ratio_; + CGPoint offset_; + CCNode *child_; // weak ref +} +@property (readwrite) CGPoint ratio; +@property (readwrite) CGPoint offset; +@property (readwrite,assign) CCNode *child; ++(id) pointWithCGPoint:(CGPoint)point offset:(CGPoint)offset; +-(id) initWithCGPoint:(CGPoint)point offset:(CGPoint)offset; +@end +@implementation CGPointObject +@synthesize ratio = ratio_; +@synthesize offset = offset_; +@synthesize child=child_; + ++(id) pointWithCGPoint:(CGPoint)ratio offset:(CGPoint)offset +{ + return [[[self alloc] initWithCGPoint:ratio offset:offset] autorelease]; +} +-(id) initWithCGPoint:(CGPoint)ratio offset:(CGPoint)offset +{ + if( (self=[super init])) { + ratio_ = ratio; + offset_ = offset; + } + return self; +} +@end + +@implementation CCParallaxNode + +@synthesize parallaxArray = parallaxArray_; + +-(id) init +{ + if( (self=[super init]) ) { + parallaxArray_ = ccArrayNew(5); + lastPosition = CGPointMake(-100,-100); + } + return self; +} + +- (void) dealloc +{ + if( parallaxArray_ ) { + ccArrayFree(parallaxArray_); + parallaxArray_ = nil; + } + [super dealloc]; +} + +-(void) addChild:(CCNode*)child z:(NSInteger)z tag:(NSInteger)tag +{ + NSAssert(NO,@"ParallaxNode: use addChild:z:parallaxRatio:positionOffset instead"); +} + +-(void) addChild: (CCNode*) child z:(NSInteger)z parallaxRatio:(CGPoint)ratio positionOffset:(CGPoint)offset +{ + NSAssert( child != nil, @"Argument must be non-nil"); + CGPointObject *obj = [CGPointObject pointWithCGPoint:ratio offset:offset]; + obj.child = child; + ccArrayAppendObjectWithResize(parallaxArray_, obj); + + CGPoint pos = self.position; + pos.x = pos.x * ratio.x + offset.x; + pos.y = pos.y * ratio.y + offset.y; + child.position = pos; + + [super addChild: child z:z tag:child.tag]; +} + +-(void) removeChild:(CCNode*)node cleanup:(BOOL)cleanup +{ + for( unsigned int i=0;i < parallaxArray_->num;i++) { + CGPointObject *point = parallaxArray_->arr[i]; + if( [point.child isEqual:node] ) { + ccArrayRemoveObjectAtIndex(parallaxArray_, i); + break; + } + } + [super removeChild:node cleanup:cleanup]; +} + +-(void) removeAllChildrenWithCleanup:(BOOL)cleanup +{ + ccArrayRemoveAllObjects(parallaxArray_); + [super removeAllChildrenWithCleanup:cleanup]; +} + +-(CGPoint) absolutePosition_ +{ + CGPoint ret = position_; + + CCNode *cn = self; + + while (cn.parent != nil) { + cn = cn.parent; + ret = ccpAdd( ret, cn.position ); + } + + return ret; +} + +/* + The positions are updated at visit because: + - using a timer is not guaranteed that it will called after all the positions were updated + - overriding "draw" will only precise if the children have a z > 0 +*/ +-(void) visit +{ +// CGPoint pos = position_; +// CGPoint pos = [self convertToWorldSpace:CGPointZero]; + CGPoint pos = [self absolutePosition_]; + if( ! CGPointEqualToPoint(pos, lastPosition) ) { + + for(unsigned int i=0; i < parallaxArray_->num; i++ ) { + + CGPointObject *point = parallaxArray_->arr[i]; + float x = -pos.x + pos.x * point.ratio.x + point.offset.x; + float y = -pos.y + pos.y * point.ratio.y + point.offset.y; + point.child.position = ccp(x,y); + } + + lastPosition = pos; + } + + [super visit]; +} +@end diff --git a/libs/cocos2d/CCParticleExamples.h b/libs/cocos2d/CCParticleExamples.h new file mode 100755 index 0000000..cd382c4 --- /dev/null +++ b/libs/cocos2d/CCParticleExamples.h @@ -0,0 +1,111 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2008-2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + + +#import + +#import "CCParticleSystemPoint.h" +#import "CCParticleSystemQuad.h" + +// build each architecture with the optimal particle system + +// ARMv7, Mac or Simulator use "Quad" particle +#if defined(__ARM_NEON__) || defined(__MAC_OS_X_VERSION_MAX_ALLOWED) || TARGET_IPHONE_SIMULATOR + #define ARCH_OPTIMAL_PARTICLE_SYSTEM CCParticleSystemQuad + +// ARMv6 use "Point" particle +#elif __arm__ + #define ARCH_OPTIMAL_PARTICLE_SYSTEM CCParticleSystemPoint +#else + #error(unknown architecture) +#endif + + +//! A fire particle system +@interface CCParticleFire: ARCH_OPTIMAL_PARTICLE_SYSTEM +{ +} +@end + +//! A fireworks particle system +@interface CCParticleFireworks : ARCH_OPTIMAL_PARTICLE_SYSTEM +{ +} +@end + +//! A sun particle system +@interface CCParticleSun : ARCH_OPTIMAL_PARTICLE_SYSTEM +{ +} +@end + +//! A galaxy particle system +@interface CCParticleGalaxy : ARCH_OPTIMAL_PARTICLE_SYSTEM +{ +} +@end + +//! A flower particle system +@interface CCParticleFlower : ARCH_OPTIMAL_PARTICLE_SYSTEM +{ +} +@end + +//! A meteor particle system +@interface CCParticleMeteor : ARCH_OPTIMAL_PARTICLE_SYSTEM +{ +} +@end + +//! An spiral particle system +@interface CCParticleSpiral : ARCH_OPTIMAL_PARTICLE_SYSTEM +{ +} +@end + +//! An explosion particle system +@interface CCParticleExplosion : ARCH_OPTIMAL_PARTICLE_SYSTEM +{ +} +@end + +//! An smoke particle system +@interface CCParticleSmoke : ARCH_OPTIMAL_PARTICLE_SYSTEM +{ +} +@end + +//! An snow particle system +@interface CCParticleSnow : ARCH_OPTIMAL_PARTICLE_SYSTEM +{ +} +@end + +//! A rain particle system +@interface CCParticleRain : ARCH_OPTIMAL_PARTICLE_SYSTEM +{ +} +@end diff --git a/libs/cocos2d/CCParticleExamples.m b/libs/cocos2d/CCParticleExamples.m new file mode 100755 index 0000000..38c8b46 --- /dev/null +++ b/libs/cocos2d/CCParticleExamples.m @@ -0,0 +1,926 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2008-2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + + +// cocos2d +#import "CCParticleExamples.h" +#import "CCTextureCache.h" +#import "CCDirector.h" +#import "Support/CGPointExtension.h" + +// +// ParticleFireworks +// +@implementation CCParticleFireworks +-(id) init +{ + return [self initWithTotalParticles:1500]; +} + +-(id) initWithTotalParticles:(NSUInteger)p +{ + if( (self=[super initWithTotalParticles:p]) ) { + // duration + duration = kCCParticleDurationInfinity; + + // Gravity Mode + self.emitterMode = kCCParticleModeGravity; + + // Gravity Mode: gravity + self.gravity = ccp(0,-90); + + // Gravity Mode: radial + self.radialAccel = 0; + self.radialAccelVar = 0; + + // Gravity Mode: speed of particles + self.speed = 180; + self.speedVar = 50; + + // emitter position + CGSize winSize = [[CCDirector sharedDirector] winSize]; + self.position = ccp(winSize.width/2, winSize.height/2); + + // angle + angle = 90; + angleVar = 20; + + // life of particles + life = 3.5f; + lifeVar = 1; + + // emits per frame + emissionRate = totalParticles/life; + + // color of particles + startColor.r = 0.5f; + startColor.g = 0.5f; + startColor.b = 0.5f; + startColor.a = 1.0f; + startColorVar.r = 0.5f; + startColorVar.g = 0.5f; + startColorVar.b = 0.5f; + startColorVar.a = 0.1f; + endColor.r = 0.1f; + endColor.g = 0.1f; + endColor.b = 0.1f; + endColor.a = 0.2f; + endColorVar.r = 0.1f; + endColorVar.g = 0.1f; + endColorVar.b = 0.1f; + endColorVar.a = 0.2f; + + // size, in pixels + startSize = 8.0f; + startSizeVar = 2.0f; + endSize = kCCParticleStartSizeEqualToEndSize; + + self.texture = [[CCTextureCache sharedTextureCache] addImage: @"fire.png"]; + + // additive + self.blendAdditive = NO; + } + + return self; +} +@end + +// +// ParticleFire +// +@implementation CCParticleFire +-(id) init +{ + return [self initWithTotalParticles:250]; +} + +-(id) initWithTotalParticles:(NSUInteger) p +{ + if( (self=[super initWithTotalParticles:p]) ) { + + // duration + duration = kCCParticleDurationInfinity; + + // Gravity Mode + self.emitterMode = kCCParticleModeGravity; + + // Gravity Mode: gravity + self.gravity = ccp(0,0); + + // Gravity Mode: radial acceleration + self.radialAccel = 0; + self.radialAccelVar = 0; + + // Gravity Mode: speed of particles + self.speed = 60; + self.speedVar = 20; + + // starting angle + angle = 90; + angleVar = 10; + + // emitter position + CGSize winSize = [[CCDirector sharedDirector] winSize]; + self.position = ccp(winSize.width/2, 60); + posVar = ccp(40, 20); + + // life of particles + life = 3; + lifeVar = 0.25f; + + + // size, in pixels + startSize = 54.0f; + startSizeVar = 10.0f; + endSize = kCCParticleStartSizeEqualToEndSize; + + // emits per frame + emissionRate = totalParticles/life; + + // color of particles + startColor.r = 0.76f; + startColor.g = 0.25f; + startColor.b = 0.12f; + startColor.a = 1.0f; + startColorVar.r = 0.0f; + startColorVar.g = 0.0f; + startColorVar.b = 0.0f; + startColorVar.a = 0.0f; + endColor.r = 0.0f; + endColor.g = 0.0f; + endColor.b = 0.0f; + endColor.a = 1.0f; + endColorVar.r = 0.0f; + endColorVar.g = 0.0f; + endColorVar.b = 0.0f; + endColorVar.a = 0.0f; + + self.texture = [[CCTextureCache sharedTextureCache] addImage: @"fire.png"]; + + // additive + self.blendAdditive = YES; + } + + return self; +} +@end + +// +// ParticleSun +// +@implementation CCParticleSun +-(id) init +{ + return [self initWithTotalParticles:350]; +} + +-(id) initWithTotalParticles:(NSUInteger) p +{ + if( (self=[super initWithTotalParticles:p]) ) { + + // additive + self.blendAdditive = YES; + + // duration + duration = kCCParticleDurationInfinity; + + // Gravity Mode + self.emitterMode = kCCParticleModeGravity; + + // Gravity Mode: gravity + self.gravity = ccp(0,0); + + // Gravity mode: radial acceleration + self.radialAccel = 0; + self.radialAccelVar = 0; + + // Gravity mode: speed of particles + self.speed = 20; + self.speedVar = 5; + + + // angle + angle = 90; + angleVar = 360; + + // emitter position + CGSize winSize = [[CCDirector sharedDirector] winSize]; + self.position = ccp(winSize.width/2, winSize.height/2); + posVar = CGPointZero; + + // life of particles + life = 1; + lifeVar = 0.5f; + + // size, in pixels + startSize = 30.0f; + startSizeVar = 10.0f; + endSize = kCCParticleStartSizeEqualToEndSize; + + // emits per seconds + emissionRate = totalParticles/life; + + // color of particles + startColor.r = 0.76f; + startColor.g = 0.25f; + startColor.b = 0.12f; + startColor.a = 1.0f; + startColorVar.r = 0.0f; + startColorVar.g = 0.0f; + startColorVar.b = 0.0f; + startColorVar.a = 0.0f; + endColor.r = 0.0f; + endColor.g = 0.0f; + endColor.b = 0.0f; + endColor.a = 1.0f; + endColorVar.r = 0.0f; + endColorVar.g = 0.0f; + endColorVar.b = 0.0f; + endColorVar.a = 0.0f; + + self.texture = [[CCTextureCache sharedTextureCache] addImage: @"fire.png"]; + } + + return self; +} +@end + +// +// ParticleGalaxy +// +@implementation CCParticleGalaxy +-(id) init +{ + return [self initWithTotalParticles:200]; +} + +-(id) initWithTotalParticles:(NSUInteger)p +{ + if( (self=[super initWithTotalParticles:p]) ) { + + // duration + duration = kCCParticleDurationInfinity; + + // Gravity Mode + self.emitterMode = kCCParticleModeGravity; + + // Gravity Mode: gravity + self.gravity = ccp(0,0); + + // Gravity Mode: speed of particles + self.speed = 60; + self.speedVar = 10; + + // Gravity Mode: radial + self.radialAccel = -80; + self.radialAccelVar = 0; + + // Gravity Mode: tagential + self.tangentialAccel = 80; + self.tangentialAccelVar = 0; + + // angle + angle = 90; + angleVar = 360; + + // emitter position + CGSize winSize = [[CCDirector sharedDirector] winSize]; + self.position = ccp(winSize.width/2, winSize.height/2); + posVar = CGPointZero; + + // life of particles + life = 4; + lifeVar = 1; + + // size, in pixels + startSize = 37.0f; + startSizeVar = 10.0f; + endSize = kCCParticleStartSizeEqualToEndSize; + + // emits per second + emissionRate = totalParticles/life; + + // color of particles + startColor.r = 0.12f; + startColor.g = 0.25f; + startColor.b = 0.76f; + startColor.a = 1.0f; + startColorVar.r = 0.0f; + startColorVar.g = 0.0f; + startColorVar.b = 0.0f; + startColorVar.a = 0.0f; + endColor.r = 0.0f; + endColor.g = 0.0f; + endColor.b = 0.0f; + endColor.a = 1.0f; + endColorVar.r = 0.0f; + endColorVar.g = 0.0f; + endColorVar.b = 0.0f; + endColorVar.a = 0.0f; + + self.texture = [[CCTextureCache sharedTextureCache] addImage: @"fire.png"]; + + // additive + self.blendAdditive = YES; + } + + return self; +} +@end + +// +// ParticleFlower +// +@implementation CCParticleFlower +-(id) init +{ + return [self initWithTotalParticles:250]; +} + +-(id) initWithTotalParticles:(NSUInteger) p +{ + if( (self=[super initWithTotalParticles:p]) ) { + + // duration + duration = kCCParticleDurationInfinity; + + // Gravity Mode + self.emitterMode = kCCParticleModeGravity; + + // Gravity Mode: gravity + self.gravity = ccp(0,0); + + // Gravity Mode: speed of particles + self.speed = 80; + self.speedVar = 10; + + // Gravity Mode: radial + self.radialAccel = -60; + self.radialAccelVar = 0; + + // Gravity Mode: tagential + self.tangentialAccel = 15; + self.tangentialAccelVar = 0; + + // angle + angle = 90; + angleVar = 360; + + // emitter position + CGSize winSize = [[CCDirector sharedDirector] winSize]; + self.position = ccp(winSize.width/2, winSize.height/2); + posVar = CGPointZero; + + // life of particles + life = 4; + lifeVar = 1; + + // size, in pixels + startSize = 30.0f; + startSizeVar = 10.0f; + endSize = kCCParticleStartSizeEqualToEndSize; + + // emits per second + emissionRate = totalParticles/life; + + // color of particles + startColor.r = 0.50f; + startColor.g = 0.50f; + startColor.b = 0.50f; + startColor.a = 1.0f; + startColorVar.r = 0.5f; + startColorVar.g = 0.5f; + startColorVar.b = 0.5f; + startColorVar.a = 0.5f; + endColor.r = 0.0f; + endColor.g = 0.0f; + endColor.b = 0.0f; + endColor.a = 1.0f; + endColorVar.r = 0.0f; + endColorVar.g = 0.0f; + endColorVar.b = 0.0f; + endColorVar.a = 0.0f; + + self.texture = [[CCTextureCache sharedTextureCache] addImage: @"fire.png"]; + + // additive + self.blendAdditive = YES; + } + + return self; +} +@end + +// +// ParticleMeteor +// +@implementation CCParticleMeteor +-(id) init +{ + return [self initWithTotalParticles:150]; +} + +-(id) initWithTotalParticles:(NSUInteger) p +{ + if( (self=[super initWithTotalParticles:p]) ) { + + // duration + duration = kCCParticleDurationInfinity; + + // Gravity Mode + self.emitterMode = kCCParticleModeGravity; + + // Gravity Mode: gravity + self.gravity = ccp(-200,200); + + // Gravity Mode: speed of particles + self.speed = 15; + self.speedVar = 5; + + // Gravity Mode: radial + self.radialAccel = 0; + self.radialAccelVar = 0; + + // Gravity Mode: tagential + self.tangentialAccel = 0; + self.tangentialAccelVar = 0; + + // angle + angle = 90; + angleVar = 360; + + // emitter position + CGSize winSize = [[CCDirector sharedDirector] winSize]; + self.position = ccp(winSize.width/2, winSize.height/2); + posVar = CGPointZero; + + // life of particles + life = 2; + lifeVar = 1; + + // size, in pixels + startSize = 60.0f; + startSizeVar = 10.0f; + endSize = kCCParticleStartSizeEqualToEndSize; + + // emits per second + emissionRate = totalParticles/life; + + // color of particles + startColor.r = 0.2f; + startColor.g = 0.4f; + startColor.b = 0.7f; + startColor.a = 1.0f; + startColorVar.r = 0.0f; + startColorVar.g = 0.0f; + startColorVar.b = 0.2f; + startColorVar.a = 0.1f; + endColor.r = 0.0f; + endColor.g = 0.0f; + endColor.b = 0.0f; + endColor.a = 1.0f; + endColorVar.r = 0.0f; + endColorVar.g = 0.0f; + endColorVar.b = 0.0f; + endColorVar.a = 0.0f; + + self.texture = [[CCTextureCache sharedTextureCache] addImage: @"fire.png"]; + + // additive + self.blendAdditive = YES; + } + + return self; +} +@end + +// +// ParticleSpiral +// +@implementation CCParticleSpiral +-(id) init +{ + return [self initWithTotalParticles:500]; +} + +-(id) initWithTotalParticles:(NSUInteger) p +{ + if( (self=[super initWithTotalParticles:p]) ) { + + // duration + duration = kCCParticleDurationInfinity; + + // Gravity Mode + self.emitterMode = kCCParticleModeGravity; + + // Gravity Mode: gravity + self.gravity = ccp(0,0); + + // Gravity Mode: speed of particles + self.speed = 150; + self.speedVar = 0; + + // Gravity Mode: radial + self.radialAccel = -380; + self.radialAccelVar = 0; + + // Gravity Mode: tagential + self.tangentialAccel = 45; + self.tangentialAccelVar = 0; + + // angle + angle = 90; + angleVar = 0; + + // emitter position + CGSize winSize = [[CCDirector sharedDirector] winSize]; + self.position = ccp(winSize.width/2, winSize.height/2); + posVar = CGPointZero; + + // life of particles + life = 12; + lifeVar = 0; + + // size, in pixels + startSize = 20.0f; + startSizeVar = 0.0f; + endSize = kCCParticleStartSizeEqualToEndSize; + + // emits per second + emissionRate = totalParticles/life; + + // color of particles + startColor.r = 0.5f; + startColor.g = 0.5f; + startColor.b = 0.5f; + startColor.a = 1.0f; + startColorVar.r = 0.5f; + startColorVar.g = 0.5f; + startColorVar.b = 0.5f; + startColorVar.a = 0.0f; + endColor.r = 0.5f; + endColor.g = 0.5f; + endColor.b = 0.5f; + endColor.a = 1.0f; + endColorVar.r = 0.5f; + endColorVar.g = 0.5f; + endColorVar.b = 0.5f; + endColorVar.a = 0.0f; + + self.texture = [[CCTextureCache sharedTextureCache] addImage: @"fire.png"]; + + // additive + self.blendAdditive = NO; + } + + return self; +} +@end + +// +// ParticleExplosion +// +@implementation CCParticleExplosion +-(id) init +{ + return [self initWithTotalParticles:700]; +} + +-(id) initWithTotalParticles:(NSUInteger)p +{ + if( (self=[super initWithTotalParticles:p]) ) { + + // duration + duration = 0.1f; + + self.emitterMode = kCCParticleModeGravity; + + // Gravity Mode: gravity + self.gravity = ccp(0,0); + + // Gravity Mode: speed of particles + self.speed = 70; + self.speedVar = 40; + + // Gravity Mode: radial + self.radialAccel = 0; + self.radialAccelVar = 0; + + // Gravity Mode: tagential + self.tangentialAccel = 0; + self.tangentialAccelVar = 0; + + // angle + angle = 90; + angleVar = 360; + + // emitter position + CGSize winSize = [[CCDirector sharedDirector] winSize]; + self.position = ccp(winSize.width/2, winSize.height/2); + posVar = CGPointZero; + + // life of particles + life = 5.0f; + lifeVar = 2; + + // size, in pixels + startSize = 15.0f; + startSizeVar = 10.0f; + endSize = kCCParticleStartSizeEqualToEndSize; + + // emits per second + emissionRate = totalParticles/duration; + + // color of particles + startColor.r = 0.7f; + startColor.g = 0.1f; + startColor.b = 0.2f; + startColor.a = 1.0f; + startColorVar.r = 0.5f; + startColorVar.g = 0.5f; + startColorVar.b = 0.5f; + startColorVar.a = 0.0f; + endColor.r = 0.5f; + endColor.g = 0.5f; + endColor.b = 0.5f; + endColor.a = 0.0f; + endColorVar.r = 0.5f; + endColorVar.g = 0.5f; + endColorVar.b = 0.5f; + endColorVar.a = 0.0f; + + self.texture = [[CCTextureCache sharedTextureCache] addImage: @"fire.png"]; + + // additive + self.blendAdditive = NO; + } + + return self; +} +@end + +// +// ParticleSmoke +// +@implementation CCParticleSmoke +-(id) init +{ + return [self initWithTotalParticles:200]; +} + +-(id) initWithTotalParticles:(NSUInteger) p +{ + if( (self=[super initWithTotalParticles:p]) ) { + + // duration + duration = kCCParticleDurationInfinity; + + // Emitter mode: Gravity Mode + self.emitterMode = kCCParticleModeGravity; + + // Gravity Mode: gravity + self.gravity = ccp(0,0); + + // Gravity Mode: radial acceleration + self.radialAccel = 0; + self.radialAccelVar = 0; + + // Gravity Mode: speed of particles + self.speed = 25; + self.speedVar = 10; + + // angle + angle = 90; + angleVar = 5; + + // emitter position + CGSize winSize = [[CCDirector sharedDirector] winSize]; + self.position = ccp(winSize.width/2, 0); + posVar = ccp(20, 0); + + // life of particles + life = 4; + lifeVar = 1; + + // size, in pixels + startSize = 60.0f; + startSizeVar = 10.0f; + endSize = kCCParticleStartSizeEqualToEndSize; + + // emits per frame + emissionRate = totalParticles/life; + + // color of particles + startColor.r = 0.8f; + startColor.g = 0.8f; + startColor.b = 0.8f; + startColor.a = 1.0f; + startColorVar.r = 0.02f; + startColorVar.g = 0.02f; + startColorVar.b = 0.02f; + startColorVar.a = 0.0f; + endColor.r = 0.0f; + endColor.g = 0.0f; + endColor.b = 0.0f; + endColor.a = 1.0f; + endColorVar.r = 0.0f; + endColorVar.g = 0.0f; + endColorVar.b = 0.0f; + endColorVar.a = 0.0f; + + self.texture = [[CCTextureCache sharedTextureCache] addImage: @"fire.png"]; + + // additive + self.blendAdditive = NO; + } + + return self; +} +@end + +@implementation CCParticleSnow +-(id) init +{ + return [self initWithTotalParticles:700]; +} + +-(id) initWithTotalParticles:(NSUInteger)p +{ + if( (self=[super initWithTotalParticles:p]) ) { + + // duration + duration = kCCParticleDurationInfinity; + + // set gravity mode. + self.emitterMode = kCCParticleModeGravity; + + // Gravity Mode: gravity + self.gravity = ccp(0,-1); + + // Gravity Mode: speed of particles + self.speed = 5; + self.speedVar = 1; + + // Gravity Mode: radial + self.radialAccel = 0; + self.radialAccelVar = 1; + + // Gravity mode: tagential + self.tangentialAccel = 0; + self.tangentialAccelVar = 1; + + // emitter position + self.position = (CGPoint) { + [[CCDirector sharedDirector] winSize].width / 2, + [[CCDirector sharedDirector] winSize].height + 10 + }; + posVar = ccp( [[CCDirector sharedDirector] winSize].width / 2, 0 ); + + // angle + angle = -90; + angleVar = 5; + + // life of particles + life = 45; + lifeVar = 15; + + // size, in pixels + startSize = 10.0f; + startSizeVar = 5.0f; + endSize = kCCParticleStartSizeEqualToEndSize; + + // emits per second + emissionRate = 10; + + // color of particles + startColor.r = 1.0f; + startColor.g = 1.0f; + startColor.b = 1.0f; + startColor.a = 1.0f; + startColorVar.r = 0.0f; + startColorVar.g = 0.0f; + startColorVar.b = 0.0f; + startColorVar.a = 0.0f; + endColor.r = 1.0f; + endColor.g = 1.0f; + endColor.b = 1.0f; + endColor.a = 0.0f; + endColorVar.r = 0.0f; + endColorVar.g = 0.0f; + endColorVar.b = 0.0f; + endColorVar.a = 0.0f; + + self.texture = [[CCTextureCache sharedTextureCache] addImage: @"fire.png"]; + + // additive + self.blendAdditive = NO; + } + + return self; +} +@end + +@implementation CCParticleRain +-(id) init +{ + return [self initWithTotalParticles:1000]; +} + +-(id) initWithTotalParticles:(NSUInteger)p +{ + if( (self=[super initWithTotalParticles:p]) ) { + + // duration + duration = kCCParticleDurationInfinity; + + self.emitterMode = kCCParticleModeGravity; + + // Gravity Mode: gravity + self.gravity = ccp(10,-10); + + // Gravity Mode: radial + self.radialAccel = 0; + self.radialAccelVar = 1; + + // Gravity Mode: tagential + self.tangentialAccel = 0; + self.tangentialAccelVar = 1; + + // Gravity Mode: speed of particles + self.speed = 130; + self.speedVar = 30; + + // angle + angle = -90; + angleVar = 5; + + + // emitter position + self.position = (CGPoint) { + [[CCDirector sharedDirector] winSize].width / 2, + [[CCDirector sharedDirector] winSize].height + }; + posVar = ccp( [[CCDirector sharedDirector] winSize].width / 2, 0 ); + + // life of particles + life = 4.5f; + lifeVar = 0; + + // size, in pixels + startSize = 4.0f; + startSizeVar = 2.0f; + endSize = kCCParticleStartSizeEqualToEndSize; + + // emits per second + emissionRate = 20; + + // color of particles + startColor.r = 0.7f; + startColor.g = 0.8f; + startColor.b = 1.0f; + startColor.a = 1.0f; + startColorVar.r = 0.0f; + startColorVar.g = 0.0f; + startColorVar.b = 0.0f; + startColorVar.a = 0.0f; + endColor.r = 0.7f; + endColor.g = 0.8f; + endColor.b = 1.0f; + endColor.a = 0.5f; + endColorVar.r = 0.0f; + endColorVar.g = 0.0f; + endColorVar.b = 0.0f; + endColorVar.a = 0.0f; + + self.texture = [[CCTextureCache sharedTextureCache] addImage: @"fire.png"]; + + // additive + self.blendAdditive = NO; + } + + return self; +} +@end diff --git a/libs/cocos2d/CCParticleSystem.h b/libs/cocos2d/CCParticleSystem.h new file mode 100755 index 0000000..429e814 --- /dev/null +++ b/libs/cocos2d/CCParticleSystem.h @@ -0,0 +1,445 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2008-2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + + +#import "CCProtocols.h" +#import "CCNode.h" +#import "ccTypes.h" +#import "ccConfig.h" + +#if CC_ENABLE_PROFILERS +@class CCProfilingTimer; +#endif + +//* @enum +enum { + /** The Particle emitter lives forever */ + kCCParticleDurationInfinity = -1, + + /** The starting size of the particle is equal to the ending size */ + kCCParticleStartSizeEqualToEndSize = -1, + + /** The starting radius of the particle is equal to the ending radius */ + kCCParticleStartRadiusEqualToEndRadius = -1, + + // backward compatible + kParticleStartSizeEqualToEndSize = kCCParticleStartSizeEqualToEndSize, + kParticleDurationInfinity = kCCParticleDurationInfinity, +}; + +//* @enum +enum { + /** Gravity mode (A mode) */ + kCCParticleModeGravity, + + /** Radius mode (B mode) */ + kCCParticleModeRadius, +}; + + +/** @typedef tCCPositionType + possible types of particle positions + */ +typedef enum { + /** Living particles are attached to the world and are unaffected by emitter repositioning. */ + kCCPositionTypeFree, + + /** Living particles are attached to the world but will follow the emitter repositioning. + Use case: Attach an emitter to an sprite, and you want that the emitter follows the sprite. + */ + kCCPositionTypeRelative, + + /** Living particles are attached to the emitter and are translated along with it. */ + kCCPositionTypeGrouped, +}tCCPositionType; + +// backward compatible +enum { + kPositionTypeFree = kCCPositionTypeFree, + kPositionTypeGrouped = kCCPositionTypeGrouped, +}; + +/** @struct tCCParticle + Structure that contains the values of each particle + */ +typedef struct sCCParticle { + CGPoint pos; + CGPoint startPos; + + ccColor4F color; + ccColor4F deltaColor; + + float size; + float deltaSize; + + float rotation; + float deltaRotation; + + ccTime timeToLive; + + union { + // Mode A: gravity, direction, radial accel, tangential accel + struct { + CGPoint dir; + float radialAccel; + float tangentialAccel; + } A; + + // Mode B: radius mode + struct { + float angle; + float degreesPerSecond; + float radius; + float deltaRadius; + } B; + } mode; + +}tCCParticle; + +typedef void (*CC_UPDATE_PARTICLE_IMP)(id, SEL, tCCParticle*, CGPoint); + +@class CCTexture2D; + +/** Particle System base class + Attributes of a Particle System: + - emmision rate of the particles + - Gravity Mode (Mode A): + - gravity + - direction + - speed +- variance + - tangential acceleration +- variance + - radial acceleration +- variance + - Radius Mode (Mode B): + - startRadius +- variance + - endRadius +- variance + - rotate +- variance + - Properties common to all modes: + - life +- life variance + - start spin +- variance + - end spin +- variance + - start size +- variance + - end size +- variance + - start color +- variance + - end color +- variance + - life +- variance + - blending function + - texture + + cocos2d also supports particles generated by Particle Designer (http://particledesigner.71squared.com/). + 'Radius Mode' in Particle Designer uses a fixed emit rate of 30 hz. Since that can't be guarateed in cocos2d, + cocos2d uses a another approach, but the results are almost identical. + + cocos2d supports all the variables used by Particle Designer plus a bit more: + - spinning particles (supported when using CCParticleSystemQuad) + - tangential acceleration (Gravity mode) + - radial acceleration (Gravity mode) + - radius direction (Radius mode) (Particle Designer supports outwards to inwards direction only) + + It is possible to customize any of the above mentioned properties in runtime. Example: + + @code + emitter.radialAccel = 15; + emitter.startSpin = 0; + @endcode + + */ +@interface CCParticleSystem : CCNode +{ + // is the particle system active ? + BOOL active; + // duration in seconds of the system. -1 is infinity + float duration; + // time elapsed since the start of the system (in seconds) + float elapsed; + + // position is from "superclass" CocosNode + CGPoint sourcePosition; + // Position variance + CGPoint posVar; + + // The angle (direction) of the particles measured in degrees + float angle; + // Angle variance measured in degrees; + float angleVar; + + // Different modes + + NSInteger emitterMode_; + union { + // Mode A:Gravity + Tangential Accel + Radial Accel + struct { + // gravity of the particles + CGPoint gravity; + + // The speed the particles will have. + float speed; + // The speed variance + float speedVar; + + // Tangential acceleration + float tangentialAccel; + // Tangential acceleration variance + float tangentialAccelVar; + + // Radial acceleration + float radialAccel; + // Radial acceleration variance + float radialAccelVar; + } A; + + // Mode B: circular movement (gravity, radial accel and tangential accel don't are not used in this mode) + struct { + + // The starting radius of the particles + float startRadius; + // The starting radius variance of the particles + float startRadiusVar; + // The ending radius of the particles + float endRadius; + // The ending radius variance of the particles + float endRadiusVar; + // Number of degress to rotate a particle around the source pos per second + float rotatePerSecond; + // Variance in degrees for rotatePerSecond + float rotatePerSecondVar; + } B; + } mode; + + // start ize of the particles + float startSize; + // start Size variance + float startSizeVar; + // End size of the particle + float endSize; + // end size of variance + float endSizeVar; + + // How many seconds will the particle live + float life; + // Life variance + float lifeVar; + + // Start color of the particles + ccColor4F startColor; + // Start color variance + ccColor4F startColorVar; + // End color of the particles + ccColor4F endColor; + // End color variance + ccColor4F endColorVar; + + // start angle of the particles + float startSpin; + // start angle variance + float startSpinVar; + // End angle of the particle + float endSpin; + // end angle ariance + float endSpinVar; + + + // Array of particles + tCCParticle *particles; + // Maximum particles + NSUInteger totalParticles; + // Count of active particles + NSUInteger particleCount; + + // color modulate +// BOOL colorModulate; + + // How many particles can be emitted per second + float emissionRate; + float emitCounter; + + // Texture of the particles + CCTexture2D *texture_; + // blend function + ccBlendFunc blendFunc_; + + // movment type: free or grouped + tCCPositionType positionType_; + + // Whether or not the node will be auto-removed when there are not particles + BOOL autoRemoveOnFinish_; + + // particle idx + NSUInteger particleIdx; + + // Optimization + CC_UPDATE_PARTICLE_IMP updateParticleImp; + SEL updateParticleSel; + +// profiling +#if CC_ENABLE_PROFILERS + CCProfilingTimer* _profilingTimer; +#endif +} + +/** Is the emitter active */ +@property (nonatomic,readonly) BOOL active; +/** Quantity of particles that are being simulated at the moment */ +@property (nonatomic,readonly) NSUInteger particleCount; +/** How many seconds the emitter wil run. -1 means 'forever' */ +@property (nonatomic,readwrite,assign) float duration; +/** sourcePosition of the emitter */ +@property (nonatomic,readwrite,assign) CGPoint sourcePosition; +/** Position variance of the emitter */ +@property (nonatomic,readwrite,assign) CGPoint posVar; +/** life, and life variation of each particle */ +@property (nonatomic,readwrite,assign) float life; +/** life variance of each particle */ +@property (nonatomic,readwrite,assign) float lifeVar; +/** angle and angle variation of each particle */ +@property (nonatomic,readwrite,assign) float angle; +/** angle variance of each particle */ +@property (nonatomic,readwrite,assign) float angleVar; + +/** Gravity value. Only available in 'Gravity' mode. */ +@property (nonatomic,readwrite,assign) CGPoint gravity; +/** speed of each particle. Only available in 'Gravity' mode. */ +@property (nonatomic,readwrite,assign) float speed; +/** speed variance of each particle. Only available in 'Gravity' mode. */ +@property (nonatomic,readwrite,assign) float speedVar; +/** tangential acceleration of each particle. Only available in 'Gravity' mode. */ +@property (nonatomic,readwrite,assign) float tangentialAccel; +/** tangential acceleration variance of each particle. Only available in 'Gravity' mode. */ +@property (nonatomic,readwrite,assign) float tangentialAccelVar; +/** radial acceleration of each particle. Only available in 'Gravity' mode. */ +@property (nonatomic,readwrite,assign) float radialAccel; +/** radial acceleration variance of each particle. Only available in 'Gravity' mode. */ +@property (nonatomic,readwrite,assign) float radialAccelVar; + +/** The starting radius of the particles. Only available in 'Radius' mode. */ +@property (nonatomic,readwrite,assign) float startRadius; +/** The starting radius variance of the particles. Only available in 'Radius' mode. */ +@property (nonatomic,readwrite,assign) float startRadiusVar; +/** The ending radius of the particles. Only available in 'Radius' mode. */ +@property (nonatomic,readwrite,assign) float endRadius; +/** The ending radius variance of the particles. Only available in 'Radius' mode. */ +@property (nonatomic,readwrite,assign) float endRadiusVar; +/** Number of degress to rotate a particle around the source pos per second. Only available in 'Radius' mode. */ +@property (nonatomic,readwrite,assign) float rotatePerSecond; +/** Variance in degrees for rotatePerSecond. Only available in 'Radius' mode. */ +@property (nonatomic,readwrite,assign) float rotatePerSecondVar; + +/** start size in pixels of each particle */ +@property (nonatomic,readwrite,assign) float startSize; +/** size variance in pixels of each particle */ +@property (nonatomic,readwrite,assign) float startSizeVar; +/** end size in pixels of each particle */ +@property (nonatomic,readwrite,assign) float endSize; +/** end size variance in pixels of each particle */ +@property (nonatomic,readwrite,assign) float endSizeVar; +/** start color of each particle */ +@property (nonatomic,readwrite,assign) ccColor4F startColor; +/** start color variance of each particle */ +@property (nonatomic,readwrite,assign) ccColor4F startColorVar; +/** end color and end color variation of each particle */ +@property (nonatomic,readwrite,assign) ccColor4F endColor; +/** end color variance of each particle */ +@property (nonatomic,readwrite,assign) ccColor4F endColorVar; +//* initial angle of each particle +@property (nonatomic,readwrite,assign) float startSpin; +//* initial angle of each particle +@property (nonatomic,readwrite,assign) float startSpinVar; +//* initial angle of each particle +@property (nonatomic,readwrite,assign) float endSpin; +//* initial angle of each particle +@property (nonatomic,readwrite,assign) float endSpinVar; +/** emission rate of the particles */ +@property (nonatomic,readwrite,assign) float emissionRate; +/** maximum particles of the system */ +@property (nonatomic,readwrite,assign) NSUInteger totalParticles; +/** conforms to CocosNodeTexture protocol */ +@property (nonatomic,readwrite, retain) CCTexture2D * texture; +/** conforms to CocosNodeTexture protocol */ +@property (nonatomic,readwrite) ccBlendFunc blendFunc; +/** whether or not the particles are using blend additive. + If enabled, the following blending function will be used. + @code + source blend function = GL_SRC_ALPHA; + dest blend function = GL_ONE; + @endcode + */ +@property (nonatomic,readwrite) BOOL blendAdditive; +/** particles movement type: Free or Grouped + @since v0.8 + */ +@property (nonatomic,readwrite) tCCPositionType positionType; +/** whether or not the node will be auto-removed when it has no particles left. + By default it is NO. + @since v0.8 + */ +@property (nonatomic,readwrite) BOOL autoRemoveOnFinish; +/** Switch between different kind of emitter modes: + - kCCParticleModeGravity: uses gravity, speed, radial and tangential acceleration + - kCCParticleModeRadius: uses radius movement + rotation + */ +@property (nonatomic,readwrite) NSInteger emitterMode; + +/** creates an initializes a CCParticleSystem from a plist file. + This plist files can be creted manually or with Particle Designer: + http://particledesigner.71squared.com/ + @since v0.99.3 + */ ++(id) particleWithFile:(NSString*)plistFile; + +/** initializes a CCParticleSystem from a plist file. + This plist files can be creted manually or with Particle Designer: + http://particledesigner.71squared.com/ + @since v0.99.3 + */ +-(id) initWithFile:(NSString*) plistFile; + +/** initializes a CCQuadParticleSystem from a NSDictionary. + @since v0.99.3 + */ +-(id) initWithDictionary:(NSDictionary*)dictionary; + +//! Initializes a system with a fixed number of particles +-(id) initWithTotalParticles:(NSUInteger) numberOfParticles; +//! Add a particle to the emitter +-(BOOL) addParticle; +//! Initializes a particle +-(void) initParticle: (tCCParticle*) particle; +//! stop emitting particles. Running particles will continue to run until they die +-(void) stopSystem; +//! Kill all living particles. +-(void) resetSystem; +//! whether or not the system is full +-(BOOL) isFull; + +//! should be overriden by subclasses +-(void) updateQuadWithParticle:(tCCParticle*)particle newPosition:(CGPoint)pos; +//! should be overriden by subclasses +-(void) postStep; + +//! called in every loop. +-(void) update: (ccTime) dt; + +@end + diff --git a/libs/cocos2d/CCParticleSystem.m b/libs/cocos2d/CCParticleSystem.m new file mode 100755 index 0000000..742676e --- /dev/null +++ b/libs/cocos2d/CCParticleSystem.m @@ -0,0 +1,808 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2008-2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + + +// ideas taken from: +// . The ocean spray in your face [Jeff Lander] +// http://www.double.co.nz/dust/col0798.pdf +// . Building an Advanced Particle System [John van der Burg] +// http://www.gamasutra.com/features/20000623/vanderburg_01.htm +// . LOVE game engine +// http://love2d.org/ +// +// +// Radius mode support, from 71 squared +// http://particledesigner.71squared.com/ +// +// IMPORTANT: Particle Designer is supported by cocos2d, but +// 'Radius Mode' in Particle Designer uses a fixed emit rate of 30 hz. Since that can't be guarateed in cocos2d, +// cocos2d uses a another approach, but the results are almost identical. +// + +// opengl +#import "Platforms/CCGL.h" + +// cocos2d +#import "ccConfig.h" +#if CC_ENABLE_PROFILERS +#import "Support/CCProfiling.h" +#endif +#import "CCParticleSystem.h" +#import "CCTextureCache.h" +#import "ccMacros.h" + +// support +#import "Support/OpenGL_Internal.h" +#import "Support/CGPointExtension.h" +#import "Support/base64.h" +#import "Support/ZipUtils.h" +#import "Support/CCFileUtils.h" + +@implementation CCParticleSystem +@synthesize active, duration; +@synthesize sourcePosition, posVar; +@synthesize particleCount; +@synthesize life, lifeVar; +@synthesize angle, angleVar; +@synthesize startColor, startColorVar, endColor, endColorVar; +@synthesize startSpin, startSpinVar, endSpin, endSpinVar; +@synthesize emissionRate; +@synthesize totalParticles; +@synthesize startSize, startSizeVar; +@synthesize endSize, endSizeVar; +@synthesize blendFunc = blendFunc_; +@synthesize positionType = positionType_; +@synthesize autoRemoveOnFinish = autoRemoveOnFinish_; +@synthesize emitterMode = emitterMode_; + + ++(id) particleWithFile:(NSString*) plistFile +{ + return [[[self alloc] initWithFile:plistFile] autorelease]; +} + +-(id) init { + NSAssert(NO, @"CCParticleSystem: Init not supported."); + [self release]; + return nil; +} + +-(id) initWithFile:(NSString *)plistFile +{ + NSString *path = [CCFileUtils fullPathFromRelativePath:plistFile]; + NSDictionary *dict = [NSDictionary dictionaryWithContentsOfFile:path]; + + NSAssert( dict != nil, @"Particles: file not found"); + return [self initWithDictionary:dict]; +} + +-(id) initWithDictionary:(NSDictionary *)dictionary +{ + NSUInteger maxParticles = [[dictionary valueForKey:@"maxParticles"] intValue]; + // self, not super + if ((self=[self initWithTotalParticles:maxParticles] ) ) { + + // angle + angle = [[dictionary valueForKey:@"angle"] floatValue]; + angleVar = [[dictionary valueForKey:@"angleVariance"] floatValue]; + + // duration + duration = [[dictionary valueForKey:@"duration"] floatValue]; + + // blend function + blendFunc_.src = [[dictionary valueForKey:@"blendFuncSource"] intValue]; + blendFunc_.dst = [[dictionary valueForKey:@"blendFuncDestination"] intValue]; + + // color + float r,g,b,a; + + r = [[dictionary valueForKey:@"startColorRed"] floatValue]; + g = [[dictionary valueForKey:@"startColorGreen"] floatValue]; + b = [[dictionary valueForKey:@"startColorBlue"] floatValue]; + a = [[dictionary valueForKey:@"startColorAlpha"] floatValue]; + startColor = (ccColor4F) {r,g,b,a}; + + r = [[dictionary valueForKey:@"startColorVarianceRed"] floatValue]; + g = [[dictionary valueForKey:@"startColorVarianceGreen"] floatValue]; + b = [[dictionary valueForKey:@"startColorVarianceBlue"] floatValue]; + a = [[dictionary valueForKey:@"startColorVarianceAlpha"] floatValue]; + startColorVar = (ccColor4F) {r,g,b,a}; + + r = [[dictionary valueForKey:@"finishColorRed"] floatValue]; + g = [[dictionary valueForKey:@"finishColorGreen"] floatValue]; + b = [[dictionary valueForKey:@"finishColorBlue"] floatValue]; + a = [[dictionary valueForKey:@"finishColorAlpha"] floatValue]; + endColor = (ccColor4F) {r,g,b,a}; + + r = [[dictionary valueForKey:@"finishColorVarianceRed"] floatValue]; + g = [[dictionary valueForKey:@"finishColorVarianceGreen"] floatValue]; + b = [[dictionary valueForKey:@"finishColorVarianceBlue"] floatValue]; + a = [[dictionary valueForKey:@"finishColorVarianceAlpha"] floatValue]; + endColorVar = (ccColor4F) {r,g,b,a}; + + // particle size + startSize = [[dictionary valueForKey:@"startParticleSize"] floatValue]; + startSizeVar = [[dictionary valueForKey:@"startParticleSizeVariance"] floatValue]; + endSize = [[dictionary valueForKey:@"finishParticleSize"] floatValue]; + endSizeVar = [[dictionary valueForKey:@"finishParticleSizeVariance"] floatValue]; + + + // position + float x = [[dictionary valueForKey:@"sourcePositionx"] floatValue]; + float y = [[dictionary valueForKey:@"sourcePositiony"] floatValue]; + self.position = ccp(x,y); + posVar.x = [[dictionary valueForKey:@"sourcePositionVariancex"] floatValue]; + posVar.y = [[dictionary valueForKey:@"sourcePositionVariancey"] floatValue]; + + + // Spinning + startSpin = [[dictionary valueForKey:@"rotationStart"] floatValue]; + startSpinVar = [[dictionary valueForKey:@"rotationStartVariance"] floatValue]; + endSpin = [[dictionary valueForKey:@"rotationEnd"] floatValue]; + endSpinVar = [[dictionary valueForKey:@"rotationEndVariance"] floatValue]; + + emitterMode_ = [[dictionary valueForKey:@"emitterType"] intValue]; + + // Mode A: Gravity + tangential accel + radial accel + if( emitterMode_ == kCCParticleModeGravity ) { + // gravity + mode.A.gravity.x = [[dictionary valueForKey:@"gravityx"] floatValue]; + mode.A.gravity.y = [[dictionary valueForKey:@"gravityy"] floatValue]; + + // + // speed + mode.A.speed = [[dictionary valueForKey:@"speed"] floatValue]; + mode.A.speedVar = [[dictionary valueForKey:@"speedVariance"] floatValue]; + + // radial acceleration + NSString *tmp = [dictionary valueForKey:@"radialAcceleration"]; + mode.A.radialAccel = tmp ? [tmp floatValue] : 0; + + tmp = [dictionary valueForKey:@"radialAccelVariance"]; + mode.A.radialAccelVar = tmp ? [tmp floatValue] : 0; + + // tangential acceleration + tmp = [dictionary valueForKey:@"tangentialAcceleration"]; + mode.A.tangentialAccel = tmp ? [tmp floatValue] : 0; + + tmp = [dictionary valueForKey:@"tangentialAccelVariance"]; + mode.A.tangentialAccelVar = tmp ? [tmp floatValue] : 0; + } + + + // or Mode B: radius movement + else if( emitterMode_ == kCCParticleModeRadius ) { + float maxRadius = [[dictionary valueForKey:@"maxRadius"] floatValue]; + float maxRadiusVar = [[dictionary valueForKey:@"maxRadiusVariance"] floatValue]; + float minRadius = [[dictionary valueForKey:@"minRadius"] floatValue]; + + mode.B.startRadius = maxRadius; + mode.B.startRadiusVar = maxRadiusVar; + mode.B.endRadius = minRadius; + mode.B.endRadiusVar = 0; + mode.B.rotatePerSecond = [[dictionary valueForKey:@"rotatePerSecond"] floatValue]; + mode.B.rotatePerSecondVar = [[dictionary valueForKey:@"rotatePerSecondVariance"] floatValue]; + + } else { + NSAssert( NO, @"Invalid emitterType in config file"); + } + + // life span + life = [[dictionary valueForKey:@"particleLifespan"] floatValue]; + lifeVar = [[dictionary valueForKey:@"particleLifespanVariance"] floatValue]; + + // emission Rate + emissionRate = totalParticles/life; + + // texture + // Try to get the texture from the cache + NSString *textureName = [dictionary valueForKey:@"textureFileName"]; + + CCTexture2D *tex = [[CCTextureCache sharedTextureCache] addImage:textureName]; + + if( tex ) + self.texture = tex; + + else { + + NSString *textureData = [dictionary valueForKey:@"textureImageData"]; + NSAssert( textureData, @"CCParticleSystem: Couldn't load texture"); + + // if it fails, try to get it from the base64-gzipped data + unsigned char *buffer = NULL; + int len = base64Decode((unsigned char*)[textureData UTF8String], (unsigned int)[textureData length], &buffer); + NSAssert( buffer != NULL, @"CCParticleSystem: error decoding textureImageData"); + + unsigned char *deflated = NULL; + NSUInteger deflatedLen = ccInflateMemory(buffer, len, &deflated); + free( buffer ); + + NSAssert( deflated != NULL, @"CCParticleSystem: error ungzipping textureImageData"); + NSData *data = [[NSData alloc] initWithBytes:deflated length:deflatedLen]; + +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED + UIImage *image = [[UIImage alloc] initWithData:data]; +#elif defined(__MAC_OS_X_VERSION_MAX_ALLOWED) + NSBitmapImageRep *image = [[NSBitmapImageRep alloc] initWithData:data]; +#endif + + free(deflated); deflated = NULL; + + self.texture = [[CCTextureCache sharedTextureCache] addCGImage:[image CGImage] forKey:textureName]; + [data release]; + [image release]; + } + + NSAssert( [self texture] != NULL, @"CCParticleSystem: error loading the texture"); + + } + + return self; +} + +-(id) initWithTotalParticles:(NSUInteger) numberOfParticles +{ + if( (self=[super init]) ) { + + totalParticles = numberOfParticles; + + particles = calloc( totalParticles, sizeof(tCCParticle) ); + + if( ! particles ) { + NSLog(@"Particle system: not enough memory"); + [self release]; + return nil; + } + + // default, active + active = YES; + + // default blend function + blendFunc_ = (ccBlendFunc) { CC_BLEND_SRC, CC_BLEND_DST }; + + // default movement type; + positionType_ = kCCPositionTypeFree; + + // by default be in mode A: + emitterMode_ = kCCParticleModeGravity; + + // default: modulate + // XXX: not used + // colorModulate = YES; + + autoRemoveOnFinish_ = NO; + + // profiling +#if CC_ENABLE_PROFILERS + _profilingTimer = [[CCProfiler timerWithName:@"particle system" andInstance:self] retain]; +#endif + + // Optimization: compile udpateParticle method + updateParticleSel = @selector(updateQuadWithParticle:newPosition:); + updateParticleImp = (CC_UPDATE_PARTICLE_IMP) [self methodForSelector:updateParticleSel]; + + // udpate after action in run! + [self scheduleUpdateWithPriority:1]; + + } + + return self; +} + +-(void) dealloc +{ + free( particles ); + + [texture_ release]; + // profiling +#if CC_ENABLE_PROFILERS + [CCProfiler releaseTimer:_profilingTimer]; +#endif + + [super dealloc]; +} + +-(BOOL) addParticle +{ + if( [self isFull] ) + return NO; + + tCCParticle * particle = &particles[ particleCount ]; + + [self initParticle: particle]; + particleCount++; + + return YES; +} + +-(void) initParticle: (tCCParticle*) particle +{ + + // timeToLive + // no negative life. prevent division by 0 + particle->timeToLive = life + lifeVar * CCRANDOM_MINUS1_1(); + particle->timeToLive = MAX(0, particle->timeToLive); + + // position + particle->pos.x = sourcePosition.x + posVar.x * CCRANDOM_MINUS1_1(); + particle->pos.x *= CC_CONTENT_SCALE_FACTOR(); + particle->pos.y = sourcePosition.y + posVar.y * CCRANDOM_MINUS1_1(); + particle->pos.y *= CC_CONTENT_SCALE_FACTOR(); + + // Color + ccColor4F start; + start.r = clampf( startColor.r + startColorVar.r * CCRANDOM_MINUS1_1(), 0, 1); + start.g = clampf( startColor.g + startColorVar.g * CCRANDOM_MINUS1_1(), 0, 1); + start.b = clampf( startColor.b + startColorVar.b * CCRANDOM_MINUS1_1(), 0, 1); + start.a = clampf( startColor.a + startColorVar.a * CCRANDOM_MINUS1_1(), 0, 1); + + ccColor4F end; + end.r = clampf( endColor.r + endColorVar.r * CCRANDOM_MINUS1_1(), 0, 1); + end.g = clampf( endColor.g + endColorVar.g * CCRANDOM_MINUS1_1(), 0, 1); + end.b = clampf( endColor.b + endColorVar.b * CCRANDOM_MINUS1_1(), 0, 1); + end.a = clampf( endColor.a + endColorVar.a * CCRANDOM_MINUS1_1(), 0, 1); + + particle->color = start; + particle->deltaColor.r = (end.r - start.r) / particle->timeToLive; + particle->deltaColor.g = (end.g - start.g) / particle->timeToLive; + particle->deltaColor.b = (end.b - start.b) / particle->timeToLive; + particle->deltaColor.a = (end.a - start.a) / particle->timeToLive; + + // size + float startS = startSize + startSizeVar * CCRANDOM_MINUS1_1(); + startS = MAX(0, startS); // No negative value + startS *= CC_CONTENT_SCALE_FACTOR(); + + particle->size = startS; + if( endSize == kCCParticleStartSizeEqualToEndSize ) + particle->deltaSize = 0; + else { + float endS = endSize + endSizeVar * CCRANDOM_MINUS1_1(); + endS = MAX(0, endS); // No negative values + endS *= CC_CONTENT_SCALE_FACTOR(); + particle->deltaSize = (endS - startS) / particle->timeToLive; + } + + // rotation + float startA = startSpin + startSpinVar * CCRANDOM_MINUS1_1(); + float endA = endSpin + endSpinVar * CCRANDOM_MINUS1_1(); + particle->rotation = startA; + particle->deltaRotation = (endA - startA) / particle->timeToLive; + + // position + if( positionType_ == kCCPositionTypeFree ) { + CGPoint p = [self convertToWorldSpace:CGPointZero]; + particle->startPos = ccpMult( p, CC_CONTENT_SCALE_FACTOR() ); + } + else if( positionType_ == kCCPositionTypeRelative ) { + particle->startPos = ccpMult( position_, CC_CONTENT_SCALE_FACTOR() ); + } + + // direction + float a = CC_DEGREES_TO_RADIANS( angle + angleVar * CCRANDOM_MINUS1_1() ); + + // Mode Gravity: A + if( emitterMode_ == kCCParticleModeGravity ) { + + CGPoint v = {cosf( a ), sinf( a )}; + float s = mode.A.speed + mode.A.speedVar * CCRANDOM_MINUS1_1(); + s *= CC_CONTENT_SCALE_FACTOR(); + + // direction + particle->mode.A.dir = ccpMult( v, s ); + + // radial accel + particle->mode.A.radialAccel = mode.A.radialAccel + mode.A.radialAccelVar * CCRANDOM_MINUS1_1(); + particle->mode.A.radialAccel *= CC_CONTENT_SCALE_FACTOR(); + + // tangential accel + particle->mode.A.tangentialAccel = mode.A.tangentialAccel + mode.A.tangentialAccelVar * CCRANDOM_MINUS1_1(); + particle->mode.A.tangentialAccel *= CC_CONTENT_SCALE_FACTOR(); + + } + + // Mode Radius: B + else { + // Set the default diameter of the particle from the source position + float startRadius = mode.B.startRadius + mode.B.startRadiusVar * CCRANDOM_MINUS1_1(); + float endRadius = mode.B.endRadius + mode.B.endRadiusVar * CCRANDOM_MINUS1_1(); + + startRadius *= CC_CONTENT_SCALE_FACTOR(); + endRadius *= CC_CONTENT_SCALE_FACTOR(); + + particle->mode.B.radius = startRadius; + + if( mode.B.endRadius == kCCParticleStartRadiusEqualToEndRadius ) + particle->mode.B.deltaRadius = 0; + else + particle->mode.B.deltaRadius = (endRadius - startRadius) / particle->timeToLive; + + particle->mode.B.angle = a; + particle->mode.B.degreesPerSecond = CC_DEGREES_TO_RADIANS(mode.B.rotatePerSecond + mode.B.rotatePerSecondVar * CCRANDOM_MINUS1_1()); + } +} + +-(void) stopSystem +{ + active = NO; + elapsed = duration; + emitCounter = 0; +} + +-(void) resetSystem +{ + active = YES; + elapsed = 0; + for(particleIdx = 0; particleIdx < particleCount; ++particleIdx) { + tCCParticle *p = &particles[particleIdx]; + p->timeToLive = 0; + } +} + +-(BOOL) isFull +{ + return (particleCount == totalParticles); +} + +#pragma mark ParticleSystem - MainLoop +-(void) update: (ccTime) dt +{ + if( active && emissionRate ) { + float rate = 1.0f / emissionRate; + emitCounter += dt; + while( particleCount < totalParticles && emitCounter > rate ) { + [self addParticle]; + emitCounter -= rate; + } + + elapsed += dt; + if(duration != -1 && duration < elapsed) + [self stopSystem]; + } + + particleIdx = 0; + + +#if CC_ENABLE_PROFILERS + CCProfilingBeginTimingBlock(_profilingTimer); +#endif + + + CGPoint currentPosition = CGPointZero; + if( positionType_ == kCCPositionTypeFree ) { + currentPosition = [self convertToWorldSpace:CGPointZero]; + currentPosition.x *= CC_CONTENT_SCALE_FACTOR(); + currentPosition.y *= CC_CONTENT_SCALE_FACTOR(); + } + else if( positionType_ == kCCPositionTypeRelative ) { + currentPosition = position_; + currentPosition.x *= CC_CONTENT_SCALE_FACTOR(); + currentPosition.y *= CC_CONTENT_SCALE_FACTOR(); + } + + while( particleIdx < particleCount ) + { + tCCParticle *p = &particles[particleIdx]; + + // life + p->timeToLive -= dt; + + if( p->timeToLive > 0 ) { + + // Mode A: gravity, direction, tangential accel & radial accel + if( emitterMode_ == kCCParticleModeGravity ) { + CGPoint tmp, radial, tangential; + + radial = CGPointZero; + // radial acceleration + if(p->pos.x || p->pos.y) + radial = ccpNormalize(p->pos); + + tangential = radial; + radial = ccpMult(radial, p->mode.A.radialAccel); + + // tangential acceleration + float newy = tangential.x; + tangential.x = -tangential.y; + tangential.y = newy; + tangential = ccpMult(tangential, p->mode.A.tangentialAccel); + + // (gravity + radial + tangential) * dt + tmp = ccpAdd( ccpAdd( radial, tangential), mode.A.gravity); + tmp = ccpMult( tmp, dt); + p->mode.A.dir = ccpAdd( p->mode.A.dir, tmp); + tmp = ccpMult(p->mode.A.dir, dt); + p->pos = ccpAdd( p->pos, tmp ); + } + + // Mode B: radius movement + else { + // Update the angle and radius of the particle. + p->mode.B.angle += p->mode.B.degreesPerSecond * dt; + p->mode.B.radius += p->mode.B.deltaRadius * dt; + + p->pos.x = - cosf(p->mode.B.angle) * p->mode.B.radius; + p->pos.y = - sinf(p->mode.B.angle) * p->mode.B.radius; + } + + // color + p->color.r += (p->deltaColor.r * dt); + p->color.g += (p->deltaColor.g * dt); + p->color.b += (p->deltaColor.b * dt); + p->color.a += (p->deltaColor.a * dt); + + // size + p->size += (p->deltaSize * dt); + p->size = MAX( 0, p->size ); + + // angle + p->rotation += (p->deltaRotation * dt); + + // + // update values in quad + // + + CGPoint newPos; + + if( positionType_ == kCCPositionTypeFree || positionType_ == kCCPositionTypeRelative ) { + CGPoint diff = ccpSub( currentPosition, p->startPos ); + newPos = ccpSub(p->pos, diff); + + } else + newPos = p->pos; + + + updateParticleImp(self, updateParticleSel, p, newPos); + + // update particle counter + particleIdx++; + + } else { + // life < 0 + if( particleIdx != particleCount-1 ) + particles[particleIdx] = particles[particleCount-1]; + particleCount--; + + if( particleCount == 0 && autoRemoveOnFinish_ ) { + [self unscheduleUpdate]; + [parent_ removeChild:self cleanup:YES]; + return; + } + } + } + +#if CC_ENABLE_PROFILERS + CCProfilingEndTimingBlock(_profilingTimer); +#endif + +#ifdef CC_USES_VBO + [self postStep]; +#endif +} + +-(void) updateQuadWithParticle:(tCCParticle*)particle newPosition:(CGPoint)pos; +{ + // should be overriden +} + +-(void) postStep +{ + // should be overriden +} + +#pragma mark ParticleSystem - CCTexture protocol + +-(void) setTexture:(CCTexture2D*) texture +{ + [texture_ release]; + texture_ = [texture retain]; + + // If the new texture has No premultiplied alpha, AND the blendFunc hasn't been changed, then update it + if( texture_ && ! [texture hasPremultipliedAlpha] && + ( blendFunc_.src == CC_BLEND_SRC && blendFunc_.dst == CC_BLEND_DST ) ) { + + blendFunc_.src = GL_SRC_ALPHA; + blendFunc_.dst = GL_ONE_MINUS_SRC_ALPHA; + } +} + +-(CCTexture2D*) texture +{ + return texture_; +} + +#pragma mark ParticleSystem - Additive Blending +-(void) setBlendAdditive:(BOOL)additive +{ + if( additive ) { + blendFunc_.src = GL_SRC_ALPHA; + blendFunc_.dst = GL_ONE; + + } else { + + if( texture_ && ! [texture_ hasPremultipliedAlpha] ) { + blendFunc_.src = GL_SRC_ALPHA; + blendFunc_.dst = GL_ONE_MINUS_SRC_ALPHA; + } else { + blendFunc_.src = CC_BLEND_SRC; + blendFunc_.dst = CC_BLEND_DST; + } + } +} + +-(BOOL) blendAdditive +{ + return( blendFunc_.src == GL_SRC_ALPHA && blendFunc_.dst == GL_ONE); +} + +#pragma mark ParticleSystem - Properties of Gravity Mode +-(void) setTangentialAccel:(float)t +{ + NSAssert( emitterMode_ == kCCParticleModeGravity, @"Particle Mode should be Gravity"); + mode.A.tangentialAccel = t; +} +-(float) tangentialAccel +{ + NSAssert( emitterMode_ == kCCParticleModeGravity, @"Particle Mode should be Gravity"); + return mode.A.tangentialAccel; +} + +-(void) setTangentialAccelVar:(float)t +{ + NSAssert( emitterMode_ == kCCParticleModeGravity, @"Particle Mode should be Gravity"); + mode.A.tangentialAccelVar = t; +} +-(float) tangentialAccelVar +{ + NSAssert( emitterMode_ == kCCParticleModeGravity, @"Particle Mode should be Gravity"); + return mode.A.tangentialAccelVar; +} + +-(void) setRadialAccel:(float)t +{ + NSAssert( emitterMode_ == kCCParticleModeGravity, @"Particle Mode should be Gravity"); + mode.A.radialAccel = t; +} +-(float) radialAccel +{ + NSAssert( emitterMode_ == kCCParticleModeGravity, @"Particle Mode should be Gravity"); + return mode.A.radialAccel; +} + +-(void) setRadialAccelVar:(float)t +{ + NSAssert( emitterMode_ == kCCParticleModeGravity, @"Particle Mode should be Gravity"); + mode.A.radialAccelVar = t; +} +-(float) radialAccelVar +{ + NSAssert( emitterMode_ == kCCParticleModeGravity, @"Particle Mode should be Gravity"); + return mode.A.radialAccelVar; +} + +-(void) setGravity:(CGPoint)g +{ + NSAssert( emitterMode_ == kCCParticleModeGravity, @"Particle Mode should be Gravity"); + mode.A.gravity = g; +} +-(CGPoint) gravity +{ + NSAssert( emitterMode_ == kCCParticleModeGravity, @"Particle Mode should be Gravity"); + return mode.A.gravity; +} + +-(void) setSpeed:(float)speed +{ + NSAssert( emitterMode_ == kCCParticleModeGravity, @"Particle Mode should be Gravity"); + mode.A.speed = speed; +} +-(float) speed +{ + NSAssert( emitterMode_ == kCCParticleModeGravity, @"Particle Mode should be Gravity"); + return mode.A.speed; +} + +-(void) setSpeedVar:(float)speedVar +{ + NSAssert( emitterMode_ == kCCParticleModeGravity, @"Particle Mode should be Gravity"); + mode.A.speedVar = speedVar; +} +-(float) speedVar +{ + NSAssert( emitterMode_ == kCCParticleModeGravity, @"Particle Mode should be Gravity"); + return mode.A.speedVar; +} + +#pragma mark ParticleSystem - Properties of Radius Mode + +-(void) setStartRadius:(float)startRadius +{ + NSAssert( emitterMode_ == kCCParticleModeRadius, @"Particle Mode should be Radius"); + mode.B.startRadius = startRadius; +} +-(float) startRadius +{ + NSAssert( emitterMode_ == kCCParticleModeRadius, @"Particle Mode should be Radius"); + return mode.B.startRadius; +} + +-(void) setStartRadiusVar:(float)startRadiusVar +{ + NSAssert( emitterMode_ == kCCParticleModeRadius, @"Particle Mode should be Radius"); + mode.B.startRadiusVar = startRadiusVar; +} +-(float) startRadiusVar +{ + NSAssert( emitterMode_ == kCCParticleModeRadius, @"Particle Mode should be Radius"); + return mode.B.startRadiusVar; +} + +-(void) setEndRadius:(float)endRadius +{ + NSAssert( emitterMode_ == kCCParticleModeRadius, @"Particle Mode should be Radius"); + mode.B.endRadius = endRadius; +} +-(float) endRadius +{ + NSAssert( emitterMode_ == kCCParticleModeRadius, @"Particle Mode should be Radius"); + return mode.B.endRadius; +} + +-(void) setEndRadiusVar:(float)endRadiusVar +{ + NSAssert( emitterMode_ == kCCParticleModeRadius, @"Particle Mode should be Radius"); + mode.B.endRadiusVar = endRadiusVar; +} +-(float) endRadiusVar +{ + NSAssert( emitterMode_ == kCCParticleModeRadius, @"Particle Mode should be Radius"); + return mode.B.endRadiusVar; +} + +-(void) setRotatePerSecond:(float)degrees +{ + NSAssert( emitterMode_ == kCCParticleModeRadius, @"Particle Mode should be Radius"); + mode.B.rotatePerSecond = degrees; +} +-(float) rotatePerSecond +{ + NSAssert( emitterMode_ == kCCParticleModeRadius, @"Particle Mode should be Radius"); + return mode.B.rotatePerSecond; +} + +-(void) setRotatePerSecondVar:(float)degrees +{ + NSAssert( emitterMode_ == kCCParticleModeRadius, @"Particle Mode should be Radius"); + mode.B.rotatePerSecondVar = degrees; +} +-(float) rotatePerSecondVar +{ + NSAssert( emitterMode_ == kCCParticleModeRadius, @"Particle Mode should be Radius"); + return mode.B.rotatePerSecondVar; +} +@end + + diff --git a/libs/cocos2d/CCParticleSystemPoint.h b/libs/cocos2d/CCParticleSystemPoint.h new file mode 100755 index 0000000..f0918fe --- /dev/null +++ b/libs/cocos2d/CCParticleSystemPoint.h @@ -0,0 +1,65 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2008-2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + + +#import +#import "CCParticleSystem.h" + +#define CC_MAX_PARTICLE_SIZE 64 + +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED + +/** CCParticleSystemPoint is a subclass of CCParticleSystem + Attributes of a Particle System: + * All the attributes of Particle System + + Features: + * consumes small memory: uses 1 vertex (x,y) per particle, no need to assign tex coordinates + * size can't be bigger than 64 + * the system can't be scaled since the particles are rendered using GL_POINT_SPRITE + + Limitations: + * On 3rd gen iPhone devices and iPads, this node performs MUCH slower than CCParticleSystemQuad. + */ +@interface CCParticleSystemPoint : CCParticleSystem +{ + // Array of (x,y,size) + ccPointSprite *vertices; + // vertices buffer id +#if CC_USES_VBO + GLuint verticesID; +#endif +} +@end + +#elif __MAC_OS_X_VERSION_MAX_ALLOWED + +#import "CCParticleSystemQuad.h" + +@interface CCParticleSystemPoint : CCParticleSystemQuad +@end + +#endif diff --git a/libs/cocos2d/CCParticleSystemPoint.m b/libs/cocos2d/CCParticleSystemPoint.m new file mode 100755 index 0000000..0894d2b --- /dev/null +++ b/libs/cocos2d/CCParticleSystemPoint.m @@ -0,0 +1,211 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2008-2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + +#import +#import "CCParticleSystemPoint.h" + +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED + +// opengl +#import "Platforms/CCGL.h" + +// cocos2d +#import "CCTextureCache.h" +#import "ccMacros.h" + +// support +#import "Support/OpenGL_Internal.h" +#import "Support/CGPointExtension.h" + +@implementation CCParticleSystemPoint + +-(id) initWithTotalParticles:(NSUInteger) numberOfParticles +{ + if( (self=[super initWithTotalParticles:numberOfParticles]) ) { + + vertices = malloc( sizeof(ccPointSprite) * totalParticles ); + + if( ! vertices ) { + NSLog(@"cocos2d: Particle system: not enough memory"); + [self release]; + return nil; + } + +#if CC_USES_VBO + glGenBuffers(1, &verticesID); + + // initial binding + glBindBuffer(GL_ARRAY_BUFFER, verticesID); + glBufferData(GL_ARRAY_BUFFER, sizeof(ccPointSprite)*totalParticles, vertices, GL_DYNAMIC_DRAW); + glBindBuffer(GL_ARRAY_BUFFER, 0); +#endif + } + + return self; +} + +-(void) dealloc +{ + free(vertices); +#if CC_USES_VBO + glDeleteBuffers(1, &verticesID); +#endif + + [super dealloc]; +} + +-(void) updateQuadWithParticle:(tCCParticle*)p newPosition:(CGPoint)newPos +{ + // place vertices and colos in array + vertices[particleIdx].pos = (ccVertex2F) {newPos.x, newPos.y}; + vertices[particleIdx].size = p->size; + ccColor4B color = { p->color.r*255, p->color.g*255, p->color.b*255, p->color.a*255 }; + vertices[particleIdx].color = color; +} + +-(void) postStep +{ +#if CC_USES_VBO + glBindBuffer(GL_ARRAY_BUFFER, verticesID); + glBufferSubData(GL_ARRAY_BUFFER, 0, sizeof(ccPointSprite)*particleCount, vertices); + glBindBuffer(GL_ARRAY_BUFFER, 0); +#endif +} + +-(void) draw +{ + [super draw]; + + if (particleIdx==0) + return; + + // Default GL states: GL_TEXTURE_2D, GL_VERTEX_ARRAY, GL_COLOR_ARRAY, GL_TEXTURE_COORD_ARRAY + // Needed states: GL_TEXTURE_2D, GL_VERTEX_ARRAY, GL_COLOR_ARRAY + // Unneeded states: GL_TEXTURE_COORD_ARRAY + glDisableClientState(GL_TEXTURE_COORD_ARRAY); + + glBindTexture(GL_TEXTURE_2D, texture_.name); + + glEnable(GL_POINT_SPRITE_OES); + glTexEnvi( GL_POINT_SPRITE_OES, GL_COORD_REPLACE_OES, GL_TRUE ); + +#define kPointSize sizeof(vertices[0]) + +#if CC_USES_VBO + glBindBuffer(GL_ARRAY_BUFFER, verticesID); + + glVertexPointer(2,GL_FLOAT, kPointSize, 0); + + glColorPointer(4, GL_UNSIGNED_BYTE, kPointSize, (GLvoid*) offsetof(ccPointSprite, color) ); + + glEnableClientState(GL_POINT_SIZE_ARRAY_OES); + glPointSizePointerOES(GL_FLOAT, kPointSize, (GLvoid*) offsetof(ccPointSprite, size) ); +#else // Uses Vertex Array List + int offset = (int)vertices; + glVertexPointer(2,GL_FLOAT, kPointSize, (GLvoid*) offset); + + int diff = offsetof(ccPointSprite, color); + glColorPointer(4, GL_UNSIGNED_BYTE, kPointSize, (GLvoid*) (offset+diff)); + + glEnableClientState(GL_POINT_SIZE_ARRAY_OES); + diff = offsetof(ccPointSprite, size); + glPointSizePointerOES(GL_FLOAT, kPointSize, (GLvoid*) (offset+diff)); +#endif + + BOOL newBlend = blendFunc_.src != CC_BLEND_SRC || blendFunc_.dst != CC_BLEND_DST; + if( newBlend ) + glBlendFunc( blendFunc_.src, blendFunc_.dst ); + + + glDrawArrays(GL_POINTS, 0, particleIdx); + + // restore blend state + if( newBlend ) + glBlendFunc( CC_BLEND_SRC, CC_BLEND_DST); + + +#if CC_USES_VBO + // unbind VBO buffer + glBindBuffer(GL_ARRAY_BUFFER, 0); +#endif + + glDisableClientState(GL_POINT_SIZE_ARRAY_OES); + glDisable(GL_POINT_SPRITE_OES); + + // restore GL default state + glEnableClientState(GL_TEXTURE_COORD_ARRAY); +} + +#pragma mark Non supported properties + +// +// SPIN IS NOT SUPPORTED +// +-(void) setStartSpin:(float)a +{ + NSAssert(a == 0, @"PointParticleSystem doesn't support spinning"); + [super setStartSpin:a]; +} +-(void) setStartSpinVar:(float)a +{ + NSAssert(a == 0, @"PointParticleSystem doesn't support spinning"); + [super setStartSpin:a]; +} +-(void) setEndSpin:(float)a +{ + NSAssert(a == 0, @"PointParticleSystem doesn't support spinning"); + [super setStartSpin:a]; +} +-(void) setEndSpinVar:(float)a +{ + NSAssert(a == 0, @"PointParticleSystem doesn't support spinning"); + [super setStartSpin:a]; +} + +// +// SIZE > 64 IS NOT SUPPORTED +// +-(void) setStartSize:(float)size +{ + NSAssert(size >= 0 && size <= CC_MAX_PARTICLE_SIZE, @"PointParticleSystem only supports 0 <= size <= 64"); + [super setStartSize:size]; +} + +-(void) setEndSize:(float)size +{ + NSAssert( (size == kCCParticleStartSizeEqualToEndSize) || + ( size >= 0 && size <= CC_MAX_PARTICLE_SIZE), @"PointParticleSystem only supports 0 <= size <= 64"); + [super setEndSize:size]; +} +@end + +#elif defined(__MAC_OS_X_VERSION_MAX_ALLOWED) +@implementation CCParticleSystemPoint +@end + +#endif // __MAC_OS_X_VERSION_MAX_ALLOWED + + diff --git a/libs/cocos2d/CCParticleSystemQuad.h b/libs/cocos2d/CCParticleSystemQuad.h new file mode 100755 index 0000000..74a9d93 --- /dev/null +++ b/libs/cocos2d/CCParticleSystemQuad.h @@ -0,0 +1,76 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2009 Leonardo Kasperavičius + * + * Copyright (c) 2008-2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + + +#import "CCParticleSystem.h" +#import "ccConfig.h" + +@class CCSpriteFrame; + +/** CCParticleSystemQuad is a subclass of CCParticleSystem + + It includes all the features of ParticleSystem. + + Special features and Limitations: + - Particle size can be any float number. + - The system can be scaled + - The particles can be rotated + - On 1st and 2nd gen iPhones: It is only a bit slower that CCParticleSystemPoint + - On 3rd gen iPhone and iPads: It is MUCH faster than CCParticleSystemPoint + - It consumes more RAM and more GPU memory than CCParticleSystemPoint + - It supports subrects + @since v0.8 + */ +@interface CCParticleSystemQuad : CCParticleSystem +{ + ccV2F_C4B_T2F_Quad *quads_; // quads to be rendered + GLushort *indices_; // indices +#if CC_USES_VBO + GLuint quadsID_; // VBO id +#endif +} + +/** initialices the indices for the vertices */ +-(void) initIndices; + +/** initilizes the texture with a rectangle measured Points */ +-(void) initTexCoordsWithRect:(CGRect)rect; + +/** Sets a new CCSpriteFrame as particle. + WARNING: this method is experimental. Use setTexture:withRect instead. + @since v0.99.4 + */ +-(void)setDisplayFrame:(CCSpriteFrame*)spriteFrame; + +/** Sets a new texture with a rect. The rect is in Points. + @since v0.99.4 + */ +-(void) setTexture:(CCTexture2D *)texture withRect:(CGRect)rect; + +@end + diff --git a/libs/cocos2d/CCParticleSystemQuad.m b/libs/cocos2d/CCParticleSystemQuad.m new file mode 100755 index 0000000..4916964 --- /dev/null +++ b/libs/cocos2d/CCParticleSystemQuad.m @@ -0,0 +1,318 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2009 Leonardo Kasperavičius + * + * Copyright (c) 2008-2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + + +// opengl +#import "Platforms/CCGL.h" + +// cocos2d +#import "ccConfig.h" +#import "CCParticleSystemQuad.h" +#import "CCTextureCache.h" +#import "ccMacros.h" +#import "CCSpriteFrame.h" + +// support +#import "Support/OpenGL_Internal.h" +#import "Support/CGPointExtension.h" + +@implementation CCParticleSystemQuad + + +// overriding the init method +-(id) initWithTotalParticles:(NSUInteger) numberOfParticles +{ + // base initialization + if( (self=[super initWithTotalParticles:numberOfParticles]) ) { + + // allocating data space + quads_ = calloc( sizeof(quads_[0]) * totalParticles, 1 ); + indices_ = calloc( sizeof(indices_[0]) * totalParticles * 6, 1 ); + + if( !quads_ || !indices_) { + NSLog(@"cocos2d: Particle system: not enough memory"); + if( quads_ ) + free( quads_ ); + if(indices_) + free(indices_); + + [self release]; + return nil; + } + + // initialize only once the texCoords and the indices + [self initTexCoordsWithRect:CGRectMake(0, 0, [texture_ pixelsWide], [texture_ pixelsHigh])]; + [self initIndices]; + +#if CC_USES_VBO + // create the VBO buffer + glGenBuffers(1, &quadsID_); + + // initial binding + glBindBuffer(GL_ARRAY_BUFFER, quadsID_); + glBufferData(GL_ARRAY_BUFFER, sizeof(quads_[0])*totalParticles, quads_,GL_DYNAMIC_DRAW); + glBindBuffer(GL_ARRAY_BUFFER, 0); +#endif + } + + return self; +} + +-(void) dealloc +{ + free(quads_); + free(indices_); +#if CC_USES_VBO + glDeleteBuffers(1, &quadsID_); +#endif + + [super dealloc]; +} + +// pointRect is in Points coordinates. +-(void) initTexCoordsWithRect:(CGRect)pointRect +{ + // convert to pixels coords + CGRect rect = CGRectMake( + pointRect.origin.x * CC_CONTENT_SCALE_FACTOR(), + pointRect.origin.y * CC_CONTENT_SCALE_FACTOR(), + pointRect.size.width * CC_CONTENT_SCALE_FACTOR(), + pointRect.size.height * CC_CONTENT_SCALE_FACTOR() ); + + GLfloat wide = [texture_ pixelsWide]; + GLfloat high = [texture_ pixelsHigh]; + +#if CC_FIX_ARTIFACTS_BY_STRECHING_TEXEL + GLfloat left = (rect.origin.x*2+1) / (wide*2); + GLfloat bottom = (rect.origin.y*2+1) / (high*2); + GLfloat right = left + (rect.size.width*2-2) / (wide*2); + GLfloat top = bottom + (rect.size.height*2-2) / (high*2); +#else + GLfloat left = rect.origin.x / wide; + GLfloat bottom = rect.origin.y / high; + GLfloat right = left + rect.size.width / wide; + GLfloat top = bottom + rect.size.height / high; +#endif // ! CC_FIX_ARTIFACTS_BY_STRECHING_TEXEL + + // Important. Texture in cocos2d are inverted, so the Y component should be inverted + CC_SWAP( top, bottom); + + for(NSUInteger i=0; icolor.r*255, p->color.g*255, p->color.b*255, p->color.a*255}; + quad->bl.colors = color; + quad->br.colors = color; + quad->tl.colors = color; + quad->tr.colors = color; + + // vertices + GLfloat size_2 = p->size/2; + if( p->rotation ) { + GLfloat x1 = -size_2; + GLfloat y1 = -size_2; + + GLfloat x2 = size_2; + GLfloat y2 = size_2; + GLfloat x = newPos.x; + GLfloat y = newPos.y; + + GLfloat r = (GLfloat)-CC_DEGREES_TO_RADIANS(p->rotation); + GLfloat cr = cosf(r); + GLfloat sr = sinf(r); + GLfloat ax = x1 * cr - y1 * sr + x; + GLfloat ay = x1 * sr + y1 * cr + y; + GLfloat bx = x2 * cr - y1 * sr + x; + GLfloat by = x2 * sr + y1 * cr + y; + GLfloat cx = x2 * cr - y2 * sr + x; + GLfloat cy = x2 * sr + y2 * cr + y; + GLfloat dx = x1 * cr - y2 * sr + x; + GLfloat dy = x1 * sr + y2 * cr + y; + + // bottom-left + quad->bl.vertices.x = ax; + quad->bl.vertices.y = ay; + + // bottom-right vertex: + quad->br.vertices.x = bx; + quad->br.vertices.y = by; + + // top-left vertex: + quad->tl.vertices.x = dx; + quad->tl.vertices.y = dy; + + // top-right vertex: + quad->tr.vertices.x = cx; + quad->tr.vertices.y = cy; + } else { + // bottom-left vertex: + quad->bl.vertices.x = newPos.x - size_2; + quad->bl.vertices.y = newPos.y - size_2; + + // bottom-right vertex: + quad->br.vertices.x = newPos.x + size_2; + quad->br.vertices.y = newPos.y - size_2; + + // top-left vertex: + quad->tl.vertices.x = newPos.x - size_2; + quad->tl.vertices.y = newPos.y + size_2; + + // top-right vertex: + quad->tr.vertices.x = newPos.x + size_2; + quad->tr.vertices.y = newPos.y + size_2; + } +} + +-(void) postStep +{ +#if CC_USES_VBO + glBindBuffer(GL_ARRAY_BUFFER, quadsID_); + glBufferSubData(GL_ARRAY_BUFFER, 0, sizeof(quads_[0])*particleCount, quads_); + glBindBuffer(GL_ARRAY_BUFFER, 0); +#endif +} + +// overriding draw method +-(void) draw +{ + [super draw]; + + // Default GL states: GL_TEXTURE_2D, GL_VERTEX_ARRAY, GL_COLOR_ARRAY, GL_TEXTURE_COORD_ARRAY + // Needed states: GL_TEXTURE_2D, GL_VERTEX_ARRAY, GL_COLOR_ARRAY, GL_TEXTURE_COORD_ARRAY + // Unneeded states: - + + glBindTexture(GL_TEXTURE_2D, [texture_ name]); + +#define kQuadSize sizeof(quads_[0].bl) + +#if CC_USES_VBO + glBindBuffer(GL_ARRAY_BUFFER, quadsID_); + + glVertexPointer(2,GL_FLOAT, kQuadSize, 0); + + glColorPointer(4, GL_UNSIGNED_BYTE, kQuadSize, (GLvoid*) offsetof(ccV2F_C4B_T2F,colors) ); + + glTexCoordPointer(2, GL_FLOAT, kQuadSize, (GLvoid*) offsetof(ccV2F_C4B_T2F,texCoords) ); +#else // vertex array list + + NSUInteger offset = (NSUInteger) quads_; + + // vertex + NSUInteger diff = offsetof( ccV2F_C4B_T2F, vertices); + glVertexPointer(2,GL_FLOAT, kQuadSize, (GLvoid*) (offset+diff) ); + + // color + diff = offsetof( ccV2F_C4B_T2F, colors); + glColorPointer(4, GL_UNSIGNED_BYTE, kQuadSize, (GLvoid*)(offset + diff)); + + // tex coords + diff = offsetof( ccV2F_C4B_T2F, texCoords); + glTexCoordPointer(2, GL_FLOAT, kQuadSize, (GLvoid*)(offset + diff)); + +#endif // ! CC_USES_VBO + + BOOL newBlend = blendFunc_.src != CC_BLEND_SRC || blendFunc_.dst != CC_BLEND_DST; + if( newBlend ) + glBlendFunc( blendFunc_.src, blendFunc_.dst ); + + NSAssert( particleIdx == particleCount, @"Abnormal error in particle quad"); + glDrawElements(GL_TRIANGLES, (GLsizei) particleIdx*6, GL_UNSIGNED_SHORT, indices_); + + // restore blend state + if( newBlend ) + glBlendFunc( CC_BLEND_SRC, CC_BLEND_DST ); + +#if CC_USES_VBO + glBindBuffer(GL_ARRAY_BUFFER, 0); +#endif + + // restore GL default state + // - +} + +@end + + diff --git a/libs/cocos2d/CCProgressTimer.h b/libs/cocos2d/CCProgressTimer.h new file mode 100755 index 0000000..9a07f2f --- /dev/null +++ b/libs/cocos2d/CCProgressTimer.h @@ -0,0 +1,83 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2010 Lam Pham + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + +#import +#import "CCSprite.h" + +/** Types of progress + @since v0.99.1 + */ +typedef enum { + /// Radial Counter-Clockwise + kCCProgressTimerTypeRadialCCW, + /// Radial ClockWise + kCCProgressTimerTypeRadialCW, + /// Horizontal Left-Right + kCCProgressTimerTypeHorizontalBarLR, + /// Horizontal Right-Left + kCCProgressTimerTypeHorizontalBarRL, + /// Vertical Bottom-top + kCCProgressTimerTypeVerticalBarBT, + /// Vertical Top-Bottom + kCCProgressTimerTypeVerticalBarTB, +} CCProgressTimerType; + +/** + CCProgresstimer is a subclass of CCNode. + It renders the inner sprite according to the percentage. + The progress can be Radial, Horizontal or vertical. + @since v0.99.1 + */ +@interface CCProgressTimer : CCNode +{ + CCProgressTimerType type_; + float percentage_; + CCSprite *sprite_; + + int vertexDataCount_; + ccV2F_C4B_T2F *vertexData_; +} + +/** Change the percentage to change progress. */ +@property (nonatomic, readwrite) CCProgressTimerType type; + +/** Percentages are from 0 to 100 */ +@property (nonatomic, readwrite) float percentage; + +/** The image to show the progress percentage */ +@property (nonatomic, readwrite, retain) CCSprite *sprite; + + +/** Creates a progress timer with an image filename as the shape the timer goes through */ ++ (id) progressWithFile:(NSString*) filename; +/** Initializes a progress timer with an image filename as the shape the timer goes through */ +- (id) initWithFile:(NSString*) filename; + +/** Creates a progress timer with the texture as the shape the timer goes through */ ++ (id) progressWithTexture:(CCTexture2D*) texture; +/** Creates a progress timer with the texture as the shape the timer goes through */ +- (id) initWithTexture:(CCTexture2D*) texture; + +@end diff --git a/libs/cocos2d/CCProgressTimer.m b/libs/cocos2d/CCProgressTimer.m new file mode 100755 index 0000000..4e697b2 --- /dev/null +++ b/libs/cocos2d/CCProgressTimer.m @@ -0,0 +1,493 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2010 Lam Pham + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + +#import "CCProgressTimer.h" + +#import "ccMacros.h" +#import "CCTextureCache.h" +#import "Support/CGPointExtension.h" + + + +#define kProgressTextureCoordsCount 4 +// kProgressTextureCoords holds points {0,0} {0,1} {1,1} {1,0} we can represent it as bits +const char kProgressTextureCoords = 0x1e; + +@interface CCProgressTimer (Internal) + +-(void)updateProgress; +-(void)updateBar; +-(void)updateRadial; +-(void)updateColor; +-(CGPoint)boundaryTexCoord:(char)index; +@end + + +@implementation CCProgressTimer +@synthesize percentage = percentage_; +@synthesize sprite = sprite_; +@synthesize type = type_; + ++(id)progressWithFile:(NSString*) filename +{ + return [[[self alloc]initWithFile:filename] autorelease]; +} +-(id)initWithFile:(NSString*) filename +{ + return [self initWithTexture:[[CCTextureCache sharedTextureCache] addImage: filename]]; +} + ++(id)progressWithTexture:(CCTexture2D*) texture +{ + return [[[self alloc]initWithTexture:texture] autorelease]; +} +-(id)initWithTexture:(CCTexture2D*) texture +{ + if(( self = [super init] )){ + self.sprite = [CCSprite spriteWithTexture:texture]; + percentage_ = 0.f; + vertexData_ = NULL; + vertexDataCount_ = 0; + self.anchorPoint = ccp(.5f,.5f); + self.contentSize = sprite_.contentSize; + self.type = kCCProgressTimerTypeRadialCCW; + } + return self; +} +-(void)dealloc +{ + if(vertexData_) + free(vertexData_); + + [sprite_ release]; + [super dealloc]; +} + +-(void)setPercentage:(float) percentage +{ + if(percentage_ != percentage) { + percentage_ = clampf( percentage, 0, 100); + [self updateProgress]; + } +} +-(void)setSprite:(CCSprite *)newSprite +{ + if(sprite_ != newSprite){ + [sprite_ release]; + sprite_ = [newSprite retain]; + + // Everytime we set a new sprite, we free the current vertex data + if(vertexData_){ + free(vertexData_); + vertexData_ = NULL; + vertexDataCount_ = 0; + } + } +} +-(void)setType:(CCProgressTimerType)newType +{ + if (newType != type_) { + + // release all previous information + if(vertexData_){ + free(vertexData_); + vertexData_ = NULL; + vertexDataCount_ = 0; + } + type_ = newType; + } +} +@end + +@implementation CCProgressTimer(Internal) + +/// +// @returns the vertex position from the texture coordinate +/// +-(ccVertex2F)vertexFromTexCoord:(CGPoint) texCoord +{ + CGPoint tmp; + ccVertex2F ret; + if (sprite_.texture) { + CCTexture2D *texture = [sprite_ texture]; + CGSize texSize = [texture contentSizeInPixels]; + tmp = ccp(texSize.width * texCoord.x/texture.maxS, + texSize.height * (1 - (texCoord.y/texture.maxT))); + } else + tmp = CGPointZero; + + ret.x = tmp.x; + ret.y = tmp.y; + return ret; +} + +-(void)updateColor +{ + GLubyte op = sprite_.opacity; + ccColor3B c3b = sprite_.color; + + ccColor4B color = { c3b.r, c3b.g, c3b.b, op }; + if([sprite_.texture hasPremultipliedAlpha]){ + color.r *= op/255; + color.g *= op/255; + color.b *= op/255; + } + + if(vertexData_){ + for (int i=0; i < vertexDataCount_; ++i) { + vertexData_[i].colors = color; + } + } +} + +-(void)updateProgress +{ + switch (type_) { + case kCCProgressTimerTypeRadialCW: + case kCCProgressTimerTypeRadialCCW: + [self updateRadial]; + break; + case kCCProgressTimerTypeHorizontalBarLR: + case kCCProgressTimerTypeHorizontalBarRL: + case kCCProgressTimerTypeVerticalBarBT: + case kCCProgressTimerTypeVerticalBarTB: + [self updateBar]; + break; + default: + break; + } +} + +/// +// Update does the work of mapping the texture onto the triangles +// It now doesn't occur the cost of free/alloc data every update cycle. +// It also only changes the percentage point but no other points if they have not +// been modified. +// +// It now deals with flipped texture. If you run into this problem, just use the +// sprite property and enable the methods flipX, flipY. +/// +-(void)updateRadial +{ + // Texture Max is the actual max coordinates to deal with non-power of 2 textures + CGPoint tMax = ccp(sprite_.texture.maxS,sprite_.texture.maxT); + + // Grab the midpoint + CGPoint midpoint = ccpCompMult(self.anchorPoint, tMax); + + float alpha = percentage_ / 100.f; + + // Otherwise we can get the angle from the alpha + float angle = 2.f*((float)M_PI) * ( type_ == kCCProgressTimerTypeRadialCW? alpha : 1.f - alpha); + + // We find the vector to do a hit detection based on the percentage + // We know the first vector is the one @ 12 o'clock (top,mid) so we rotate + // from that by the progress angle around the midpoint pivot + CGPoint topMid = ccp(midpoint.x, 0.f); + CGPoint percentagePt = ccpRotateByAngle(topMid, midpoint, angle); + + + int index = 0; + CGPoint hit = CGPointZero; + + if (alpha == 0.f) { + // More efficient since we don't always need to check intersection + // If the alpha is zero then the hit point is top mid and the index is 0. + hit = topMid; + index = 0; + } else if (alpha == 1.f) { + // More efficient since we don't always need to check intersection + // If the alpha is one then the hit point is top mid and the index is 4. + hit = topMid; + index = 4; + } else { + // We run a for loop checking the edges of the texture to find the + // intersection point + // We loop through five points since the top is split in half + + float min_t = FLT_MAX; + + for (int i = 0; i <= kProgressTextureCoordsCount; ++i) { + int pIndex = (i + (kProgressTextureCoordsCount - 1))%kProgressTextureCoordsCount; + + CGPoint edgePtA = ccpCompMult([self boundaryTexCoord:i % kProgressTextureCoordsCount],tMax); + CGPoint edgePtB = ccpCompMult([self boundaryTexCoord:pIndex],tMax); + + // Remember that the top edge is split in half for the 12 o'clock position + // Let's deal with that here by finding the correct endpoints + if(i == 0){ + edgePtB = ccpLerp(edgePtA,edgePtB,.5f); + } else if(i == 4){ + edgePtA = ccpLerp(edgePtA,edgePtB,.5f); + } + + // s and t are returned by ccpLineIntersect + float s = 0, t = 0; + if(ccpLineIntersect(edgePtA, edgePtB, midpoint, percentagePt, &s, &t)) + { + + // Since our hit test is on rays we have to deal with the top edge + // being in split in half so we have to test as a segment + if ((i == 0 || i == 4)) { + // s represents the point between edgePtA--edgePtB + if (!(0.f <= s && s <= 1.f)) { + continue; + } + } + // As long as our t isn't negative we are at least finding a + // correct hitpoint from midpoint to percentagePt. + if (t >= 0.f) { + // Because the percentage line and all the texture edges are + // rays we should only account for the shortest intersection + if (t < min_t) { + min_t = t; + index = i; + } + } + } + } + + // Now that we have the minimum magnitude we can use that to find our intersection + hit = ccpAdd(midpoint, ccpMult(ccpSub(percentagePt, midpoint),min_t)); + + } + + + // The size of the vertex data is the index from the hitpoint + // the 3 is for the midpoint, 12 o'clock point and hitpoint position. + + BOOL sameIndexCount = YES; + if(vertexDataCount_ != index + 3){ + sameIndexCount = NO; + if(vertexData_){ + free(vertexData_); + vertexData_ = NULL; + vertexDataCount_ = 0; + } + } + + + if(!vertexData_) { + vertexDataCount_ = index + 3; + vertexData_ = malloc(vertexDataCount_ * sizeof(ccV2F_C4B_T2F)); + NSAssert( vertexData_, @"CCProgressTimer. Not enough memory"); + + [self updateColor]; + } + + if (!sameIndexCount) { + + // First we populate the array with the midpoint, then all + // vertices/texcoords/colors of the 12 'o clock start and edges and the hitpoint + vertexData_[0].texCoords = (ccTex2F){midpoint.x, midpoint.y}; + vertexData_[0].vertices = [self vertexFromTexCoord:midpoint]; + + vertexData_[1].texCoords = (ccTex2F){midpoint.x, 0.f}; + vertexData_[1].vertices = [self vertexFromTexCoord:ccp(midpoint.x, 0.f)]; + + for(int i = 0; i < index; ++i){ + CGPoint texCoords = ccpCompMult([self boundaryTexCoord:i], tMax); + + vertexData_[i+2].texCoords = (ccTex2F){texCoords.x, texCoords.y}; + vertexData_[i+2].vertices = [self vertexFromTexCoord:texCoords]; + } + + // Flip the texture coordinates if set + if (sprite_.flipY || sprite_.flipX) { + for(int i = 0; i < vertexDataCount_ - 1; ++i){ + if (sprite_.flipX) { + vertexData_[i].texCoords.u = tMax.x - vertexData_[i].texCoords.u; + } + if(sprite_.flipY){ + vertexData_[i].texCoords.v = tMax.y - vertexData_[i].texCoords.v; + } + } + } + } + + // hitpoint will go last + vertexData_[vertexDataCount_ - 1].texCoords = (ccTex2F){hit.x, hit.y}; + vertexData_[vertexDataCount_ - 1].vertices = [self vertexFromTexCoord:hit]; + + if (sprite_.flipY || sprite_.flipX) { + if (sprite_.flipX) { + vertexData_[vertexDataCount_ - 1].texCoords.u = tMax.x - vertexData_[vertexDataCount_ - 1].texCoords.u; + } + if(sprite_.flipY){ + vertexData_[vertexDataCount_ - 1].texCoords.v = tMax.y - vertexData_[vertexDataCount_ - 1].texCoords.v; + } + } +} + +/// +// Update does the work of mapping the texture onto the triangles for the bar +// It now doesn't occur the cost of free/alloc data every update cycle. +// It also only changes the percentage point but no other points if they have not +// been modified. +// +// It now deals with flipped texture. If you run into this problem, just use the +// sprite property and enable the methods flipX, flipY. +/// +-(void)updateBar +{ + + float alpha = percentage_ / 100.f; + + CGPoint tMax = ccp(sprite_.texture.maxS,sprite_.texture.maxT); + + unsigned char vIndexes[2] = {0,0}; + unsigned char index = 0; + + // We know vertex data is always equal to the 4 corners + // If we don't have vertex data then we create it here and populate + // the side of the bar vertices that won't ever change. + if (!vertexData_) { + vertexDataCount_ = kProgressTextureCoordsCount; + vertexData_ = malloc(vertexDataCount_ * sizeof(ccV2F_C4B_T2F)); + NSAssert( vertexData_, @"CCProgressTimer. Not enough memory"); + + if(type_ == kCCProgressTimerTypeHorizontalBarLR){ + vertexData_[vIndexes[0] = 0].texCoords = (ccTex2F){0,0}; + vertexData_[vIndexes[1] = 1].texCoords = (ccTex2F){0, tMax.y}; + }else if (type_ == kCCProgressTimerTypeHorizontalBarRL) { + vertexData_[vIndexes[0] = 2].texCoords = (ccTex2F){tMax.x, tMax.y}; + vertexData_[vIndexes[1] = 3].texCoords = (ccTex2F){tMax.x, 0.f}; + }else if (type_ == kCCProgressTimerTypeVerticalBarBT) { + vertexData_[vIndexes[0] = 1].texCoords = (ccTex2F){0, tMax.y}; + vertexData_[vIndexes[1] = 3].texCoords = (ccTex2F){tMax.x, tMax.y}; + }else if (type_ == kCCProgressTimerTypeVerticalBarTB) { + vertexData_[vIndexes[0] = 0].texCoords = (ccTex2F){0, 0}; + vertexData_[vIndexes[1] = 2].texCoords = (ccTex2F){tMax.x, 0}; + } + + index = vIndexes[0]; + vertexData_[index].vertices = [self vertexFromTexCoord:ccp(vertexData_[index].texCoords.u, vertexData_[index].texCoords.v)]; + + index = vIndexes[1]; + vertexData_[index].vertices = [self vertexFromTexCoord:ccp(vertexData_[index].texCoords.u, vertexData_[index].texCoords.v)]; + + if (sprite_.flipY || sprite_.flipX) { + if (sprite_.flipX) { + index = vIndexes[0]; + vertexData_[index].texCoords.u = tMax.x - vertexData_[index].texCoords.u; + index = vIndexes[1]; + vertexData_[index].texCoords.u = tMax.x - vertexData_[index].texCoords.u; + } + if(sprite_.flipY){ + index = vIndexes[0]; + vertexData_[index].texCoords.v = tMax.y - vertexData_[index].texCoords.v; + index = vIndexes[1]; + vertexData_[index].texCoords.v = tMax.y - vertexData_[index].texCoords.v; + } + } + + [self updateColor]; + } + + if(type_ == kCCProgressTimerTypeHorizontalBarLR){ + vertexData_[vIndexes[0] = 3].texCoords = (ccTex2F){tMax.x*alpha, tMax.y}; + vertexData_[vIndexes[1] = 2].texCoords = (ccTex2F){tMax.x*alpha, 0}; + }else if (type_ == kCCProgressTimerTypeHorizontalBarRL) { + vertexData_[vIndexes[0] = 1].texCoords = (ccTex2F){tMax.x*(1.f - alpha), 0}; + vertexData_[vIndexes[1] = 0].texCoords = (ccTex2F){tMax.x*(1.f - alpha), tMax.y}; + }else if (type_ == kCCProgressTimerTypeVerticalBarBT) { + vertexData_[vIndexes[0] = 0].texCoords = (ccTex2F){0, tMax.y*(1.f - alpha)}; + vertexData_[vIndexes[1] = 2].texCoords = (ccTex2F){tMax.x, tMax.y*(1.f - alpha)}; + }else if (type_ == kCCProgressTimerTypeVerticalBarTB) { + vertexData_[vIndexes[0] = 1].texCoords = (ccTex2F){0, tMax.y*alpha}; + vertexData_[vIndexes[1] = 3].texCoords = (ccTex2F){tMax.x, tMax.y*alpha}; + } + + index = vIndexes[0]; + vertexData_[index].vertices = [self vertexFromTexCoord:ccp(vertexData_[index].texCoords.u, vertexData_[index].texCoords.v)]; + index = vIndexes[1]; + vertexData_[index].vertices = [self vertexFromTexCoord:ccp(vertexData_[index].texCoords.u, vertexData_[index].texCoords.v)]; + + if (sprite_.flipY || sprite_.flipX) { + if (sprite_.flipX) { + index = vIndexes[0]; + vertexData_[index].texCoords.u = tMax.x - vertexData_[index].texCoords.u; + index = vIndexes[1]; + vertexData_[index].texCoords.u = tMax.x - vertexData_[index].texCoords.u; + } + if(sprite_.flipY){ + index = vIndexes[0]; + vertexData_[index].texCoords.v = tMax.y - vertexData_[index].texCoords.v; + index = vIndexes[1]; + vertexData_[index].texCoords.v = tMax.y - vertexData_[index].texCoords.v; + } + } + +} + +-(CGPoint)boundaryTexCoord:(char)index +{ + if (index < kProgressTextureCoordsCount) { + switch (type_) { + case kCCProgressTimerTypeRadialCW: + return ccp((kProgressTextureCoords>>((index<<1)+1))&1,(kProgressTextureCoords>>(index<<1))&1); + case kCCProgressTimerTypeRadialCCW: + return ccp((kProgressTextureCoords>>(7-(index<<1)))&1,(kProgressTextureCoords>>(7-((index<<1)+1)))&1); + default: + break; + } + } + return CGPointZero; +} + +-(void)draw +{ + [super draw]; + + if(!vertexData_)return; + if(!sprite_)return; + ccBlendFunc blendFunc = sprite_.blendFunc; + BOOL newBlend = blendFunc.src != CC_BLEND_SRC || blendFunc.dst != CC_BLEND_DST; + if( newBlend ) + glBlendFunc( blendFunc.src, blendFunc.dst ); + + /// ======================================================================== + // Replaced [texture_ drawAtPoint:CGPointZero] with my own vertexData + // Everything above me and below me is copied from CCTextureNode's draw + glBindTexture(GL_TEXTURE_2D, sprite_.texture.name); + glVertexPointer(2, GL_FLOAT, sizeof(ccV2F_C4B_T2F), &vertexData_[0].vertices); + glTexCoordPointer(2, GL_FLOAT, sizeof(ccV2F_C4B_T2F), &vertexData_[0].texCoords); + glColorPointer(4, GL_UNSIGNED_BYTE, sizeof(ccV2F_C4B_T2F), &vertexData_[0].colors); + if(type_ == kCCProgressTimerTypeRadialCCW || type_ == kCCProgressTimerTypeRadialCW){ + glDrawArrays(GL_TRIANGLE_FAN, 0, vertexDataCount_); + } else if (type_ == kCCProgressTimerTypeHorizontalBarLR || + type_ == kCCProgressTimerTypeHorizontalBarRL || + type_ == kCCProgressTimerTypeVerticalBarBT || + type_ == kCCProgressTimerTypeVerticalBarTB) { + glDrawArrays(GL_TRIANGLE_STRIP, 0, vertexDataCount_); + } + //glDrawElements(GL_TRIANGLES, indicesCount_, GL_UNSIGNED_BYTE, indices_); + /// ======================================================================== + + if( newBlend ) + glBlendFunc(CC_BLEND_SRC, CC_BLEND_DST); +} + +@end diff --git a/libs/cocos2d/CCProtocols.h b/libs/cocos2d/CCProtocols.h new file mode 100755 index 0000000..f7043fc --- /dev/null +++ b/libs/cocos2d/CCProtocols.h @@ -0,0 +1,125 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2008-2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ + + +#import "ccTypes.h" +#import "CCTexture2D.h" + +#pragma mark - +#pragma mark CCRGBAProtocol + +/// CC RGBA protocol +@protocol CCRGBAProtocol +/** sets Color + @since v0.8 + */ +-(void) setColor:(ccColor3B)color; +/** returns the color + @since v0.8 + */ +-(ccColor3B) color; + +/// returns the opacity +-(GLubyte) opacity; +/** sets the opacity. + @warning If the the texture has premultiplied alpha then, the R, G and B channels will be modifed. + Values goes from 0 to 255, where 255 means fully opaque. + */ +-(void) setOpacity: (GLubyte) opacity; +@optional +/** sets the premultipliedAlphaOpacity property. + If set to NO then opacity will be applied as: glColor(R,G,B,opacity); + If set to YES then oapcity will be applied as: glColor(opacity, opacity, opacity, opacity ); + Textures with premultiplied alpha will have this property by default on YES. Otherwise the default value is NO + @since v0.8 + */ +-(void) setOpacityModifyRGB:(BOOL)boolean; +/** returns whether or not the opacity will be applied using glColor(R,G,B,opacity) or glColor(opacity, opacity, opacity, opacity); + @since v0.8 + */ + -(BOOL) doesOpacityModifyRGB; +@end + +#pragma mark - +#pragma mark CCBlendProtocol +/** + You can specify the blending fuction. + @since v0.99.0 + */ +@protocol CCBlendProtocol +/** set the source blending function for the texture */ +-(void) setBlendFunc:(ccBlendFunc)blendFunc; +/** returns the blending function used for the texture */ +-(ccBlendFunc) blendFunc; +@end + + +#pragma mark - +#pragma mark CCTextureProtocol + +/** CCNode objects that uses a Texture2D to render the images. + The texture can have a blending function. + If the texture has alpha premultiplied the default blending function is: + src=GL_ONE dst= GL_ONE_MINUS_SRC_ALPHA + else + src=GL_SRC_ALPHA dst= GL_ONE_MINUS_SRC_ALPHA + But you can change the blending funtion at any time. + @since v0.8.0 + */ +@protocol CCTextureProtocol +/** returns the used texture */ +-(CCTexture2D*) texture; +/** sets a new texture. it will be retained */ +-(void) setTexture:(CCTexture2D*)texture; +@end + +#pragma mark - +#pragma mark CCLabelProtocol +/** Common interface for Labels */ +@protocol CCLabelProtocol +/** sets a new label using an NSString. + The string will be copied. + */ +-(void) setString:(NSString*)label; +/** returns the string that is rendered */ +-(NSString*) string; +@optional +/** sets a new label using a CString. + It is faster than setString since it doesn't require to alloc/retain/release an NString object. + @since v0.99.0 + */ +-(void) setCString:(char*)label; +@end + + +#pragma mark - +#pragma mark CCProjectionProtocol +/** OpenGL projection protocol */ +@protocol CCProjectionProtocol +/** Called by CCDirector when the porjection is updated, and "custom" projection is used + @since v0.99.5 + */ +-(void) updateProjection; +@end diff --git a/libs/cocos2d/CCRenderTexture.h b/libs/cocos2d/CCRenderTexture.h new file mode 100755 index 0000000..d5e39cc --- /dev/null +++ b/libs/cocos2d/CCRenderTexture.h @@ -0,0 +1,108 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2009 Jason Booth + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + +#import +#import "CCNode.h" +#import "CCSprite.h" +#import "Support/OpenGL_Internal.h" + +#import +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED +#import +#endif // iPHone + +enum +{ + kCCImageFormatJPG = 0, + kCCImageFormatPNG = 1, + kCCImageFormatRawData =2 +}; + + +/** + CCRenderTexture is a generic rendering target. To render things into it, + simply construct a render target, call begin on it, call visit on any cocos + scenes or objects to render them, and call end. For convienience, render texture + adds a sprite as it's display child with the results, so you can simply add + the render texture to your scene and treat it like any other CocosNode. + There are also functions for saving the render texture to disk in PNG or JPG format. + + @since v0.8.1 + */ +@interface CCRenderTexture : CCNode +{ + GLuint fbo_; + GLint oldFBO_; + CCTexture2D* texture_; + CCSprite* sprite_; + + GLenum pixelFormat_; +} + +/** The CCSprite being used. + The sprite, by default, will use the following blending function: GL_ONE, GL_ONE_MINUS_SRC_ALPHA. + The blending function can be changed in runtime by calling: + - [[renderTexture sprite] setBlendFunc:(ccBlendFunc){GL_ONE, GL_ONE_MINUS_SRC_ALPHA}]; +*/ +@property (nonatomic,readwrite, assign) CCSprite* sprite; + +/** creates a RenderTexture object with width and height in Points and a pixel format, only RGB and RGBA formats are valid */ ++(id)renderTextureWithWidth:(int)w height:(int)h pixelFormat:(CCTexture2DPixelFormat) format; + +/** creates a RenderTexture object with width and height in Points, pixel format is RGBA8888 */ ++(id)renderTextureWithWidth:(int)w height:(int)h; + +/** initializes a RenderTexture object with width and height in Points and a pixel format, only RGB and RGBA formats are valid */ +-(id)initWithWidth:(int)w height:(int)h pixelFormat:(CCTexture2DPixelFormat) format; + +/** starts grabbing */ +-(void)begin; + +/** starts rendering to the texture while clearing the texture first. + This is more efficient then calling -clear first and then -begin */ +-(void)beginWithClear:(float)r g:(float)g b:(float)b a:(float)a; + +/** ends grabbing */ +-(void)end; + +/** clears the texture with a color */ +-(void)clear:(float)r g:(float)g b:(float)b a:(float)a; + +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED + +/** saves the texture into a file */ +-(BOOL)saveBuffer:(NSString*)name; +/** saves the texture into a file. The format can be JPG or PNG */ +-(BOOL)saveBuffer:(NSString*)name format:(int)format; +/* get buffer as UIImage, can only save a render buffer which has a RGBA8888 pixel format */ +-(NSData*)getUIImageAsDataFromBuffer:(int) format; +/* get buffer as UIImage */ +-(UIImage *)getUIImageFromBuffer; + +#endif // __IPHONE_OS_VERSION_MAX_ALLOWED + +@end + + diff --git a/libs/cocos2d/CCRenderTexture.m b/libs/cocos2d/CCRenderTexture.m new file mode 100755 index 0000000..4a4768e --- /dev/null +++ b/libs/cocos2d/CCRenderTexture.m @@ -0,0 +1,340 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2009 Jason Booth + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + +#import +#import "CCRenderTexture.h" +#import "CCDirector.h" +#import "ccMacros.h" +#import "Support/ccUtils.h" +#import "Support/CCFileUtils.h" + +@implementation CCRenderTexture + +@synthesize sprite=sprite_; + +// issue #994 ++(id)renderTextureWithWidth:(int)w height:(int)h pixelFormat:(CCTexture2DPixelFormat) format +{ + return [[[self alloc] initWithWidth:w height:h pixelFormat:format] autorelease]; +} + ++(id)renderTextureWithWidth:(int)w height:(int)h +{ + return [[[self alloc] initWithWidth:w height:h pixelFormat:kCCTexture2DPixelFormat_RGBA8888] autorelease]; +} + +-(id)initWithWidth:(int)w height:(int)h +{ + return [self initWithWidth:w height:h pixelFormat:kCCTexture2DPixelFormat_RGBA8888]; +} + +-(id)initWithWidth:(int)w height:(int)h pixelFormat:(CCTexture2DPixelFormat) format +{ + if ((self = [super init])) + { + NSAssert(format != kCCTexture2DPixelFormat_A8,@"only RGB and RGBA formats are valid for a render texture"); + + w *= CC_CONTENT_SCALE_FACTOR(); + h *= CC_CONTENT_SCALE_FACTOR(); + + glGetIntegerv(CC_GL_FRAMEBUFFER_BINDING, &oldFBO_); + + // textures must be power of two + NSUInteger powW = ccNextPOT(w); + NSUInteger powH = ccNextPOT(h); + + void *data = malloc((int)(powW * powH * 4)); + memset(data, 0, (int)(powW * powH * 4)); + pixelFormat_=format; + + texture_ = [[CCTexture2D alloc] initWithData:data pixelFormat:pixelFormat_ pixelsWide:powW pixelsHigh:powH contentSize:CGSizeMake(w, h)]; + free( data ); + + // generate FBO + ccglGenFramebuffers(1, &fbo_); + ccglBindFramebuffer(CC_GL_FRAMEBUFFER, fbo_); + + // associate texture with FBO + ccglFramebufferTexture2D(CC_GL_FRAMEBUFFER, CC_GL_COLOR_ATTACHMENT0, GL_TEXTURE_2D, texture_.name, 0); + + // check if it worked (probably worth doing :) ) + GLuint status = ccglCheckFramebufferStatus(CC_GL_FRAMEBUFFER); + if (status != CC_GL_FRAMEBUFFER_COMPLETE) + { + [NSException raise:@"Render Texture" format:@"Could not attach texture to framebuffer"]; + } + [texture_ setAliasTexParameters]; + + sprite_ = [CCSprite spriteWithTexture:texture_]; + + [texture_ release]; + [sprite_ setScaleY:-1]; + [self addChild:sprite_]; + + // issue #937 + [sprite_ setBlendFunc:(ccBlendFunc){GL_ONE, GL_ONE_MINUS_SRC_ALPHA}]; + + ccglBindFramebuffer(CC_GL_FRAMEBUFFER, oldFBO_); + } + return self; +} + +-(void)dealloc +{ +// [self removeAllChildrenWithCleanup:YES]; + ccglDeleteFramebuffers(1, &fbo_); + [super dealloc]; +} + +-(void)begin +{ + // Save the current matrix + glPushMatrix(); + + CGSize texSize = [texture_ contentSizeInPixels]; + + + // Calculate the adjustment ratios based on the old and new projections + CGSize size = [[CCDirector sharedDirector] displaySizeInPixels]; + float widthRatio = size.width / texSize.width; + float heightRatio = size.height / texSize.height; + + + // Adjust the orthographic propjection and viewport + ccglOrtho((float)-1.0 / widthRatio, (float)1.0 / widthRatio, (float)-1.0 / heightRatio, (float)1.0 / heightRatio, -1,1); + glViewport(0, 0, texSize.width, texSize.height); + + + glGetIntegerv(CC_GL_FRAMEBUFFER_BINDING, &oldFBO_); + ccglBindFramebuffer(CC_GL_FRAMEBUFFER, fbo_);//Will direct drawing to the frame buffer created above + + // Issue #1145 + // There is no need to enable the default GL states here + // but since CCRenderTexture is mostly used outside the "render" loop + // these states needs to be enabled. + // Since this bug was discovered in API-freeze (very close of 1.0 release) + // This bug won't be fixed to prevent incompatibilities with code. + // + // If you understand the above mentioned message, then you can comment the following line + // and enable the gl states manually, in case you need them. + CC_ENABLE_DEFAULT_GL_STATES(); +} + +-(void)beginWithClear:(float)r g:(float)g b:(float)b a:(float)a +{ + [self begin]; + + // save clear color + GLfloat clearColor[4]; + glGetFloatv(GL_COLOR_CLEAR_VALUE,clearColor); + + glClearColor(r, g, b, a); + glClear(GL_COLOR_BUFFER_BIT | GL_DEPTH_BUFFER_BIT); + + // restore clear color + glClearColor(clearColor[0], clearColor[1], clearColor[2], clearColor[3]); +} + +-(void)end +{ + ccglBindFramebuffer(CC_GL_FRAMEBUFFER, oldFBO_); + // Restore the original matrix and viewport + glPopMatrix(); + CGSize size = [[CCDirector sharedDirector] displaySizeInPixels]; + glViewport(0, 0, size.width, size.height); +} + +-(void)clear:(float)r g:(float)g b:(float)b a:(float)a +{ + [self beginWithClear:r g:g b:b a:a]; + [self end]; +} + +#pragma mark RenderTexture - Save Image + +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED +-(BOOL)saveBuffer:(NSString*)name +{ + return [self saveBuffer:name format:kCCImageFormatJPG]; +} + +-(BOOL)saveBuffer:(NSString*)fileName format:(int)format +{ + NSString *fullPath = [CCFileUtils fullPathFromRelativePath:fileName]; + + NSData *data = [self getUIImageAsDataFromBuffer:format]; + + return [data writeToFile:fullPath atomically:YES]; +} + +/* get buffer as UIImage */ +-(UIImage *)getUIImageFromBuffer +{ + NSAssert(pixelFormat_ == kCCTexture2DPixelFormat_RGBA8888,@"only RGBA8888 can be saved as image"); + + CGSize s = [texture_ contentSizeInPixels]; + int tx = s.width; + int ty = s.height; + + int bitsPerComponent = 8; + int bitsPerPixel = 32; + int bytesPerPixel = (bitsPerComponent * 4)/8; + int bytesPerRow = bytesPerPixel * tx; + NSInteger myDataLength = bytesPerRow * ty; + + NSMutableData *buffer = [[NSMutableData alloc] initWithCapacity:myDataLength]; + NSMutableData *pixels = [[NSMutableData alloc] initWithCapacity:myDataLength]; + + if( ! (buffer && pixels) ) { + CCLOG(@"cocos2d: CCRenderTexture#getUIImageFromBuffer: not enough memory"); + [buffer release]; + [pixels release]; + return nil; + } + + [self begin]; + glReadPixels(0,0,tx,ty,GL_RGBA,GL_UNSIGNED_BYTE, [buffer mutableBytes]); + [self end]; + + // make data provider with data. + + CGBitmapInfo bitmapInfo = kCGImageAlphaPremultipliedLast | kCGBitmapByteOrderDefault; + CGDataProviderRef provider = CGDataProviderCreateWithData(NULL, [buffer mutableBytes], myDataLength, NULL); + CGColorSpaceRef colorSpaceRef = CGColorSpaceCreateDeviceRGB(); + CGImageRef iref = CGImageCreate(tx, ty, + bitsPerComponent, bitsPerPixel, bytesPerRow, + colorSpaceRef, bitmapInfo, provider, + NULL, false, + kCGRenderingIntentDefault); + + CGContextRef context = CGBitmapContextCreate([pixels mutableBytes], tx, + ty, CGImageGetBitsPerComponent(iref), + CGImageGetBytesPerRow(iref), CGImageGetColorSpace(iref), + bitmapInfo); + CGContextTranslateCTM(context, 0.0f, ty); + CGContextScaleCTM(context, 1.0f, -1.0f); + CGContextDrawImage(context, CGRectMake(0.0f, 0.0f, tx, ty), iref); + CGImageRef outputRef = CGBitmapContextCreateImage(context); + UIImage* image = [[UIImage alloc] initWithCGImage:outputRef]; + + CGImageRelease(iref); + CGContextRelease(context); + CGColorSpaceRelease(colorSpaceRef); + CGDataProviderRelease(provider); + CGImageRelease(outputRef); + + [pixels release]; + [buffer release]; + + return [image autorelease]; +} + +-(NSData*)getUIImageAsDataFromBuffer:(int) format +{ + NSAssert(pixelFormat_ == kCCTexture2DPixelFormat_RGBA8888,@"only RGBA8888 can be saved as image"); + + CGSize s = [texture_ contentSizeInPixels]; + int tx = s.width; + int ty = s.height; + + int bitsPerComponent=8; + int bitsPerPixel=32; + + int bytesPerRow = (bitsPerPixel/8) * tx; + NSInteger myDataLength = bytesPerRow * ty; + + GLubyte *buffer = malloc(sizeof(GLubyte)*myDataLength); + GLubyte *pixels = malloc(sizeof(GLubyte)*myDataLength); + + if( ! (buffer && pixels) ) { + CCLOG(@"cocos2d: CCRenderTexture#getUIImageFromBuffer: not enough memory"); + free(buffer); + free(pixels); + return nil; + } + + [self begin]; + glReadPixels(0,0,tx,ty,GL_RGBA,GL_UNSIGNED_BYTE, buffer); + [self end]; + + int x,y; + + for(y = 0; y +{ + NSMutableArray* segments_; + NSMutableArray* deletedSegments_; + + CGPoint lastPoint1_; + CGPoint lastPoint2_; + CGPoint lastLocation_; + int vertCount_; + float texVPos_; + float curTime_; + float fadeTime_; + float delta_; + float lastWidth_; + float lastSign_; + BOOL pastFirstPoint_; + + // Texture used + CCTexture2D* texture_; + + // texture length + float textureLength_; + + // RGBA protocol + ccColor4B color_; + + // blend func + ccBlendFunc blendFunc_; +} + +/** Texture used by the ribbon. Conforms to CCTextureProtocol protocol */ +@property (nonatomic,readwrite,retain) CCTexture2D* texture; + +/** Texture lengths in pixels */ +@property (nonatomic,readwrite) float textureLength; + +/** GL blendind function */ +@property (nonatomic,readwrite,assign) ccBlendFunc blendFunc; + +/** color used by the Ribbon (RGBA) */ +@property (nonatomic,readwrite) ccColor4B color; + +/** creates the ribbon */ ++(id)ribbonWithWidth:(float)w image:(NSString*)path length:(float)l color:(ccColor4B)color fade:(float)fade; +/** init the ribbon */ +-(id)initWithWidth:(float)w image:(NSString*)path length:(float)l color:(ccColor4B)color fade:(float)fade; +/** add a point to the ribbon */ +-(void)addPointAt:(CGPoint)location width:(float)w; +/** polling function */ +-(void)update:(ccTime)delta; +/** determine side of line */ +-(float)sideOfLine:(CGPoint)p l1:(CGPoint)l1 l2:(CGPoint)l2; + +@end + +/** object to hold ribbon segment data */ +@interface CCRibbonSegment : NSObject +{ +@public + GLfloat verts[50*6]; + GLfloat coords[50*4]; + GLubyte colors[50*8]; + float creationTime[50]; + BOOL finished; + uint end; + uint begin; +} +-(id)init; +-(void)reset; +-(void)draw:(float)curTime fadeTime:(float)fadeTime color:(ccColor4B)color; +@end diff --git a/libs/cocos2d/CCRibbon.m b/libs/cocos2d/CCRibbon.m new file mode 100755 index 0000000..2d9acaa --- /dev/null +++ b/libs/cocos2d/CCRibbon.m @@ -0,0 +1,383 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2008, 2009 Jason Booth + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ + +/* + * A ribbon is a dynamically generated list of polygons drawn as a single or series + * of triangle strips. The primary use of Ribbon is as the drawing class of Motion Streak, + * but it is quite useful on it's own. When manually drawing a ribbon, you can call addPointAt + * and pass in the parameters for the next location in the ribbon. The system will automatically + * generate new polygons, texture them accourding to your texture width, etc, etc. + * + * Ribbon data is stored in a RibbonSegment class. This class statically allocates enough verticies and + * texture coordinates for 50 locations (100 verts or 48 triangles). The ribbon class will allocate + * new segments when they are needed, and reuse old ones if available. The idea is to avoid constantly + * allocating new memory and prefer a more static method. However, since there is no way to determine + * the maximum size of some ribbons (motion streaks), a truely static allocation is not possible. + * + */ + + +#import "CCRibbon.h" +#import "CCTextureCache.h" +#import "Support/CGPointExtension.h" +#import "ccMacros.h" + +// +// Ribbon +// +@implementation CCRibbon +@synthesize blendFunc=blendFunc_; +@synthesize color=color_; +@synthesize textureLength = textureLength_; + ++(id)ribbonWithWidth:(float)w image:(NSString*)path length:(float)l color:(ccColor4B)color fade:(float)fade +{ + self = [[[self alloc] initWithWidth:w image:path length:l color:color fade:fade] autorelease]; + return self; +} + +-(id)initWithWidth:(float)w image:(NSString*)path length:(float)l color:(ccColor4B)color fade:(float)fade +{ + self = [super init]; + if (self) + { + + segments_ = [[NSMutableArray alloc] init]; + deletedSegments_ = [[NSMutableArray alloc] init]; + + /* 1 initial segment */ + CCRibbonSegment* seg = [[CCRibbonSegment alloc] init]; + [segments_ addObject:seg]; + [seg release]; + + textureLength_ = l; + + color_ = color; + fadeTime_ = fade; + lastLocation_ = CGPointZero; + lastWidth_ = w/2; + texVPos_ = 0.0f; + + curTime_ = 0; + pastFirstPoint_ = NO; + + /* XXX: + Ribbon, by default uses this blend function, which might not be correct + if you are using premultiplied alpha images, + but 99% you might want to use this blending function regarding of the texture + */ + blendFunc_.src = GL_SRC_ALPHA; + blendFunc_.dst = GL_ONE_MINUS_SRC_ALPHA; + + self.texture = [[CCTextureCache sharedTextureCache] addImage:path]; + + /* default texture parameter */ + ccTexParams params = { GL_LINEAR, GL_LINEAR, GL_REPEAT, GL_REPEAT }; + [texture_ setTexParameters:¶ms]; + } + return self; +} + +-(void)dealloc +{ + [segments_ release]; + [deletedSegments_ release]; + [texture_ release]; + [super dealloc]; +} + +// rotates a point around 0, 0 +-(CGPoint)rotatePoint:(CGPoint)vec rotation:(float)a +{ + float xtemp = (vec.x * cosf(a)) - (vec.y * sinf(a)); + vec.y = (vec.x * sinf(a)) + (vec.y * cosf(a)); + vec.x = xtemp; + return vec; +} + +-(void)update:(ccTime)delta +{ + curTime_+= delta; + delta_ = delta; +} + +-(float)sideOfLine:(CGPoint)p l1:(CGPoint)l1 l2:(CGPoint)l2 +{ + CGPoint vp = ccpPerp(ccpSub(l1, l2)); + CGPoint vx = ccpSub(p, l1); + return ccpDot(vx, vp); +} + +// adds a new segment to the ribbon +-(void)addPointAt:(CGPoint)location width:(float)w +{ + location.x *= CC_CONTENT_SCALE_FACTOR(); + location.y *= CC_CONTENT_SCALE_FACTOR(); + + w = w*0.5f; + // if this is the first point added, cache it and return + if (!pastFirstPoint_) + { + lastWidth_ = w; + lastLocation_ = location; + pastFirstPoint_ = YES; + return; + } + + CGPoint sub = ccpSub(lastLocation_, location); + float r = ccpToAngle(sub) + (float)M_PI_2; + CGPoint p1 = ccpAdd([self rotatePoint:ccp(-w, 0) rotation:r], location); + CGPoint p2 = ccpAdd([self rotatePoint:ccp(w, 0) rotation:r], location); + float len = sqrtf(powf(lastLocation_.x - location.x, 2) + powf(lastLocation_.y - location.y, 2)); + float tend = texVPos_ + len/textureLength_; + CCRibbonSegment* seg; + // grab last segment + seg = [segments_ lastObject]; + // lets kill old segments + for (CCRibbonSegment* seg2 in segments_) + { + if (seg2 != seg && seg2->finished) + { + [deletedSegments_ addObject:seg2]; + } + } + [segments_ removeObjectsInArray:deletedSegments_]; + // is the segment full? + if (seg->end >= 50) + [segments_ removeObjectsInArray:deletedSegments_]; + // grab last segment and append to it if it's not full + seg = [segments_ lastObject]; + // is the segment full? + if (seg->end >= 50) + { + CCRibbonSegment* newSeg; + // grab it from the cache if we can + if ([deletedSegments_ count] > 0) + { + newSeg = [deletedSegments_ objectAtIndex:0]; + [newSeg retain]; // will be released later + [deletedSegments_ removeObject:newSeg]; + [newSeg reset]; + } + else + { + newSeg = [[CCRibbonSegment alloc] init]; // will be released later + } + + newSeg->creationTime[0] = seg->creationTime[seg->end - 1]; + int v = (seg->end-1)*6; + int c = (seg->end-1)*4; + newSeg->verts[0] = seg->verts[v]; + newSeg->verts[1] = seg->verts[v+1]; + newSeg->verts[2] = seg->verts[v+2]; + newSeg->verts[3] = seg->verts[v+3]; + newSeg->verts[4] = seg->verts[v+4]; + newSeg->verts[5] = seg->verts[v+5]; + + newSeg->coords[0] = seg->coords[c]; + newSeg->coords[1] = seg->coords[c+1]; + newSeg->coords[2] = seg->coords[c+2]; + newSeg->coords[3] = seg->coords[c+3]; + newSeg->end++; + seg = newSeg; + [segments_ addObject:seg]; + [newSeg release]; // it was retained before + + } + if (seg->end == 0) + { + // first edge has to get rotation from the first real polygon + CGPoint lp1 = ccpAdd([self rotatePoint:ccp(-lastWidth_, 0) rotation:r], lastLocation_); + CGPoint lp2 = ccpAdd([self rotatePoint:ccp(+lastWidth_, 0) rotation:r], lastLocation_); + seg->creationTime[0] = curTime_ - delta_; + seg->verts[0] = lp1.x; + seg->verts[1] = lp1.y; + seg->verts[2] = 0.0f; + seg->verts[3] = lp2.x; + seg->verts[4] = lp2.y; + seg->verts[5] = 0.0f; + seg->coords[0] = 0.0f; + seg->coords[1] = texVPos_; + seg->coords[2] = 1.0f; + seg->coords[3] = texVPos_; + seg->end++; + } + + int v = seg->end*6; + int c = seg->end*4; + // add new vertex + seg->creationTime[seg->end] = curTime_; + seg->verts[v] = p1.x; + seg->verts[v+1] = p1.y; + seg->verts[v+2] = 0.0f; + seg->verts[v+3] = p2.x; + seg->verts[v+4] = p2.y; + seg->verts[v+5] = 0.0f; + + + seg->coords[c] = 0.0f; + seg->coords[c+1] = tend; + seg->coords[c+2] = 1.0f; + seg->coords[c+3] = tend; + + texVPos_ = tend; + lastLocation_ = location; + lastPoint1_ = p1; + lastPoint2_ = p2; + lastWidth_ = w; + seg->end++; +} + +-(void) draw +{ + [super draw]; + + if ([segments_ count] > 0) + { + // Default GL states: GL_TEXTURE_2D, GL_VERTEX_ARRAY, GL_COLOR_ARRAY, GL_TEXTURE_COORD_ARRAY + // Needed states: GL_TEXTURE_2D, GL_VERTEX_ARRAY, GL_TEXTURE_COORD_ARRAY + // Unneeded states: GL_COLOR_ARRAY + glDisableClientState(GL_COLOR_ARRAY); + + glBindTexture(GL_TEXTURE_2D, [texture_ name]); + + BOOL newBlend = blendFunc_.src != CC_BLEND_SRC || blendFunc_.dst != CC_BLEND_DST; + if( newBlend ) + glBlendFunc( blendFunc_.src, blendFunc_.dst ); + + for (CCRibbonSegment* seg in segments_) + [seg draw:curTime_ fadeTime:fadeTime_ color:color_]; + + if( newBlend ) + glBlendFunc(CC_BLEND_SRC, CC_BLEND_DST); + + // restore default GL state + glEnableClientState( GL_COLOR_ARRAY ); + } +} + +#pragma mark Ribbon - CocosNodeTexture protocol +-(void) setTexture:(CCTexture2D*) texture +{ + [texture_ release]; + texture_ = [texture retain]; + [self setContentSizeInPixels: texture.contentSizeInPixels]; + /* XXX Don't update blending function in Ribbons */ +} + +-(CCTexture2D*) texture +{ + return texture_; +} + +@end + + +#pragma mark - +#pragma mark RibbonSegment + +@implementation CCRibbonSegment + +-(id)init +{ + self = [super init]; + if (self) + { + [self reset]; + } + return self; +} + +- (NSString*) description +{ + return [NSString stringWithFormat:@"<%@ = %08X | end = %i, begin = %i>", [self class], self, end, begin]; +} + +- (void) dealloc +{ + CCLOGINFO(@"cocos2d: deallocing %@", self); + [super dealloc]; +} + +-(void)reset +{ + end = 0; + begin = 0; + finished = NO; +} + +-(void)draw:(float)curTime fadeTime:(float)fadeTime color:(ccColor4B)color +{ + GLubyte r = color.r; + GLubyte g = color.g; + GLubyte b = color.b; + GLubyte a = color.a; + + if (begin < 50) + { + // the motion streak class will call update and cause time to change, thus, if curTime_ != 0 + // we have to generate alpha for the ribbon each frame. + if (curTime == 0) + { + // no alpha over time, so just set the color + glColor4ub(r,g,b,a); + } + else + { + // generate alpha/color for each point + glEnableClientState(GL_COLOR_ARRAY); + uint i = begin; + for (; i < end; ++i) + { + int idx = i*8; + colors[idx] = r; + colors[idx+1] = g; + colors[idx+2] = b; + colors[idx+4] = r; + colors[idx+5] = g; + colors[idx+6] = b; + float alive = ((curTime - creationTime[i]) / fadeTime); + if (alive > 1) + { + begin++; + colors[idx+3] = 0; + colors[idx+7] = 0; + } + else + { + colors[idx+3] = (GLubyte)(255.f - (alive * 255.f)); + colors[idx+7] = colors[idx+3]; + } + } + glColorPointer(4, GL_UNSIGNED_BYTE, 0, &colors[begin*8]); + } + glVertexPointer(3, GL_FLOAT, 0, &verts[begin*6]); + glTexCoordPointer(2, GL_FLOAT, 0, &coords[begin*4]); + glDrawArrays(GL_TRIANGLE_STRIP, 0, (end - begin) * 2); + } + else + finished = YES; +} +@end + diff --git a/libs/cocos2d/CCScene.h b/libs/cocos2d/CCScene.h new file mode 100755 index 0000000..1d104bc --- /dev/null +++ b/libs/cocos2d/CCScene.h @@ -0,0 +1,43 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2008-2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + + +#import "CCNode.h" + +/** CCScene is a subclass of CCNode that is used only as an abstract concept. + + CCScene an CCNode are almost identical with the difference that CCScene has it's + anchor point (by default) at the center of the screen. + + For the moment CCScene has no other logic than that, but in future releases it might have + additional logic. + + It is a good practice to use and CCScene as the parent of all your nodes. +*/ +@interface CCScene : CCNode +{ +} +@end diff --git a/libs/cocos2d/CCScene.m b/libs/cocos2d/CCScene.m new file mode 100755 index 0000000..e991d6e --- /dev/null +++ b/libs/cocos2d/CCScene.m @@ -0,0 +1,45 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2008-2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + + +#import "CCScene.h" +#import "Support/CGPointExtension.h" +#import "CCDirector.h" + + +@implementation CCScene +-(id) init +{ + if( (self=[super init]) ) { + CGSize s = [[CCDirector sharedDirector] winSize]; + self.isRelativeAnchorPoint = NO; + anchorPoint_ = ccp(0.5f, 0.5f); + [self setContentSize:s]; + } + + return self; +} +@end diff --git a/libs/cocos2d/CCScheduler.h b/libs/cocos2d/CCScheduler.h new file mode 100755 index 0000000..122b8fe --- /dev/null +++ b/libs/cocos2d/CCScheduler.h @@ -0,0 +1,199 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2008-2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ + + + +#import "Support/uthash.h" +#import "ccTypes.h" + +typedef void (*TICK_IMP)(id, SEL, ccTime); + +// +// CCTimer +// +/** Light weight timer */ +@interface CCTimer : NSObject +{ + id target; + TICK_IMP impMethod; + + ccTime elapsed; + +@public // optimization + ccTime interval; + SEL selector; +} + +/** interval in seconds */ +@property (nonatomic,readwrite,assign) ccTime interval; + +/** Allocates a timer with a target and a selector. +*/ ++(id) timerWithTarget:(id) t selector:(SEL)s; + +/** Allocates a timer with a target, a selector and an interval in seconds. +*/ ++(id) timerWithTarget:(id) t selector:(SEL)s interval:(ccTime)seconds; + +/** Initializes a timer with a target and a selector. +*/ + -(id) initWithTarget:(id) t selector:(SEL)s; + +/** Initializes a timer with a target, a selector and an interval in seconds. +*/ +-(id) initWithTarget:(id) t selector:(SEL)s interval:(ccTime)seconds; + + +/** triggers the timer */ +-(void) update: (ccTime) dt; +@end + + + +// +// CCScheduler +// +/** Scheduler is responsible of triggering the scheduled callbacks. + You should not use NSTimer. Instead use this class. + + There are 2 different types of callbacks (selectors): + + - update selector: the 'update' selector will be called every frame. You can customize the priority. + - custom selector: A custom selector will be called every frame, or with a custom interval of time + + The 'custom selectors' should be avoided when possible. It is faster, and consumes less memory to use the 'update selector'. + +*/ + +struct _listEntry; +struct _hashSelectorEntry; +struct _hashUpdateEntry; + +@interface CCScheduler : NSObject +{ + ccTime timeScale_; + + // + // "updates with priority" stuff + // + struct _listEntry *updatesNeg; // list of priority < 0 + struct _listEntry *updates0; // list priority == 0 + struct _listEntry *updatesPos; // list priority > 0 + struct _hashUpdateEntry *hashForUpdates; // hash used to fetch quickly the list entries for pause,delete,etc. + + // Used for "selectors with interval" + struct _hashSelectorEntry *hashForSelectors; + struct _hashSelectorEntry *currentTarget; + BOOL currentTargetSalvaged; + + // Optimization + TICK_IMP impMethod; + SEL updateSelector; + + BOOL updateHashLocked; // If true unschedule will not remove anything from a hash. Elements will only be marked for deletion. +} + +/** Modifies the time of all scheduled callbacks. + You can use this property to create a 'slow motion' or 'fast fordward' effect. + Default is 1.0. To create a 'slow motion' effect, use values below 1.0. + To create a 'fast fordward' effect, use values higher than 1.0. + @since v0.8 + @warning It will affect EVERY scheduled selector / action. + */ +@property (nonatomic,readwrite) ccTime timeScale; + +/** returns a shared instance of the Scheduler */ ++(CCScheduler *)sharedScheduler; + +/** purges the shared scheduler. It releases the retained instance. + @since v0.99.0 + */ ++(void)purgeSharedScheduler; + +/** 'tick' the scheduler. + You should NEVER call this method, unless you know what you are doing. + */ +-(void) tick:(ccTime)dt; + +/** The scheduled method will be called every 'interval' seconds. + If paused is YES, then it won't be called until it is resumed. + If 'interval' is 0, it will be called every frame, but if so, it recommened to use 'scheduleUpdateForTarget:' instead. + If the selector is already scheduled, then only the interval parameter will be updated without re-scheduling it again. + + @since v0.99.3 + */ +-(void) scheduleSelector:(SEL)selector forTarget:(id)target interval:(ccTime)interval paused:(BOOL)paused; + +/** Schedules the 'update' selector for a given target with a given priority. + The 'update' selector will be called every frame. + The lower the priority, the earlier it is called. + @since v0.99.3 + */ +-(void) scheduleUpdateForTarget:(id)target priority:(NSInteger)priority paused:(BOOL)paused; + +/** Unshedules a selector for a given target. + If you want to unschedule the "update", use unscheudleUpdateForTarget. + @since v0.99.3 + */ +-(void) unscheduleSelector:(SEL)selector forTarget:(id)target; + +/** Unschedules the update selector for a given target + @since v0.99.3 + */ +-(void) unscheduleUpdateForTarget:(id)target; + +/** Unschedules all selectors for a given target. + This also includes the "update" selector. + @since v0.99.3 + */ +-(void) unscheduleAllSelectorsForTarget:(id)target; + +/** Unschedules all selectors from all targets. + You should NEVER call this method, unless you know what you are doing. + + @since v0.99.3 + */ +-(void) unscheduleAllSelectors; + +/** Pauses the target. + All scheduled selectors/update for a given target won't be 'ticked' until the target is resumed. + If the target is not present, nothing happens. + @since v0.99.3 + */ +-(void) pauseTarget:(id)target; + +/** Resumes the target. + The 'target' will be unpaused, so all schedule selectors/update will be 'ticked' again. + If the target is not present, nothing happens. + @since v0.99.3 + */ +-(void) resumeTarget:(id)target; + +/** Returns whether or not the target is paused + @since v1.0.0 + */ +-(BOOL) isTargetPaused:(id)target; + +@end diff --git a/libs/cocos2d/CCScheduler.m b/libs/cocos2d/CCScheduler.m new file mode 100755 index 0000000..a14ca10 --- /dev/null +++ b/libs/cocos2d/CCScheduler.m @@ -0,0 +1,657 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2008-2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ + + +// cocos2d imports +#import "CCScheduler.h" +#import "ccMacros.h" +#import "Support/uthash.h" +#import "Support/utlist.h" +#import "Support/ccCArray.h" + +// +// Data structures +// +#pragma mark - +#pragma mark Data Structures + +// A list double-linked list used for "updates with priority" +typedef struct _listEntry +{ + struct _listEntry *prev, *next; + TICK_IMP impMethod; + id target; // not retained (retained by hashUpdateEntry) + NSInteger priority; + BOOL paused; + BOOL markedForDeletion; // selector will no longer be called and entry will be removed at end of the next tick +} tListEntry; + +typedef struct _hashUpdateEntry +{ + tListEntry **list; // Which list does it belong to ? + tListEntry *entry; // entry in the list + id target; // hash key (retained) + UT_hash_handle hh; +} tHashUpdateEntry; + +// Hash Element used for "selectors with interval" +typedef struct _hashSelectorEntry +{ + struct ccArray *timers; + id target; // hash key (retained) + unsigned int timerIndex; + CCTimer *currentTimer; + BOOL currentTimerSalvaged; + BOOL paused; + UT_hash_handle hh; +} tHashSelectorEntry; + + + +// +// CCTimer +// +#pragma mark - +#pragma mark - CCTimer + +@implementation CCTimer + +@synthesize interval; + +-(id) init +{ + NSAssert(NO, @"CCTimer: Init not supported."); + [self release]; + return nil; +} + ++(id) timerWithTarget:(id)t selector:(SEL)s +{ + return [[[self alloc] initWithTarget:t selector:s] autorelease]; +} + ++(id) timerWithTarget:(id)t selector:(SEL)s interval:(ccTime) i +{ + return [[[self alloc] initWithTarget:t selector:s interval:i] autorelease]; +} + +-(id) initWithTarget:(id)t selector:(SEL)s +{ + return [self initWithTarget:t selector:s interval:0]; +} + +-(id) initWithTarget:(id)t selector:(SEL)s interval:(ccTime) seconds +{ + if( (self=[super init]) ) { +#if COCOS2D_DEBUG + NSMethodSignature *sig = [t methodSignatureForSelector:s]; + NSAssert(sig !=0 , @"Signature not found for selector - does it have the following form? -(void) name: (ccTime) dt"); +#endif + + // target is not retained. It is retained in the hash structure + target = t; + selector = s; + impMethod = (TICK_IMP) [t methodForSelector:s]; + elapsed = -1; + interval = seconds; + } + return self; +} + +- (NSString*) description +{ + return [NSString stringWithFormat:@"<%@ = %08X | target:%@ selector:(%@)>", [self class], self, [target class], NSStringFromSelector(selector)]; +} + +-(void) dealloc +{ + CCLOGINFO(@"cocos2d: deallocing %@", self); + [super dealloc]; +} + +-(void) update: (ccTime) dt +{ + if( elapsed == - 1) + elapsed = 0; + else + elapsed += dt; + if( elapsed >= interval ) { + impMethod(target, selector, elapsed); + elapsed = 0; + } +} +@end + +// +// CCScheduler +// +#pragma mark - +#pragma mark - CCScheduler + +@interface CCScheduler (Private) +-(void) removeHashElement:(tHashSelectorEntry*)element; +@end + +@implementation CCScheduler + +static CCScheduler *sharedScheduler; + +@synthesize timeScale = timeScale_; + ++ (CCScheduler *)sharedScheduler +{ + if (!sharedScheduler) + sharedScheduler = [[CCScheduler alloc] init]; + + return sharedScheduler; +} + ++(id)alloc +{ + NSAssert(sharedScheduler == nil, @"Attempted to allocate a second instance of a singleton."); + return [super alloc]; +} + ++(void)purgeSharedScheduler +{ + [sharedScheduler release]; + sharedScheduler = nil; +} + +- (id) init +{ + if( (self=[super init]) ) { + timeScale_ = 1.0f; + + // used to trigger CCTimer#update + updateSelector = @selector(update:); + impMethod = (TICK_IMP) [CCTimer instanceMethodForSelector:updateSelector]; + + // updates with priority + updates0 = NULL; + updatesNeg = NULL; + updatesPos = NULL; + hashForUpdates = NULL; + + // selectors with interval + currentTarget = nil; + currentTargetSalvaged = NO; + hashForSelectors = nil; + updateHashLocked = NO; + } + + return self; +} + +- (void) dealloc +{ + CCLOG(@"cocos2d: deallocing %@", self); + + [self unscheduleAllSelectors]; + + sharedScheduler = nil; + + [super dealloc]; +} + + +#pragma mark CCScheduler - Custom Selectors + +-(void) removeHashElement:(tHashSelectorEntry*)element +{ + ccArrayFree(element->timers); + [element->target release]; + HASH_DEL(hashForSelectors, element); + free(element); +} + +-(void) scheduleSelector:(SEL)selector forTarget:(id)target interval:(ccTime)interval paused:(BOOL)paused +{ + NSAssert( selector != nil, @"Argument selector must be non-nil"); + NSAssert( target != nil, @"Argument target must be non-nil"); + + tHashSelectorEntry *element = NULL; + HASH_FIND_INT(hashForSelectors, &target, element); + + if( ! element ) { + element = calloc( sizeof( *element ), 1 ); + element->target = [target retain]; + HASH_ADD_INT( hashForSelectors, target, element ); + + // Is this the 1st element ? Then set the pause level to all the selectors of this target + element->paused = paused; + + } else + NSAssert( element->paused == paused, @"CCScheduler. Trying to schedule a selector with a pause value different than the target"); + + + if( element->timers == nil ) + element->timers = ccArrayNew(10); + else + { + for( unsigned int i=0; i< element->timers->num; i++ ) { + CCTimer *timer = element->timers->arr[i]; + if( selector == timer->selector ) { + CCLOG(@"CCScheduler#scheduleSelector. Selector already scheduled. Updating interval from: %.2f to %.2f", timer->interval, interval); + timer->interval = interval; + return; + } + } + ccArrayEnsureExtraCapacity(element->timers, 1); + } + + CCTimer *timer = [[CCTimer alloc] initWithTarget:target selector:selector interval:interval]; + ccArrayAppendObject(element->timers, timer); + [timer release]; +} + +-(void) unscheduleSelector:(SEL)selector forTarget:(id)target +{ + // explicity handle nil arguments when removing an object + if( target==nil && selector==NULL) + return; + + NSAssert( target != nil, @"Target MUST not be nil"); + NSAssert( selector != NULL, @"Selector MUST not be NULL"); + + tHashSelectorEntry *element = NULL; + HASH_FIND_INT(hashForSelectors, &target, element); + + if( element ) { + + for( unsigned int i=0; i< element->timers->num; i++ ) { + CCTimer *timer = element->timers->arr[i]; + + + if( selector == timer->selector ) { + + if( timer == element->currentTimer && !element->currentTimerSalvaged ) { + [element->currentTimer retain]; + element->currentTimerSalvaged = YES; + } + + ccArrayRemoveObjectAtIndex(element->timers, i ); + + // update timerIndex in case we are in tick:, looping over the actions + if( element->timerIndex >= i ) + element->timerIndex--; + + if( element->timers->num == 0 ) { + if( currentTarget == element ) + currentTargetSalvaged = YES; + else + [self removeHashElement: element]; + } + return; + } + } + } + + // Not Found +// NSLog(@"CCScheduler#unscheduleSelector:forTarget: selector not found: %@", selString); + +} + +#pragma mark CCScheduler - Update Specific + +-(void) priorityIn:(tListEntry**)list target:(id)target priority:(NSInteger)priority paused:(BOOL)paused +{ + tListEntry *listElement = malloc( sizeof(*listElement) ); + + listElement->target = target; + listElement->priority = priority; + listElement->paused = paused; + listElement->impMethod = (TICK_IMP) [target methodForSelector:updateSelector]; + listElement->next = listElement->prev = NULL; + listElement->markedForDeletion = NO; + + // empty list ? + if( ! *list ) { + DL_APPEND( *list, listElement ); + + } else { + BOOL added = NO; + + for( tListEntry *elem = *list; elem ; elem = elem->next ) { + if( priority < elem->priority ) { + + if( elem == *list ) + DL_PREPEND(*list, listElement); + else { + listElement->next = elem; + listElement->prev = elem->prev; + + elem->prev->next = listElement; + elem->prev = listElement; + } + + added = YES; + break; + } + } + + // Not added? priority has the higher value. Append it. + if( !added ) + DL_APPEND(*list, listElement); + } + + // update hash entry for quicker access + tHashUpdateEntry *hashElement = calloc( sizeof(*hashElement), 1 ); + hashElement->target = [target retain]; + hashElement->list = list; + hashElement->entry = listElement; + HASH_ADD_INT(hashForUpdates, target, hashElement ); +} + +-(void) appendIn:(tListEntry**)list target:(id)target paused:(BOOL)paused +{ + tListEntry *listElement = malloc( sizeof( * listElement ) ); + + listElement->target = target; + listElement->paused = paused; + listElement->markedForDeletion = NO; + listElement->impMethod = (TICK_IMP) [target methodForSelector:updateSelector]; + + DL_APPEND(*list, listElement); + + + // update hash entry for quicker access + tHashUpdateEntry *hashElement = calloc( sizeof(*hashElement), 1 ); + hashElement->target = [target retain]; + hashElement->list = list; + hashElement->entry = listElement; + HASH_ADD_INT(hashForUpdates, target, hashElement ); +} + +-(void) scheduleUpdateForTarget:(id)target priority:(NSInteger)priority paused:(BOOL)paused +{ + tHashUpdateEntry * hashElement = NULL; + HASH_FIND_INT(hashForUpdates, &target, hashElement); + if(hashElement) + { +#if COCOS2D_DEBUG >= 1 + NSAssert( hashElement->entry->markedForDeletion, @"CCScheduler: You can't re-schedule an 'update' selector'. Unschedule it first"); +#endif + // TODO : check if priority has changed! + + hashElement->entry->markedForDeletion = NO; + return; + } + + // most of the updates are going to be 0, that's way there + // is an special list for updates with priority 0 + if( priority == 0 ) + [self appendIn:&updates0 target:target paused:paused]; + + else if( priority < 0 ) + [self priorityIn:&updatesNeg target:target priority:priority paused:paused]; + + else // priority > 0 + [self priorityIn:&updatesPos target:target priority:priority paused:paused]; +} + +- (void) removeUpdateFromHash:(tListEntry*)entry +{ + tHashUpdateEntry * element = NULL; + + HASH_FIND_INT(hashForUpdates, &entry->target, element); + if( element ) { + // list entry + DL_DELETE( *element->list, element->entry ); + free( element->entry ); + + // hash entry + [element->target release]; + HASH_DEL( hashForUpdates, element); + free(element); + } +} + +-(void) unscheduleUpdateForTarget:(id)target +{ + if( target == nil ) + return; + + tHashUpdateEntry * element = NULL; + HASH_FIND_INT(hashForUpdates, &target, element); + if( element ) { + if(updateHashLocked) + element->entry->markedForDeletion = YES; + else + [self removeUpdateFromHash:element->entry]; + +// // list entry +// DL_DELETE( *element->list, element->entry ); +// free( element->entry ); +// +// // hash entry +// [element->target release]; +// HASH_DEL( hashForUpdates, element); +// free(element); + } +} + +#pragma mark CCScheduler - Common for Update selector & Custom Selectors + +-(void) unscheduleAllSelectors +{ + // Custom Selectors + for(tHashSelectorEntry *element=hashForSelectors; element != NULL; ) { + id target = element->target; + element=element->hh.next; + [self unscheduleAllSelectorsForTarget:target]; + } + + // Updates selectors + tListEntry *entry, *tmp; + DL_FOREACH_SAFE( updates0, entry, tmp ) { + [self unscheduleUpdateForTarget:entry->target]; + } + DL_FOREACH_SAFE( updatesNeg, entry, tmp ) { + [self unscheduleUpdateForTarget:entry->target]; + } + DL_FOREACH_SAFE( updatesPos, entry, tmp ) { + [self unscheduleUpdateForTarget:entry->target]; + } + +} + +-(void) unscheduleAllSelectorsForTarget:(id)target +{ + // explicit nil handling + if( target == nil ) + return; + + // Custom Selectors + tHashSelectorEntry *element = NULL; + HASH_FIND_INT(hashForSelectors, &target, element); + + if( element ) { + if( ccArrayContainsObject(element->timers, element->currentTimer) && !element->currentTimerSalvaged ) { + [element->currentTimer retain]; + element->currentTimerSalvaged = YES; + } + ccArrayRemoveAllObjects(element->timers); + if( currentTarget == element ) + currentTargetSalvaged = YES; + else + [self removeHashElement:element]; + } + + // Update Selector + [self unscheduleUpdateForTarget:target]; +} + +-(void) resumeTarget:(id)target +{ + NSAssert( target != nil, @"target must be non nil" ); + + // Custom Selectors + tHashSelectorEntry *element = NULL; + HASH_FIND_INT(hashForSelectors, &target, element); + if( element ) + element->paused = NO; + + // Update selector + tHashUpdateEntry * elementUpdate = NULL; + HASH_FIND_INT(hashForUpdates, &target, elementUpdate); + if( elementUpdate ) { + NSAssert( elementUpdate->entry != NULL, @"resumeTarget: unknown error"); + elementUpdate->entry->paused = NO; + } +} + +-(void) pauseTarget:(id)target +{ + NSAssert( target != nil, @"target must be non nil" ); + + // Custom selectors + tHashSelectorEntry *element = NULL; + HASH_FIND_INT(hashForSelectors, &target, element); + if( element ) + element->paused = YES; + + // Update selector + tHashUpdateEntry * elementUpdate = NULL; + HASH_FIND_INT(hashForUpdates, &target, elementUpdate); + if( elementUpdate ) { + NSAssert( elementUpdate->entry != NULL, @"pauseTarget: unknown error"); + elementUpdate->entry->paused = YES; + } + +} + +-(BOOL) isTargetPaused:(id)target +{ + NSAssert( target != nil, @"target must be non nil" ); + + // Custom selectors + tHashSelectorEntry *element = NULL; + HASH_FIND_INT(hashForSelectors, &target, element); + if( element ) + { + return element->paused; + } + return NO; // should never get here + +} + +#pragma mark CCScheduler - Main Loop + +-(void) tick: (ccTime) dt +{ + updateHashLocked = YES; + + if( timeScale_ != 1.0f ) + dt *= timeScale_; + + // Iterate all over the Updates selectors + tListEntry *entry, *tmp; + + // updates with priority < 0 + DL_FOREACH_SAFE( updatesNeg, entry, tmp ) { + if( ! entry->paused && !entry->markedForDeletion ) + entry->impMethod( entry->target, updateSelector, dt ); + } + + // updates with priority == 0 + DL_FOREACH_SAFE( updates0, entry, tmp ) { + if( ! entry->paused && !entry->markedForDeletion ) + { + entry->impMethod( entry->target, updateSelector, dt ); + } + } + + // updates with priority > 0 + DL_FOREACH_SAFE( updatesPos, entry, tmp ) { + if( ! entry->paused && !entry->markedForDeletion ) + entry->impMethod( entry->target, updateSelector, dt ); + } + + // Iterate all over the custome selectors + for(tHashSelectorEntry *elt=hashForSelectors; elt != NULL; ) { + + currentTarget = elt; + currentTargetSalvaged = NO; + + if( ! currentTarget->paused ) { + + // The 'timers' ccArray may change while inside this loop. + for( elt->timerIndex = 0; elt->timerIndex < elt->timers->num; elt->timerIndex++) { + elt->currentTimer = elt->timers->arr[elt->timerIndex]; + elt->currentTimerSalvaged = NO; + + impMethod( elt->currentTimer, updateSelector, dt); + + if( elt->currentTimerSalvaged ) { + // The currentTimer told the remove itself. To prevent the timer from + // accidentally deallocating itself before finishing its step, we retained + // it. Now that step is done, it's safe to release it. + [elt->currentTimer release]; + } + + elt->currentTimer = nil; + } + } + + // elt, at this moment, is still valid + // so it is safe to ask this here (issue #490) + elt = elt->hh.next; + + // only delete currentTarget if no actions were scheduled during the cycle (issue #481) + if( currentTargetSalvaged && currentTarget->timers->num == 0 ) + [self removeHashElement:currentTarget]; + } + + // delete all updates that are morked for deletion + // updates with priority < 0 + DL_FOREACH_SAFE( updatesNeg, entry, tmp ) { + if(entry->markedForDeletion ) + { + [self removeUpdateFromHash:entry]; + } + } + + // updates with priority == 0 + DL_FOREACH_SAFE( updates0, entry, tmp ) { + if(entry->markedForDeletion ) + { + [self removeUpdateFromHash:entry]; + } + } + + // updates with priority > 0 + DL_FOREACH_SAFE( updatesPos, entry, tmp ) { + if(entry->markedForDeletion ) + { + [self removeUpdateFromHash:entry]; + } + } + + updateHashLocked = NO; + currentTarget = nil; +} +@end + diff --git a/libs/cocos2d/CCSprite.h b/libs/cocos2d/CCSprite.h new file mode 100755 index 0000000..f01688e --- /dev/null +++ b/libs/cocos2d/CCSprite.h @@ -0,0 +1,351 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2008-2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + + +#import "CCNode.h" +#import "CCProtocols.h" +#import "CCTextureAtlas.h" + +@class CCSpriteBatchNode; +@class CCSpriteFrame; +@class CCAnimation; + +#pragma mark CCSprite + +#define CCSpriteIndexNotInitialized 0xffffffff /// CCSprite invalid index on the CCSpriteBatchode + +/** + Whether or not an CCSprite will rotate, scale or translate with it's parent. + Useful in health bars, when you want that the health bar translates with it's parent but you don't + want it to rotate with its parent. + @since v0.99.0 + */ +typedef enum { + //! Translate with it's parent + CC_HONOR_PARENT_TRANSFORM_TRANSLATE = 1 << 0, + //! Rotate with it's parent + CC_HONOR_PARENT_TRANSFORM_ROTATE = 1 << 1, + //! Scale with it's parent + CC_HONOR_PARENT_TRANSFORM_SCALE = 1 << 2, + //! Skew with it's parent + CC_HONOR_PARENT_TRANSFORM_SKEW = 1 << 3, + + //! All possible transformation enabled. Default value. + CC_HONOR_PARENT_TRANSFORM_ALL = CC_HONOR_PARENT_TRANSFORM_TRANSLATE | CC_HONOR_PARENT_TRANSFORM_ROTATE | CC_HONOR_PARENT_TRANSFORM_SCALE | CC_HONOR_PARENT_TRANSFORM_SKEW, + +} ccHonorParentTransform; + +/** CCSprite is a 2d image ( http://en.wikipedia.org/wiki/Sprite_(computer_graphics) ) + * + * CCSprite can be created with an image, or with a sub-rectangle of an image. + * + * If the parent or any of its ancestors is a CCSpriteBatchNode then the following features/limitations are valid + * - Features when the parent is a CCBatchNode: + * - MUCH faster rendering, specially if the CCSpriteBatchNode has many children. All the children will be drawn in a single batch. + * + * - Limitations + * - Camera is not supported yet (eg: CCOrbitCamera action doesn't work) + * - GridBase actions are not supported (eg: CCLens, CCRipple, CCTwirl) + * - The Alias/Antialias property belongs to CCSpriteBatchNode, so you can't individually set the aliased property. + * - The Blending function property belongs to CCSpriteBatchNode, so you can't individually set the blending function property. + * - Parallax scroller is not supported, but can be simulated with a "proxy" sprite. + * + * If the parent is an standard CCNode, then CCSprite behaves like any other CCNode: + * - It supports blending functions + * - It supports aliasing / antialiasing + * - But the rendering will be slower: 1 draw per children. + * + * The default anchorPoint in CCSprite is (0.5, 0.5). + */ +@interface CCSprite : CCNode +{ + + // + // Data used when the sprite is rendered using a CCSpriteBatchNode + // + CCTextureAtlas *textureAtlas_; // Sprite Sheet texture atlas (weak reference) + NSUInteger atlasIndex_; // Absolute (real) Index on the batch node + CCSpriteBatchNode *batchNode_; // Used batch node (weak reference) + ccHonorParentTransform honorParentTransform_; // whether or not to transform according to its parent transformations + BOOL dirty_; // Sprite needs to be updated + BOOL recursiveDirty_; // Subchildren needs to be updated + BOOL hasChildren_; // optimization to check if it contain children + + // + // Data used when the sprite is self-rendered + // + ccBlendFunc blendFunc_; // Needed for the texture protocol + CCTexture2D *texture_; // Texture used to render the sprite + + // + // Shared data + // + + // whether or not it's parent is a CCSpriteBatchNode + BOOL usesBatchNode_; + + // texture + CGRect rect_; + CGRect rectInPixels_; + BOOL rectRotated_; + + // Offset Position (used by Zwoptex) + CGPoint offsetPositionInPixels_; + CGPoint unflippedOffsetPositionFromCenter_; + + // vertex coords, texture coords and color info + ccV3F_C4B_T2F_Quad quad_; + + // opacity and RGB protocol + GLubyte opacity_; + ccColor3B color_; + ccColor3B colorUnmodified_; + BOOL opacityModifyRGB_; + + // image is flipped + BOOL flipX_; + BOOL flipY_; + + + // Animations that belong to the sprite + NSMutableDictionary *animations_; + +@public + // used internally. + void (*updateMethod)(id, SEL); +} + +/** whether or not the Sprite needs to be updated in the Atlas */ +@property (nonatomic,readwrite) BOOL dirty; +/** the quad (tex coords, vertex coords and color) information */ +@property (nonatomic,readonly) ccV3F_C4B_T2F_Quad quad; +/** The index used on the TextureAtlas. Don't modify this value unless you know what you are doing */ +@property (nonatomic,readwrite) NSUInteger atlasIndex; +/** returns the rect of the CCSprite in points */ +@property (nonatomic,readonly) CGRect textureRect; +/** returns whether or not the texture rectangle is rotated */ +@property (nonatomic,readonly) BOOL textureRectRotated; +/** whether or not the sprite is flipped horizontally. + It only flips the texture of the sprite, and not the texture of the sprite's children. + Also, flipping the texture doesn't alter the anchorPoint. + If you want to flip the anchorPoint too, and/or to flip the children too use: + + sprite.scaleX *= -1; + */ +@property (nonatomic,readwrite) BOOL flipX; +/** whether or not the sprite is flipped vertically. + It only flips the texture of the sprite, and not the texture of the sprite's children. + Also, flipping the texture doesn't alter the anchorPoint. + If you want to flip the anchorPoint too, and/or to flip the children too use: + + sprite.scaleY *= -1; + */ +@property (nonatomic,readwrite) BOOL flipY; +/** opacity: conforms to CCRGBAProtocol protocol */ +@property (nonatomic,readwrite) GLubyte opacity; +/** RGB colors: conforms to CCRGBAProtocol protocol */ +@property (nonatomic,readwrite) ccColor3B color; +/** whether or not the Sprite is rendered using a CCSpriteBatchNode */ +@property (nonatomic,readwrite) BOOL usesBatchNode; +/** weak reference of the CCTextureAtlas used when the sprite is rendered using a CCSpriteBatchNode */ +@property (nonatomic,readwrite,assign) CCTextureAtlas *textureAtlas; +/** weak reference to the CCSpriteBatchNode that renders the CCSprite */ +@property (nonatomic,readwrite,assign) CCSpriteBatchNode *batchNode; +/** whether or not to transform according to its parent transfomrations. + Useful for health bars. eg: Don't rotate the health bar, even if the parent rotates. + IMPORTANT: Only valid if it is rendered using an CCSpriteBatchNode. + @since v0.99.0 + */ +@property (nonatomic,readwrite) ccHonorParentTransform honorParentTransform; +/** offset position in pixels of the sprite in points. Calculated automatically by editors like Zwoptex. + @since v0.99.0 + */ +@property (nonatomic,readonly) CGPoint offsetPositionInPixels; +/** conforms to CCTextureProtocol protocol */ +@property (nonatomic,readwrite) ccBlendFunc blendFunc; + +#pragma mark CCSprite - Initializers + +/** Creates an sprite with a texture. + The rect used will be the size of the texture. + The offset will be (0,0). + */ ++(id) spriteWithTexture:(CCTexture2D*)texture; + +/** Creates an sprite with a texture and a rect. + The offset will be (0,0). + */ ++(id) spriteWithTexture:(CCTexture2D*)texture rect:(CGRect)rect; + +/** Creates an sprite with an sprite frame. + */ ++(id) spriteWithSpriteFrame:(CCSpriteFrame*)spriteFrame; + +/** Creates an sprite with an sprite frame name. + An CCSpriteFrame will be fetched from the CCSpriteFrameCache by name. + If the CCSpriteFrame doesn't exist it will raise an exception. + @since v0.9 + */ ++(id) spriteWithSpriteFrameName:(NSString*)spriteFrameName; + +/** Creates an sprite with an image filename. + The rect used will be the size of the image. + The offset will be (0,0). + */ ++(id) spriteWithFile:(NSString*)filename; + +/** Creates an sprite with an image filename and a rect. + The offset will be (0,0). + */ ++(id) spriteWithFile:(NSString*)filename rect:(CGRect)rect; + +/** Creates an sprite with a CGImageRef and a key. + The key is used by the CCTextureCache to know if a texture was already created with this CGImage. + For example, a valid key is: @"sprite_frame_01". + If key is nil, then a new texture will be created each time by the CCTextureCache. + @since v0.99.0 + */ ++(id) spriteWithCGImage: (CGImageRef)image key:(NSString*)key; + + +/** Creates an sprite with an CCBatchNode and a rect + */ ++(id) spriteWithBatchNode:(CCSpriteBatchNode*)batchNode rect:(CGRect)rect; + + +/** Initializes an sprite with a texture. + The rect used will be the size of the texture. + The offset will be (0,0). + */ +-(id) initWithTexture:(CCTexture2D*)texture; + +/** Initializes an sprite with a texture and a rect in points. + The offset will be (0,0). + */ +-(id) initWithTexture:(CCTexture2D*)texture rect:(CGRect)rect; + +/** Initializes an sprite with an sprite frame. + */ +-(id) initWithSpriteFrame:(CCSpriteFrame*)spriteFrame; + +/** Initializes an sprite with an sprite frame name. + An CCSpriteFrame will be fetched from the CCSpriteFrameCache by name. + If the CCSpriteFrame doesn't exist it will raise an exception. + @since v0.9 + */ +-(id) initWithSpriteFrameName:(NSString*)spriteFrameName; + +/** Initializes an sprite with an image filename. + The rect used will be the size of the image. + The offset will be (0,0). + */ +-(id) initWithFile:(NSString*)filename; + +/** Initializes an sprite with an image filename, and a rect. + The offset will be (0,0). + */ +-(id) initWithFile:(NSString*)filename rect:(CGRect)rect; + +/** Initializes an sprite with a CGImageRef and a key + The key is used by the CCTextureCache to know if a texture was already created with this CGImage. + For example, a valid key is: @"sprite_frame_01". + If key is nil, then a new texture will be created each time by the CCTextureCache. + @since v0.99.0 + */ +-(id) initWithCGImage:(CGImageRef)image key:(NSString*)key; + +/** Initializes an sprite with an CCSpriteBatchNode and a rect in points + */ +-(id) initWithBatchNode:(CCSpriteBatchNode*)batchNode rect:(CGRect)rect; + +/** Initializes an sprite with an CCSpriteBatchNode and a rect in pixels + @since v0.99.5 + */ +-(id) initWithBatchNode:(CCSpriteBatchNode*)batchNode rectInPixels:(CGRect)rect; + + + +#pragma mark CCSprite - BatchNode methods + +/** updates the quad according the the rotation, position, scale values. + */ +-(void)updateTransform; + +/** updates the texture rect of the CCSprite in points. + */ +-(void) setTextureRect:(CGRect) rect; +/** updates the texture rect, rectRotated and untrimmed size of the CCSprite in pixels + */ +-(void) setTextureRectInPixels:(CGRect)rect rotated:(BOOL)rotated untrimmedSize:(CGSize)size; + +/** tell the sprite to use self-render. + @since v0.99.0 + */ +-(void) useSelfRender; + +/** tell the sprite to use sprite batch node + @since v0.99.0 + */ +-(void) useBatchNode:(CCSpriteBatchNode*)batchNode; + + +#pragma mark CCSprite - Frames + +/** sets a new display frame to the CCSprite. */ +-(void) setDisplayFrame:(CCSpriteFrame*)newFrame; + +/** returns whether or not a CCSpriteFrame is being displayed */ +-(BOOL) isFrameDisplayed:(CCSpriteFrame*)frame; + +/** returns the current displayed frame. */ +-(CCSpriteFrame*) displayedFrame; + +#pragma mark CCSprite - Animation + +/** changes the display frame based on an animation and an index. + @deprecated Will be removed in 1.0.1. Use setDisplayFrameWithAnimationName:index instead + */ +-(void) setDisplayFrame: (NSString*) animationName index:(int) frameIndex DEPRECATED_ATTRIBUTE; + +/** changes the display frame with animation name and index. + The animation name will be get from the CCAnimationCache + @since v0.99.5 + */ +-(void) setDisplayFrameWithAnimationName:(NSString*)animationName index:(int) frameIndex; + +/** returns an Animation given it's name. + + @deprecated Use CCAnimationCache instead. Will be removed in 1.0.1 + */ +-(CCAnimation*)animationByName: (NSString*) animationName DEPRECATED_ATTRIBUTE; + +/** adds an Animation to the Sprite. + + @deprecated Use CCAnimationCache instead. Will be removed in 1.0.1 + */ +-(void) addAnimation: (CCAnimation*) animation DEPRECATED_ATTRIBUTE; + +@end diff --git a/libs/cocos2d/CCSprite.m b/libs/cocos2d/CCSprite.m new file mode 100755 index 0000000..37f06d2 --- /dev/null +++ b/libs/cocos2d/CCSprite.m @@ -0,0 +1,1029 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2008-2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + +#import + +#import "ccConfig.h" +#import "CCSpriteBatchNode.h" +#import "CCSprite.h" +#import "CCSpriteFrame.h" +#import "CCSpriteFrameCache.h" +#import "CCAnimation.h" +#import "CCAnimationCache.h" +#import "CCTextureCache.h" +#import "Support/CGPointExtension.h" +#import "CCDrawingPrimitives.h" + +#pragma mark - +#pragma mark CCSprite + +#if CC_SPRITEBATCHNODE_RENDER_SUBPIXEL +#define RENDER_IN_SUBPIXEL +#else +#define RENDER_IN_SUBPIXEL(__A__) ( (int)(__A__)) +#endif + +// XXX: Optmization +struct transformValues_ { + CGPoint pos; // position x and y + CGPoint scale; // scale x and y + float rotation; + CGPoint skew; // skew x and y + CGPoint ap; // anchor point in pixels + BOOL visible; +}; + +@interface CCSprite (Private) +-(void)updateTextureCoords:(CGRect)rect; +-(void)updateBlendFunc; +-(void) initAnimationDictionary; +-(void) getTransformValues:(struct transformValues_*)tv; // optimization +@end + +@implementation CCSprite + +@synthesize dirty = dirty_; +@synthesize quad = quad_; +@synthesize atlasIndex = atlasIndex_; +@synthesize textureRect = rect_; +@synthesize textureRectRotated = rectRotated_; +@synthesize blendFunc = blendFunc_; +@synthesize usesBatchNode = usesBatchNode_; +@synthesize textureAtlas = textureAtlas_; +@synthesize batchNode = batchNode_; +@synthesize honorParentTransform = honorParentTransform_; +@synthesize offsetPositionInPixels = offsetPositionInPixels_; + + ++(id)spriteWithTexture:(CCTexture2D*)texture +{ + return [[[self alloc] initWithTexture:texture] autorelease]; +} + ++(id)spriteWithTexture:(CCTexture2D*)texture rect:(CGRect)rect +{ + return [[[self alloc] initWithTexture:texture rect:rect] autorelease]; +} + ++(id)spriteWithFile:(NSString*)filename +{ + return [[[self alloc] initWithFile:filename] autorelease]; +} + ++(id)spriteWithFile:(NSString*)filename rect:(CGRect)rect +{ + return [[[self alloc] initWithFile:filename rect:rect] autorelease]; +} + ++(id)spriteWithSpriteFrame:(CCSpriteFrame*)spriteFrame +{ + return [[[self alloc] initWithSpriteFrame:spriteFrame] autorelease]; +} + ++(id)spriteWithSpriteFrameName:(NSString*)spriteFrameName +{ + CCSpriteFrame *frame = [[CCSpriteFrameCache sharedSpriteFrameCache] spriteFrameByName:spriteFrameName]; + + NSAssert1(frame!=nil, @"Invalid spriteFrameName: %@", spriteFrameName); + return [self spriteWithSpriteFrame:frame]; +} + ++(id)spriteWithCGImage:(CGImageRef)image key:(NSString*)key +{ + return [[[self alloc] initWithCGImage:image key:key] autorelease]; +} + ++(id) spriteWithBatchNode:(CCSpriteBatchNode*)batchNode rect:(CGRect)rect +{ + return [[[self alloc] initWithBatchNode:batchNode rect:rect] autorelease]; +} + +-(id) init +{ + if( (self=[super init]) ) { + dirty_ = recursiveDirty_ = NO; + + // by default use "Self Render". + // if the sprite is added to a batchnode, then it will automatically switch to "batchnode Render" + [self useSelfRender]; + + opacityModifyRGB_ = YES; + opacity_ = 255; + color_ = colorUnmodified_ = ccWHITE; + + blendFunc_.src = CC_BLEND_SRC; + blendFunc_.dst = CC_BLEND_DST; + + // update texture (calls updateBlendFunc) + [self setTexture:nil]; + + // clean the Quad + bzero(&quad_, sizeof(quad_)); + + flipY_ = flipX_ = NO; + + // lazy alloc + animations_ = nil; + + // default transform anchor: center + anchorPoint_ = ccp(0.5f, 0.5f); + + // zwoptex default values + offsetPositionInPixels_ = CGPointZero; + + honorParentTransform_ = CC_HONOR_PARENT_TRANSFORM_ALL; + hasChildren_ = NO; + + // Atlas: Color + ccColor4B tmpColor = {255,255,255,255}; + quad_.bl.colors = tmpColor; + quad_.br.colors = tmpColor; + quad_.tl.colors = tmpColor; + quad_.tr.colors = tmpColor; + + // Atlas: Vertex + + // updated in "useSelfRender" + + // Atlas: TexCoords + [self setTextureRectInPixels:CGRectZero rotated:NO untrimmedSize:CGSizeZero]; + + // updateMethod selector + updateMethod = (__typeof__(updateMethod))[self methodForSelector:@selector(updateTransform)]; + } + + return self; +} + +-(id) initWithTexture:(CCTexture2D*)texture rect:(CGRect)rect +{ + NSAssert(texture!=nil, @"Invalid texture for sprite"); + // IMPORTANT: [self init] and not [super init]; + if( (self = [self init]) ) + { + [self setTexture:texture]; + [self setTextureRect:rect]; + } + return self; +} + +-(id) initWithTexture:(CCTexture2D*)texture +{ + NSAssert(texture!=nil, @"Invalid texture for sprite"); + + CGRect rect = CGRectZero; + rect.size = texture.contentSize; + return [self initWithTexture:texture rect:rect]; +} + +-(id) initWithFile:(NSString*)filename +{ + NSAssert(filename!=nil, @"Invalid filename for sprite"); + + CCTexture2D *texture = [[CCTextureCache sharedTextureCache] addImage: filename]; + if( texture ) { + CGRect rect = CGRectZero; + rect.size = texture.contentSize; + return [self initWithTexture:texture rect:rect]; + } + + [self release]; + return nil; +} + +-(id) initWithFile:(NSString*)filename rect:(CGRect)rect +{ + NSAssert(filename!=nil, @"Invalid filename for sprite"); + + CCTexture2D *texture = [[CCTextureCache sharedTextureCache] addImage: filename]; + if( texture ) + return [self initWithTexture:texture rect:rect]; + + [self release]; + return nil; +} + +- (id) initWithSpriteFrame:(CCSpriteFrame*)spriteFrame +{ + NSAssert(spriteFrame!=nil, @"Invalid spriteFrame for sprite"); + + id ret = [self initWithTexture:spriteFrame.texture rect:spriteFrame.rect]; + [self setDisplayFrame:spriteFrame]; + return ret; +} + +-(id)initWithSpriteFrameName:(NSString*)spriteFrameName +{ + NSAssert(spriteFrameName!=nil, @"Invalid spriteFrameName for sprite"); + + CCSpriteFrame *frame = [[CCSpriteFrameCache sharedSpriteFrameCache] spriteFrameByName:spriteFrameName]; + return [self initWithSpriteFrame:frame]; +} + +// XXX: deprecated +- (id) initWithCGImage: (CGImageRef)image +{ + NSAssert(image!=nil, @"Invalid CGImageRef for sprite"); + + // XXX: possible bug. See issue #349. New API should be added + NSString *key = [NSString stringWithFormat:@"%08X",(unsigned long)image]; + CCTexture2D *texture = [[CCTextureCache sharedTextureCache] addCGImage:image forKey:key]; + + CGRect rect = CGRectZero; + rect.size = texture.contentSize; + + return [self initWithTexture:texture rect:rect]; +} + +- (id) initWithCGImage:(CGImageRef)image key:(NSString*)key +{ + NSAssert(image!=nil, @"Invalid CGImageRef for sprite"); + + // XXX: possible bug. See issue #349. New API should be added + CCTexture2D *texture = [[CCTextureCache sharedTextureCache] addCGImage:image forKey:key]; + + CGRect rect = CGRectZero; + rect.size = texture.contentSize; + + return [self initWithTexture:texture rect:rect]; +} + +-(id) initWithBatchNode:(CCSpriteBatchNode*)batchNode rect:(CGRect)rect +{ + id ret = [self initWithTexture:batchNode.texture rect:rect]; + [self useBatchNode:batchNode]; + + return ret; +} + +-(id) initWithBatchNode:(CCSpriteBatchNode*)batchNode rectInPixels:(CGRect)rect +{ + id ret = [self initWithTexture:batchNode.texture]; + [self setTextureRectInPixels:rect rotated:NO untrimmedSize:rect.size]; + [self useBatchNode:batchNode]; + + return ret; +} + +- (NSString*) description +{ + return [NSString stringWithFormat:@"<%@ = %08X | Rect = (%.2f,%.2f,%.2f,%.2f) | tag = %i | atlasIndex = %i>", [self class], self, + rect_.origin.x, rect_.origin.y, rect_.size.width, rect_.size.height, + tag_, + atlasIndex_ + ]; +} + +- (void) dealloc +{ + [texture_ release]; + [animations_ release]; + [super dealloc]; +} + +-(void) useSelfRender +{ + atlasIndex_ = CCSpriteIndexNotInitialized; + usesBatchNode_ = NO; + textureAtlas_ = nil; + batchNode_ = nil; + dirty_ = recursiveDirty_ = NO; + + float x1 = 0 + offsetPositionInPixels_.x; + float y1 = 0 + offsetPositionInPixels_.y; + float x2 = x1 + rectInPixels_.size.width; + float y2 = y1 + rectInPixels_.size.height; + quad_.bl.vertices = (ccVertex3F) { x1, y1, 0 }; + quad_.br.vertices = (ccVertex3F) { x2, y1, 0 }; + quad_.tl.vertices = (ccVertex3F) { x1, y2, 0 }; + quad_.tr.vertices = (ccVertex3F) { x2, y2, 0 }; +} + +-(void) useBatchNode:(CCSpriteBatchNode*)batchNode +{ + usesBatchNode_ = YES; + textureAtlas_ = [batchNode textureAtlas]; // weak ref + batchNode_ = batchNode; // weak ref +} + +-(void) initAnimationDictionary +{ + animations_ = [[NSMutableDictionary alloc] initWithCapacity:2]; +} + +-(void)setTextureRect:(CGRect)rect +{ + CGRect rectInPixels = CC_RECT_POINTS_TO_PIXELS( rect ); + [self setTextureRectInPixels:rectInPixels rotated:NO untrimmedSize:rectInPixels.size]; +} + +-(void)setTextureRectInPixels:(CGRect)rect rotated:(BOOL)rotated untrimmedSize:(CGSize)untrimmedSize +{ + rectInPixels_ = rect; + rect_ = CC_RECT_PIXELS_TO_POINTS( rect ); + rectRotated_ = rotated; + + [self setContentSizeInPixels:untrimmedSize]; + [self updateTextureCoords:rectInPixels_]; + + CGPoint relativeOffsetInPixels = unflippedOffsetPositionFromCenter_; + + // issue #732 + if( flipX_ ) + relativeOffsetInPixels.x = -relativeOffsetInPixels.x; + if( flipY_ ) + relativeOffsetInPixels.y = -relativeOffsetInPixels.y; + + offsetPositionInPixels_.x = relativeOffsetInPixels.x + (contentSizeInPixels_.width - rectInPixels_.size.width) / 2; + offsetPositionInPixels_.y = relativeOffsetInPixels.y + (contentSizeInPixels_.height - rectInPixels_.size.height) / 2; + + + // rendering using batch node + if( usesBatchNode_ ) { + // update dirty_, don't update recursiveDirty_ + dirty_ = YES; + } + + // self rendering + else + { + // Atlas: Vertex + float x1 = 0 + offsetPositionInPixels_.x; + float y1 = 0 + offsetPositionInPixels_.y; + float x2 = x1 + rectInPixels_.size.width; + float y2 = y1 + rectInPixels_.size.height; + + // Don't update Z. + quad_.bl.vertices = (ccVertex3F) { x1, y1, 0 }; + quad_.br.vertices = (ccVertex3F) { x2, y1, 0 }; + quad_.tl.vertices = (ccVertex3F) { x1, y2, 0 }; + quad_.tr.vertices = (ccVertex3F) { x2, y2, 0 }; + } +} + +-(void)updateTextureCoords:(CGRect)rect +{ + CCTexture2D *tex = (usesBatchNode_)?[textureAtlas_ texture]:texture_; + if(!tex) + return; + + float atlasWidth = (float)tex.pixelsWide; + float atlasHeight = (float)tex.pixelsHigh; + + float left,right,top,bottom; + + if(rectRotated_){ +#if CC_FIX_ARTIFACTS_BY_STRECHING_TEXEL + left = (2*rect.origin.x+1)/(2*atlasWidth); + right = left+(rect.size.height*2-2)/(2*atlasWidth); + top = (2*rect.origin.y+1)/(2*atlasHeight); + bottom = top+(rect.size.width*2-2)/(2*atlasHeight); +#else + left = rect.origin.x/atlasWidth; + right = left+(rect.size.height/atlasWidth); + top = rect.origin.y/atlasHeight; + bottom = top+(rect.size.width/atlasHeight); +#endif // ! CC_FIX_ARTIFACTS_BY_STRECHING_TEXEL + + if( flipX_) + CC_SWAP(top,bottom); + if( flipY_) + CC_SWAP(left,right); + + quad_.bl.texCoords.u = left; + quad_.bl.texCoords.v = top; + quad_.br.texCoords.u = left; + quad_.br.texCoords.v = bottom; + quad_.tl.texCoords.u = right; + quad_.tl.texCoords.v = top; + quad_.tr.texCoords.u = right; + quad_.tr.texCoords.v = bottom; + } else { +#if CC_FIX_ARTIFACTS_BY_STRECHING_TEXEL + left = (2*rect.origin.x+1)/(2*atlasWidth); + right = left + (rect.size.width*2-2)/(2*atlasWidth); + top = (2*rect.origin.y+1)/(2*atlasHeight); + bottom = top + (rect.size.height*2-2)/(2*atlasHeight); +#else + left = rect.origin.x/atlasWidth; + right = left + rect.size.width/atlasWidth; + top = rect.origin.y/atlasHeight; + bottom = top + rect.size.height/atlasHeight; +#endif // ! CC_FIX_ARTIFACTS_BY_STRECHING_TEXEL + + if( flipX_) + CC_SWAP(left,right); + if( flipY_) + CC_SWAP(top,bottom); + + quad_.bl.texCoords.u = left; + quad_.bl.texCoords.v = bottom; + quad_.br.texCoords.u = right; + quad_.br.texCoords.v = bottom; + quad_.tl.texCoords.u = left; + quad_.tl.texCoords.v = top; + quad_.tr.texCoords.u = right; + quad_.tr.texCoords.v = top; + } +} + +-(void)updateTransform +{ + NSAssert( usesBatchNode_, @"updateTransform is only valid when CCSprite is being renderd using an CCSpriteBatchNode"); + + // optimization. Quick return if not dirty + if( ! dirty_ ) + return; + + CGAffineTransform matrix; + + // Optimization: if it is not visible, then do nothing + if( ! visible_ ) { + quad_.br.vertices = quad_.tl.vertices = quad_.tr.vertices = quad_.bl.vertices = (ccVertex3F){0,0,0}; + [textureAtlas_ updateQuad:&quad_ atIndex:atlasIndex_]; + dirty_ = recursiveDirty_ = NO; + return ; + } + + + // Optimization: If parent is batchnode, or parent is nil + // build Affine transform manually + if( ! parent_ || parent_ == batchNode_ ) { + + float radians = -CC_DEGREES_TO_RADIANS(rotation_); + float c = cosf(radians); + float s = sinf(radians); + + matrix = CGAffineTransformMake( c * scaleX_, s * scaleX_, + -s * scaleY_, c * scaleY_, + positionInPixels_.x, positionInPixels_.y); + if( skewX_ || skewY_ ) { + CGAffineTransform skewMatrix = CGAffineTransformMake(1.0f, tanf(CC_DEGREES_TO_RADIANS(skewY_)), + tanf(CC_DEGREES_TO_RADIANS(skewX_)), 1.0f, + 0.0f, 0.0f); + matrix = CGAffineTransformConcat(skewMatrix, matrix); + } + matrix = CGAffineTransformTranslate(matrix, -anchorPointInPixels_.x, -anchorPointInPixels_.y); + + + } else { // parent_ != batchNode_ + + // else do affine transformation according to the HonorParentTransform + + matrix = CGAffineTransformIdentity; + ccHonorParentTransform prevHonor = CC_HONOR_PARENT_TRANSFORM_ALL; + + for (CCNode *p = self ; p && p != batchNode_ ; p = p.parent) { + + // Might happen. Issue #1053 + NSAssert( [p isKindOfClass:[CCSprite class]], @"CCSprite should be a CCSprite subclass. Probably you initialized an sprite with a batchnode, but you didn't add it to the batch node." ); + + struct transformValues_ tv; + [(CCSprite*)p getTransformValues: &tv]; + + // If any of the parents are not visible, then don't draw this node + if( ! tv.visible ) { + quad_.br.vertices = quad_.tl.vertices = quad_.tr.vertices = quad_.bl.vertices = (ccVertex3F){0,0,0}; + [textureAtlas_ updateQuad:&quad_ atIndex:atlasIndex_]; + dirty_ = recursiveDirty_ = NO; + return; + } + CGAffineTransform newMatrix = CGAffineTransformIdentity; + + // 2nd: Translate, Skew, Rotate, Scale + if( prevHonor & CC_HONOR_PARENT_TRANSFORM_TRANSLATE ) + newMatrix = CGAffineTransformTranslate(newMatrix, tv.pos.x, tv.pos.y); + if( prevHonor & CC_HONOR_PARENT_TRANSFORM_ROTATE ) + newMatrix = CGAffineTransformRotate(newMatrix, -CC_DEGREES_TO_RADIANS(tv.rotation)); + if ( prevHonor & CC_HONOR_PARENT_TRANSFORM_SKEW ) { + CGAffineTransform skew = CGAffineTransformMake(1.0f, tanf(CC_DEGREES_TO_RADIANS(tv.skew.y)), tanf(CC_DEGREES_TO_RADIANS(tv.skew.x)), 1.0f, 0.0f, 0.0f); + // apply the skew to the transform + newMatrix = CGAffineTransformConcat(skew, newMatrix); + } + if( prevHonor & CC_HONOR_PARENT_TRANSFORM_SCALE ) { + newMatrix = CGAffineTransformScale(newMatrix, tv.scale.x, tv.scale.y); + } + + // 3rd: Translate anchor point + newMatrix = CGAffineTransformTranslate(newMatrix, -tv.ap.x, -tv.ap.y); + + // 4th: Matrix multiplication + matrix = CGAffineTransformConcat( matrix, newMatrix); + + prevHonor = [(CCSprite*)p honorParentTransform]; + } + } + + + // + // calculate the Quad based on the Affine Matrix + // + + CGSize size = rectInPixels_.size; + + float x1 = offsetPositionInPixels_.x; + float y1 = offsetPositionInPixels_.y; + + float x2 = x1 + size.width; + float y2 = y1 + size.height; + float x = matrix.tx; + float y = matrix.ty; + + float cr = matrix.a; + float sr = matrix.b; + float cr2 = matrix.d; + float sr2 = -matrix.c; + float ax = x1 * cr - y1 * sr2 + x; + float ay = x1 * sr + y1 * cr2 + y; + + float bx = x2 * cr - y1 * sr2 + x; + float by = x2 * sr + y1 * cr2 + y; + + float cx = x2 * cr - y2 * sr2 + x; + float cy = x2 * sr + y2 * cr2 + y; + + float dx = x1 * cr - y2 * sr2 + x; + float dy = x1 * sr + y2 * cr2 + y; + + quad_.bl.vertices = (ccVertex3F) { RENDER_IN_SUBPIXEL(ax), RENDER_IN_SUBPIXEL(ay), vertexZ_ }; + quad_.br.vertices = (ccVertex3F) { RENDER_IN_SUBPIXEL(bx), RENDER_IN_SUBPIXEL(by), vertexZ_ }; + quad_.tl.vertices = (ccVertex3F) { RENDER_IN_SUBPIXEL(dx), RENDER_IN_SUBPIXEL(dy), vertexZ_ }; + quad_.tr.vertices = (ccVertex3F) { RENDER_IN_SUBPIXEL(cx), RENDER_IN_SUBPIXEL(cy), vertexZ_ }; + + [textureAtlas_ updateQuad:&quad_ atIndex:atlasIndex_]; + dirty_ = recursiveDirty_ = NO; +} + +// XXX: Optimization: instead of calling 5 times the parent sprite to obtain: position, scale.x, scale.y, anchorpoint and rotation, +// this fuction return the 5 values in 1 single call +-(void) getTransformValues:(struct transformValues_*) tv +{ + tv->pos = positionInPixels_; + tv->scale.x = scaleX_; + tv->scale.y = scaleY_; + tv->rotation = rotation_; + tv->skew.x = skewX_; + tv->skew.y = skewY_; + tv->ap = anchorPointInPixels_; + tv->visible = visible_; +} + +#pragma mark CCSprite - draw + +-(void) draw +{ + [super draw]; + + NSAssert(!usesBatchNode_, @"If CCSprite is being rendered by CCSpriteBatchNode, CCSprite#draw SHOULD NOT be called"); + + // Default GL states: GL_TEXTURE_2D, GL_VERTEX_ARRAY, GL_COLOR_ARRAY, GL_TEXTURE_COORD_ARRAY + // Needed states: GL_TEXTURE_2D, GL_VERTEX_ARRAY, GL_COLOR_ARRAY, GL_TEXTURE_COORD_ARRAY + // Unneeded states: - + + BOOL newBlend = blendFunc_.src != CC_BLEND_SRC || blendFunc_.dst != CC_BLEND_DST; + if( newBlend ) + glBlendFunc( blendFunc_.src, blendFunc_.dst ); + +#define kQuadSize sizeof(quad_.bl) + glBindTexture(GL_TEXTURE_2D, [texture_ name]); + + long offset = (long)&quad_; + + // vertex + NSInteger diff = offsetof( ccV3F_C4B_T2F, vertices); + glVertexPointer(3, GL_FLOAT, kQuadSize, (void*) (offset + diff) ); + + // color + diff = offsetof( ccV3F_C4B_T2F, colors); + glColorPointer(4, GL_UNSIGNED_BYTE, kQuadSize, (void*)(offset + diff)); + + // tex coords + diff = offsetof( ccV3F_C4B_T2F, texCoords); + glTexCoordPointer(2, GL_FLOAT, kQuadSize, (void*)(offset + diff)); + + glDrawArrays(GL_TRIANGLE_STRIP, 0, 4); + + if( newBlend ) + glBlendFunc(CC_BLEND_SRC, CC_BLEND_DST); + +#if CC_SPRITE_DEBUG_DRAW == 1 + // draw bounding box + CGSize s = self.contentSize; + CGPoint vertices[4] = { + ccp(0,0), ccp(s.width,0), + ccp(s.width,s.height), ccp(0,s.height) + }; + ccDrawPoly(vertices, 4, YES); +#elif CC_SPRITE_DEBUG_DRAW == 2 + // draw texture box + CGSize s = self.textureRect.size; + CGPoint offsetPix = self.offsetPositionInPixels; + CGPoint vertices[4] = { + ccp(offsetPix.x,offsetPix.y), ccp(offsetPix.x+s.width,offsetPix.y), + ccp(offsetPix.x+s.width,offsetPix.y+s.height), ccp(offsetPix.x,offsetPix.y+s.height) + }; + ccDrawPoly(vertices, 4, YES); +#endif // CC_SPRITE_DEBUG_DRAW + +} + +#pragma mark CCSprite - CCNode overrides + +-(void) addChild:(CCSprite*)child z:(NSInteger)z tag:(NSInteger) aTag +{ + NSAssert( child != nil, @"Argument must be non-nil"); + + [super addChild:child z:z tag:aTag]; + + if( usesBatchNode_ ) { + NSAssert( [child isKindOfClass:[CCSprite class]], @"CCSprite only supports CCSprites as children when using CCSpriteBatchNode"); + NSAssert( child.texture.name == textureAtlas_.texture.name, @"CCSprite is not using the same texture id"); + + NSUInteger index = [batchNode_ atlasIndexForChild:child atZ:z]; + [batchNode_ insertChild:child inAtlasAtIndex:index]; + } + + hasChildren_ = YES; +} + +-(void) reorderChild:(CCSprite*)child z:(NSInteger)z +{ + NSAssert( child != nil, @"Child must be non-nil"); + NSAssert( [children_ containsObject:child], @"Child doesn't belong to Sprite" ); + + if( z == child.zOrder ) + return; + + if( usesBatchNode_ ) { + // XXX: Instead of removing/adding, it is more efficient to reorder manually + [child retain]; + [self removeChild:child cleanup:NO]; + [self addChild:child z:z]; + [child release]; + } + + else + [super reorderChild:child z:z]; +} + +-(void)removeChild: (CCSprite *)sprite cleanup:(BOOL)doCleanup +{ + if( usesBatchNode_ ) + [batchNode_ removeSpriteFromAtlas:sprite]; + + [super removeChild:sprite cleanup:doCleanup]; + + hasChildren_ = ( [children_ count] > 0 ); +} + +-(void)removeAllChildrenWithCleanup:(BOOL)doCleanup +{ + if( usesBatchNode_ ) { + CCSprite *child; + CCARRAY_FOREACH(children_, child) + [batchNode_ removeSpriteFromAtlas:child]; + } + + [super removeAllChildrenWithCleanup:doCleanup]; + + hasChildren_ = NO; +} + +// +// CCNode property overloads +// used only when parent is CCSpriteBatchNode +// +#pragma mark CCSprite - property overloads + + +-(void) setDirtyRecursively:(BOOL)b +{ + dirty_ = recursiveDirty_ = b; + // recursively set dirty + if( hasChildren_ ) { + CCSprite *child; + CCARRAY_FOREACH(children_, child) + [child setDirtyRecursively:YES]; + } +} + +// XXX HACK: optimization +#define SET_DIRTY_RECURSIVELY() { \ + if( usesBatchNode_ && ! recursiveDirty_ ) { \ + dirty_ = recursiveDirty_ = YES; \ + if( hasChildren_) \ + [self setDirtyRecursively:YES]; \ + } \ + } + +-(void)setPosition:(CGPoint)pos +{ + [super setPosition:pos]; + SET_DIRTY_RECURSIVELY(); +} + +-(void)setPositionInPixels:(CGPoint)pos +{ + [super setPositionInPixels:pos]; + SET_DIRTY_RECURSIVELY(); +} + +-(void)setRotation:(float)rot +{ + [super setRotation:rot]; + SET_DIRTY_RECURSIVELY(); +} + +-(void)setSkewX:(float)sx +{ + [super setSkewX:sx]; + SET_DIRTY_RECURSIVELY(); +} + +-(void)setSkewY:(float)sy +{ + [super setSkewY:sy]; + SET_DIRTY_RECURSIVELY(); +} + +-(void)setScaleX:(float) sx +{ + [super setScaleX:sx]; + SET_DIRTY_RECURSIVELY(); +} + +-(void)setScaleY:(float) sy +{ + [super setScaleY:sy]; + SET_DIRTY_RECURSIVELY(); +} + +-(void)setScale:(float) s +{ + [super setScale:s]; + SET_DIRTY_RECURSIVELY(); +} + +-(void) setVertexZ:(float)z +{ + [super setVertexZ:z]; + SET_DIRTY_RECURSIVELY(); +} + +-(void)setAnchorPoint:(CGPoint)anchor +{ + [super setAnchorPoint:anchor]; + SET_DIRTY_RECURSIVELY(); +} + +-(void)setIsRelativeAnchorPoint:(BOOL)relative +{ + NSAssert( ! usesBatchNode_, @"relativeTransformAnchor is invalid in CCSprite"); + [super setIsRelativeAnchorPoint:relative]; +} + +-(void)setVisible:(BOOL)v +{ + [super setVisible:v]; + SET_DIRTY_RECURSIVELY(); +} + +-(void)setFlipX:(BOOL)b +{ + if( flipX_ != b ) { + flipX_ = b; + [self setTextureRectInPixels:rectInPixels_ rotated:rectRotated_ untrimmedSize:contentSizeInPixels_]; + } +} +-(BOOL) flipX +{ + return flipX_; +} + +-(void) setFlipY:(BOOL)b +{ + if( flipY_ != b ) { + flipY_ = b; + [self setTextureRectInPixels:rectInPixels_ rotated:rectRotated_ untrimmedSize:contentSizeInPixels_]; + } +} +-(BOOL) flipY +{ + return flipY_; +} + +// +// RGBA protocol +// +#pragma mark CCSprite - RGBA protocol +-(void) updateColor +{ + ccColor4B color4 = {color_.r, color_.g, color_.b, opacity_ }; + + quad_.bl.colors = color4; + quad_.br.colors = color4; + quad_.tl.colors = color4; + quad_.tr.colors = color4; + + // renders using Sprite Manager + if( usesBatchNode_ ) { + if( atlasIndex_ != CCSpriteIndexNotInitialized) + [textureAtlas_ updateQuad:&quad_ atIndex:atlasIndex_]; + else + // no need to set it recursively + // update dirty_, don't update recursiveDirty_ + dirty_ = YES; + } + // self render + // do nothing +} + +-(GLubyte) opacity +{ + return opacity_; +} + +-(void) setOpacity:(GLubyte) anOpacity +{ + opacity_ = anOpacity; + + // special opacity for premultiplied textures + if( opacityModifyRGB_ ) + [self setColor: colorUnmodified_]; + + [self updateColor]; +} + +- (ccColor3B) color +{ + if(opacityModifyRGB_) + return colorUnmodified_; + + return color_; +} + +-(void) setColor:(ccColor3B)color3 +{ + color_ = colorUnmodified_ = color3; + + if( opacityModifyRGB_ ){ + color_.r = color3.r * opacity_/255; + color_.g = color3.g * opacity_/255; + color_.b = color3.b * opacity_/255; + } + + [self updateColor]; +} + +-(void) setOpacityModifyRGB:(BOOL)modify +{ + ccColor3B oldColor = self.color; + opacityModifyRGB_ = modify; + self.color = oldColor; +} + +-(BOOL) doesOpacityModifyRGB +{ + return opacityModifyRGB_; +} + +// +// Frames +// +#pragma mark CCSprite - Frames + +-(void) setDisplayFrame:(CCSpriteFrame*)frame +{ + unflippedOffsetPositionFromCenter_ = frame.offsetInPixels; + + CCTexture2D *newTexture = [frame texture]; + // update texture before updating texture rect + if ( newTexture.name != texture_.name ) + [self setTexture: newTexture]; + + // update rect + rectRotated_ = frame.rotated; + [self setTextureRectInPixels:frame.rectInPixels rotated:frame.rotated untrimmedSize:frame.originalSizeInPixels]; +} + +// XXX deprecated +-(void) setDisplayFrame: (NSString*) animationName index:(int) frameIndex +{ + if( ! animations_ ) + [self initAnimationDictionary]; + + CCAnimation *a = [animations_ objectForKey: animationName]; + CCSpriteFrame *frame = [[a frames] objectAtIndex:frameIndex]; + + NSAssert( frame, @"CCSprite#setDisplayFrame. Invalid frame"); + + [self setDisplayFrame:frame]; +} + +-(void) setDisplayFrameWithAnimationName: (NSString*) animationName index:(int) frameIndex +{ + NSAssert( animationName, @"CCSprite#setDisplayFrameWithAnimationName. animationName must not be nil"); + + CCAnimation *a = [[CCAnimationCache sharedAnimationCache] animationByName:animationName]; + + NSAssert( a, @"CCSprite#setDisplayFrameWithAnimationName: Frame not found"); + + CCSpriteFrame *frame = [[a frames] objectAtIndex:frameIndex]; + + NSAssert( frame, @"CCSprite#setDisplayFrame. Invalid frame"); + + [self setDisplayFrame:frame]; +} + + +-(BOOL) isFrameDisplayed:(CCSpriteFrame*)frame +{ + CGRect r = [frame rect]; + return ( CGRectEqualToRect(r, rect_) && + frame.texture.name == self.texture.name ); +} + +-(CCSpriteFrame*) displayedFrame +{ + return [CCSpriteFrame frameWithTexture:texture_ + rectInPixels:rectInPixels_ + rotated:rectRotated_ + offset:unflippedOffsetPositionFromCenter_ + originalSize:contentSizeInPixels_]; +} + +-(void) addAnimation: (CCAnimation*) anim +{ + // lazy alloc + if( ! animations_ ) + [self initAnimationDictionary]; + + [animations_ setObject:anim forKey:[anim name]]; +} + +-(CCAnimation*)animationByName: (NSString*) animationName +{ + NSAssert( animationName != nil, @"animationName parameter must be non nil"); + return [animations_ objectForKey:animationName]; +} + +#pragma mark CCSprite - CocosNodeTexture protocol + +-(void) updateBlendFunc +{ + NSAssert( ! usesBatchNode_, @"CCSprite: updateBlendFunc doesn't work when the sprite is rendered using a CCSpriteBatchNode"); + + // it's possible to have an untextured sprite + if( !texture_ || ! [texture_ hasPremultipliedAlpha] ) { + blendFunc_.src = GL_SRC_ALPHA; + blendFunc_.dst = GL_ONE_MINUS_SRC_ALPHA; + [self setOpacityModifyRGB:NO]; + } else { + blendFunc_.src = CC_BLEND_SRC; + blendFunc_.dst = CC_BLEND_DST; + [self setOpacityModifyRGB:YES]; + } +} + +-(void) setTexture:(CCTexture2D*)texture +{ + NSAssert( ! usesBatchNode_, @"CCSprite: setTexture doesn't work when the sprite is rendered using a CCSpriteBatchNode"); + + // accept texture==nil as argument + NSAssert( !texture || [texture isKindOfClass:[CCTexture2D class]], @"setTexture expects a CCTexture2D. Invalid argument"); + + [texture_ release]; + texture_ = [texture retain]; + + [self updateBlendFunc]; +} + +-(CCTexture2D*) texture +{ + return texture_; +} + +@end diff --git a/libs/cocos2d/CCSpriteBatchNode.h b/libs/cocos2d/CCSpriteBatchNode.h new file mode 100755 index 0000000..0342e24 --- /dev/null +++ b/libs/cocos2d/CCSpriteBatchNode.h @@ -0,0 +1,145 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (C) 2009 Matt Oswald + * + * Copyright (c) 2009-2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + + +#import "CCNode.h" +#import "CCProtocols.h" +#import "CCTextureAtlas.h" +#import "ccMacros.h" + +#pragma mark CCSpriteBatchNode + +@class CCSprite; + +/** CCSpriteBatchNode is like a batch node: if it contains children, it will draw them in 1 single OpenGL call + * (often known as "batch draw"). + * + * A CCSpriteBatchNode can reference one and only one texture (one image file, one texture atlas). + * Only the CCSprites that are contained in that texture can be added to the CCSpriteBatchNode. + * All CCSprites added to a CCSpriteBatchNode are drawn in one OpenGL ES draw call. + * If the CCSprites are not added to a CCSpriteBatchNode then an OpenGL ES draw call will be needed for each one, which is less efficient. + * + * + * Limitations: + * - The only object that is accepted as child (or grandchild, grand-grandchild, etc...) is CCSprite or any subclass of CCSprite. eg: particles, labels and layer can't be added to a CCSpriteBatchNode. + * - Either all its children are Aliased or Antialiased. It can't be a mix. This is because "alias" is a property of the texture, and all the sprites share the same texture. + * + * @since v0.7.1 + */ +@interface CCSpriteBatchNode : CCNode +{ + CCTextureAtlas *textureAtlas_; + ccBlendFunc blendFunc_; + + // all descendants: chlidren, gran children, etc... + CCArray *descendants_; +} + +/** returns the TextureAtlas that is used */ +@property (nonatomic,readwrite,retain) CCTextureAtlas * textureAtlas; + +/** conforms to CCTextureProtocol protocol */ +@property (nonatomic,readwrite) ccBlendFunc blendFunc; + +/** descendants (children, gran children, etc) */ +@property (nonatomic,readonly) CCArray *descendants; + +/** creates a CCSpriteBatchNode with a texture2d and a default capacity of 29 children. + The capacity will be increased in 33% in runtime if it run out of space. + */ ++(id)batchNodeWithTexture:(CCTexture2D *)tex; ++(id)spriteSheetWithTexture:(CCTexture2D *)tex DEPRECATED_ATTRIBUTE; + +/** creates a CCSpriteBatchNode with a texture2d and capacity of children. + The capacity will be increased in 33% in runtime if it run out of space. + */ ++(id)batchNodeWithTexture:(CCTexture2D *)tex capacity:(NSUInteger)capacity; ++(id)spriteSheetWithTexture:(CCTexture2D *)tex capacity:(NSUInteger)capacity DEPRECATED_ATTRIBUTE; + +/** creates a CCSpriteBatchNode with a file image (.png, .jpeg, .pvr, etc) with a default capacity of 29 children. + The capacity will be increased in 33% in runtime if it run out of space. + The file will be loaded using the TextureMgr. + */ ++(id)batchNodeWithFile:(NSString*) fileImage; ++(id)spriteSheetWithFile:(NSString*) fileImage DEPRECATED_ATTRIBUTE; + +/** creates a CCSpriteBatchNode with a file image (.png, .jpeg, .pvr, etc) and capacity of children. + The capacity will be increased in 33% in runtime if it run out of space. + The file will be loaded using the TextureMgr. +*/ ++(id)batchNodeWithFile:(NSString*)fileImage capacity:(NSUInteger)capacity; ++(id)spriteSheetWithFile:(NSString*)fileImage capacity:(NSUInteger)capacity DEPRECATED_ATTRIBUTE; + +/** initializes a CCSpriteBatchNode with a texture2d and capacity of children. + The capacity will be increased in 33% in runtime if it run out of space. + */ +-(id)initWithTexture:(CCTexture2D *)tex capacity:(NSUInteger)capacity; +/** initializes a CCSpriteBatchNode with a file image (.png, .jpeg, .pvr, etc) and a capacity of children. + The capacity will be increased in 33% in runtime if it run out of space. + The file will be loaded using the TextureMgr. + */ +-(id)initWithFile:(NSString*)fileImage capacity:(NSUInteger)capacity; + +-(void) increaseAtlasCapacity; + +/** creates an sprite with a rect in the CCSpriteBatchNode. + It's the same as: + - create an standard CCSsprite + - set the usingSpriteSheet = YES + - set the textureAtlas to the same texture Atlas as the CCSpriteBatchNode + @deprecated Use [CCSprite spriteWithBatchNode:rect:] instead; + */ +-(CCSprite*) createSpriteWithRect:(CGRect)rect DEPRECATED_ATTRIBUTE; + +/** initializes a previously created sprite with a rect. This sprite will have the same texture as the CCSpriteBatchNode. + It's the same as: + - initialize an standard CCSsprite + - set the usingBatchNode = YES + - set the textureAtlas to the same texture Atlas as the CCSpriteBatchNode + @since v0.99.0 + @deprecated Use [CCSprite initWithBatchNode:rect:] instead; +*/ +-(void) initSprite:(CCSprite*)sprite rect:(CGRect)rect DEPRECATED_ATTRIBUTE; + +/** removes a child given a certain index. It will also cleanup the running actions depending on the cleanup parameter. + @warning Removing a child from a CCSpriteBatchNode is very slow + */ +-(void)removeChildAtIndex:(NSUInteger)index cleanup:(BOOL)doCleanup; + +/** removes a child given a reference. It will also cleanup the running actions depending on the cleanup parameter. + @warning Removing a child from a CCSpriteBatchNode is very slow + */ +-(void)removeChild: (CCSprite *)sprite cleanup:(BOOL)doCleanup; + +-(void) insertChild:(CCSprite*)child inAtlasAtIndex:(NSUInteger)index; +-(void) removeSpriteFromAtlas:(CCSprite*)sprite; + +-(NSUInteger) rebuildIndexInOrder:(CCSprite*)parent atlasIndex:(NSUInteger)index; +-(NSUInteger) atlasIndexForChild:(CCSprite*)sprite atZ:(NSInteger)z; + +@end diff --git a/libs/cocos2d/CCSpriteBatchNode.m b/libs/cocos2d/CCSpriteBatchNode.m new file mode 100755 index 0000000..7c8b05b --- /dev/null +++ b/libs/cocos2d/CCSpriteBatchNode.m @@ -0,0 +1,503 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (C) 2009 Matt Oswald + * + * Copyright (c) 2009-2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + + +#import "ccConfig.h" +#import "CCSprite.h" +#import "CCSpriteBatchNode.h" +#import "CCGrid.h" +#import "CCDrawingPrimitives.h" +#import "CCTextureCache.h" +#import "Support/CGPointExtension.h" + +const NSUInteger defaultCapacity = 29; + +#pragma mark - +#pragma mark CCSpriteBatchNode + +static SEL selUpdate = NULL; + +@interface CCSpriteBatchNode (private) +-(void) updateBlendFunc; +@end + +@implementation CCSpriteBatchNode + +@synthesize textureAtlas = textureAtlas_; +@synthesize blendFunc = blendFunc_; +@synthesize descendants = descendants_; + + ++(void) initialize +{ + if ( self == [CCSpriteBatchNode class] ) { + selUpdate = @selector(updateTransform); + } +} +/* + * creation with CCTexture2D + */ ++(id)batchNodeWithTexture:(CCTexture2D *)tex +{ + return [[[self alloc] initWithTexture:tex capacity:defaultCapacity] autorelease]; +} ++(id)spriteSheetWithTexture:(CCTexture2D *)tex // XXX DEPRECATED +{ + return [self batchNodeWithTexture:tex]; +} + ++(id)batchNodeWithTexture:(CCTexture2D *)tex capacity:(NSUInteger)capacity +{ + return [[[self alloc] initWithTexture:tex capacity:capacity] autorelease]; +} ++(id)spriteSheetWithTexture:(CCTexture2D *)tex capacity:(NSUInteger)capacity // XXX DEPRECATED +{ + return [self batchNodeWithTexture:tex capacity:capacity]; +} + +/* + * creation with File Image + */ ++(id)batchNodeWithFile:(NSString*)fileImage capacity:(NSUInteger)capacity +{ + return [[[self alloc] initWithFile:fileImage capacity:capacity] autorelease]; +} ++(id)spriteSheetWithFile:(NSString*)fileImage capacity:(NSUInteger)capacity // XXX DEPRECATED +{ + return [self batchNodeWithFile:fileImage capacity:capacity]; +} + ++(id)batchNodeWithFile:(NSString*) imageFile +{ + return [[[self alloc] initWithFile:imageFile capacity:defaultCapacity] autorelease]; +} ++(id)spriteSheetWithFile:(NSString*) imageFile // XXX DEPRECATED +{ + return [self batchNodeWithFile:imageFile]; +} + + +/* + * init with CCTexture2D + */ +-(id)initWithTexture:(CCTexture2D *)tex capacity:(NSUInteger)capacity +{ + if( (self=[super init])) { + + blendFunc_.src = CC_BLEND_SRC; + blendFunc_.dst = CC_BLEND_DST; + textureAtlas_ = [[CCTextureAtlas alloc] initWithTexture:tex capacity:capacity]; + + [self updateBlendFunc]; + + // no lazy alloc in this node + children_ = [[CCArray alloc] initWithCapacity:capacity]; + descendants_ = [[CCArray alloc] initWithCapacity:capacity]; + } + + return self; +} + +/* + * init with FileImage + */ +-(id)initWithFile:(NSString *)fileImage capacity:(NSUInteger)capacity +{ + CCTexture2D *tex = [[CCTextureCache sharedTextureCache] addImage:fileImage]; + return [self initWithTexture:tex capacity:capacity]; +} + +- (NSString*) description +{ + return [NSString stringWithFormat:@"<%@ = %08X | Tag = %i>", [self class], self, tag_ ]; +} + +-(void)dealloc +{ + [textureAtlas_ release]; + [descendants_ release]; + + [super dealloc]; +} + +#pragma mark CCSpriteBatchNode - composition + +// override visit. +// Don't call visit on it's children +-(void) visit +{ + + // CAREFUL: + // This visit is almost identical to CocosNode#visit + // with the exception that it doesn't call visit on it's children + // + // The alternative is to have a void CCSprite#visit, but + // although this is less mantainable, is faster + // + if (!visible_) + return; + + glPushMatrix(); + + if ( grid_ && grid_.active) { + [grid_ beforeDraw]; + [self transformAncestors]; + } + + [self transform]; + + [self draw]; + + if ( grid_ && grid_.active) + [grid_ afterDraw:self]; + + glPopMatrix(); +} + +// XXX deprecated +-(CCSprite*) createSpriteWithRect:(CGRect)rect +{ + CCSprite *sprite = [CCSprite spriteWithTexture:textureAtlas_.texture rect:rect]; + [sprite useBatchNode:self]; + + return sprite; +} + +// XXX deprecated +-(void) initSprite:(CCSprite*)sprite rect:(CGRect)rect +{ + [sprite initWithTexture:textureAtlas_.texture rect:rect]; + [sprite useBatchNode:self]; +} + +// override addChild: +-(void) addChild:(CCSprite*)child z:(NSInteger)z tag:(NSInteger) aTag +{ + NSAssert( child != nil, @"Argument must be non-nil"); + NSAssert( [child isKindOfClass:[CCSprite class]], @"CCSpriteBatchNode only supports CCSprites as children"); + NSAssert( child.texture.name == textureAtlas_.texture.name, @"CCSprite is not using the same texture id"); + + [super addChild:child z:z tag:aTag]; + + NSUInteger index = [self atlasIndexForChild:child atZ:z]; + [self insertChild:child inAtlasAtIndex:index]; +} + +// override reorderChild +-(void) reorderChild:(CCSprite*)child z:(NSInteger)z +{ + NSAssert( child != nil, @"Child must be non-nil"); + NSAssert( [children_ containsObject:child], @"Child doesn't belong to Sprite" ); + + if( z == child.zOrder ) + return; + + // XXX: Instead of removing/adding, it is more efficient to reorder manually + [child retain]; + [self removeChild:child cleanup:NO]; + [self addChild:child z:z]; + [child release]; +} + +// override removeChild: +-(void)removeChild: (CCSprite *)sprite cleanup:(BOOL)doCleanup +{ + // explicit nil handling + if (sprite == nil) + return; + + NSAssert([children_ containsObject:sprite], @"CCSpriteBatchNode doesn't contain the sprite. Can't remove it"); + + // cleanup before removing + [self removeSpriteFromAtlas:sprite]; + + [super removeChild:sprite cleanup:doCleanup]; +} + +-(void)removeChildAtIndex:(NSUInteger)index cleanup:(BOOL)doCleanup +{ + [self removeChild:(CCSprite *)[children_ objectAtIndex:index] cleanup:doCleanup]; +} + +-(void)removeAllChildrenWithCleanup:(BOOL)doCleanup +{ + // Invalidate atlas index. issue #569 + [children_ makeObjectsPerformSelector:@selector(useSelfRender)]; + + [super removeAllChildrenWithCleanup:doCleanup]; + + [descendants_ removeAllObjects]; + [textureAtlas_ removeAllQuads]; +} + +#pragma mark CCSpriteBatchNode - draw +-(void) draw +{ + [super draw]; + + // Optimization: Fast Dispatch + if( textureAtlas_.totalQuads == 0 ) + return; + + CCSprite *child; + ccArray *array = descendants_->data; + + NSUInteger i = array->num; + id *arr = array->arr; + + if( i > 0 ) { + + while (i-- > 0) { + child = *arr++; + + // fast dispatch + child->updateMethod(child, selUpdate); + +#if CC_SPRITEBATCHNODE_DEBUG_DRAW + //Issue #528 + CGRect rect = [child boundingBox]; + CGPoint vertices[4]={ + ccp(rect.origin.x,rect.origin.y), + ccp(rect.origin.x+rect.size.width,rect.origin.y), + ccp(rect.origin.x+rect.size.width,rect.origin.y+rect.size.height), + ccp(rect.origin.x,rect.origin.y+rect.size.height), + }; + ccDrawPoly(vertices, 4, YES); +#endif // CC_SPRITEBATCHNODE_DEBUG_DRAW + } + } + + // Default GL states: GL_TEXTURE_2D, GL_VERTEX_ARRAY, GL_COLOR_ARRAY, GL_TEXTURE_COORD_ARRAY + // Needed states: GL_TEXTURE_2D, GL_VERTEX_ARRAY, GL_COLOR_ARRAY, GL_TEXTURE_COORD_ARRAY + // Unneeded states: - + + BOOL newBlend = blendFunc_.src != CC_BLEND_SRC || blendFunc_.dst != CC_BLEND_DST; + if( newBlend ) + glBlendFunc( blendFunc_.src, blendFunc_.dst ); + + [textureAtlas_ drawQuads]; + if( newBlend ) + glBlendFunc(CC_BLEND_SRC, CC_BLEND_DST); +} + +#pragma mark CCSpriteBatchNode - private +-(void) increaseAtlasCapacity +{ + // if we're going beyond the current TextureAtlas's capacity, + // all the previously initialized sprites will need to redo their texture coords + // this is likely computationally expensive + NSUInteger quantity = (textureAtlas_.capacity + 1) * 4 / 3; + + CCLOG(@"cocos2d: CCSpriteBatchNode: resizing TextureAtlas capacity from [%lu] to [%lu].", + (long)textureAtlas_.capacity, + (long)quantity); + + + if( ! [textureAtlas_ resizeCapacity:quantity] ) { + // serious problems + CCLOG(@"cocos2d: WARNING: Not enough memory to resize the atlas"); + NSAssert(NO,@"XXX: SpriteSheet#increaseAtlasCapacity SHALL handle this assert"); + } +} + + +#pragma mark CCSpriteBatchNode - Atlas Index Stuff + +-(NSUInteger) rebuildIndexInOrder:(CCSprite*)node atlasIndex:(NSUInteger)index +{ + CCSprite *sprite; + CCARRAY_FOREACH(node.children, sprite){ + if( sprite.zOrder < 0 ) + index = [self rebuildIndexInOrder:sprite atlasIndex:index]; + } + + // ignore self (batch node) + if( ! [node isEqual:self]) { + node.atlasIndex = index; + index++; + } + + CCARRAY_FOREACH(node.children, sprite){ + if( sprite.zOrder >= 0 ) + index = [self rebuildIndexInOrder:sprite atlasIndex:index]; + } + + return index; +} + +-(NSUInteger) highestAtlasIndexInChild:(CCSprite*)sprite +{ + CCArray *array = [sprite children]; + NSUInteger count = [array count]; + if( count == 0 ) + return sprite.atlasIndex; + else + return [self highestAtlasIndexInChild:[array lastObject]]; +} + +-(NSUInteger) lowestAtlasIndexInChild:(CCSprite*)sprite +{ + CCArray *array = [sprite children]; + NSUInteger count = [array count]; + if( count == 0 ) + return sprite.atlasIndex; + else + return [self lowestAtlasIndexInChild:[array objectAtIndex:0] ]; +} + + +-(NSUInteger)atlasIndexForChild:(CCSprite*)sprite atZ:(NSInteger)z +{ + CCArray *brothers = [[sprite parent] children]; + NSUInteger childIndex = [brothers indexOfObject:sprite]; + + // ignore parent Z if parent is batchnode + BOOL ignoreParent = ( sprite.parent == self ); + CCSprite *previous = nil; + if( childIndex > 0 ) + previous = [brothers objectAtIndex:childIndex-1]; + + // first child of the sprite sheet + if( ignoreParent ) { + if( childIndex == 0 ) + return 0; + // else + return [self highestAtlasIndexInChild: previous] + 1; + } + + // parent is a CCSprite, so, it must be taken into account + + // first child of an CCSprite ? + if( childIndex == 0 ) + { + CCSprite *p = (CCSprite*) sprite.parent; + + // less than parent and brothers + if( z < 0 ) + return p.atlasIndex; + else + return p.atlasIndex+1; + + } else { + // previous & sprite belong to the same branch + if( ( previous.zOrder < 0 && z < 0 )|| (previous.zOrder >= 0 && z >= 0) ) + return [self highestAtlasIndexInChild:previous] + 1; + + // else (previous < 0 and sprite >= 0 ) + CCSprite *p = (CCSprite*) sprite.parent; + return p.atlasIndex + 1; + } + + NSAssert( NO, @"Should not happen. Error calculating Z on Batch Node"); + return 0; +} + +#pragma mark CCSpriteBatchNode - add / remove / reorder helper methods +// add child helper +-(void) insertChild:(CCSprite*)sprite inAtlasAtIndex:(NSUInteger)index +{ + [sprite useBatchNode:self]; + [sprite setAtlasIndex:index]; + [sprite setDirty: YES]; + + if(textureAtlas_.totalQuads == textureAtlas_.capacity) + [self increaseAtlasCapacity]; + + ccV3F_C4B_T2F_Quad quad = [sprite quad]; + [textureAtlas_ insertQuad:&quad atIndex:index]; + + ccArray *descendantsData = descendants_->data; + + ccArrayInsertObjectAtIndex(descendantsData, sprite, index); + + // update indices + NSUInteger i = index+1; + CCSprite *child; + for(; inum; i++){ + child = descendantsData->arr[i]; + child.atlasIndex = child.atlasIndex + 1; + } + + // add children recursively + CCARRAY_FOREACH(sprite.children, child){ + NSUInteger idx = [self atlasIndexForChild:child atZ: child.zOrder]; + [self insertChild:child inAtlasAtIndex:idx]; + } +} + +// remove child helper +-(void) removeSpriteFromAtlas:(CCSprite*)sprite +{ + // remove from TextureAtlas + [textureAtlas_ removeQuadAtIndex:sprite.atlasIndex]; + + // Cleanup sprite. It might be reused (issue #569) + [sprite useSelfRender]; + + ccArray *descendantsData = descendants_->data; + NSUInteger index = ccArrayGetIndexOfObject(descendantsData, sprite); + if( index != NSNotFound ) { + ccArrayRemoveObjectAtIndex(descendantsData, index); + + // update all sprites beyond this one + NSUInteger count = descendantsData->num; + + for(; index < count; index++) + { + CCSprite *s = descendantsData->arr[index]; + s.atlasIndex = s.atlasIndex - 1; + } + } + + // remove children recursively + CCSprite *child; + CCARRAY_FOREACH(sprite.children, child) + [self removeSpriteFromAtlas:child]; +} + +#pragma mark CCSpriteBatchNode - CocosNodeTexture protocol + +-(void) updateBlendFunc +{ + if( ! [textureAtlas_.texture hasPremultipliedAlpha] ) { + blendFunc_.src = GL_SRC_ALPHA; + blendFunc_.dst = GL_ONE_MINUS_SRC_ALPHA; + } +} + +-(void) setTexture:(CCTexture2D*)texture +{ + textureAtlas_.texture = texture; + [self updateBlendFunc]; +} + +-(CCTexture2D*) texture +{ + return textureAtlas_.texture; +} +@end diff --git a/libs/cocos2d/CCSpriteFrame.h b/libs/cocos2d/CCSpriteFrame.h new file mode 100755 index 0000000..983aeed --- /dev/null +++ b/libs/cocos2d/CCSpriteFrame.h @@ -0,0 +1,90 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2008-2011 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + +#import +#import "CCNode.h" +#import "CCProtocols.h" + +/** A CCSpriteFrame has: + - texture: A CCTexture2D that will be used by the CCSprite + - rectangle: A rectangle of the texture + + + You can modify the frame of a CCSprite by doing: + + CCSpriteFrame *frame = [CCSpriteFrame frameWithTexture:texture rect:rect offset:offset]; + [sprite setDisplayFrame:frame]; + */ +@interface CCSpriteFrame : NSObject +{ + CGRect rect_; + CGRect rectInPixels_; + BOOL rotated_; + CGPoint offsetInPixels_; + CGSize originalSizeInPixels_; + CCTexture2D *texture_; +} +/** rect of the frame in points. If it is updated, then rectInPixels will be updated too. */ +@property (nonatomic,readwrite) CGRect rect; + +/** rect of the frame in pixels. If it is updated, then rect (points) will be udpated too. */ +@property (nonatomic,readwrite) CGRect rectInPixels; + +/** whether or not the rect of the frame is rotated ( x = x+width, y = y+height, width = height, height = width ) */ +@property (nonatomic,readwrite) BOOL rotated; + +/** offset of the frame in pixels */ +@property (nonatomic,readwrite) CGPoint offsetInPixels; + +/** original size of the trimmed image in pixels */ +@property (nonatomic,readwrite) CGSize originalSizeInPixels; + +/** texture of the frame */ +@property (nonatomic, retain, readwrite) CCTexture2D *texture; + +/** Create a CCSpriteFrame with a texture, rect in points. + It is assumed that the frame was not trimmed. + */ ++(id) frameWithTexture:(CCTexture2D*)texture rect:(CGRect)rect; + +/** Create a CCSpriteFrame with a texture, rect, rotated, offset and originalSize in pixels. + The originalSize is the size in points of the frame before being trimmed. + */ ++(id) frameWithTexture:(CCTexture2D*)texture rectInPixels:(CGRect)rect rotated:(BOOL)rotated offset:(CGPoint)offset originalSize:(CGSize)originalSize; + + +/** Initializes a CCSpriteFrame with a texture, rect in points; + It is assumed that the frame was not trimmed. + */ +-(id) initWithTexture:(CCTexture2D*)texture rect:(CGRect)rect; + +/** Initializes a CCSpriteFrame with a texture, rect, rotated, offset and originalSize in pixels. + The originalSize is the size in points of the frame before being trimmed. + */ +-(id) initWithTexture:(CCTexture2D*)texture rectInPixels:(CGRect)rect rotated:(BOOL)rotated offset:(CGPoint)offset originalSize:(CGSize)originalSize; + +@end + diff --git a/libs/cocos2d/CCSpriteFrame.m b/libs/cocos2d/CCSpriteFrame.m new file mode 100755 index 0000000..e9ebd04 --- /dev/null +++ b/libs/cocos2d/CCSpriteFrame.m @@ -0,0 +1,111 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2008-2011 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + + +#import "CCTextureCache.h" +#import "CCSpriteFrame.h" +#import "ccMacros.h" + +@implementation CCSpriteFrame +@synthesize rotated = rotated_, offsetInPixels = offsetInPixels_, texture = texture_; +@synthesize originalSizeInPixels=originalSizeInPixels_; + ++(id) frameWithTexture:(CCTexture2D*)texture rect:(CGRect)rect +{ + return [[[self alloc] initWithTexture:texture rect:rect] autorelease]; +} + ++(id) frameWithTexture:(CCTexture2D*)texture rectInPixels:(CGRect)rect rotated:(BOOL)rotated offset:(CGPoint)offset originalSize:(CGSize)originalSize +{ + return [[[self alloc] initWithTexture:texture rectInPixels:rect rotated:rotated offset:offset originalSize:originalSize] autorelease]; +} + +-(id) initWithTexture:(CCTexture2D*)texture rect:(CGRect)rect +{ + CGRect rectInPixels = CC_RECT_POINTS_TO_PIXELS( rect ); + return [self initWithTexture:texture rectInPixels:rectInPixels rotated:NO offset:CGPointZero originalSize:rectInPixels.size]; +} + +-(id) initWithTexture:(CCTexture2D*)texture rectInPixels:(CGRect)rect rotated:(BOOL)rotated offset:(CGPoint)offset originalSize:(CGSize)originalSize +{ + if( (self=[super init]) ) { + self.texture = texture; + rectInPixels_ = rect; + rect_ = CC_RECT_PIXELS_TO_POINTS( rect ); + rotated_ = rotated; + offsetInPixels_ = offset; + originalSizeInPixels_ = originalSize; + } + return self; +} + +- (NSString*) description +{ + return [NSString stringWithFormat:@"<%@ = %08X | TextureName=%d, Rect = (%.2f,%.2f,%.2f,%.2f)> rotated:%d", [self class], self, + texture_.name, + rect_.origin.x, + rect_.origin.y, + rect_.size.width, + rect_.size.height, + rotated_ + ]; +} + +- (void) dealloc +{ + CCLOGINFO( @"cocos2d: deallocing %@",self); + [texture_ release]; + [super dealloc]; +} + +-(id) copyWithZone: (NSZone*) zone +{ + CCSpriteFrame *copy = [[[self class] allocWithZone: zone] initWithTexture:texture_ rectInPixels:rectInPixels_ rotated:rotated_ offset:offsetInPixels_ originalSize:originalSizeInPixels_]; + return copy; +} + +-(CGRect) rect +{ + return rect_; +} + +-(CGRect) rectInPixels +{ + return rectInPixels_; +} + +-(void) setRect:(CGRect)rect +{ + rect_ = rect; + rectInPixels_ = CC_RECT_POINTS_TO_PIXELS( rect_ ); +} + +-(void) setRectInPixels:(CGRect)rectInPixels +{ + rectInPixels_ = rectInPixels; + rect_ = CC_RECT_PIXELS_TO_POINTS(rectInPixels); +} +@end diff --git a/libs/cocos2d/CCSpriteFrameCache.h b/libs/cocos2d/CCSpriteFrameCache.h new file mode 100755 index 0000000..d3119a6 --- /dev/null +++ b/libs/cocos2d/CCSpriteFrameCache.h @@ -0,0 +1,137 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2009 Jason Booth + * + * Copyright (c) 2009 Robert J Payne + * + * Copyright (c) 2008-2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + + +/* + * To create sprite frames and texture atlas, use this tool: + * http://zwoptex.zwopple.com/ + */ + +#import + +#import "CCSpriteFrame.h" +#import "CCTexture2D.h" + +@class CCSprite; + +/** Singleton that handles the loading of the sprite frames. + It saves in a cache the sprite frames. + @since v0.9 + */ +@interface CCSpriteFrameCache : NSObject +{ + NSMutableDictionary *spriteFrames_; + NSMutableDictionary *spriteFramesAliases_; +} + +/** Retruns ths shared instance of the Sprite Frame cache */ ++ (CCSpriteFrameCache *) sharedSpriteFrameCache; + +/** Purges the cache. It releases all the Sprite Frames and the retained instance. + */ ++(void)purgeSharedSpriteFrameCache; + + +/** Adds multiple Sprite Frames with a dictionary. The texture will be associated with the created sprite frames. + */ +-(void) addSpriteFramesWithDictionary:(NSDictionary*)dictionary texture:(CCTexture2D*)texture; + +/** Adds multiple Sprite Frames from a plist file. + * A texture will be loaded automatically. The texture name will composed by replacing the .plist suffix with .png + * If you want to use another texture, you should use the addSpriteFramesWithFile:texture method. + */ +-(void) addSpriteFramesWithFile:(NSString*)plist; + +/** Adds multiple Sprite Frames from a plist file. The texture will be associated with the created sprite frames. + */ +-(void) addSpriteFramesWithFile:(NSString*)plist texture:(CCTexture2D*)texture; + +/** Adds multiple Sprite Frames from a plist file. The texture will be associated with the created sprite frames. + @since v0.99.5 + */ +-(void) addSpriteFramesWithFile:(NSString*)plist textureFile:(NSString*)textureFileName; + +/** Adds an sprite frame with a given name. + If the name already exists, then the contents of the old name will be replaced with the new one. + */ +-(void) addSpriteFrame:(CCSpriteFrame*)frame name:(NSString*)frameName; + + +/** Purges the dictionary of loaded sprite frames. + * Call this method if you receive the "Memory Warning". + * In the short term: it will free some resources preventing your app from being killed. + * In the medium term: it will allocate more resources. + * In the long term: it will be the same. + */ +-(void) removeSpriteFrames; + +/** Removes unused sprite frames. + * Sprite Frames that have a retain count of 1 will be deleted. + * It is convinient to call this method after when starting a new Scene. + */ +-(void) removeUnusedSpriteFrames; + +/** Deletes an sprite frame from the sprite frame cache. + */ +-(void) removeSpriteFrameByName:(NSString*)name; + +/** Removes multiple Sprite Frames from a plist file. +* Sprite Frames stored in this file will be removed. +* It is convinient to call this method when a specific texture needs to be removed. +* @since v0.99.5 +*/ +- (void) removeSpriteFramesFromFile:(NSString*) plist; + +/** Removes multiple Sprite Frames from NSDictionary. + * @since v0.99.5 + */ +- (void) removeSpriteFramesFromDictionary:(NSDictionary*) dictionary; + +/** Removes all Sprite Frames associated with the specified textures. + * It is convinient to call this method when a specific texture needs to be removed. + * @since v0.995. + */ +- (void) removeSpriteFramesFromTexture:(CCTexture2D*) texture; + +/** Returns an Sprite Frame that was previously added. + If the name is not found it will return nil. + You should retain the returned copy if you are going to use it. + */ +-(CCSpriteFrame*) spriteFrameByName:(NSString*)name; + +/** Creates an sprite with the name of an sprite frame. + The created sprite will contain the texture, rect and offset of the sprite frame. + It returns an autorelease object. + @deprecated use [CCSprite spriteWithSpriteFrameName:name]. This method will be removed on final v0.9 + */ +-(CCSprite*) createSpriteWithFrameName:(NSString*)name DEPRECATED_ATTRIBUTE; + +@end diff --git a/libs/cocos2d/CCSpriteFrameCache.m b/libs/cocos2d/CCSpriteFrameCache.m new file mode 100755 index 0000000..f154c3d --- /dev/null +++ b/libs/cocos2d/CCSpriteFrameCache.m @@ -0,0 +1,347 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2009 Jason Booth + * + * Copyright (c) 2009 Robert J Payne + * + * Copyright (c) 2008-2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + +/* + * To create sprite frames and texture atlas, use this tool: + * http://zwoptex.zwopple.com/ + */ + +#import "Platforms/CCNS.h" +#import "ccMacros.h" +#import "CCTextureCache.h" +#import "CCSpriteFrameCache.h" +#import "CCSpriteFrame.h" +#import "CCSprite.h" +#import "Support/CCFileUtils.h" + + +@implementation CCSpriteFrameCache + +#pragma mark CCSpriteFrameCache - Alloc, Init & Dealloc + +static CCSpriteFrameCache *sharedSpriteFrameCache_=nil; + ++ (CCSpriteFrameCache *)sharedSpriteFrameCache +{ + if (!sharedSpriteFrameCache_) + sharedSpriteFrameCache_ = [[CCSpriteFrameCache alloc] init]; + + return sharedSpriteFrameCache_; +} + ++(id)alloc +{ + NSAssert(sharedSpriteFrameCache_ == nil, @"Attempted to allocate a second instance of a singleton."); + return [super alloc]; +} + ++(void)purgeSharedSpriteFrameCache +{ + [sharedSpriteFrameCache_ release]; + sharedSpriteFrameCache_ = nil; +} + +-(id) init +{ + if( (self=[super init]) ) { + spriteFrames_ = [[NSMutableDictionary alloc] initWithCapacity: 100]; + spriteFramesAliases_ = [[NSMutableDictionary alloc] initWithCapacity:10]; + } + + return self; +} + +- (NSString*) description +{ + return [NSString stringWithFormat:@"<%@ = %08X | num of sprite frames = %i>", [self class], self, [spriteFrames_ count]]; +} + +-(void) dealloc +{ + CCLOGINFO(@"cocos2d: deallocing %@", self); + + [spriteFrames_ release]; + [spriteFramesAliases_ release]; + [super dealloc]; +} + +#pragma mark CCSpriteFrameCache - loading sprite frames + +-(void) addSpriteFramesWithDictionary:(NSDictionary*)dictionary texture:(CCTexture2D*)texture +{ + /* + Supported Zwoptex Formats: + ZWTCoordinatesFormatOptionXMLLegacy = 0, // Flash Version + ZWTCoordinatesFormatOptionXML1_0 = 1, // Desktop Version 0.0 - 0.4b + ZWTCoordinatesFormatOptionXML1_1 = 2, // Desktop Version 1.0.0 - 1.0.1 + ZWTCoordinatesFormatOptionXML1_2 = 3, // Desktop Version 1.0.2+ + */ + NSDictionary *metadataDict = [dictionary objectForKey:@"metadata"]; + NSDictionary *framesDict = [dictionary objectForKey:@"frames"]; + + int format = 0; + + // get the format + if(metadataDict != nil) + format = [[metadataDict objectForKey:@"format"] intValue]; + + // check the format + NSAssert( format >= 0 && format <= 3, @"cocos2d: WARNING: format is not supported for CCSpriteFrameCache addSpriteFramesWithDictionary:texture:"); + + + // add real frames + for(NSString *frameDictKey in framesDict) { + NSDictionary *frameDict = [framesDict objectForKey:frameDictKey]; + CCSpriteFrame *spriteFrame; + if(format == 0) { + float x = [[frameDict objectForKey:@"x"] floatValue]; + float y = [[frameDict objectForKey:@"y"] floatValue]; + float w = [[frameDict objectForKey:@"width"] floatValue]; + float h = [[frameDict objectForKey:@"height"] floatValue]; + float ox = [[frameDict objectForKey:@"offsetX"] floatValue]; + float oy = [[frameDict objectForKey:@"offsetY"] floatValue]; + int ow = [[frameDict objectForKey:@"originalWidth"] intValue]; + int oh = [[frameDict objectForKey:@"originalHeight"] intValue]; + // check ow/oh + if(!ow || !oh) + CCLOG(@"cocos2d: WARNING: originalWidth/Height not found on the CCSpriteFrame. AnchorPoint won't work as expected. Regenerate the .plist"); + + // abs ow/oh + ow = abs(ow); + oh = abs(oh); + // create frame + + spriteFrame = [[CCSpriteFrame alloc] initWithTexture:texture + rectInPixels:CGRectMake(x, y, w, h) + rotated:NO + offset:CGPointMake(ox, oy) + originalSize:CGSizeMake(ow, oh)]; + } else if(format == 1 || format == 2) { + CGRect frame = CCRectFromString([frameDict objectForKey:@"frame"]); + BOOL rotated = NO; + + // rotation + if(format == 2) + rotated = [[frameDict objectForKey:@"rotated"] boolValue]; + + CGPoint offset = CCPointFromString([frameDict objectForKey:@"offset"]); + CGSize sourceSize = CCSizeFromString([frameDict objectForKey:@"sourceSize"]); + + // create frame + spriteFrame = [[CCSpriteFrame alloc] initWithTexture:texture + rectInPixels:frame + rotated:rotated + offset:offset + originalSize:sourceSize]; + } else if(format == 3) { + // get values + CGSize spriteSize = CCSizeFromString([frameDict objectForKey:@"spriteSize"]); + CGPoint spriteOffset = CCPointFromString([frameDict objectForKey:@"spriteOffset"]); + CGSize spriteSourceSize = CCSizeFromString([frameDict objectForKey:@"spriteSourceSize"]); + CGRect textureRect = CCRectFromString([frameDict objectForKey:@"textureRect"]); + BOOL textureRotated = [[frameDict objectForKey:@"textureRotated"] boolValue]; + + // get aliases + NSArray *aliases = [frameDict objectForKey:@"aliases"]; + for(NSString *alias in aliases) { + if( [spriteFramesAliases_ objectForKey:alias] ) + CCLOG(@"cocos2d: WARNING: an alias with name %@ already exists",alias); + + [spriteFramesAliases_ setObject:frameDictKey forKey:alias]; + } + + // create frame + spriteFrame = [[CCSpriteFrame alloc] initWithTexture:texture + rectInPixels:CGRectMake(textureRect.origin.x, textureRect.origin.y, spriteSize.width, spriteSize.height) + rotated:textureRotated + offset:spriteOffset + originalSize:spriteSourceSize]; + } + + // add sprite frame + [spriteFrames_ setObject:spriteFrame forKey:frameDictKey]; + [spriteFrame release]; + } +} + +-(void) addSpriteFramesWithFile:(NSString*)plist texture:(CCTexture2D*)texture +{ + NSString *path = [CCFileUtils fullPathFromRelativePath:plist]; + NSDictionary *dict = [NSDictionary dictionaryWithContentsOfFile:path]; + + [self addSpriteFramesWithDictionary:dict texture:texture]; +} + +-(void) addSpriteFramesWithFile:(NSString*)plist textureFile:(NSString*)textureFileName +{ + NSAssert( textureFileName, @"Invalid texture file name"); + CCTexture2D *texture = [[CCTextureCache sharedTextureCache] addImage:textureFileName]; + + if( texture ) + [self addSpriteFramesWithFile:plist texture:texture]; + else + CCLOG(@"cocos2d: CCSpriteFrameCache: couldn't load texture file. File not found: %@", textureFileName); +} + +-(void) addSpriteFramesWithFile:(NSString*)plist +{ + NSString *path = [CCFileUtils fullPathFromRelativePath:plist]; + NSDictionary *dict = [NSDictionary dictionaryWithContentsOfFile:path]; + + NSString *texturePath = nil; + NSDictionary *metadataDict = [dict objectForKey:@"metadata"]; + if( metadataDict ) + // try to read texture file name from meta data + texturePath = [metadataDict objectForKey:@"textureFileName"]; + + + if( texturePath ) + { + // build texture path relative to plist file + NSString *textureBase = [plist stringByDeletingLastPathComponent]; + texturePath = [textureBase stringByAppendingPathComponent:texturePath]; + } else { + // build texture path by replacing file extension + texturePath = [plist stringByDeletingPathExtension]; + texturePath = [texturePath stringByAppendingPathExtension:@"png"]; + + CCLOG(@"cocos2d: CCSpriteFrameCache: Trying to use file '%@' as texture", texturePath); + } + + CCTexture2D *texture = [[CCTextureCache sharedTextureCache] addImage:texturePath]; + + if( texture ) + [self addSpriteFramesWithDictionary:dict texture:texture]; + + else + CCLOG(@"cocos2d: CCSpriteFrameCache: Couldn't load texture"); +} + +-(void) addSpriteFrame:(CCSpriteFrame*)frame name:(NSString*)frameName +{ + [spriteFrames_ setObject:frame forKey:frameName]; +} + +#pragma mark CCSpriteFrameCache - removing + +-(void) removeSpriteFrames +{ + [spriteFrames_ removeAllObjects]; + [spriteFramesAliases_ removeAllObjects]; +} + +-(void) removeUnusedSpriteFrames +{ + NSArray *keys = [spriteFrames_ allKeys]; + for( id key in keys ) { + id value = [spriteFrames_ objectForKey:key]; + if( [value retainCount] == 1 ) { + CCLOG(@"cocos2d: CCSpriteFrameCache: removing unused frame: %@", key); + [spriteFrames_ removeObjectForKey:key]; + } + } +} + +-(void) removeSpriteFrameByName:(NSString*)name +{ + // explicit nil handling + if( ! name ) + return; + + // Is this an alias ? + NSString *key = [spriteFramesAliases_ objectForKey:name]; + + if( key ) { + [spriteFrames_ removeObjectForKey:key]; + [spriteFramesAliases_ removeObjectForKey:name]; + + } else + [spriteFrames_ removeObjectForKey:name]; +} + +- (void) removeSpriteFramesFromFile:(NSString*) plist +{ + NSString *path = [CCFileUtils fullPathFromRelativePath:plist]; + NSDictionary *dict = [NSDictionary dictionaryWithContentsOfFile:path]; + + [self removeSpriteFramesFromDictionary:dict]; +} + +- (void) removeSpriteFramesFromDictionary:(NSDictionary*) dictionary +{ + NSDictionary *framesDict = [dictionary objectForKey:@"frames"]; + NSMutableArray *keysToRemove=[NSMutableArray array]; + + for(NSString *frameDictKey in framesDict) + { + if ([spriteFrames_ objectForKey:frameDictKey]!=nil) + [keysToRemove addObject:frameDictKey]; + } + [spriteFrames_ removeObjectsForKeys:keysToRemove]; +} + +- (void) removeSpriteFramesFromTexture:(CCTexture2D*) texture +{ + NSMutableArray *keysToRemove=[NSMutableArray array]; + + for (NSString *spriteFrameKey in spriteFrames_) + { + if ([[spriteFrames_ valueForKey:spriteFrameKey] texture] == texture) + [keysToRemove addObject:spriteFrameKey]; + + } + [spriteFrames_ removeObjectsForKeys:keysToRemove]; +} + +#pragma mark CCSpriteFrameCache - getting + +-(CCSpriteFrame*) spriteFrameByName:(NSString*)name +{ + CCSpriteFrame *frame = [spriteFrames_ objectForKey:name]; + if( ! frame ) { + // try alias dictionary + NSString *key = [spriteFramesAliases_ objectForKey:name]; + frame = [spriteFrames_ objectForKey:key]; + + if( ! frame ) + CCLOG(@"cocos2d: CCSpriteFrameCache: Frame '%@' not found", name); + } + + return frame; +} + +#pragma mark CCSpriteFrameCache - sprite creation + +-(CCSprite*) createSpriteWithFrameName:(NSString*)name +{ + CCSpriteFrame *frame = [spriteFrames_ objectForKey:name]; + return [CCSprite spriteWithSpriteFrame:frame]; +} +@end diff --git a/libs/cocos2d/CCTMXLayer.h b/libs/cocos2d/CCTMXLayer.h new file mode 100755 index 0000000..477a380 --- /dev/null +++ b/libs/cocos2d/CCTMXLayer.h @@ -0,0 +1,152 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2009-2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + * + * TMX Tiled Map support: + * http://www.mapeditor.org + * + */ + + +#import "CCAtlasNode.h" +#import "CCSpriteBatchNode.h" + + +@class CCTMXMapInfo; +@class CCTMXLayerInfo; +@class CCTMXTilesetInfo; + +/** CCTMXLayer represents the TMX layer. + + It is a subclass of CCSpriteBatchNode. By default the tiles are rendered using a CCTextureAtlas. + If you mofify a tile on runtime, then, that tile will become a CCSprite, otherwise no CCSprite objects are created. + The benefits of using CCSprite objects as tiles are: + - tiles (CCSprite) can be rotated/scaled/moved with a nice API + + If the layer contains a property named "cc_vertexz" with an integer (in can be positive or negative), + then all the tiles belonging to the layer will use that value as their OpenGL vertex Z for depth. + + On the other hand, if the "cc_vertexz" property has the "automatic" value, then the tiles will use an automatic vertex Z value. + Also before drawing the tiles, GL_ALPHA_TEST will be enabled, and disabled after drawing them. The used alpha func will be: + + glAlphaFunc( GL_GREATER, value ) + + "value" by default is 0, but you can change it from Tiled by adding the "cc_alpha_func" property to the layer. + The value 0 should work for most cases, but if you have tiles that are semi-transparent, then you might want to use a differnt + value, like 0.5. + + For further information, please see the programming guide: + + http://www.cocos2d-iphone.org/wiki/doku.php/prog_guide:tiled_maps + + @since v0.8.1 + */ +@interface CCTMXLayer : CCSpriteBatchNode +{ + CCTMXTilesetInfo *tileset_; + NSString *layerName_; + CGSize layerSize_; + CGSize mapTileSize_; + uint32_t *tiles_; // GID are 32 bit + NSUInteger layerOrientation_; + NSMutableArray *properties_; + + unsigned char opacity_; // TMX Layer supports opacity + + NSUInteger minGID_; + NSUInteger maxGID_; + + // Only used when vertexZ is used + NSInteger vertexZvalue_; + BOOL useAutomaticVertexZ_; + float alphaFuncValue_; + + // used for optimization + CCSprite *reusedTile_; + ccCArray *atlasIndexArray_; +} +/** name of the layer */ +@property (nonatomic,readwrite,retain) NSString *layerName; +/** size of the layer in tiles */ +@property (nonatomic,readwrite) CGSize layerSize; +/** size of the map's tile (could be differnt from the tile's size) */ +@property (nonatomic,readwrite) CGSize mapTileSize; +/** pointer to the map of tiles */ +@property (nonatomic,readwrite) uint32_t *tiles; +/** Tilset information for the layer */ +@property (nonatomic,readwrite,retain) CCTMXTilesetInfo *tileset; +/** Layer orientation, which is the same as the map orientation */ +@property (nonatomic,readwrite) NSUInteger layerOrientation; +/** properties from the layer. They can be added using Tiled */ +@property (nonatomic,readwrite,retain) NSMutableArray *properties; + +/** creates a CCTMXLayer with an tileset info, a layer info and a map info */ ++(id) layerWithTilesetInfo:(CCTMXTilesetInfo*)tilesetInfo layerInfo:(CCTMXLayerInfo*)layerInfo mapInfo:(CCTMXMapInfo*)mapInfo; +/** initializes a CCTMXLayer with a tileset info, a layer info and a map info */ +-(id) initWithTilesetInfo:(CCTMXTilesetInfo*)tilesetInfo layerInfo:(CCTMXLayerInfo*)layerInfo mapInfo:(CCTMXMapInfo*)mapInfo; + +/** dealloc the map that contains the tile position from memory. + Unless you want to know at runtime the tiles positions, you can safely call this method. + If you are going to call [layer tileGIDAt:] then, don't release the map + */ +-(void) releaseMap; + +/** returns the tile (CCSprite) at a given a tile coordinate. + The returned CCSprite will be already added to the CCTMXLayer. Don't add it again. + The CCSprite can be treated like any other CCSprite: rotated, scaled, translated, opacity, color, etc. + You can remove either by calling: + - [layer removeChild:sprite cleanup:cleanup]; + - or [layer removeTileAt:ccp(x,y)]; + */ +-(CCSprite*) tileAt:(CGPoint)tileCoordinate; + +/** returns the tile gid at a given tile coordinate. + if it returns 0, it means that the tile is empty. + This method requires the the tile map has not been previously released (eg. don't call [layer releaseMap]) + */ +-(uint32_t) tileGIDAt:(CGPoint)tileCoordinate; + +/** sets the tile gid (gid = tile global id) at a given tile coordinate. + The Tile GID can be obtained by using the method "tileGIDAt" or by using the TMX editor -> Tileset Mgr +1. + If a tile is already placed at that position, then it will be removed. + */ +-(void) setTileGID:(uint32_t)gid at:(CGPoint)tileCoordinate; + +/** removes a tile at given tile coordinate */ +-(void) removeTileAt:(CGPoint)tileCoordinate; + +/** returns the position in pixels of a given tile coordinate */ +-(CGPoint) positionAt:(CGPoint)tileCoordinate; + +/** return the value for the specific property name */ +-(id) propertyNamed:(NSString *)propertyName; + +/** Creates the tiles */ +-(void) setupTiles; + +/** CCTMXLayer doesn't support adding a CCSprite manually. + @warning addchild:z:tag: is not supported on CCTMXLayer. Instead of setTileGID:at:/tileAt: + */ +-(void) addChild: (CCNode*)node z:(NSInteger)z tag:(NSInteger)tag; +@end diff --git a/libs/cocos2d/CCTMXLayer.m b/libs/cocos2d/CCTMXLayer.m new file mode 100755 index 0000000..bb2ba60 --- /dev/null +++ b/libs/cocos2d/CCTMXLayer.m @@ -0,0 +1,670 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2009-2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + * + * TMX Tiled Map support: + * http://www.mapeditor.org + * + */ + +#import "CCTMXLayer.h" +#import "CCTMXTiledMap.h" +#import "CCTMXXMLParser.h" +#import "CCSprite.h" +#import "CCSpriteBatchNode.h" +#import "CCTextureCache.h" +#import "Support/CGPointExtension.h" + +#pragma mark - +#pragma mark CCSpriteBatchNode Extension + +@interface CCSpriteBatchNode (TMXTiledMapExtensions) +-(id) addSpriteWithoutQuad:(CCSprite*)child z:(NSUInteger)z tag:(NSInteger)aTag; +-(void) addQuadFromSprite:(CCSprite*)sprite quadIndex:(NSUInteger)index; +@end + +/* IMPORTANT XXX IMPORTNAT: + * These 2 methods can't be part of CCTMXLayer since they call [super add...], and CCSpriteBatchNode#add SHALL not be called + */ +@implementation CCSpriteBatchNode (TMXTiledMapExtension) + +/* Adds a quad into the texture atlas but it won't be added into the children array. + This method should be called only when you are dealing with very big AtlasSrite and when most of the CCSprite won't be updated. + For example: a tile map (CCTMXMap) or a label with lots of characgers (CCLabelBMFont) + */ +-(void) addQuadFromSprite:(CCSprite*)sprite quadIndex:(NSUInteger)index +{ + NSAssert( sprite != nil, @"Argument must be non-nil"); + NSAssert( [sprite isKindOfClass:[CCSprite class]], @"CCSpriteBatchNode only supports CCSprites as children"); + + + while(index >= textureAtlas_.capacity || textureAtlas_.capacity == textureAtlas_.totalQuads ) + [self increaseAtlasCapacity]; + + // + // update the quad directly. Don't add the sprite to the scene graph + // + + [sprite useBatchNode:self]; + [sprite setAtlasIndex:index]; + + ccV3F_C4B_T2F_Quad quad = [sprite quad]; + [textureAtlas_ insertQuad:&quad atIndex:index]; + + // XXX: updateTransform will update the textureAtlas too using updateQuad. + // XXX: so, it should be AFTER the insertQuad + [sprite setDirty:YES]; + [sprite updateTransform]; +} + +/* This is the opposite of "addQuadFromSprite. + It add the sprite to the children and descendants array, but it doesn't update add it to the texture atlas + */ +-(id) addSpriteWithoutQuad:(CCSprite*)child z:(NSUInteger)z tag:(NSInteger)aTag +{ + NSAssert( child != nil, @"Argument must be non-nil"); + NSAssert( [child isKindOfClass:[CCSprite class]], @"CCSpriteBatchNode only supports CCSprites as children"); + + // quad index is Z + [child setAtlasIndex:z]; + + // XXX: optimize with a binary search + int i=0; + for( CCSprite *c in descendants_ ) { + if( c.atlasIndex >= z ) + break; + i++; + } + [descendants_ insertObject:child atIndex:i]; + + + // IMPORTANT: Call super, and not self. Avoid adding it to the texture atlas array + [super addChild:child z:z tag:aTag]; + return self; +} +@end + + +#pragma mark - +#pragma mark CCTMXLayer + +int compareInts (const void * a, const void * b); + + +@interface CCTMXLayer () +-(CGPoint) positionForIsoAt:(CGPoint)pos; +-(CGPoint) positionForOrthoAt:(CGPoint)pos; +-(CGPoint) positionForHexAt:(CGPoint)pos; + +-(CGPoint) calculateLayerOffset:(CGPoint)offset; + +/* optimization methos */ +-(CCSprite*) appendTileForGID:(uint32_t)gid at:(CGPoint)pos; +-(CCSprite*) insertTileForGID:(uint32_t)gid at:(CGPoint)pos; +-(CCSprite*) updateTileForGID:(uint32_t)gid at:(CGPoint)pos; + +/* The layer recognizes some special properties, like cc_vertez */ +-(void) parseInternalProperties; + +-(NSInteger) vertexZForPos:(CGPoint)pos; + +// index +-(NSUInteger) atlasIndexForExistantZ:(NSUInteger)z; +-(NSUInteger) atlasIndexForNewZ:(NSUInteger)z; +@end + +@implementation CCTMXLayer +@synthesize layerSize = layerSize_, layerName = layerName_, tiles = tiles_; +@synthesize tileset = tileset_; +@synthesize layerOrientation = layerOrientation_; +@synthesize mapTileSize = mapTileSize_; +@synthesize properties = properties_; + +#pragma mark CCTMXLayer - init & alloc & dealloc + ++(id) layerWithTilesetInfo:(CCTMXTilesetInfo*)tilesetInfo layerInfo:(CCTMXLayerInfo*)layerInfo mapInfo:(CCTMXMapInfo*)mapInfo +{ + return [[[self alloc] initWithTilesetInfo:tilesetInfo layerInfo:layerInfo mapInfo:mapInfo] autorelease]; +} + +-(id) initWithTilesetInfo:(CCTMXTilesetInfo*)tilesetInfo layerInfo:(CCTMXLayerInfo*)layerInfo mapInfo:(CCTMXMapInfo*)mapInfo +{ + // XXX: is 35% a good estimate ? + CGSize size = layerInfo.layerSize; + float totalNumberOfTiles = size.width * size.height; + float capacity = totalNumberOfTiles * 0.35f + 1; // 35 percent is occupied ? + + CCTexture2D *tex = nil; + if( tilesetInfo ) + tex = [[CCTextureCache sharedTextureCache] addImage:tilesetInfo.sourceImage]; + + if((self = [super initWithTexture:tex capacity:capacity])) { + + // layerInfo + self.layerName = layerInfo.name; + layerSize_ = layerInfo.layerSize; + tiles_ = layerInfo.tiles; + minGID_ = layerInfo.minGID; + maxGID_ = layerInfo.maxGID; + opacity_ = layerInfo.opacity; + self.properties = [NSMutableDictionary dictionaryWithDictionary:layerInfo.properties]; + + // tilesetInfo + self.tileset = tilesetInfo; + + // mapInfo + mapTileSize_ = mapInfo.tileSize; + layerOrientation_ = mapInfo.orientation; + + // offset (after layer orientation is set); + CGPoint offset = [self calculateLayerOffset:layerInfo.offset]; + [self setPositionInPixels:offset]; + + atlasIndexArray_ = ccCArrayNew(totalNumberOfTiles); + + [self setContentSizeInPixels: CGSizeMake( layerSize_.width * mapTileSize_.width, layerSize_.height * mapTileSize_.height )]; + + useAutomaticVertexZ_= NO; + vertexZvalue_ = 0; + alphaFuncValue_ = 0; + + } + return self; +} + +- (void) dealloc +{ + [layerName_ release]; + [tileset_ release]; + [reusedTile_ release]; + [properties_ release]; + + if( atlasIndexArray_ ) { + ccCArrayFree(atlasIndexArray_); + atlasIndexArray_ = NULL; + } + + if( tiles_ ) { + free(tiles_); + tiles_ = NULL; + } + + [super dealloc]; +} + +-(void) releaseMap +{ + if( tiles_) { + free( tiles_); + tiles_ = NULL; + } + + if( atlasIndexArray_ ) { + ccCArrayFree(atlasIndexArray_); + atlasIndexArray_ = NULL; + } +} + +#pragma mark CCTMXLayer - setup Tiles + +-(void) setupTiles +{ + // Optimization: quick hack that sets the image size on the tileset + tileset_.imageSize = [textureAtlas_.texture contentSizeInPixels]; + + // By default all the tiles are aliased + // pros: + // - easier to render + // cons: + // - difficult to scale / rotate / etc. + [textureAtlas_.texture setAliasTexParameters]; + + CFByteOrder o = CFByteOrderGetCurrent(); + + // Parse cocos2d properties + [self parseInternalProperties]; + + for( NSUInteger y=0; y < layerSize_.height; y++ ) { + for( NSUInteger x=0; x < layerSize_.width; x++ ) { + + NSUInteger pos = x + layerSize_.width * y; + uint32_t gid = tiles_[ pos ]; + + // gid are stored in little endian. + // if host is big endian, then swap + if( o == CFByteOrderBigEndian ) + gid = CFSwapInt32( gid ); + + // XXX: gid == 0 --> empty tile + if( gid != 0 ) { + [self appendTileForGID:gid at:ccp(x,y)]; + + // Optimization: update min and max GID rendered by the layer + minGID_ = MIN(gid, minGID_); + maxGID_ = MAX(gid, maxGID_); + } + } + } + + NSAssert( maxGID_ >= tileset_.firstGid && + minGID_ >= tileset_.firstGid, @"TMX: Only 1 tilset per layer is supported"); +} + +#pragma mark CCTMXLayer - Properties + +-(id) propertyNamed:(NSString *)propertyName +{ + return [properties_ valueForKey:propertyName]; +} + +-(void) parseInternalProperties +{ + // if cc_vertex=automatic, then tiles will be rendered using vertexz + + NSString *vertexz = [self propertyNamed:@"cc_vertexz"]; + if( vertexz ) { + if( [vertexz isEqualToString:@"automatic"] ) + useAutomaticVertexZ_ = YES; + else + vertexZvalue_ = [vertexz intValue]; + } + + NSString *alphaFuncVal = [self propertyNamed:@"cc_alpha_func"]; + alphaFuncValue_ = [alphaFuncVal floatValue]; +} + +#pragma mark CCTMXLayer - obtaining tiles/gids + +-(CCSprite*) tileAt:(CGPoint)pos +{ + NSAssert( pos.x < layerSize_.width && pos.y < layerSize_.height && pos.x >=0 && pos.y >=0, @"TMXLayer: invalid position"); + NSAssert( tiles_ && atlasIndexArray_, @"TMXLayer: the tiles map has been released"); + + CCSprite *tile = nil; + uint32_t gid = [self tileGIDAt:pos]; + + // if GID == 0, then no tile is present + if( gid ) { + int z = pos.x + pos.y * layerSize_.width; + tile = (CCSprite*) [self getChildByTag:z]; + + // tile not created yet. create it + if( ! tile ) { + CGRect rect = [tileset_ rectForGID:gid]; + tile = [[CCSprite alloc] initWithBatchNode:self rectInPixels:rect]; + [tile setPositionInPixels: [self positionAt:pos]]; + [tile setVertexZ: [self vertexZForPos:pos]]; + tile.anchorPoint = CGPointZero; + [tile setOpacity:opacity_]; + + NSUInteger indexForZ = [self atlasIndexForExistantZ:z]; + [self addSpriteWithoutQuad:tile z:indexForZ tag:z]; + [tile release]; + } + } + return tile; +} + +-(uint32_t) tileGIDAt:(CGPoint)pos +{ + NSAssert( pos.x < layerSize_.width && pos.y < layerSize_.height && pos.x >=0 && pos.y >=0, @"TMXLayer: invalid position"); + NSAssert( tiles_ && atlasIndexArray_, @"TMXLayer: the tiles map has been released"); + + NSInteger idx = pos.x + pos.y * layerSize_.width; + return tiles_[ idx ]; +} + +#pragma mark CCTMXLayer - adding helper methods + +-(CCSprite*) insertTileForGID:(uint32_t)gid at:(CGPoint)pos +{ + CGRect rect = [tileset_ rectForGID:gid]; + + NSInteger z = pos.x + pos.y * layerSize_.width; + + if( ! reusedTile_ ) + reusedTile_ = [[CCSprite alloc] initWithBatchNode:self rectInPixels:rect]; + else + [reusedTile_ initWithBatchNode:self rectInPixels:rect]; + + [reusedTile_ setPositionInPixels: [self positionAt:pos]]; + [reusedTile_ setVertexZ: [self vertexZForPos:pos]]; + reusedTile_.anchorPoint = CGPointZero; + [reusedTile_ setOpacity:opacity_]; + + // get atlas index + NSUInteger indexForZ = [self atlasIndexForNewZ:z]; + + // Optimization: add the quad without adding a child + [self addQuadFromSprite:reusedTile_ quadIndex:indexForZ]; + + // insert it into the local atlasindex array + ccCArrayInsertValueAtIndex(atlasIndexArray_, (void*)z, indexForZ); + + // update possible children + CCSprite *sprite; + CCARRAY_FOREACH(children_, sprite) { + NSUInteger ai = [sprite atlasIndex]; + if( ai >= indexForZ) + [sprite setAtlasIndex: ai+1]; + } + + tiles_[z] = gid; + + return reusedTile_; +} + +-(CCSprite*) updateTileForGID:(uint32_t)gid at:(CGPoint)pos +{ + CGRect rect = [tileset_ rectForGID:gid]; + + int z = pos.x + pos.y * layerSize_.width; + + if( ! reusedTile_ ) + reusedTile_ = [[CCSprite alloc] initWithBatchNode:self rectInPixels:rect]; + else + [reusedTile_ initWithBatchNode:self rectInPixels:rect]; + + [reusedTile_ setPositionInPixels: [self positionAt:pos]]; + [reusedTile_ setVertexZ: [self vertexZForPos:pos]]; + reusedTile_.anchorPoint = CGPointZero; + [reusedTile_ setOpacity:opacity_]; + + // get atlas index + NSUInteger indexForZ = [self atlasIndexForExistantZ:z]; + + [reusedTile_ setAtlasIndex:indexForZ]; + [reusedTile_ setDirty:YES]; + [reusedTile_ updateTransform]; + tiles_[z] = gid; + + return reusedTile_; +} + + +// used only when parsing the map. useless after the map was parsed +// since lot's of assumptions are no longer true +-(CCSprite*) appendTileForGID:(uint32_t)gid at:(CGPoint)pos +{ + CGRect rect = [tileset_ rectForGID:gid]; + + NSInteger z = pos.x + pos.y * layerSize_.width; + + if( ! reusedTile_ ) + reusedTile_ = [[CCSprite alloc] initWithBatchNode:self rectInPixels:rect]; + else + [reusedTile_ initWithBatchNode:self rectInPixels:rect]; + + [reusedTile_ setPositionInPixels: [self positionAt:pos]]; + [reusedTile_ setVertexZ: [self vertexZForPos:pos]]; + reusedTile_.anchorPoint = CGPointZero; + [reusedTile_ setOpacity:opacity_]; + + // optimization: + // The difference between appendTileForGID and insertTileforGID is that append is faster, since + // it appends the tile at the end of the texture atlas + NSUInteger indexForZ = atlasIndexArray_->num; + + + // don't add it using the "standard" way. + [self addQuadFromSprite:reusedTile_ quadIndex:indexForZ]; + + + // append should be after addQuadFromSprite since it modifies the quantity values + ccCArrayInsertValueAtIndex(atlasIndexArray_, (void*)z, indexForZ); + + return reusedTile_; +} + +#pragma mark CCTMXLayer - atlasIndex and Z + +int compareInts (const void * a, const void * b) +{ + return ( *(int*)a - *(int*)b ); +} + +-(NSUInteger) atlasIndexForExistantZ:(NSUInteger)z +{ + NSInteger key = z; + NSInteger *item = bsearch((void*)&key, (void*)&atlasIndexArray_->arr[0], atlasIndexArray_->num, sizeof(void*), compareInts); + + NSAssert( item, @"TMX atlas index not found. Shall not happen"); + + NSUInteger index = ((NSInteger)item - (NSInteger)atlasIndexArray_->arr) / sizeof(void*); + return index; +} + +-(NSUInteger)atlasIndexForNewZ:(NSUInteger)z +{ + // XXX: This can be improved with a sort of binary search + NSUInteger i = 0; + for(i = 0; i< atlasIndexArray_->num; i++) { + NSUInteger val = (NSUInteger) atlasIndexArray_->arr[i]; + if( z < val ) + break; + } + return i; +} + +#pragma mark CCTMXLayer - adding / remove tiles + +-(void) setTileGID:(uint32_t)gid at:(CGPoint)pos +{ + NSAssert( pos.x < layerSize_.width && pos.y < layerSize_.height && pos.x >=0 && pos.y >=0, @"TMXLayer: invalid position"); + NSAssert( tiles_ && atlasIndexArray_, @"TMXLayer: the tiles map has been released"); + NSAssert( gid == 0 || gid >= tileset_.firstGid, @"TMXLayer: invalid gid" ); + + uint32_t currentGID = [self tileGIDAt:pos]; + + if( currentGID != gid ) { + + // setting gid=0 is equal to remove the tile + if( gid == 0 ) + [self removeTileAt:pos]; + + // empty tile. create a new one + else if( currentGID == 0 ) + [self insertTileForGID:gid at:pos]; + + // modifying an existing tile with a non-empty tile + else { + + NSUInteger z = pos.x + pos.y * layerSize_.width; + id sprite = [self getChildByTag:z]; + if( sprite ) { + CGRect rect = [tileset_ rectForGID:gid]; + [sprite setTextureRectInPixels:rect rotated:NO untrimmedSize:rect.size]; + tiles_[z] = gid; + } else + [self updateTileForGID:gid at:pos]; + } + } +} + +-(void) addChild: (CCNode*)node z:(NSInteger)z tag:(NSInteger)tag +{ + NSAssert(NO, @"addChild: is not supported on CCTMXLayer. Instead use setTileGID:at:/tileAt:"); +} + +-(void) removeChild:(CCSprite*)sprite cleanup:(BOOL)cleanup +{ + // allows removing nil objects + if( ! sprite ) + return; + + NSAssert( [children_ containsObject:sprite], @"Tile does not belong to TMXLayer"); + + NSUInteger atlasIndex = [sprite atlasIndex]; + NSUInteger zz = (NSUInteger) atlasIndexArray_->arr[atlasIndex]; + tiles_[zz] = 0; + ccCArrayRemoveValueAtIndex(atlasIndexArray_, atlasIndex); + [super removeChild:sprite cleanup:cleanup]; +} + +-(void) removeTileAt:(CGPoint)pos +{ + NSAssert( pos.x < layerSize_.width && pos.y < layerSize_.height && pos.x >=0 && pos.y >=0, @"TMXLayer: invalid position"); + NSAssert( tiles_ && atlasIndexArray_, @"TMXLayer: the tiles map has been released"); + + uint32_t gid = [self tileGIDAt:pos]; + + if( gid ) { + + NSUInteger z = pos.x + pos.y * layerSize_.width; + NSUInteger atlasIndex = [self atlasIndexForExistantZ:z]; + + // remove tile from GID map + tiles_[z] = 0; + + // remove tile from atlas position array + ccCArrayRemoveValueAtIndex(atlasIndexArray_, atlasIndex); + + // remove it from sprites and/or texture atlas + id sprite = [self getChildByTag:z]; + if( sprite ) + [super removeChild:sprite cleanup:YES]; + else { + [textureAtlas_ removeQuadAtIndex:atlasIndex]; + + // update possible children + CCARRAY_FOREACH(children_, sprite) { + NSUInteger ai = [sprite atlasIndex]; + if( ai >= atlasIndex) { + [sprite setAtlasIndex: ai-1]; + } + } + } + } +} + +#pragma mark CCTMXLayer - obtaining positions, offset + +-(CGPoint) calculateLayerOffset:(CGPoint)pos +{ + CGPoint ret = CGPointZero; + switch( layerOrientation_ ) { + case CCTMXOrientationOrtho: + ret = ccp( pos.x * mapTileSize_.width, -pos.y *mapTileSize_.height); + break; + case CCTMXOrientationIso: + ret = ccp( (mapTileSize_.width /2) * (pos.x - pos.y), + (mapTileSize_.height /2 ) * (-pos.x - pos.y) ); + break; + case CCTMXOrientationHex: + NSAssert(CGPointEqualToPoint(pos, CGPointZero), @"offset for hexagonal map not implemented yet"); + break; + } + return ret; +} + +-(CGPoint) positionAt:(CGPoint)pos +{ + CGPoint ret = CGPointZero; + switch( layerOrientation_ ) { + case CCTMXOrientationOrtho: + ret = [self positionForOrthoAt:pos]; + break; + case CCTMXOrientationIso: + ret = [self positionForIsoAt:pos]; + break; + case CCTMXOrientationHex: + ret = [self positionForHexAt:pos]; + break; + } + return ret; +} + +-(CGPoint) positionForOrthoAt:(CGPoint)pos +{ + CGPoint xy = { + pos.x * mapTileSize_.width, + (layerSize_.height - pos.y - 1) * mapTileSize_.height, + }; + return xy; +} + +-(CGPoint) positionForIsoAt:(CGPoint)pos +{ + CGPoint xy = { + mapTileSize_.width /2 * ( layerSize_.width + pos.x - pos.y - 1), + mapTileSize_.height /2 * (( layerSize_.height * 2 - pos.x - pos.y) - 2), + }; + return xy; +} + +-(CGPoint) positionForHexAt:(CGPoint)pos +{ + float diffY = 0; + if( (int)pos.x % 2 == 1 ) + diffY = -mapTileSize_.height/2 ; + + CGPoint xy = { + pos.x * mapTileSize_.width*3/4, + (layerSize_.height - pos.y - 1) * mapTileSize_.height + diffY + }; + return xy; +} + +-(NSInteger) vertexZForPos:(CGPoint)pos +{ + NSInteger ret = 0; + NSUInteger maxVal = 0; + if( useAutomaticVertexZ_ ) { + switch( layerOrientation_ ) { + case CCTMXOrientationIso: + maxVal = layerSize_.width + layerSize_.height; + ret = -(maxVal - (pos.x + pos.y)); + break; + case CCTMXOrientationOrtho: + ret = -(layerSize_.height-pos.y); + break; + case CCTMXOrientationHex: + NSAssert(NO,@"TMX Hexa zOrder not supported"); + break; + default: + NSAssert(NO,@"TMX invalid value"); + break; + } + } else + ret = vertexZvalue_; + + return ret; +} + +#pragma mark CCTMXLayer - draw + +-(void) draw +{ + if( useAutomaticVertexZ_ ) { + glEnable(GL_ALPHA_TEST); + glAlphaFunc(GL_GREATER, alphaFuncValue_); + } + + [super draw]; + + if( useAutomaticVertexZ_ ) + glDisable(GL_ALPHA_TEST); +} +@end + diff --git a/libs/cocos2d/CCTMXObjectGroup.h b/libs/cocos2d/CCTMXObjectGroup.h new file mode 100755 index 0000000..02feadf --- /dev/null +++ b/libs/cocos2d/CCTMXObjectGroup.h @@ -0,0 +1,67 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2010 Neophit + * + * Copyright (c) 2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + * + * TMX Tiled Map support: + * http://www.mapeditor.org + * + */ + +#import "CCNode.h" + + +@class CCTMXObjectGroup; + + +/** CCTMXObjectGroup represents the TMX object group. +@since v0.99.0 +*/ +@interface CCTMXObjectGroup : NSObject +{ + NSString *groupName_; + CGPoint positionOffset_; + NSMutableArray *objects_; + NSMutableDictionary *properties_; +} + +/** name of the group */ +@property (nonatomic,readwrite,retain) NSString *groupName; +/** offset position of child objects */ +@property (nonatomic,readwrite,assign) CGPoint positionOffset; +/** array of the objects */ +@property (nonatomic,readwrite,retain) NSMutableArray *objects; +/** list of properties stored in a dictionary */ +@property (nonatomic,readwrite,retain) NSMutableDictionary *properties; + +/** return the value for the specific property name */ +-(id) propertyNamed:(NSString *)propertyName; + +/** return the dictionary for the specific object name. + It will return the 1st object found on the array for the given name. + */ +-(NSMutableDictionary*) objectNamed:(NSString *)objectName; + +@end diff --git a/libs/cocos2d/CCTMXObjectGroup.m b/libs/cocos2d/CCTMXObjectGroup.m new file mode 100755 index 0000000..648cda4 --- /dev/null +++ b/libs/cocos2d/CCTMXObjectGroup.m @@ -0,0 +1,86 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2010 Neophit + * + * Copyright (c) 2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + * + * TMX Tiled Map support: + * http://www.mapeditor.org + * + */ + +#import "CCTMXObjectGroup.h" +#import "CCTMXXMLParser.h" +#import "ccMacros.h" +#import "Support/CGPointExtension.h" + + +#pragma mark - +#pragma mark TMXObjectGroup + +@implementation CCTMXObjectGroup + +@synthesize groupName = groupName_; +@synthesize objects = objects_; +@synthesize positionOffset = positionOffset_; +@synthesize properties = properties_; + +-(id) init +{ + if (( self=[super init] )) { + self.groupName = nil; + self.positionOffset = CGPointZero; + self.objects = [NSMutableArray arrayWithCapacity:10]; + self.properties = [NSMutableDictionary dictionaryWithCapacity:5]; + } + return self; +} + +-(void) dealloc +{ + CCLOGINFO( @"cocos2d: deallocing %@", self ); + + [groupName_ release]; + [objects_ release]; + [properties_ release]; + [super dealloc]; +} + +-(NSMutableDictionary*) objectNamed:(NSString *)objectName +{ + for( id object in objects_ ) { + if( [[object valueForKey:@"name"] isEqual:objectName] ) + return object; + } + + // object not found + return nil; +} + +-(id) propertyNamed:(NSString *)propertyName +{ + return [properties_ valueForKey:propertyName]; +} + +@end diff --git a/libs/cocos2d/CCTMXTiledMap.h b/libs/cocos2d/CCTMXTiledMap.h new file mode 100755 index 0000000..8f48da3 --- /dev/null +++ b/libs/cocos2d/CCTMXTiledMap.h @@ -0,0 +1,145 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2009-2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + * + * TMX Tiled Map support: + * http://www.mapeditor.org + * + */ + +#import "CCNode.h" + + +@class CCTMXLayer; +@class CCTMXObjectGroup; + +/** Possible oritentations of the TMX map */ +enum +{ + /** Orthogonal orientation */ + CCTMXOrientationOrtho, + + /** Hexagonal orientation */ + CCTMXOrientationHex, + + /** Isometric orientation */ + CCTMXOrientationIso, +}; + +/** CCTMXTiledMap knows how to parse and render a TMX map. + + It adds support for the TMX tiled map format used by http://www.mapeditor.org + It supports isometric, hexagonal and orthogonal tiles. + It also supports object groups, objects, and properties. + + Features: + - Each tile will be treated as an CCSprite + - The sprites are created on demand. They will be created only when you call "[layer tileAt:]" + - Each tile can be rotated / moved / scaled / tinted / "opacitied", since each tile is a CCSprite + - Tiles can be added/removed in runtime + - The z-order of the tiles can be modified in runtime + - Each tile has an anchorPoint of (0,0) + - The anchorPoint of the TMXTileMap is (0,0) + - The TMX layers will be added as a child + - The TMX layers will be aliased by default + - The tileset image will be loaded using the CCTextureCache + - Each tile will have a unique tag + - Each tile will have a unique z value. top-left: z=1, bottom-right: z=max z + - Each object group will be treated as an NSMutableArray + - Object class which will contain all the properties in a dictionary + - Properties can be assigned to the Map, Layer, Object Group, and Object + + Limitations: + - It only supports one tileset per layer. + - Embeded images are not supported + - It only supports the XML format (the JSON format is not supported) + + Technical description: + Each layer is created using an CCTMXLayer (subclass of CCSpriteBatchNode). If you have 5 layers, then 5 CCTMXLayer will be created, + unless the layer visibility is off. In that case, the layer won't be created at all. + You can obtain the layers (CCTMXLayer objects) at runtime by: + - [map getChildByTag: tag_number]; // 0=1st layer, 1=2nd layer, 2=3rd layer, etc... + - [map layerNamed: name_of_the_layer]; + + Each object group is created using a CCTMXObjectGroup which is a subclass of NSMutableArray. + You can obtain the object groups at runtime by: + - [map objectGroupNamed: name_of_the_object_group]; + + Each object is a CCTMXObject. + + Each property is stored as a key-value pair in an NSMutableDictionary. + You can obtain the properties at runtime by: + + [map propertyNamed: name_of_the_property]; + [layer propertyNamed: name_of_the_property]; + [objectGroup propertyNamed: name_of_the_property]; + [object propertyNamed: name_of_the_property]; + + @since v0.8.1 + */ +@interface CCTMXTiledMap : CCNode +{ + CGSize mapSize_; + CGSize tileSize_; + int mapOrientation_; + NSMutableArray *objectGroups_; + NSMutableDictionary *properties_; + NSMutableDictionary *tileProperties_; +} + +/** the map's size property measured in tiles */ +@property (nonatomic,readonly) CGSize mapSize; +/** the tiles's size property measured in pixels */ +@property (nonatomic,readonly) CGSize tileSize; +/** map orientation */ +@property (nonatomic,readonly) int mapOrientation; +/** object groups */ +@property (nonatomic,readwrite,retain) NSMutableArray *objectGroups; +/** properties */ +@property (nonatomic,readwrite,retain) NSMutableDictionary *properties; + +/** creates a TMX Tiled Map with a TMX file.*/ ++(id) tiledMapWithTMXFile:(NSString*)tmxFile; + +/** initializes a TMX Tiled Map with a TMX file */ +-(id) initWithTMXFile:(NSString*)tmxFile; + +/** return the TMXLayer for the specific layer */ +-(CCTMXLayer*) layerNamed:(NSString *)layerName; + +/** return the TMXObjectGroup for the secific group */ +-(CCTMXObjectGroup*) objectGroupNamed:(NSString *)groupName; + +/** return the TMXObjectGroup for the secific group + @deprecated Use map#objectGroupNamed instead + */ +-(CCTMXObjectGroup*) groupNamed:(NSString *)groupName DEPRECATED_ATTRIBUTE; + +/** return the value for the specific property name */ +-(id) propertyNamed:(NSString *)propertyName; + +/** return properties dictionary for tile GID */ +-(NSDictionary*)propertiesForGID:(unsigned int)GID; +@end + diff --git a/libs/cocos2d/CCTMXTiledMap.m b/libs/cocos2d/CCTMXTiledMap.m new file mode 100755 index 0000000..7f86c6a --- /dev/null +++ b/libs/cocos2d/CCTMXTiledMap.m @@ -0,0 +1,201 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2009-2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + * + * TMX Tiled Map support: + * http://www.mapeditor.org + * + */ + +#import "CCTMXTiledMap.h" +#import "CCTMXXMLParser.h" +#import "CCTMXLayer.h" +#import "CCTMXObjectGroup.h" +#import "CCSprite.h" +#import "CCTextureCache.h" +#import "Support/CGPointExtension.h" + + +#pragma mark - +#pragma mark CCTMXTiledMap + +@interface CCTMXTiledMap (Private) +-(id) parseLayer:(CCTMXLayerInfo*)layer map:(CCTMXMapInfo*)mapInfo; +-(CCTMXTilesetInfo*) tilesetForLayer:(CCTMXLayerInfo*)layerInfo map:(CCTMXMapInfo*)mapInfo; +@end + +@implementation CCTMXTiledMap +@synthesize mapSize = mapSize_; +@synthesize tileSize = tileSize_; +@synthesize mapOrientation = mapOrientation_; +@synthesize objectGroups = objectGroups_; +@synthesize properties = properties_; + ++(id) tiledMapWithTMXFile:(NSString*)tmxFile +{ + return [[[self alloc] initWithTMXFile:tmxFile] autorelease]; +} + +-(id) initWithTMXFile:(NSString*)tmxFile +{ + NSAssert(tmxFile != nil, @"TMXTiledMap: tmx file should not bi nil"); + + if ((self=[super init])) { + + [self setContentSize:CGSizeZero]; + + CCTMXMapInfo *mapInfo = [CCTMXMapInfo formatWithTMXFile:tmxFile]; + + NSAssert( [mapInfo.tilesets count] != 0, @"TMXTiledMap: Map not found. Please check the filename."); + + mapSize_ = mapInfo.mapSize; + tileSize_ = mapInfo.tileSize; + mapOrientation_ = mapInfo.orientation; + objectGroups_ = [mapInfo.objectGroups retain]; + properties_ = [mapInfo.properties retain]; + tileProperties_ = [mapInfo.tileProperties retain]; + + int idx=0; + + for( CCTMXLayerInfo *layerInfo in mapInfo.layers ) { + + if( layerInfo.visible ) { + CCNode *child = [self parseLayer:layerInfo map:mapInfo]; + [self addChild:child z:idx tag:idx]; + + // update content size with the max size + CGSize childSize = [child contentSize]; + CGSize currentSize = [self contentSize]; + currentSize.width = MAX( currentSize.width, childSize.width ); + currentSize.height = MAX( currentSize.height, childSize.height ); + [self setContentSize:currentSize]; + + idx++; + } + } + } + + return self; +} + +-(void) dealloc +{ + [objectGroups_ release]; + [properties_ release]; + [tileProperties_ release]; + [super dealloc]; +} + +// private +-(id) parseLayer:(CCTMXLayerInfo*)layerInfo map:(CCTMXMapInfo*)mapInfo +{ + CCTMXTilesetInfo *tileset = [self tilesetForLayer:layerInfo map:mapInfo]; + CCTMXLayer *layer = [CCTMXLayer layerWithTilesetInfo:tileset layerInfo:layerInfo mapInfo:mapInfo]; + + // tell the layerinfo to release the ownership of the tiles map. + layerInfo.ownTiles = NO; + + [layer setupTiles]; + + return layer; +} + +-(CCTMXTilesetInfo*) tilesetForLayer:(CCTMXLayerInfo*)layerInfo map:(CCTMXMapInfo*)mapInfo +{ + CFByteOrder o = CFByteOrderGetCurrent(); + + CGSize size = layerInfo.layerSize; + + id iter = [mapInfo.tilesets reverseObjectEnumerator]; + for( CCTMXTilesetInfo* tileset in iter) { + for( unsigned int y = 0; y < size.height; y++ ) { + for( unsigned int x = 0; x < size.width; x++ ) { + + unsigned int pos = x + size.width * y; + unsigned int gid = layerInfo.tiles[ pos ]; + + // gid are stored in little endian. + // if host is big endian, then swap + if( o == CFByteOrderBigEndian ) + gid = CFSwapInt32( gid ); + + // XXX: gid == 0 --> empty tile + if( gid != 0 ) { + + // Optimization: quick return + // if the layer is invalid (more than 1 tileset per layer) an assert will be thrown later + if( gid >= tileset.firstGid ) + return tileset; + } + } + } + } + + // If all the tiles are 0, return empty tileset + CCLOG(@"cocos2d: Warning: TMX Layer '%@' has no tiles", layerInfo.name); + return nil; +} + + +// public + +-(CCTMXLayer*) layerNamed:(NSString *)layerName +{ + CCTMXLayer *layer; + CCARRAY_FOREACH(children_, layer) { + if([layer isKindOfClass:[CCTMXLayer class]]) + if([layer.layerName isEqual:layerName]) + return layer; + } + + // layer not found + return nil; +} + +-(CCTMXObjectGroup*) objectGroupNamed:(NSString *)groupName +{ + for( CCTMXObjectGroup *objectGroup in objectGroups_ ) { + if( [objectGroup.groupName isEqual:groupName] ) + return objectGroup; + } + + // objectGroup not found + return nil; +} + +// XXX deprecated +-(CCTMXObjectGroup*) groupNamed:(NSString *)groupName +{ + return [self objectGroupNamed:groupName]; +} + +-(id) propertyNamed:(NSString *)propertyName +{ + return [properties_ valueForKey:propertyName]; +} +-(NSDictionary*)propertiesForGID:(unsigned int)GID{ + return [tileProperties_ objectForKey:[NSNumber numberWithInt:GID]]; +} +@end + diff --git a/libs/cocos2d/CCTMXXMLParser.h b/libs/cocos2d/CCTMXXMLParser.h new file mode 100755 index 0000000..18d7a8a --- /dev/null +++ b/libs/cocos2d/CCTMXXMLParser.h @@ -0,0 +1,202 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2009-2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + * + * TMX Tiled Map support: + * http://www.mapeditor.org + * + */ + +/* + * Internal TMX parser + * + * IMPORTANT: These classed should not be documented using doxygen strings + * since the user should not use them. + * + */ + + +#import +#import + +enum { + TMXLayerAttribNone = 1 << 0, + TMXLayerAttribBase64 = 1 << 1, + TMXLayerAttribGzip = 1 << 2, + TMXLayerAttribZlib = 1 << 3, +}; + +enum { + TMXPropertyNone, + TMXPropertyMap, + TMXPropertyLayer, + TMXPropertyObjectGroup, + TMXPropertyObject, + TMXPropertyTile +}; + +/* CCTMXLayerInfo contains the information about the layers like: + - Layer name + - Layer size + - Layer opacity at creation time (it can be modified at runtime) + - Whether the layer is visible (if it's not visible, then the CocosNode won't be created) + + This information is obtained from the TMX file. + */ +@interface CCTMXLayerInfo : NSObject +{ + NSString *name_; + CGSize layerSize_; + unsigned int *tiles_; + BOOL visible_; + unsigned char opacity_; + BOOL ownTiles_; + unsigned int minGID_; + unsigned int maxGID_; + NSMutableDictionary *properties_; + CGPoint offset_; +} + +@property (nonatomic,readwrite,retain) NSString *name; +@property (nonatomic,readwrite) CGSize layerSize; +@property (nonatomic,readwrite) unsigned int *tiles; +@property (nonatomic,readwrite) BOOL visible; +@property (nonatomic,readwrite) unsigned char opacity; +@property (nonatomic,readwrite) BOOL ownTiles; +@property (nonatomic,readwrite) unsigned int minGID; +@property (nonatomic,readwrite) unsigned int maxGID; +@property (nonatomic,readwrite,retain) NSMutableDictionary *properties; +@property (nonatomic,readwrite) CGPoint offset; +@end + +/* CCTMXTilesetInfo contains the information about the tilesets like: + - Tileset name + - Tilset spacing + - Tileset margin + - size of the tiles + - Image used for the tiles + - Image size + + This information is obtained from the TMX file. + */ +@interface CCTMXTilesetInfo : NSObject +{ + NSString *name_; + unsigned int firstGid_; + CGSize tileSize_; + unsigned int spacing_; + unsigned int margin_; + + // filename containing the tiles (should be spritesheet / texture atlas) + NSString *sourceImage_; + + // size in pixels of the image + CGSize imageSize_; +} +@property (nonatomic,readwrite,retain) NSString *name; +@property (nonatomic,readwrite,assign) unsigned int firstGid; +@property (nonatomic,readwrite,assign) CGSize tileSize; +@property (nonatomic,readwrite,assign) unsigned int spacing; +@property (nonatomic,readwrite,assign) unsigned int margin; +@property (nonatomic,readwrite,retain) NSString *sourceImage; +@property (nonatomic,readwrite,assign) CGSize imageSize; + +-(CGRect) rectForGID:(unsigned int)gid; +@end + +/* CCTMXMapInfo contains the information about the map like: + - Map orientation (hexagonal, isometric or orthogonal) + - Tile size + - Map size + + And it also contains: + - Layers (an array of TMXLayerInfo objects) + - Tilesets (an array of TMXTilesetInfo objects) + - ObjectGroups (an array of TMXObjectGroupInfo objects) + + This information is obtained from the TMX file. + + */ +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED +#if defined(__IPHONE_4_0) +@interface CCTMXMapInfo : NSObject +#else +@interface CCTMXMapInfo : NSObject +#endif + +#elif defined(__MAC_OS_X_VERSION_MAX_ALLOWED) +@interface CCTMXMapInfo : NSObject +#endif +{ + NSMutableString *currentString; + BOOL storingCharacters; + int layerAttribs; + int parentElement; + unsigned int parentGID_; + + + // tmx filename + NSString *filename_; + + // map orientation + int orientation_; + + // map width & height + CGSize mapSize_; + + // tiles width & height + CGSize tileSize_; + + // Layers + NSMutableArray *layers_; + + // tilesets + NSMutableArray *tilesets_; + + // ObjectGroups + NSMutableArray *objectGroups_; + + // properties + NSMutableDictionary *properties_; + + // tile properties + NSMutableDictionary *tileProperties_; +} + +@property (nonatomic,readwrite,assign) int orientation; +@property (nonatomic,readwrite,assign) CGSize mapSize; +@property (nonatomic,readwrite,assign) CGSize tileSize; +@property (nonatomic,readwrite,retain) NSMutableArray *layers; +@property (nonatomic,readwrite,retain) NSMutableArray *tilesets; +@property (nonatomic,readwrite,retain) NSString *filename; +@property (nonatomic,readwrite,retain) NSMutableArray *objectGroups; +@property (nonatomic,readwrite,retain) NSMutableDictionary *properties; +@property (nonatomic,readwrite,retain) NSMutableDictionary *tileProperties; + +/** creates a TMX Format with a tmx file */ ++(id) formatWithTMXFile:(NSString*)tmxFile; +/** initializes a TMX format witha tmx file */ +-(id) initWithTMXFile:(NSString*)tmxFile; +@end + diff --git a/libs/cocos2d/CCTMXXMLParser.m b/libs/cocos2d/CCTMXXMLParser.m new file mode 100755 index 0000000..77cea0e --- /dev/null +++ b/libs/cocos2d/CCTMXXMLParser.m @@ -0,0 +1,456 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2009-2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + * + * TMX Tiled Map support: + * http://www.mapeditor.org + * + */ + + +#import +#include + +#import "ccMacros.h" +#import "Support/CGPointExtension.h" +#import "CCTMXXMLParser.h" +#import "CCTMXTiledMap.h" +#import "CCTMXObjectGroup.h" +#import "Support/base64.h" +#import "Support/ZipUtils.h" +#import "Support/CCFileUtils.h" + +#pragma mark - +#pragma mark TMXLayerInfo + + +@implementation CCTMXLayerInfo + +@synthesize name = name_, layerSize = layerSize_, tiles = tiles_, visible = visible_, opacity = opacity_, ownTiles = ownTiles_, minGID = minGID_, maxGID = maxGID_, properties = properties_; +@synthesize offset = offset_; +-(id) init +{ + if( (self=[super init])) { + ownTiles_ = YES; + minGID_ = 100000; + maxGID_ = 0; + self.name = nil; + tiles_ = NULL; + offset_ = CGPointZero; + self.properties = [NSMutableDictionary dictionaryWithCapacity:5]; + } + return self; +} +- (void) dealloc +{ + CCLOGINFO(@"cocos2d: deallocing %@",self); + + [name_ release]; + [properties_ release]; + + if( ownTiles_ && tiles_ ) { + free( tiles_ ); + tiles_ = NULL; + } + [super dealloc]; +} + +@end + +#pragma mark - +#pragma mark TMXTilesetInfo +@implementation CCTMXTilesetInfo + +@synthesize name = name_, firstGid = firstGid_, tileSize = tileSize_, spacing = spacing_, margin = margin_, sourceImage = sourceImage_, imageSize = imageSize_; + +- (void) dealloc +{ + CCLOGINFO(@"cocos2d: deallocing %@", self); + [sourceImage_ release]; + [name_ release]; + [super dealloc]; +} + +-(CGRect) rectForGID:(unsigned int)gid +{ + CGRect rect; + rect.size = tileSize_; + + gid = gid - firstGid_; + + int max_x = (imageSize_.width - margin_*2 + spacing_) / (tileSize_.width + spacing_); + // int max_y = (imageSize.height - margin*2 + spacing) / (tileSize.height + spacing); + + rect.origin.x = (gid % max_x) * (tileSize_.width + spacing_) + margin_; + rect.origin.y = (gid / max_x) * (tileSize_.height + spacing_) + margin_; + + return rect; +} +@end + +#pragma mark - +#pragma mark CCTMXMapInfo + +@interface CCTMXMapInfo (Private) +/* initalises parsing of an XML file, either a tmx (Map) file or tsx (Tileset) file */ +-(void) parseXMLFile:(NSString *)xmlFilename; +@end + + +@implementation CCTMXMapInfo + +@synthesize orientation = orientation_, mapSize = mapSize_, layers = layers_, tilesets = tilesets_, tileSize = tileSize_, filename = filename_, objectGroups = objectGroups_, properties = properties_; +@synthesize tileProperties = tileProperties_; + ++(id) formatWithTMXFile:(NSString*)tmxFile +{ + return [[[self alloc] initWithTMXFile:tmxFile] autorelease]; +} + +-(id) initWithTMXFile:(NSString*)tmxFile +{ + if( (self=[super init])) { + + self.tilesets = [NSMutableArray arrayWithCapacity:4]; + self.layers = [NSMutableArray arrayWithCapacity:4]; + self.filename = tmxFile; + self.objectGroups = [NSMutableArray arrayWithCapacity:4]; + self.properties = [NSMutableDictionary dictionaryWithCapacity:5]; + self.tileProperties = [NSMutableDictionary dictionaryWithCapacity:5]; + + // tmp vars + currentString = [[NSMutableString alloc] initWithCapacity:1024]; + storingCharacters = NO; + layerAttribs = TMXLayerAttribNone; + parentElement = TMXPropertyNone; + + [self parseXMLFile:filename_]; + } + return self; +} +- (void) dealloc +{ + CCLOGINFO(@"cocos2d: deallocing %@", self); + [tilesets_ release]; + [layers_ release]; + [filename_ release]; + [currentString release]; + [objectGroups_ release]; + [properties_ release]; + [tileProperties_ release]; + [super dealloc]; +} + +- (void) parseXMLFile:(NSString *)xmlFilename +{ + NSURL *url = [NSURL fileURLWithPath:[CCFileUtils fullPathFromRelativePath:xmlFilename] ]; + NSData *data = [NSData dataWithContentsOfURL:url]; + NSXMLParser *parser = [[NSXMLParser alloc] initWithData:data]; + + // we'll do the parsing + [parser setDelegate:self]; + [parser setShouldProcessNamespaces:NO]; + [parser setShouldReportNamespacePrefixes:NO]; + [parser setShouldResolveExternalEntities:NO]; + [parser parse]; + + NSAssert1( ! [parser parserError], @"Error parsing file: %@.", xmlFilename ); + + [parser release]; +} + +// the XML parser calls here with all the elements +-(void)parser:(NSXMLParser *)parser didStartElement:(NSString *)elementName namespaceURI:(NSString *)namespaceURI qualifiedName:(NSString *)qName attributes:(NSDictionary *)attributeDict +{ + if([elementName isEqualToString:@"map"]) { + NSString *version = [attributeDict valueForKey:@"version"]; + if( ! [version isEqualToString:@"1.0"] ) + CCLOG(@"cocos2d: TMXFormat: Unsupported TMX version: %@", version); + NSString *orientationStr = [attributeDict valueForKey:@"orientation"]; + if( [orientationStr isEqualToString:@"orthogonal"]) + orientation_ = CCTMXOrientationOrtho; + else if ( [orientationStr isEqualToString:@"isometric"]) + orientation_ = CCTMXOrientationIso; + else if( [orientationStr isEqualToString:@"hexagonal"]) + orientation_ = CCTMXOrientationHex; + else + CCLOG(@"cocos2d: TMXFomat: Unsupported orientation: %@", orientation_); + + mapSize_.width = [[attributeDict valueForKey:@"width"] intValue]; + mapSize_.height = [[attributeDict valueForKey:@"height"] intValue]; + tileSize_.width = [[attributeDict valueForKey:@"tilewidth"] intValue]; + tileSize_.height = [[attributeDict valueForKey:@"tileheight"] intValue]; + + // The parent element is now "map" + parentElement = TMXPropertyMap; + } else if([elementName isEqualToString:@"tileset"]) { + + // If this is an external tileset then start parsing that + NSString *externalTilesetFilename = [attributeDict valueForKey:@"source"]; + if (externalTilesetFilename) { + // Tileset file will be relative to the map file. So we need to convert it to an absolute path + NSString *dir = [filename_ stringByDeletingLastPathComponent]; // Directory of map file + externalTilesetFilename = [dir stringByAppendingPathComponent:externalTilesetFilename]; // Append path to tileset file + + [self parseXMLFile:externalTilesetFilename]; + } else { + + CCTMXTilesetInfo *tileset = [CCTMXTilesetInfo new]; + tileset.name = [attributeDict valueForKey:@"name"]; + tileset.firstGid = [[attributeDict valueForKey:@"firstgid"] intValue]; + tileset.spacing = [[attributeDict valueForKey:@"spacing"] intValue]; + tileset.margin = [[attributeDict valueForKey:@"margin"] intValue]; + CGSize s; + s.width = [[attributeDict valueForKey:@"tilewidth"] intValue]; + s.height = [[attributeDict valueForKey:@"tileheight"] intValue]; + tileset.tileSize = s; + + [tilesets_ addObject:tileset]; + [tileset release]; + } + + }else if([elementName isEqualToString:@"tile"]){ + CCTMXTilesetInfo* info = [tilesets_ lastObject]; + NSMutableDictionary* dict = [NSMutableDictionary dictionaryWithCapacity:3]; + parentGID_ = [info firstGid] + [[attributeDict valueForKey:@"id"] intValue]; + [tileProperties_ setObject:dict forKey:[NSNumber numberWithInt:parentGID_]]; + + parentElement = TMXPropertyTile; + + }else if([elementName isEqualToString:@"layer"]) { + CCTMXLayerInfo *layer = [CCTMXLayerInfo new]; + layer.name = [attributeDict valueForKey:@"name"]; + + CGSize s; + s.width = [[attributeDict valueForKey:@"width"] intValue]; + s.height = [[attributeDict valueForKey:@"height"] intValue]; + layer.layerSize = s; + + layer.visible = ![[attributeDict valueForKey:@"visible"] isEqualToString:@"0"]; + + if( [attributeDict valueForKey:@"opacity"] ) + layer.opacity = 255 * [[attributeDict valueForKey:@"opacity"] floatValue]; + else + layer.opacity = 255; + + int x = [[attributeDict valueForKey:@"x"] intValue]; + int y = [[attributeDict valueForKey:@"y"] intValue]; + layer.offset = ccp(x,y); + + [layers_ addObject:layer]; + [layer release]; + + // The parent element is now "layer" + parentElement = TMXPropertyLayer; + + } else if([elementName isEqualToString:@"objectgroup"]) { + + CCTMXObjectGroup *objectGroup = [[CCTMXObjectGroup alloc] init]; + objectGroup.groupName = [attributeDict valueForKey:@"name"]; + CGPoint positionOffset; + positionOffset.x = [[attributeDict valueForKey:@"x"] intValue] * tileSize_.width; + positionOffset.y = [[attributeDict valueForKey:@"y"] intValue] * tileSize_.height; + objectGroup.positionOffset = positionOffset; + + [objectGroups_ addObject:objectGroup]; + [objectGroup release]; + + // The parent element is now "objectgroup" + parentElement = TMXPropertyObjectGroup; + + } else if([elementName isEqualToString:@"image"]) { + + CCTMXTilesetInfo *tileset = [tilesets_ lastObject]; + + // build full path + NSString *imagename = [attributeDict valueForKey:@"source"]; + NSString *path = [filename_ stringByDeletingLastPathComponent]; + tileset.sourceImage = [path stringByAppendingPathComponent:imagename]; + + } else if([elementName isEqualToString:@"data"]) { + NSString *encoding = [attributeDict valueForKey:@"encoding"]; + NSString *compression = [attributeDict valueForKey:@"compression"]; + + if( [encoding isEqualToString:@"base64"] ) { + layerAttribs |= TMXLayerAttribBase64; + storingCharacters = YES; + + if( [compression isEqualToString:@"gzip"] ) + layerAttribs |= TMXLayerAttribGzip; + + else if( [compression isEqualToString:@"zlib"] ) + layerAttribs |= TMXLayerAttribZlib; + + NSAssert( !compression || [compression isEqualToString:@"gzip"] || [compression isEqualToString:@"zlib"], @"TMX: unsupported compression method" ); + } + + NSAssert( layerAttribs != TMXLayerAttribNone, @"TMX tile map: Only base64 and/or gzip/zlib maps are supported" ); + + } else if([elementName isEqualToString:@"object"]) { + + CCTMXObjectGroup *objectGroup = [objectGroups_ lastObject]; + + // The value for "type" was blank or not a valid class name + // Create an instance of TMXObjectInfo to store the object and its properties + NSMutableDictionary *dict = [[NSMutableDictionary alloc] initWithCapacity:5]; + + // Set the name of the object to the value for "name" + [dict setValue:[attributeDict valueForKey:@"name"] forKey:@"name"]; + + // Assign all the attributes as key/name pairs in the properties dictionary + [dict setValue:[attributeDict valueForKey:@"type"] forKey:@"type"]; + int x = [[attributeDict valueForKey:@"x"] intValue] + objectGroup.positionOffset.x; + [dict setValue:[NSNumber numberWithInt:x] forKey:@"x"]; + int y = [[attributeDict valueForKey:@"y"] intValue] + objectGroup.positionOffset.y; + // Correct y position. (Tiled uses Flipped, cocos2d uses Standard) + y = (mapSize_.height * tileSize_.height) - y - [[attributeDict valueForKey:@"height"] intValue]; + [dict setValue:[NSNumber numberWithInt:y] forKey:@"y"]; + [dict setValue:[attributeDict valueForKey:@"width"] forKey:@"width"]; + [dict setValue:[attributeDict valueForKey:@"height"] forKey:@"height"]; + + // Add the object to the objectGroup + [[objectGroup objects] addObject:dict]; + [dict release]; + + // The parent element is now "object" + parentElement = TMXPropertyObject; + + } else if([elementName isEqualToString:@"property"]) { + + if ( parentElement == TMXPropertyNone ) { + + CCLOG( @"TMX tile map: Parent element is unsupported. Cannot add property named '%@' with value '%@'", + [attributeDict valueForKey:@"name"], [attributeDict valueForKey:@"value"] ); + + } else if ( parentElement == TMXPropertyMap ) { + + // The parent element is the map + [properties_ setValue:[attributeDict valueForKey:@"value"] forKey:[attributeDict valueForKey:@"name"]]; + + } else if ( parentElement == TMXPropertyLayer ) { + + // The parent element is the last layer + CCTMXLayerInfo *layer = [layers_ lastObject]; + // Add the property to the layer + [[layer properties] setValue:[attributeDict valueForKey:@"value"] forKey:[attributeDict valueForKey:@"name"]]; + + } else if ( parentElement == TMXPropertyObjectGroup ) { + + // The parent element is the last object group + CCTMXObjectGroup *objectGroup = [objectGroups_ lastObject]; + [[objectGroup properties] setValue:[attributeDict valueForKey:@"value"] forKey:[attributeDict valueForKey:@"name"]]; + + } else if ( parentElement == TMXPropertyObject ) { + + // The parent element is the last object + CCTMXObjectGroup *objectGroup = [objectGroups_ lastObject]; + NSMutableDictionary *dict = [[objectGroup objects] lastObject]; + + NSString *propertyName = [attributeDict valueForKey:@"name"]; + NSString *propertyValue = [attributeDict valueForKey:@"value"]; + + [dict setValue:propertyValue forKey:propertyName]; + } else if ( parentElement == TMXPropertyTile ) { + + NSMutableDictionary* dict = [tileProperties_ objectForKey:[NSNumber numberWithInt:parentGID_]]; + NSString *propertyName = [attributeDict valueForKey:@"name"]; + NSString *propertyValue = [attributeDict valueForKey:@"value"]; + [dict setObject:propertyValue forKey:propertyName]; + + } + } +} + +- (void)parser:(NSXMLParser *)parser didEndElement:(NSString *)elementName namespaceURI:(NSString *)namespaceURI qualifiedName:(NSString *)qName +{ + int len = 0; + + if([elementName isEqualToString:@"data"] && layerAttribs&TMXLayerAttribBase64) { + storingCharacters = NO; + + CCTMXLayerInfo *layer = [layers_ lastObject]; + + unsigned char *buffer; + len = base64Decode((unsigned char*)[currentString UTF8String], (unsigned int) [currentString length], &buffer); + if( ! buffer ) { + CCLOG(@"cocos2d: TiledMap: decode data error"); + return; + } + + if( layerAttribs & (TMXLayerAttribGzip | TMXLayerAttribZlib) ) { + unsigned char *deflated; + CGSize s = [layer layerSize]; + int sizeHint = s.width * s.height * sizeof(uint32_t); + + int inflatedLen = ccInflateMemoryWithHint(buffer, len, &deflated, sizeHint); + NSAssert( inflatedLen == sizeHint, @"CCTMXXMLParser: Hint failed!"); + + inflatedLen = (int)&inflatedLen; // XXX: to avoid warings in compiler + + free( buffer ); + + if( ! deflated ) { + CCLOG(@"cocos2d: TiledMap: inflate data error"); + return; + } + + layer.tiles = (unsigned int*) deflated; + } else + layer.tiles = (unsigned int*) buffer; + + [currentString setString:@""]; + + } else if ([elementName isEqualToString:@"map"]) { + // The map element has ended + parentElement = TMXPropertyNone; + + } else if ([elementName isEqualToString:@"layer"]) { + // The layer element has ended + parentElement = TMXPropertyNone; + + } else if ([elementName isEqualToString:@"objectgroup"]) { + // The objectgroup element has ended + parentElement = TMXPropertyNone; + + } else if ([elementName isEqualToString:@"object"]) { + // The object element has ended + parentElement = TMXPropertyNone; + } +} + +- (void)parser:(NSXMLParser *)parser foundCharacters:(NSString *)string +{ + if (storingCharacters) + [currentString appendString:string]; +} + + +// +// the level did not load, file not found, etc. +// +-(void)parser:(NSXMLParser *)parser parseErrorOccurred:(NSError *)parseError{ + CCLOG(@"cocos2d: Error on XML Parse: %@", [parseError localizedDescription] ); +} + +@end diff --git a/libs/cocos2d/CCTexture2D.h b/libs/cocos2d/CCTexture2D.h new file mode 100755 index 0000000..45eea9c --- /dev/null +++ b/libs/cocos2d/CCTexture2D.h @@ -0,0 +1,328 @@ +/* + +===== IMPORTANT ===== + +This is sample code demonstrating API, technology or techniques in development. +Although this sample code has been reviewed for technical accuracy, it is not +final. Apple is supplying this information to help you plan for the adoption of +the technologies and programming interfaces described herein. This information +is subject to change, and software implemented based on this sample code should +be tested with final operating system software and final documentation. Newer +versions of this sample code may be provided with future seeds of the API or +technology. For information about updates to this and other developer +documentation, view the New & Updated sidebars in subsequent documentation +seeds. + +===================== + +File: Texture2D.h +Abstract: Creates OpenGL 2D textures from images or text. + +Version: 1.6 + +Disclaimer: IMPORTANT: This Apple software is supplied to you by Apple Inc. +("Apple") in consideration of your agreement to the following terms, and your +use, installation, modification or redistribution of this Apple software +constitutes acceptance of these terms. If you do not agree with these terms, +please do not use, install, modify or redistribute this Apple software. + +In consideration of your agreement to abide by the following terms, and subject +to these terms, Apple grants you a personal, non-exclusive license, under +Apple's copyrights in this original Apple software (the "Apple Software"), to +use, reproduce, modify and redistribute the Apple Software, with or without +modifications, in source and/or binary forms; provided that if you redistribute +the Apple Software in its entirety and without modifications, you must retain +this notice and the following text and disclaimers in all such redistributions +of the Apple Software. +Neither the name, trademarks, service marks or logos of Apple Inc. may be used +to endorse or promote products derived from the Apple Software without specific +prior written permission from Apple. Except as expressly stated in this notice, +no other rights or licenses, express or implied, are granted by Apple herein, +including but not limited to any patent rights that may be infringed by your +derivative works or by other works in which the Apple Software may be +incorporated. + +The Apple Software is provided by Apple on an "AS IS" basis. APPLE MAKES NO +WARRANTIES, EXPRESS OR IMPLIED, INCLUDING WITHOUT LIMITATION THE IMPLIED +WARRANTIES OF NON-INFRINGEMENT, MERCHANTABILITY AND FITNESS FOR A PARTICULAR +PURPOSE, REGARDING THE APPLE SOFTWARE OR ITS USE AND OPERATION ALONE OR IN +COMBINATION WITH YOUR PRODUCTS. + +IN NO EVENT SHALL APPLE BE LIABLE FOR ANY SPECIAL, INDIRECT, INCIDENTAL OR +CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE +GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) +ARISING IN ANY WAY OUT OF THE USE, REPRODUCTION, MODIFICATION AND/OR +DISTRIBUTION OF THE APPLE SOFTWARE, HOWEVER CAUSED AND WHETHER UNDER THEORY OF +CONTRACT, TORT (INCLUDING NEGLIGENCE), STRICT LIABILITY OR OTHERWISE, EVEN IF +APPLE HAS BEEN ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +Copyright (C) 2008 Apple Inc. All Rights Reserved. + +*/ + +#import + +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED +#import // for UIImage +#endif + +#import // for NSObject + +#import "Platforms/CCGL.h" // OpenGL stuff +#import "Platforms/CCNS.h" // Next-Step stuff + +//CONSTANTS: + +/** @typedef CCTexture2DPixelFormat + Possible texture pixel formats + */ +typedef enum { + kCCTexture2DPixelFormat_Automatic = 0, + //! 32-bit texture: RGBA8888 + kCCTexture2DPixelFormat_RGBA8888, + //! 16-bit texture without Alpha channel + kCCTexture2DPixelFormat_RGB565, + //! 8-bit textures used as masks + kCCTexture2DPixelFormat_A8, + //! 8-bit intensity texture + kCCTexture2DPixelFormat_I8, + //! 16-bit textures used as masks + kCCTexture2DPixelFormat_AI88, + //! 16-bit textures: RGBA4444 + kCCTexture2DPixelFormat_RGBA4444, + //! 16-bit textures: RGB5A1 + kCCTexture2DPixelFormat_RGB5A1, + //! 4-bit PVRTC-compressed texture: PVRTC4 + kCCTexture2DPixelFormat_PVRTC4, + //! 2-bit PVRTC-compressed texture: PVRTC2 + kCCTexture2DPixelFormat_PVRTC2, + + //! Default texture format: RGBA8888 + kCCTexture2DPixelFormat_Default = kCCTexture2DPixelFormat_RGBA8888, + + // backward compatibility stuff + kTexture2DPixelFormat_Automatic = kCCTexture2DPixelFormat_Automatic, + kTexture2DPixelFormat_RGBA8888 = kCCTexture2DPixelFormat_RGBA8888, + kTexture2DPixelFormat_RGB565 = kCCTexture2DPixelFormat_RGB565, + kTexture2DPixelFormat_A8 = kCCTexture2DPixelFormat_A8, + kTexture2DPixelFormat_RGBA4444 = kCCTexture2DPixelFormat_RGBA4444, + kTexture2DPixelFormat_RGB5A1 = kCCTexture2DPixelFormat_RGB5A1, + kTexture2DPixelFormat_Default = kCCTexture2DPixelFormat_Default + +} CCTexture2DPixelFormat; + +//CLASS INTERFACES: + +/** CCTexture2D class. + * This class allows to easily create OpenGL 2D textures from images, text or raw data. + * The created CCTexture2D object will always have power-of-two dimensions. + * Depending on how you create the CCTexture2D object, the actual image area of the texture might be smaller than the texture dimensions i.e. "contentSize" != (pixelsWide, pixelsHigh) and (maxS, maxT) != (1.0, 1.0). + * Be aware that the content of the generated textures will be upside-down! + */ +@interface CCTexture2D : NSObject +{ + GLuint name_; + CGSize size_; + NSUInteger width_, + height_; + CCTexture2DPixelFormat format_; + GLfloat maxS_, + maxT_; + BOOL hasPremultipliedAlpha_; +} +/** Intializes with a texture2d with data */ +- (id) initWithData:(const void*)data pixelFormat:(CCTexture2DPixelFormat)pixelFormat pixelsWide:(NSUInteger)width pixelsHigh:(NSUInteger)height contentSize:(CGSize)size; + +/** These functions are needed to create mutable textures */ +- (void) releaseData:(void*)data; +- (void*) keepData:(void*)data length:(NSUInteger)length; + +/** pixel format of the texture */ +@property(nonatomic,readonly) CCTexture2DPixelFormat pixelFormat; +/** width in pixels */ +@property(nonatomic,readonly) NSUInteger pixelsWide; +/** hight in pixels */ +@property(nonatomic,readonly) NSUInteger pixelsHigh; + +/** texture name */ +@property(nonatomic,readonly) GLuint name; + +/** returns content size of the texture in pixels */ +@property(nonatomic,readonly, nonatomic) CGSize contentSizeInPixels; + +/** texture max S */ +@property(nonatomic,readwrite) GLfloat maxS; +/** texture max T */ +@property(nonatomic,readwrite) GLfloat maxT; +/** whether or not the texture has their Alpha premultiplied */ +@property(nonatomic,readonly) BOOL hasPremultipliedAlpha; + +/** returns the content size of the texture in points */ +-(CGSize) contentSize; +@end + +/** +Drawing extensions to make it easy to draw basic quads using a CCTexture2D object. +These functions require GL_TEXTURE_2D and both GL_VERTEX_ARRAY and GL_TEXTURE_COORD_ARRAY client states to be enabled. +*/ +@interface CCTexture2D (Drawing) +/** draws a texture at a given point */ +- (void) drawAtPoint:(CGPoint)point; +/** draws a texture inside a rect */ +- (void) drawInRect:(CGRect)rect; +@end + +/** +Extensions to make it easy to create a CCTexture2D object from an image file. +Note that RGBA type textures will have their alpha premultiplied - use the blending mode (GL_ONE, GL_ONE_MINUS_SRC_ALPHA). +*/ +@interface CCTexture2D (Image) +/** Initializes a texture from a UIImage object */ +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED +- (id) initWithImage:(UIImage *)uiImage; +#elif defined(__MAC_OS_X_VERSION_MAX_ALLOWED) +- (id) initWithImage:(CGImageRef)cgImage; +#endif +@end + +/** +Extensions to make it easy to create a CCTexture2D object from a string of text. +Note that the generated textures are of type A8 - use the blending mode (GL_SRC_ALPHA, GL_ONE_MINUS_SRC_ALPHA). +*/ +@interface CCTexture2D (Text) +/** Initializes a texture from a string with dimensions, alignment, line break mode, font name and font size + Supported lineBreakModes: + - iOS: all UILineBreakMode supported modes + - Mac: Only NSLineBreakByWordWrapping is supported. + @since v1.0 + */ +- (id) initWithString:(NSString*)string dimensions:(CGSize)dimensions alignment:(CCTextAlignment)alignment lineBreakMode:(CCLineBreakMode)lineBreakMode fontName:(NSString*)name fontSize:(CGFloat)size; +/** Initializes a texture from a string with dimensions, alignment, font name and font size */ +- (id) initWithString:(NSString*)string dimensions:(CGSize)dimensions alignment:(CCTextAlignment)alignment fontName:(NSString*)name fontSize:(CGFloat)size; +/** Initializes a texture from a string with font name and font size */ +- (id) initWithString:(NSString*)string fontName:(NSString*)name fontSize:(CGFloat)size; +@end + + +/** + Extensions to make it easy to create a CCTexture2D object from a PVRTC file + Note that the generated textures don't have their alpha premultiplied - use the blending mode (GL_SRC_ALPHA, GL_ONE_MINUS_SRC_ALPHA). + */ +@interface CCTexture2D (PVRSupport) +/** Initializes a texture from a PVR Texture Compressed (PVRTC) buffer + * + * IMPORTANT: This method is only defined on iOS. It is not supported on the Mac version. + */ +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED +-(id) initWithPVRTCData: (const void*)data level:(int)level bpp:(int)bpp hasAlpha:(BOOL)hasAlpha length:(int)length pixelFormat:(CCTexture2DPixelFormat)pixelFormat; +#endif // __IPHONE_OS_VERSION_MAX_ALLOWED +/** Initializes a texture from a PVR file. + + Supported PVR formats: + - BGRA 8888 + - RGBA 8888 + - RGBA 4444 + - RGBA 5551 + - RBG 565 + - A 8 + - I 8 + - AI 8 + - PVRTC 2BPP + - PVRTC 4BPP + + By default PVR images are treated as if they alpha channel is NOT premultiplied. You can override this behavior with this class method: + - PVRImagesHavePremultipliedAlpha:(BOOL)haveAlphaPremultiplied; + + IMPORTANT: This method is only defined on iOS. It is not supported on the Mac version. + + */ +-(id) initWithPVRFile: (NSString*) file; + +/** treats (or not) PVR files as if they have alpha premultiplied. + Since it is impossible to know at runtime if the PVR images have the alpha channel premultiplied, it is + possible load them as if they have (or not) the alpha channel premultiplied. + + By default it is disabled. + + @since v0.99.5 + */ ++(void) PVRImagesHavePremultipliedAlpha:(BOOL)haveAlphaPremultiplied; +@end + +/** + Extension to set the Min / Mag filter + */ +typedef struct _ccTexParams { + GLuint minFilter; + GLuint magFilter; + GLuint wrapS; + GLuint wrapT; +} ccTexParams; + +@interface CCTexture2D (GLFilter) +/** sets the min filter, mag filter, wrap s and wrap t texture parameters. + If the texture size is NPOT (non power of 2), then in can only use GL_CLAMP_TO_EDGE in GL_TEXTURE_WRAP_{S,T}. + @since v0.8 + */ +-(void) setTexParameters: (ccTexParams*) texParams; + +/** sets antialias texture parameters: + - GL_TEXTURE_MIN_FILTER = GL_LINEAR + - GL_TEXTURE_MAG_FILTER = GL_LINEAR + + @since v0.8 + */ +- (void) setAntiAliasTexParameters; + +/** sets alias texture parameters: + - GL_TEXTURE_MIN_FILTER = GL_NEAREST + - GL_TEXTURE_MAG_FILTER = GL_NEAREST + + @since v0.8 + */ +- (void) setAliasTexParameters; + + +/** Generates mipmap images for the texture. + It only works if the texture size is POT (power of 2). + @since v0.99.0 + */ +-(void) generateMipmap; + + +@end + +@interface CCTexture2D (PixelFormat) +/** sets the default pixel format for UIImages that contains alpha channel. + If the UIImage contains alpha channel, then the options are: + - generate 32-bit textures: kCCTexture2DPixelFormat_RGBA8888 (default one) + - generate 16-bit textures: kCCTexture2DPixelFormat_RGBA4444 + - generate 16-bit textures: kCCTexture2DPixelFormat_RGB5A1 + - generate 16-bit textures: kCCTexture2DPixelFormat_RGB565 + - generate 8-bit textures: kCCTexture2DPixelFormat_A8 (only use it if you use just 1 color) + + How does it work ? + - If the image is an RGBA (with Alpha) then the default pixel format will be used (it can be a 8-bit, 16-bit or 32-bit texture) + - If the image is an RGB (without Alpha) then an RGB565 texture will be used (16-bit texture) + + This parameter is not valid for PVR images. + + @since v0.8 + */ ++(void) setDefaultAlphaPixelFormat:(CCTexture2DPixelFormat)format; + +/** returns the alpha pixel format + @since v0.8 + */ ++(CCTexture2DPixelFormat) defaultAlphaPixelFormat; + +/** returns the bits-per-pixel of the in-memory OpenGL texture + @since v1.0 + */ +-(NSUInteger) bitsPerPixelForFormat; +@end + + + + + diff --git a/libs/cocos2d/CCTexture2D.m b/libs/cocos2d/CCTexture2D.m new file mode 100755 index 0000000..afa64e2 --- /dev/null +++ b/libs/cocos2d/CCTexture2D.m @@ -0,0 +1,814 @@ +/* + +===== IMPORTANT ===== + +This is sample code demonstrating API, technology or techniques in development. +Although this sample code has been reviewed for technical accuracy, it is not +final. Apple is supplying this information to help you plan for the adoption of +the technologies and programming interfaces described herein. This information +is subject to change, and software implemented based on this sample code should +be tested with final operating system software and final documentation. Newer +versions of this sample code may be provided with future seeds of the API or +technology. For information about updates to this and other developer +documentation, view the New & Updated sidebars in subsequent documentationd +seeds. + +===================== + +File: Texture2D.m +Abstract: Creates OpenGL 2D textures from images or text. + +Version: 1.6 + +Disclaimer: IMPORTANT: This Apple software is supplied to you by Apple Inc. +("Apple") in consideration of your agreement to the following terms, and your +use, installation, modification or redistribution of this Apple software +constitutes acceptance of these terms. If you do not agree with these terms, +please do not use, install, modify or redistribute this Apple software. + +In consideration of your agreement to abide by the following terms, and subject +to these terms, Apple grants you a personal, non-exclusive license, under +Apple's copyrights in this original Apple software (the "Apple Software"), to +use, reproduce, modify and redistribute the Apple Software, with or without +modifications, in source and/or binary forms; provided that if you redistribute +the Apple Software in its entirety and without modifications, you must retain +this notice and the following text and disclaimers in all such redistributions +of the Apple Software. +Neither the name, trademarks, service marks or logos of Apple Inc. may be used +to endorse or promote products derived from the Apple Software without specific +prior written permission from Apple. Except as expressly stated in this notice, +no other rights or licenses, express or implied, are granted by Apple herein, +including but not limited to any patent rights that may be infringed by your +derivative works or by other works in which the Apple Software may be +incorporated. + +The Apple Software is provided by Apple on an "AS IS" basis. APPLE MAKES NO +WARRANTIES, EXPRESS OR IMPLIED, INCLUDING WITHOUT LIMITATION THE IMPLIED +WARRANTIES OF NON-INFRINGEMENT, MERCHANTABILITY AND FITNESS FOR A PARTICULAR +PURPOSE, REGARDING THE APPLE SOFTWARE OR ITS USE AND OPERATION ALONE OR IN +COMBINATION WITH YOUR PRODUCTS. + +IN NO EVENT SHALL APPLE BE LIABLE FOR ANY SPECIAL, INDIRECT, INCIDENTAL OR +CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE +GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) +ARISING IN ANY WAY OUT OF THE USE, REPRODUCTION, MODIFICATION AND/OR +DISTRIBUTION OF THE APPLE SOFTWARE, HOWEVER CAUSED AND WHETHER UNDER THEORY OF +CONTRACT, TORT (INCLUDING NEGLIGENCE), STRICT LIABILITY OR OTHERWISE, EVEN IF +APPLE HAS BEEN ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +Copyright (C) 2008 Apple Inc. All Rights Reserved. + +*/ + +/* + * Support for RGBA_4_4_4_4 and RGBA_5_5_5_1 was copied from: + * https://devforums.apple.com/message/37855#37855 by a1studmuffin + */ + + +#import + +#import "Platforms/CCGL.h" +#import "Platforms/CCNS.h" + + +#import "CCTexture2D.h" +#import "ccConfig.h" +#import "ccMacros.h" +#import "CCConfiguration.h" +#import "Support/ccUtils.h" +#import "CCTexturePVR.h" + +#if defined(__IPHONE_OS_VERSION_MAX_ALLOWED) && CC_FONT_LABEL_SUPPORT +// FontLabel support +#import "FontManager.h" +#import "FontLabelStringDrawing.h" +#endif// CC_FONT_LABEL_SUPPORT + + +// For Labels use 16-bit textures on iPhone 3GS / iPads since A8 textures are very slow +#if (defined(__ARM_NEON__) || TARGET_IPHONE_SIMULATOR) && CC_USE_LA88_LABELS_ON_NEON_ARCH +#define USE_TEXT_WITH_A8_TEXTURES 0 + +#else +#define USE_TEXT_WITH_A8_TEXTURES 1 +#endif + +//CLASS IMPLEMENTATIONS: + + +// If the image has alpha, you can create RGBA8 (32-bit) or RGBA4 (16-bit) or RGB5A1 (16-bit) +// Default is: RGBA8888 (32-bit textures) +static CCTexture2DPixelFormat defaultAlphaPixelFormat_ = kCCTexture2DPixelFormat_Default; + +#pragma mark - +#pragma mark CCTexture2D - Main + +@implementation CCTexture2D + +@synthesize contentSizeInPixels = size_, pixelFormat = format_, pixelsWide = width_, pixelsHigh = height_, name = name_, maxS = maxS_, maxT = maxT_; +@synthesize hasPremultipliedAlpha = hasPremultipliedAlpha_; + +- (id) initWithData:(const void*)data pixelFormat:(CCTexture2DPixelFormat)pixelFormat pixelsWide:(NSUInteger)width pixelsHigh:(NSUInteger)height contentSize:(CGSize)size +{ + if((self = [super init])) { + glPixelStorei(GL_UNPACK_ALIGNMENT,1); + glGenTextures(1, &name_); + glBindTexture(GL_TEXTURE_2D, name_); + + [self setAntiAliasTexParameters]; + + // Specify OpenGL texture image + + switch(pixelFormat) + { + case kCCTexture2DPixelFormat_RGBA8888: + glTexImage2D(GL_TEXTURE_2D, 0, GL_RGBA, (GLsizei) width, (GLsizei) height, 0, GL_RGBA, GL_UNSIGNED_BYTE, data); + break; + case kCCTexture2DPixelFormat_RGBA4444: + glTexImage2D(GL_TEXTURE_2D, 0, GL_RGBA, (GLsizei) width, (GLsizei) height, 0, GL_RGBA, GL_UNSIGNED_SHORT_4_4_4_4, data); + break; + case kCCTexture2DPixelFormat_RGB5A1: + glTexImage2D(GL_TEXTURE_2D, 0, GL_RGBA, (GLsizei) width, (GLsizei) height, 0, GL_RGBA, GL_UNSIGNED_SHORT_5_5_5_1, data); + break; + case kCCTexture2DPixelFormat_RGB565: + glTexImage2D(GL_TEXTURE_2D, 0, GL_RGB, (GLsizei) width, (GLsizei) height, 0, GL_RGB, GL_UNSIGNED_SHORT_5_6_5, data); + break; + case kCCTexture2DPixelFormat_AI88: + glTexImage2D(GL_TEXTURE_2D, 0, GL_LUMINANCE_ALPHA, (GLsizei) width, (GLsizei) height, 0, GL_LUMINANCE_ALPHA, GL_UNSIGNED_BYTE, data); + break; + case kCCTexture2DPixelFormat_A8: + glTexImage2D(GL_TEXTURE_2D, 0, GL_ALPHA, (GLsizei) width, (GLsizei) height, 0, GL_ALPHA, GL_UNSIGNED_BYTE, data); + break; + default: + [NSException raise:NSInternalInconsistencyException format:@""]; + + } + + size_ = size; + width_ = width; + height_ = height; + format_ = pixelFormat; + maxS_ = size.width / (float)width; + maxT_ = size.height / (float)height; + + hasPremultipliedAlpha_ = NO; + } + return self; +} + +- (void) releaseData:(void*)data +{ + //Free data + free(data); +} + +- (void*) keepData:(void*)data length:(NSUInteger)length +{ + //The texture data mustn't be saved becuase it isn't a mutable texture. + return data; +} + +- (void) dealloc +{ + CCLOGINFO(@"cocos2d: deallocing %@", self); + if(name_) + glDeleteTextures(1, &name_); + + [super dealloc]; +} + +- (NSString*) description +{ + return [NSString stringWithFormat:@"<%@ = %08X | Name = %i | Dimensions = %ix%i | Coordinates = (%.2f, %.2f)>", [self class], self, name_, width_, height_, maxS_, maxT_]; +} + +-(CGSize) contentSize +{ + CGSize ret; + ret.width = size_.width / CC_CONTENT_SCALE_FACTOR(); + ret.height = size_.height / CC_CONTENT_SCALE_FACTOR(); + + return ret; +} +@end + +#pragma mark - +#pragma mark CCTexture2D - Image + +@implementation CCTexture2D (Image) +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED +- (id) initWithImage:(UIImage *)uiImage +#elif defined(__MAC_OS_X_VERSION_MAX_ALLOWED) +- (id) initWithImage:(CGImageRef)CGImage +#endif +{ + NSUInteger POTWide, POTHigh; + CGContextRef context = nil; + void* data = nil;; + CGColorSpaceRef colorSpace; + void* tempData; + unsigned int* inPixel32; + unsigned short* outPixel16; + BOOL hasAlpha; + CGImageAlphaInfo info; + CGSize imageSize; + CCTexture2DPixelFormat pixelFormat; + +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED + CGImageRef CGImage = uiImage.CGImage; +#endif + + if(CGImage == NULL) { + CCLOG(@"cocos2d: CCTexture2D. Can't create Texture. UIImage is nil"); + [self release]; + return nil; + } + + CCConfiguration *conf = [CCConfiguration sharedConfiguration]; + +#if CC_TEXTURE_NPOT_SUPPORT + if( [conf supportsNPOT] ) { + POTWide = CGImageGetWidth(CGImage); + POTHigh = CGImageGetHeight(CGImage); + + } else +#endif + { + POTWide = ccNextPOT(CGImageGetWidth(CGImage)); + POTHigh = ccNextPOT(CGImageGetHeight(CGImage)); + } + + NSUInteger maxTextureSize = [conf maxTextureSize]; + if( POTHigh > maxTextureSize || POTWide > maxTextureSize ) { + CCLOG(@"cocos2d: WARNING: Image (%lu x %lu) is bigger than the supported %ld x %ld", + (long)POTWide, (long)POTHigh, + (long)maxTextureSize, (long)maxTextureSize); + [self release]; + return nil; + } + + info = CGImageGetAlphaInfo(CGImage); + hasAlpha = ((info == kCGImageAlphaPremultipliedLast) || (info == kCGImageAlphaPremultipliedFirst) || (info == kCGImageAlphaLast) || (info == kCGImageAlphaFirst) ? YES : NO); + + size_t bpp = CGImageGetBitsPerComponent(CGImage); + colorSpace = CGImageGetColorSpace(CGImage); + + if(colorSpace) { + if(hasAlpha || bpp >= 8) + pixelFormat = defaultAlphaPixelFormat_; + else { + CCLOG(@"cocos2d: CCTexture2D: Using RGB565 texture since image has no alpha"); + pixelFormat = kCCTexture2DPixelFormat_RGB565; + } + } else { + // NOTE: No colorspace means a mask image + CCLOG(@"cocos2d: CCTexture2D: Using A8 texture since image is a mask"); + pixelFormat = kCCTexture2DPixelFormat_A8; + } + + imageSize = CGSizeMake(CGImageGetWidth(CGImage), CGImageGetHeight(CGImage)); + + // Create the bitmap graphics context + + switch(pixelFormat) { + case kCCTexture2DPixelFormat_RGBA8888: + case kCCTexture2DPixelFormat_RGBA4444: + case kCCTexture2DPixelFormat_RGB5A1: + colorSpace = CGColorSpaceCreateDeviceRGB(); + data = malloc(POTHigh * POTWide * 4); + info = hasAlpha ? kCGImageAlphaPremultipliedLast : kCGImageAlphaNoneSkipLast; +// info = kCGImageAlphaPremultipliedLast; // issue #886. This patch breaks BMP images. + context = CGBitmapContextCreate(data, POTWide, POTHigh, 8, 4 * POTWide, colorSpace, info | kCGBitmapByteOrder32Big); + CGColorSpaceRelease(colorSpace); + break; + + case kCCTexture2DPixelFormat_RGB565: + colorSpace = CGColorSpaceCreateDeviceRGB(); + data = malloc(POTHigh * POTWide * 4); + info = kCGImageAlphaNoneSkipLast; + context = CGBitmapContextCreate(data, POTWide, POTHigh, 8, 4 * POTWide, colorSpace, info | kCGBitmapByteOrder32Big); + CGColorSpaceRelease(colorSpace); + break; + case kCCTexture2DPixelFormat_A8: + data = malloc(POTHigh * POTWide); + info = kCGImageAlphaOnly; + context = CGBitmapContextCreate(data, POTWide, POTHigh, 8, POTWide, NULL, info); + break; + default: + [NSException raise:NSInternalInconsistencyException format:@"Invalid pixel format"]; + } + + + CGContextClearRect(context, CGRectMake(0, 0, POTWide, POTHigh)); + CGContextTranslateCTM(context, 0, POTHigh - imageSize.height); + CGContextDrawImage(context, CGRectMake(0, 0, CGImageGetWidth(CGImage), CGImageGetHeight(CGImage)), CGImage); + + // Repack the pixel data into the right format + + if(pixelFormat == kCCTexture2DPixelFormat_RGB565) { + //Convert "RRRRRRRRRGGGGGGGGBBBBBBBBAAAAAAAA" to "RRRRRGGGGGGBBBBB" + tempData = malloc(POTHigh * POTWide * 2); + inPixel32 = (unsigned int*)data; + outPixel16 = (unsigned short*)tempData; + for(unsigned int i = 0; i < POTWide * POTHigh; ++i, ++inPixel32) + *outPixel16++ = ((((*inPixel32 >> 0) & 0xFF) >> 3) << 11) | ((((*inPixel32 >> 8) & 0xFF) >> 2) << 5) | ((((*inPixel32 >> 16) & 0xFF) >> 3) << 0); + free(data); + data = tempData; + + } + else if (pixelFormat == kCCTexture2DPixelFormat_RGBA4444) { + //Convert "RRRRRRRRRGGGGGGGGBBBBBBBBAAAAAAAA" to "RRRRGGGGBBBBAAAA" + tempData = malloc(POTHigh * POTWide * 2); + inPixel32 = (unsigned int*)data; + outPixel16 = (unsigned short*)tempData; + for(unsigned int i = 0; i < POTWide * POTHigh; ++i, ++inPixel32) + *outPixel16++ = + ((((*inPixel32 >> 0) & 0xFF) >> 4) << 12) | // R + ((((*inPixel32 >> 8) & 0xFF) >> 4) << 8) | // G + ((((*inPixel32 >> 16) & 0xFF) >> 4) << 4) | // B + ((((*inPixel32 >> 24) & 0xFF) >> 4) << 0); // A + + + free(data); + data = tempData; + + } + else if (pixelFormat == kCCTexture2DPixelFormat_RGB5A1) { + //Convert "RRRRRRRRRGGGGGGGGBBBBBBBBAAAAAAAA" to "RRRRRGGGGGBBBBBA" + tempData = malloc(POTHigh * POTWide * 2); + inPixel32 = (unsigned int*)data; + outPixel16 = (unsigned short*)tempData; + for(unsigned int i = 0; i < POTWide * POTHigh; ++i, ++inPixel32) + *outPixel16++ = + ((((*inPixel32 >> 0) & 0xFF) >> 3) << 11) | // R + ((((*inPixel32 >> 8) & 0xFF) >> 3) << 6) | // G + ((((*inPixel32 >> 16) & 0xFF) >> 3) << 1) | // B + ((((*inPixel32 >> 24) & 0xFF) >> 7) << 0); // A + + + free(data); + data = tempData; + } + self = [self initWithData:data pixelFormat:pixelFormat pixelsWide:POTWide pixelsHigh:POTHigh contentSize:imageSize]; + + // should be after calling super init + hasPremultipliedAlpha_ = (info == kCGImageAlphaPremultipliedLast || info == kCGImageAlphaPremultipliedFirst); + + CGContextRelease(context); + [self releaseData:data]; + + return self; +} +@end + +#pragma mark - +#pragma mark CCTexture2D - Text + +@implementation CCTexture2D (Text) + +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED + +- (id) initWithString:(NSString*)string dimensions:(CGSize)dimensions alignment:(CCTextAlignment)alignment lineBreakMode:(CCLineBreakMode)lineBreakMode font:(id)uifont +{ + NSAssert( uifont, @"Invalid font"); + + NSUInteger POTWide = ccNextPOT(dimensions.width); + NSUInteger POTHigh = ccNextPOT(dimensions.height); + unsigned char* data; + + CGContextRef context; + CGColorSpaceRef colorSpace; + +#if USE_TEXT_WITH_A8_TEXTURES + data = calloc(POTHigh, POTWide); +#else + data = calloc(POTHigh, POTWide * 2); +#endif + + colorSpace = CGColorSpaceCreateDeviceGray(); + context = CGBitmapContextCreate(data, POTWide, POTHigh, 8, POTWide, colorSpace, kCGImageAlphaNone); + CGColorSpaceRelease(colorSpace); + + if( ! context ) { + free(data); + [self release]; + return nil; + } + + CGContextSetGrayFillColor(context, 1.0f, 1.0f); + CGContextTranslateCTM(context, 0.0f, POTHigh); + CGContextScaleCTM(context, 1.0f, -1.0f); //NOTE: NSString draws in UIKit referential i.e. renders upside-down compared to CGBitmapContext referential + + UIGraphicsPushContext(context); + + // normal fonts + if( [uifont isKindOfClass:[UIFont class] ] ) + [string drawInRect:CGRectMake(0, 0, dimensions.width, dimensions.height) withFont:uifont lineBreakMode:lineBreakMode alignment:alignment]; + +#if CC_FONT_LABEL_SUPPORT + else // ZFont class + [string drawInRect:CGRectMake(0, 0, dimensions.width, dimensions.height) withZFont:uifont lineBreakMode:lineBreakMode alignment:alignment]; +#endif + + UIGraphicsPopContext(); + +#if USE_TEXT_WITH_A8_TEXTURES + self = [self initWithData:data pixelFormat:kCCTexture2DPixelFormat_A8 pixelsWide:POTWide pixelsHigh:POTHigh contentSize:dimensions]; + +#else // ! USE_TEXT_WITH_A8_TEXTURES + NSUInteger textureSize = POTWide*POTHigh; + unsigned short *la88_data = (unsigned short*)data; + for(int i = textureSize-1; i>=0; i--) //Convert A8 to AI88 + la88_data[i] = (data[i] << 8) | 0xff; + + self = [self initWithData:data pixelFormat:kCCTexture2DPixelFormat_AI88 pixelsWide:POTWide pixelsHigh:POTHigh contentSize:dimensions]; +#endif // ! USE_TEXT_WITH_A8_TEXTURES + + CGContextRelease(context); + [self releaseData:data]; + + return self; +} + + + +#elif defined(__MAC_OS_X_VERSION_MAX_ALLOWED) + +- (id) initWithString:(NSString*)string dimensions:(CGSize)dimensions alignment:(CCTextAlignment)alignment attributedString:(NSAttributedString*)stringWithAttributes +{ + NSAssert( stringWithAttributes, @"Invalid stringWithAttributes"); + + NSUInteger POTWide = ccNextPOT(dimensions.width); + NSUInteger POTHigh = ccNextPOT(dimensions.height); + unsigned char* data; + + NSSize realDimensions = [stringWithAttributes size]; + + //Alignment + float xPadding = 0; + + // Mac crashes if the width or height is 0 + if( realDimensions.width > 0 && realDimensions.height > 0 ) { + switch (alignment) { + case CCTextAlignmentLeft: xPadding = 0; break; + case CCTextAlignmentCenter: xPadding = (dimensions.width-realDimensions.width)/2.0f; break; + case CCTextAlignmentRight: xPadding = dimensions.width-realDimensions.width; break; + default: break; + } + + //Disable antialias + [[NSGraphicsContext currentContext] setShouldAntialias:NO]; + + NSImage *image = [[NSImage alloc] initWithSize:NSMakeSize(POTWide, POTHigh)]; + [image lockFocus]; + + [stringWithAttributes drawAtPoint:NSMakePoint(xPadding, POTHigh-dimensions.height)]; // draw at offset position + + NSBitmapImageRep *bitmap = [[NSBitmapImageRep alloc] initWithFocusedViewRect:NSMakeRect (0.0f, 0.0f, POTWide, POTHigh)]; + [image unlockFocus]; + + data = (unsigned char*) [bitmap bitmapData]; //Use the same buffer to improve the performance. + + NSUInteger textureSize = POTWide*POTHigh; + for(int i = 0; iwrapS == GL_CLAMP_TO_EDGE && texParams->wrapT == GL_CLAMP_TO_EDGE), + @"GL_CLAMP_TO_EDGE should be used in NPOT textures"); + glBindTexture( GL_TEXTURE_2D, name_ ); + glTexParameteri(GL_TEXTURE_2D, GL_TEXTURE_MIN_FILTER, texParams->minFilter ); + glTexParameteri(GL_TEXTURE_2D, GL_TEXTURE_MAG_FILTER, texParams->magFilter ); + glTexParameteri( GL_TEXTURE_2D, GL_TEXTURE_WRAP_S, texParams->wrapS ); + glTexParameteri( GL_TEXTURE_2D, GL_TEXTURE_WRAP_T, texParams->wrapT ); +} + +-(void) setAliasTexParameters +{ + ccTexParams texParams = { GL_NEAREST, GL_NEAREST, GL_CLAMP_TO_EDGE, GL_CLAMP_TO_EDGE }; + [self setTexParameters: &texParams]; +} + +-(void) setAntiAliasTexParameters +{ + ccTexParams texParams = { GL_LINEAR, GL_LINEAR, GL_CLAMP_TO_EDGE, GL_CLAMP_TO_EDGE }; + [self setTexParameters: &texParams]; +} +@end + + +#pragma mark - +#pragma mark CCTexture2D - Pixel Format + +// +// Texture options for images that contains alpha +// +@implementation CCTexture2D (PixelFormat) ++(void) setDefaultAlphaPixelFormat:(CCTexture2DPixelFormat)format +{ + defaultAlphaPixelFormat_ = format; +} + ++(CCTexture2DPixelFormat) defaultAlphaPixelFormat +{ + return defaultAlphaPixelFormat_; +} + +-(NSUInteger) bitsPerPixelForFormat +{ + NSUInteger ret=0; + + switch (format_) { + case kCCTexture2DPixelFormat_RGBA8888: + ret = 32; + break; + case kCCTexture2DPixelFormat_RGB565: + ret = 16; + break; + case kCCTexture2DPixelFormat_A8: + ret = 8; + break; + case kCCTexture2DPixelFormat_RGBA4444: + ret = 16; + break; + case kCCTexture2DPixelFormat_RGB5A1: + ret = 16; + break; + case kCCTexture2DPixelFormat_PVRTC4: + ret = 4; + break; + case kCCTexture2DPixelFormat_PVRTC2: + ret = 2; + break; + case kCCTexture2DPixelFormat_I8: + ret = 8; + break; + case kCCTexture2DPixelFormat_AI88: + ret = 16; + break; + default: + ret = -1; + NSAssert1(NO , @"bitsPerPixelForFormat: %ld, unrecognised pixel format", (long)format_); + CCLOG(@"bitsPerPixelForFormat: %ld, cannot give useful result", (long)format_); + break; + } + return ret; +} +@end + diff --git a/libs/cocos2d/CCTextureAtlas.h b/libs/cocos2d/CCTextureAtlas.h new file mode 100755 index 0000000..f70bb54 --- /dev/null +++ b/libs/cocos2d/CCTextureAtlas.h @@ -0,0 +1,147 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2008-2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + +#import "CCTexture2D.h" +#import "ccTypes.h" +#import "ccConfig.h" + +/** A class that implements a Texture Atlas. + Supported features: + * The atlas file can be a PVRTC, PNG or any other fomrat supported by Texture2D + * Quads can be udpated in runtime + * Quads can be added in runtime + * Quads can be removed in runtime + * Quads can be re-ordered in runtime + * The TextureAtlas capacity can be increased or decreased in runtime + * OpenGL component: V3F, C4B, T2F. + The quads are rendered using an OpenGL ES VBO. + To render the quads using an interleaved vertex array list, you should modify the ccConfig.h file + */ +@interface CCTextureAtlas : NSObject +{ + NSUInteger totalQuads_; + NSUInteger capacity_; + ccV3F_C4B_T2F_Quad *quads_; // quads to be rendered + GLushort *indices_; + CCTexture2D *texture_; +#if CC_USES_VBO + GLuint buffersVBO_[2]; //0: vertex 1: indices + BOOL dirty_; //indicates whether or not the array buffer of the VBO needs to be updated +#endif // CC_USES_VBO +} + +/** quantity of quads that are going to be drawn */ +@property (nonatomic,readonly) NSUInteger totalQuads; +/** quantity of quads that can be stored with the current texture atlas size */ +@property (nonatomic,readonly) NSUInteger capacity; +/** Texture of the texture atlas */ +@property (nonatomic,retain) CCTexture2D *texture; +/** Quads that are going to be rendered */ +@property (nonatomic,readwrite) ccV3F_C4B_T2F_Quad *quads; + +/** creates a TextureAtlas with an filename and with an initial capacity for Quads. + * The TextureAtlas capacity can be increased in runtime. + */ ++(id) textureAtlasWithFile:(NSString*)file capacity:(NSUInteger)capacity; + +/** initializes a TextureAtlas with a filename and with a certain capacity for Quads. + * The TextureAtlas capacity can be increased in runtime. + * + * WARNING: Do not reinitialize the TextureAtlas because it will leak memory (issue #706) + */ +-(id) initWithFile: (NSString*) file capacity:(NSUInteger)capacity; + +/** creates a TextureAtlas with a previously initialized Texture2D object, and + * with an initial capacity for n Quads. + * The TextureAtlas capacity can be increased in runtime. + */ ++(id) textureAtlasWithTexture:(CCTexture2D *)tex capacity:(NSUInteger)capacity; + +/** initializes a TextureAtlas with a previously initialized Texture2D object, and + * with an initial capacity for Quads. + * The TextureAtlas capacity can be increased in runtime. + * + * WARNING: Do not reinitialize the TextureAtlas because it will leak memory (issue #706) + */ +-(id) initWithTexture:(CCTexture2D *)tex capacity:(NSUInteger)capacity; + +/** updates a Quad (texture, vertex and color) at a certain index + * index must be between 0 and the atlas capacity - 1 + @since v0.8 + */ +-(void) updateQuad:(ccV3F_C4B_T2F_Quad*)quad atIndex:(NSUInteger)index; + +/** Inserts a Quad (texture, vertex and color) at a certain index + index must be between 0 and the atlas capacity - 1 + @since v0.8 + */ +-(void) insertQuad:(ccV3F_C4B_T2F_Quad*)quad atIndex:(NSUInteger)index; + +/** Removes the quad that is located at a certain index and inserts it at a new index + This operation is faster than removing and inserting in a quad in 2 different steps + @since v0.7.2 +*/ +-(void) insertQuadFromIndex:(NSUInteger)fromIndex atIndex:(NSUInteger)newIndex; + +/** removes a quad at a given index number. + The capacity remains the same, but the total number of quads to be drawn is reduced in 1 + @since v0.7.2 + */ +-(void) removeQuadAtIndex:(NSUInteger) index; + +/** removes all Quads. + The TextureAtlas capacity remains untouched. No memory is freed. + The total number of quads to be drawn will be 0 + @since v0.7.2 + */ +-(void) removeAllQuads; + +/** resize the capacity of the CCTextureAtlas. + * The new capacity can be lower or higher than the current one + * It returns YES if the resize was successful. + * If it fails to resize the capacity it will return NO with a new capacity of 0. + */ +-(BOOL) resizeCapacity: (NSUInteger) n; + + +/** draws n quads + * n can't be greater than the capacity of the Atlas + */ +-(void) drawNumberOfQuads: (NSUInteger) n; + + +/** draws n quads from an index (offset). + n + start can't be greater than the capacity of the atlas + + @since v1.0 + */ +-(void) drawNumberOfQuads: (NSUInteger) n fromIndex: (NSUInteger) start; + +/** draws all the Atlas's Quads + */ +-(void) drawQuads; + +@end diff --git a/libs/cocos2d/CCTextureAtlas.m b/libs/cocos2d/CCTextureAtlas.m new file mode 100755 index 0000000..7c7df75 --- /dev/null +++ b/libs/cocos2d/CCTextureAtlas.m @@ -0,0 +1,369 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2008-2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + + +// cocos2d +#import "CCTextureAtlas.h" +#import "ccMacros.h" +#import "CCTexture2D.h" +#import "CCTextureCache.h" + + +@interface CCTextureAtlas (Private) +-(void) initIndices; +@end + +//According to some tests GL_TRIANGLE_STRIP is slower, MUCH slower. Probably I'm doing something very wrong + +@implementation CCTextureAtlas + +@synthesize totalQuads = totalQuads_, capacity = capacity_; +@synthesize texture = texture_; +@synthesize quads = quads_; + +#pragma mark TextureAtlas - alloc & init + ++(id) textureAtlasWithFile:(NSString*) file capacity: (NSUInteger) n +{ + return [[[self alloc] initWithFile:file capacity:n] autorelease]; +} + ++(id) textureAtlasWithTexture:(CCTexture2D *)tex capacity:(NSUInteger)n +{ + return [[[self alloc] initWithTexture:tex capacity:n] autorelease]; +} + +-(id) initWithFile:(NSString*)file capacity:(NSUInteger)n +{ + // retained in property + CCTexture2D *tex = [[CCTextureCache sharedTextureCache] addImage:file]; + if( tex ) + return [self initWithTexture:tex capacity:n]; + + // else + { + CCLOG(@"cocos2d: Could not open file: %@", file); + [self release]; + return nil; + } +} + +-(id) initWithTexture:(CCTexture2D*)tex capacity:(NSUInteger)n +{ + if( (self=[super init]) ) { + + capacity_ = n; + totalQuads_ = 0; + + // retained in property + self.texture = tex; + + // Re-initialization is not allowed + NSAssert(quads_==nil && indices_==nil, @"CCTextureAtlas re-initialization is not allowed"); + + quads_ = calloc( sizeof(quads_[0]) * capacity_, 1 ); + indices_ = calloc( sizeof(indices_[0]) * capacity_ * 6, 1 ); + + if( ! ( quads_ && indices_) ) { + CCLOG(@"cocos2d: CCTextureAtlas: not enough memory"); + if( quads_ ) + free(quads_); + if( indices_ ) + free(indices_); + return nil; + } + +#if CC_USES_VBO + // initial binding + glGenBuffers(2, &buffersVBO_[0]); + dirty_ = YES; +#endif // CC_USES_VBO + + [self initIndices]; + } + + return self; +} + +- (NSString*) description +{ + return [NSString stringWithFormat:@"<%@ = %08X | totalQuads = %i>", [self class], self, totalQuads_]; +} + +-(void) dealloc +{ + CCLOGINFO(@"cocos2d: deallocing %@",self); + + free(quads_); + free(indices_); + +#if CC_USES_VBO + glDeleteBuffers(2, buffersVBO_); +#endif // CC_USES_VBO + + + [texture_ release]; + + [super dealloc]; +} + +-(void) initIndices +{ + for( NSUInteger i=0;i< capacity_;i++) { +#if CC_TEXTURE_ATLAS_USE_TRIANGLE_STRIP + indices_[i*6+0] = i*4+0; + indices_[i*6+1] = i*4+0; + indices_[i*6+2] = i*4+2; + indices_[i*6+3] = i*4+1; + indices_[i*6+4] = i*4+3; + indices_[i*6+5] = i*4+3; +#else + indices_[i*6+0] = i*4+0; + indices_[i*6+1] = i*4+1; + indices_[i*6+2] = i*4+2; + + // inverted index. issue #179 + indices_[i*6+3] = i*4+3; + indices_[i*6+4] = i*4+2; + indices_[i*6+5] = i*4+1; +// indices_[i*6+3] = i*4+2; +// indices_[i*6+4] = i*4+3; +// indices_[i*6+5] = i*4+1; +#endif + } + +#if CC_USES_VBO + glBindBuffer(GL_ARRAY_BUFFER, buffersVBO_[0]); + glBufferData(GL_ARRAY_BUFFER, sizeof(quads_[0]) * capacity_, quads_, GL_DYNAMIC_DRAW); + glBindBuffer(GL_ELEMENT_ARRAY_BUFFER, buffersVBO_[1]); + glBufferData(GL_ELEMENT_ARRAY_BUFFER, sizeof(indices_[0]) * capacity_ * 6, indices_, GL_STATIC_DRAW); + glBindBuffer(GL_ARRAY_BUFFER, 0); + glBindBuffer(GL_ELEMENT_ARRAY_BUFFER, 0); +#endif // CC_USES_VBO +} + +#pragma mark TextureAtlas - Update, Insert, Move & Remove + +-(void) updateQuad:(ccV3F_C4B_T2F_Quad*)quad atIndex:(NSUInteger) n +{ + NSAssert(n < capacity_, @"updateQuadWithTexture: Invalid index"); + + totalQuads_ = MAX( n+1, totalQuads_); + + quads_[n] = *quad; + +#if CC_USES_VBO + dirty_ = YES; +#endif +} + + +-(void) insertQuad:(ccV3F_C4B_T2F_Quad*)quad atIndex:(NSUInteger)index +{ + NSAssert(index < capacity_, @"insertQuadWithTexture: Invalid index"); + + totalQuads_++; + NSAssert( totalQuads_ <= capacity_, @"invalid totalQuads"); + + // issue #575. index can be > totalQuads + NSInteger remaining = (totalQuads_-1) - index; + + // last object doesn't need to be moved + if( remaining > 0) + // tex coordinates + memmove( &quads_[index+1],&quads_[index], sizeof(quads_[0]) * remaining ); + + quads_[index] = *quad; + +#if CC_USES_VBO + dirty_ = YES; +#endif +} + + +-(void) insertQuadFromIndex:(NSUInteger)oldIndex atIndex:(NSUInteger)newIndex +{ + NSAssert(newIndex < totalQuads_, @"insertQuadFromIndex:atIndex: Invalid index"); + NSAssert(oldIndex < totalQuads_, @"insertQuadFromIndex:atIndex: Invalid index"); + + if( oldIndex == newIndex ) + return; + + NSUInteger howMany = labs( oldIndex - newIndex); + NSUInteger dst = oldIndex; + NSUInteger src = oldIndex + 1; + if( oldIndex > newIndex) { + dst = newIndex+1; + src = newIndex; + } + + // tex coordinates + ccV3F_C4B_T2F_Quad quadsBackup = quads_[oldIndex]; + memmove( &quads_[dst],&quads_[src], sizeof(quads_[0]) * howMany ); + quads_[newIndex] = quadsBackup; + +#if CC_USES_VBO + dirty_ = YES; +#endif +} + +-(void) removeQuadAtIndex:(NSUInteger) index +{ + NSAssert(index < totalQuads_, @"removeQuadAtIndex: Invalid index"); + + NSUInteger remaining = (totalQuads_-1) - index; + + + // last object doesn't need to be moved + if( remaining ) + // tex coordinates + memmove( &quads_[index],&quads_[index+1], sizeof(quads_[0]) * remaining ); + + totalQuads_--; + +#if CC_USES_VBO + dirty_ = YES; +#endif +} + +-(void) removeAllQuads +{ + totalQuads_ = 0; +} + +#pragma mark TextureAtlas - Resize + +-(BOOL) resizeCapacity: (NSUInteger) newCapacity +{ + if( newCapacity == capacity_ ) + return YES; + + // update capacity and totolQuads + totalQuads_ = MIN(totalQuads_,newCapacity); + capacity_ = newCapacity; + + void * tmpQuads = realloc( quads_, sizeof(quads_[0]) * capacity_ ); + void * tmpIndices = realloc( indices_, sizeof(indices_[0]) * capacity_ * 6 ); + + if( ! ( tmpQuads && tmpIndices) ) { + CCLOG(@"cocos2d: CCTextureAtlas: not enough memory"); + if( tmpQuads ) + free(tmpQuads); + else + free(quads_); + + if( tmpIndices ) + free(tmpIndices); + else + free(indices_); + + indices_ = nil; + quads_ = nil; + capacity_ = totalQuads_ = 0; + return NO; + } + + quads_ = tmpQuads; + indices_ = tmpIndices; + + [self initIndices]; + +#if CC_USES_VBO + dirty_ = YES; +#endif + return YES; +} + +#pragma mark TextureAtlas - Drawing + +-(void) drawQuads +{ + [self drawNumberOfQuads: totalQuads_ fromIndex:0]; +} + +-(void) drawNumberOfQuads: (NSUInteger) n +{ + [self drawNumberOfQuads:n fromIndex:0]; +} + +-(void) drawNumberOfQuads: (NSUInteger) n fromIndex: (NSUInteger) start +{ + // Default GL states: GL_TEXTURE_2D, GL_VERTEX_ARRAY, GL_COLOR_ARRAY, GL_TEXTURE_COORD_ARRAY + // Needed states: GL_TEXTURE_2D, GL_VERTEX_ARRAY, GL_COLOR_ARRAY, GL_TEXTURE_COORD_ARRAY + // Unneeded states: - + + glBindTexture(GL_TEXTURE_2D, [texture_ name]); +#define kQuadSize sizeof(quads_[0].bl) +#if CC_USES_VBO + glBindBuffer(GL_ARRAY_BUFFER, buffersVBO_[0]); + + // XXX: update is done in draw... perhaps it should be done in a timer + if (dirty_) { + glBufferSubData(GL_ARRAY_BUFFER, sizeof(quads_[0])*start, sizeof(quads_[0]) * n , &quads_[start] ); + dirty_ = NO; + } + + // vertices + glVertexPointer(3, GL_FLOAT, kQuadSize, (GLvoid*) offsetof( ccV3F_C4B_T2F, vertices)); + + // colors + glColorPointer(4, GL_UNSIGNED_BYTE, kQuadSize, (GLvoid*) offsetof( ccV3F_C4B_T2F, colors)); + + // tex coords + glTexCoordPointer(2, GL_FLOAT, kQuadSize, (GLvoid*) offsetof( ccV3F_C4B_T2F, texCoords)); + + glBindBuffer(GL_ELEMENT_ARRAY_BUFFER, buffersVBO_[1]); +#if CC_TEXTURE_ATLAS_USE_TRIANGLE_STRIP + glDrawElements(GL_TRIANGLE_STRIP, (GLsizei) n*6, GL_UNSIGNED_SHORT, (GLvoid*) (start*6*sizeof(indices_[0])) ); +#else + glDrawElements(GL_TRIANGLES, (GLsizei) n*6, GL_UNSIGNED_SHORT, (GLvoid*) (start*6*sizeof(indices_[0])) ); +#endif // CC_TEXTURE_ATLAS_USE_TRIANGLE_STRIP + + glBindBuffer(GL_ARRAY_BUFFER, 0); + glBindBuffer(GL_ELEMENT_ARRAY_BUFFER, 0); +#else // ! CC_USES_VBO + + NSUInteger offset = (NSUInteger)quads_; + // vertex + NSUInteger diff = offsetof( ccV3F_C4B_T2F, vertices); + glVertexPointer(3, GL_FLOAT, kQuadSize, (GLvoid*) (offset + diff) ); + // color + diff = offsetof( ccV3F_C4B_T2F, colors); + glColorPointer(4, GL_UNSIGNED_BYTE, kQuadSize, (GLvoid*)(offset + diff)); + + // tex coords + diff = offsetof( ccV3F_C4B_T2F, texCoords); + glTexCoordPointer(2, GL_FLOAT, kQuadSize, (GLvoid*)(offset + diff)); + +#if CC_TEXTURE_ATLAS_USE_TRIANGLE_STRIP + glDrawElements(GL_TRIANGLE_STRIP, n*6, GL_UNSIGNED_SHORT, indices_ + start * 6 ); +#else + glDrawElements(GL_TRIANGLES, n*6, GL_UNSIGNED_SHORT, indices_ + start * 6 ); +#endif + +#endif // CC_USES_VBO +} +@end diff --git a/libs/cocos2d/CCTextureCache.h b/libs/cocos2d/CCTextureCache.h new file mode 100755 index 0000000..7084793 --- /dev/null +++ b/libs/cocos2d/CCTextureCache.h @@ -0,0 +1,149 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2008-2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + +#import + +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED +#import +#endif + +#import + +@class CCTexture2D; + +/** Singleton that handles the loading of textures + * Once the texture is loaded, the next time it will return + * a reference of the previously loaded texture reducing GPU & CPU memory + */ +@interface CCTextureCache : NSObject +{ + NSMutableDictionary *textures_; + NSLock *dictLock_; + NSLock *contextLock_; +} + +/** Retruns ths shared instance of the cache */ ++ (CCTextureCache *) sharedTextureCache; + +/** purges the cache. It releases the retained instance. + @since v0.99.0 + */ ++(void)purgeSharedTextureCache; + + +/** Returns a Texture2D object given an file image + * If the file image was not previously loaded, it will create a new CCTexture2D + * object and it will return it. It will use the filename as a key. + * Otherwise it will return a reference of a previosly loaded image. + * Supported image extensions: .png, .bmp, .tiff, .jpeg, .pvr, .gif + */ +-(CCTexture2D*) addImage: (NSString*) fileimage; + +/** Returns a Texture2D object given a file image + * If the file image was not previously loaded, it will create a new CCTexture2D object and it will return it. + * Otherwise it will load a texture in a new thread, and when the image is loaded, the callback will be called with the Texture2D as a parameter. + * The callback will be called from the main thread, so it is safe to create any cocos2d object from the callback. + * Supported image extensions: .png, .bmp, .tiff, .jpeg, .pvr, .gif + * @since v0.8 + */ +-(void) addImageAsync:(NSString*) filename target:(id)target selector:(SEL)selector; + +/** Returns a Texture2D object given an CGImageRef image + * If the image was not previously loaded, it will create a new CCTexture2D object and it will return it. + * Otherwise it will return a reference of a previously loaded image + * The "key" parameter will be used as the "key" for the cache. + * If "key" is nil, then a new texture will be created each time. + * @since v0.8 + */ +-(CCTexture2D*) addCGImage: (CGImageRef) image forKey: (NSString *)key; + +/** Returns an already created texture. Returns nil if the texture doesn't exist. + @since v0.99.5 + */ +-(CCTexture2D *) textureForKey:(NSString *)key; + +/** Purges the dictionary of loaded textures. + * Call this method if you receive the "Memory Warning" + * In the short term: it will free some resources preventing your app from being killed + * In the medium term: it will allocate more resources + * In the long term: it will be the same + */ +-(void) removeAllTextures; + +/** Removes unused textures + * Textures that have a retain count of 1 will be deleted + * It is convinient to call this method after when starting a new Scene + * @since v0.8 + */ +-(void) removeUnusedTextures; + +/** Deletes a texture from the cache given a texture + */ +-(void) removeTexture: (CCTexture2D*) tex; + +/** Deletes a texture from the cache given a its key name + @since v0.99.4 + */ +-(void) removeTextureForKey: (NSString*) textureKeyName; + +@end + + +@interface CCTextureCache (PVRSupport) + +/** Returns a Texture2D object given an PVRTC RAW filename + * If the file image was not previously loaded, it will create a new CCTexture2D + * object and it will return it. Otherwise it will return a reference of a previosly loaded image + * + * It can only load square images: width == height, and it must be a power of 2 (128,256,512...) + * bpp can only be 2 or 4. 2 means more compression but lower quality. + * hasAlpha: whether or not the image contains alpha channel + * + * IMPORTANT: This method is only defined on iOS. It is not supported on the Mac version. + */ +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED +-(CCTexture2D*) addPVRTCImage:(NSString*)fileimage bpp:(int)bpp hasAlpha:(BOOL)alpha width:(int)w; +#endif // __IPHONE_OS_VERSION_MAX_ALLOWED + +/** Returns a Texture2D object given an PVR filename. + * If the file image was not previously loaded, it will create a new CCTexture2D + * object and it will return it. Otherwise it will return a reference of a previosly loaded image + * + */ +-(CCTexture2D*) addPVRImage:(NSString*) filename; + +@end + + +@interface CCTextureCache (Debug) +/** Output to CCLOG the current contents of this CCTextureCache + * This will attempt to calculate the size of each texture, and the total texture memory in use + * + * @since v1.0 + */ +-(void) dumpCachedTextureInfo; + +@end diff --git a/libs/cocos2d/CCTextureCache.m b/libs/cocos2d/CCTextureCache.m new file mode 100755 index 0000000..080770a --- /dev/null +++ b/libs/cocos2d/CCTextureCache.m @@ -0,0 +1,498 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2008-2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + +#import + +#import "Platforms/CCGL.h" +#import "CCTextureCache.h" +#import "CCTexture2D.h" +#import "CCTexturePVR.h" +#import "ccMacros.h" +#import "CCConfiguration.h" +#import "Support/CCFileUtils.h" +#import "CCDirector.h" +#import "ccConfig.h" + +// needed for CCCallFuncO in Mac-display_link version +#import "CCActionManager.h" +#import "CCActionInstant.h" + +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED +static EAGLContext *auxGLcontext = nil; +#elif defined(__MAC_OS_X_VERSION_MAX_ALLOWED) +static NSOpenGLContext *auxGLcontext = nil; +#endif + + +@interface CCAsyncObject : NSObject +{ + SEL selector_; + id target_; + id data_; +} +@property (readwrite,assign) SEL selector; +@property (readwrite,retain) id target; +@property (readwrite,retain) id data; +@end + +@implementation CCAsyncObject +@synthesize selector = selector_; +@synthesize target = target_; +@synthesize data = data_; +- (void) dealloc +{ + CCLOGINFO(@"cocos2d: deallocing %@", self); + [target_ release]; + [data_ release]; + [super dealloc]; +} +@end + + +@implementation CCTextureCache + +#pragma mark TextureCache - Alloc, Init & Dealloc +static CCTextureCache *sharedTextureCache; + ++ (CCTextureCache *)sharedTextureCache +{ + if (!sharedTextureCache) + sharedTextureCache = [[CCTextureCache alloc] init]; + + return sharedTextureCache; +} + ++(id)alloc +{ + NSAssert(sharedTextureCache == nil, @"Attempted to allocate a second instance of a singleton."); + return [super alloc]; +} + ++(void)purgeSharedTextureCache +{ + [sharedTextureCache release]; + sharedTextureCache = nil; +} + +-(id) init +{ + if( (self=[super init]) ) { + textures_ = [[NSMutableDictionary dictionaryWithCapacity: 10] retain]; + dictLock_ = [[NSLock alloc] init]; + contextLock_ = [[NSLock alloc] init]; + } + + return self; +} + +- (NSString*) description +{ + return [NSString stringWithFormat:@"<%@ = %08X | num of textures = %i | keys: %@>", + [self class], + self, + [textures_ count], + [textures_ allKeys] + ]; + +} + +-(void) dealloc +{ + CCLOGINFO(@"cocos2d: deallocing %@", self); + + [textures_ release]; + [dictLock_ release]; + [contextLock_ release]; + [auxGLcontext release]; + auxGLcontext = nil; + sharedTextureCache = nil; + [super dealloc]; +} + +#pragma mark TextureCache - Add Images + +-(void) addImageWithAsyncObject:(CCAsyncObject*)async +{ + NSAutoreleasePool *autoreleasepool = [[NSAutoreleasePool alloc] init]; + +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED + // textures will be created on the main OpenGL context + // it seems that in SDK 2.2.x there can't be 2 threads creating textures at the same time + // the lock is used for this purpose: issue #472 + [contextLock_ lock]; + if( auxGLcontext == nil ) { + auxGLcontext = [[EAGLContext alloc] + initWithAPI:kEAGLRenderingAPIOpenGLES1 + sharegroup:[[[[CCDirector sharedDirector] openGLView] context] sharegroup]]; + + if( ! auxGLcontext ) + CCLOG(@"cocos2d: TextureCache: Could not create EAGL context"); + } + + if( [EAGLContext setCurrentContext:auxGLcontext] ) { + + // load / create the texture + CCTexture2D *tex = [self addImage:async.data]; + + // The callback will be executed on the main thread + [async.target performSelectorOnMainThread:async.selector withObject:tex waitUntilDone:NO]; + + [EAGLContext setCurrentContext:nil]; + } else { + CCLOG(@"cocos2d: TetureCache: EAGLContext error"); + } + [contextLock_ unlock]; + + [autoreleasepool release]; + +#elif defined(__MAC_OS_X_VERSION_MAX_ALLOWED) + + [contextLock_ lock]; + if( auxGLcontext == nil ) { + + MacGLView *view = [[CCDirector sharedDirector] openGLView]; + + NSOpenGLPixelFormat *pf = [view pixelFormat]; + NSOpenGLContext *share = [view openGLContext]; + + auxGLcontext = [[NSOpenGLContext alloc] initWithFormat:pf shareContext:share]; + + if( ! auxGLcontext ) + CCLOG(@"cocos2d: TextureCache: Could not create NSOpenGLContext"); + } + + [auxGLcontext makeCurrentContext]; + + // load / create the texture + CCTexture2D *tex = [self addImage:async.data]; + +#if CC_DIRECTOR_MAC_USE_DISPLAY_LINK_THREAD + id action = [CCCallFuncO actionWithTarget:async.target selector:async.selector object:tex]; + [[CCActionManager sharedManager] addAction:action target:async.target paused:NO]; +#else + // The callback will be executed on the main thread + [async.target performSelector:async.selector + onThread:[[CCDirector sharedDirector] runningThread] + withObject:tex + waitUntilDone:NO]; +#endif + + + [NSOpenGLContext clearCurrentContext]; + + [contextLock_ unlock]; + + [autoreleasepool release]; + +#endif // __MAC_OS_X_VERSION_MAX_ALLOWED +} + +-(void) addImageAsync: (NSString*)path target:(id)target selector:(SEL)selector +{ + NSAssert(path != nil, @"TextureCache: fileimage MUST not be nill"); + + // optimization + + CCTexture2D * tex; + + path = ccRemoveHDSuffixFromFile(path); + + if( (tex=[textures_ objectForKey: path] ) ) { + [target performSelector:selector withObject:tex]; + return; + } + + // schedule the load + + CCAsyncObject *asyncObject = [[CCAsyncObject alloc] init]; + asyncObject.selector = selector; + asyncObject.target = target; + asyncObject.data = path; + + [NSThread detachNewThreadSelector:@selector(addImageWithAsyncObject:) toTarget:self withObject:asyncObject]; + [asyncObject release]; +} + +-(CCTexture2D*) addImage: (NSString*) path +{ + NSAssert(path != nil, @"TextureCache: fileimage MUST not be nill"); + + CCTexture2D * tex = nil; + + // MUTEX: + // Needed since addImageAsync calls this method from a different thread + [dictLock_ lock]; + + // remove possible -HD suffix to prevent caching the same image twice (issue #1040) + path = ccRemoveHDSuffixFromFile( path ); + + tex=[textures_ objectForKey: path]; + + if( ! tex ) { + + NSString *lowerCase = [path lowercaseString]; + // all images are handled by UIImage except PVR extension that is handled by our own handler + + if ( [lowerCase hasSuffix:@".pvr"] || [lowerCase hasSuffix:@".pvr.gz"] || [lowerCase hasSuffix:@".pvr.ccz"] ) + tex = [self addPVRImage:path]; + + // Only iPhone +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED + + // Issue #886: TEMPORARY FIX FOR TRANSPARENT JPEGS IN IOS4 + else if ( ( [[CCConfiguration sharedConfiguration] OSVersion] >= kCCiOSVersion_4_0) && + ( [lowerCase hasSuffix:@".jpg"] || [lowerCase hasSuffix:@".jpeg"] ) + ) { + // convert jpg to png before loading the texture + + NSString *fullpath = [CCFileUtils fullPathFromRelativePath: path ]; + + UIImage *jpg = [[UIImage alloc] initWithContentsOfFile:fullpath]; + UIImage *png = [[UIImage alloc] initWithData:UIImagePNGRepresentation(jpg)]; + tex = [ [CCTexture2D alloc] initWithImage: png ]; + [png release]; + [jpg release]; + + if( tex ) + [textures_ setObject: tex forKey:path]; + else + CCLOG(@"cocos2d: Couldn't add image:%@ in CCTextureCache", path); + + // autorelease prevents possible crash in multithreaded environments + [tex autorelease]; + } + + else { + + // prevents overloading the autorelease pool + NSString *fullpath = [CCFileUtils fullPathFromRelativePath: path ]; + + UIImage *image = [ [UIImage alloc] initWithContentsOfFile: fullpath ]; + tex = [ [CCTexture2D alloc] initWithImage: image ]; + [image release]; + + if( tex ) + [textures_ setObject: tex forKey:path]; + else + CCLOG(@"cocos2d: Couldn't add image:%@ in CCTextureCache", path); + + // autorelease prevents possible crash in multithreaded environments + [tex autorelease]; + } + + // Only in Mac +#elif defined(__MAC_OS_X_VERSION_MAX_ALLOWED) + else { + NSString *fullpath = [CCFileUtils fullPathFromRelativePath: path ]; + + NSData *data = [[NSData alloc] initWithContentsOfFile:fullpath]; + NSBitmapImageRep *image = [[NSBitmapImageRep alloc] initWithData:data]; + tex = [ [CCTexture2D alloc] initWithImage:[image CGImage]]; + + [data release]; + [image release]; + + if( tex ) + [textures_ setObject: tex forKey:path]; + else + CCLOG(@"cocos2d: Couldn't add image:%@ in CCTextureCache", path); + + // autorelease prevents possible crash in multithreaded environments + [tex autorelease]; + } +#endif // __MAC_OS_X_VERSION_MAX_ALLOWED + + } + + [dictLock_ unlock]; + + return tex; +} + + +-(CCTexture2D*) addCGImage: (CGImageRef) imageref forKey: (NSString *)key +{ + NSAssert(imageref != nil, @"TextureCache: image MUST not be nill"); + + CCTexture2D * tex = nil; + + // If key is nil, then create a new texture each time + if( key && (tex=[textures_ objectForKey: key] ) ) { + return tex; + } + +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED + // prevents overloading the autorelease pool + UIImage *image = [[UIImage alloc] initWithCGImage:imageref]; + tex = [[CCTexture2D alloc] initWithImage: image]; + [image release]; + +#elif defined(__MAC_OS_X_VERSION_MAX_ALLOWED) + tex = [[CCTexture2D alloc] initWithImage: imageref]; +#endif + + if(tex && key) + [textures_ setObject: tex forKey:key]; + else + CCLOG(@"cocos2d: Couldn't add CGImage in CCTextureCache"); + + return [tex autorelease]; +} + +#pragma mark TextureCache - Remove + +-(void) removeAllTextures +{ + [textures_ removeAllObjects]; +} + +-(void) removeUnusedTextures +{ + NSArray *keys = [textures_ allKeys]; + for( id key in keys ) { + id value = [textures_ objectForKey:key]; + if( [value retainCount] == 1 ) { + CCLOG(@"cocos2d: CCTextureCache: removing unused texture: %@", key); + [textures_ removeObjectForKey:key]; + } + } +} + +-(void) removeTexture: (CCTexture2D*) tex +{ + if( ! tex ) + return; + + NSArray *keys = [textures_ allKeysForObject:tex]; + + for( NSUInteger i = 0; i < [keys count]; i++ ) + [textures_ removeObjectForKey:[keys objectAtIndex:i]]; +} + +-(void) removeTextureForKey:(NSString*)name +{ + if( ! name ) + return; + + [textures_ removeObjectForKey:name]; +} + +#pragma mark TextureCache - Get +- (CCTexture2D *)textureForKey:(NSString *)key +{ + return [textures_ objectForKey:key]; +} + +@end + + +@implementation CCTextureCache (PVRSupport) + +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED +-(CCTexture2D*) addPVRTCImage:(NSString*)path bpp:(int)bpp hasAlpha:(BOOL)alpha width:(int)w +{ + NSAssert(path != nil, @"TextureCache: fileimage MUST not be nill"); + NSAssert( bpp==2 || bpp==4, @"TextureCache: bpp must be either 2 or 4"); + + CCTexture2D * tex; + + // remove possible -HD suffix to prevent caching the same image twice (issue #1040) + path = ccRemoveHDSuffixFromFile( path ); + + if( (tex=[textures_ objectForKey: path] ) ) { + return tex; + } + + // Split up directory and filename + NSString *fullpath = [CCFileUtils fullPathFromRelativePath:path]; + + NSData *nsdata = [[NSData alloc] initWithContentsOfFile:fullpath]; + tex = [[CCTexture2D alloc] initWithPVRTCData:[nsdata bytes] level:0 bpp:bpp hasAlpha:alpha length:w pixelFormat:bpp==2?kCCTexture2DPixelFormat_PVRTC2:kCCTexture2DPixelFormat_PVRTC4]; + if( tex ) + [textures_ setObject: tex forKey:path]; + else + CCLOG(@"cocos2d: Couldn't add PVRTCImage:%@ in CCTextureCache",path); + + [nsdata release]; + + return [tex autorelease]; +} +#endif // __IPHONE_OS_VERSION_MAX_ALLOWED + +-(CCTexture2D*) addPVRImage:(NSString*)path +{ + NSAssert(path != nil, @"TextureCache: fileimage MUST not be nill"); + + CCTexture2D * tex; + + // remove possible -HD suffix to prevent caching the same image twice (issue #1040) + path = ccRemoveHDSuffixFromFile( path ); + + if( (tex=[textures_ objectForKey: path] ) ) { + return tex; + } + + // Split up directory and filename + NSString *fullpath = [CCFileUtils fullPathFromRelativePath:path]; + + tex = [[CCTexture2D alloc] initWithPVRFile: fullpath]; + if( tex ) + [textures_ setObject: tex forKey:path]; + else + CCLOG(@"cocos2d: Couldn't add PVRImage:%@ in CCTextureCache",path); + + return [tex autorelease]; +} + +@end + + +@implementation CCTextureCache (Debug) + +-(void) dumpCachedTextureInfo +{ + NSUInteger count = 0; + NSUInteger totalBytes = 0; + for (NSString* texKey in textures_) { + CCTexture2D* tex = [textures_ objectForKey:texKey]; + NSUInteger bpp = [tex bitsPerPixelForFormat]; + // Each texture takes up width * height * bytesPerPixel bytes. + NSUInteger bytes = tex.pixelsWide * tex.pixelsWide * bpp / 8; + totalBytes += bytes; + count++; + CCLOG( @"cocos2d: \"%@\" rc=%lu id=%lu %lu x %lu @ %ld bpp => %lu KB", + texKey, + (long)[tex retainCount], + (long)tex.name, + (long)tex.pixelsWide, + (long)tex.pixelsHigh, + (long)bpp, + (long)bytes / 1024 ); + } + CCLOG( @"cocos2d: CCTextureCache dumpDebugInfo: %ld textures, for %lu KB (%.2f MB)", (long)count, (long)totalBytes / 1024, totalBytes / (1024.0f*1024.0f)); +} + +@end diff --git a/libs/cocos2d/CCTexturePVR.h b/libs/cocos2d/CCTexturePVR.h new file mode 100755 index 0000000..66f8286 --- /dev/null +++ b/libs/cocos2d/CCTexturePVR.h @@ -0,0 +1,127 @@ +/* + +File: PVRTexture.h +Abstract: The PVRTexture class is responsible for loading .pvr files. + +Version: 1.0 + +Disclaimer: IMPORTANT: This Apple software is supplied to you by Apple Inc. +("Apple") in consideration of your agreement to the following terms, and your +use, installation, modification or redistribution of this Apple software +constitutes acceptance of these terms. If you do not agree with these terms, +please do not use, install, modify or redistribute this Apple software. + +In consideration of your agreement to abide by the following terms, and subject +to these terms, Apple grants you a personal, non-exclusive license, under +Apple's copyrights in this original Apple software (the "Apple Software"), to +use, reproduce, modify and redistribute the Apple Software, with or without +modifications, in source and/or binary forms; provided that if you redistribute +the Apple Software in its entirety and without modifications, you must retain +this notice and the following text and disclaimers in all such redistributions +of the Apple Software. +Neither the name, trademarks, service marks or logos of Apple Inc. may be used +to endorse or promote products derived from the Apple Software without specific +prior written permission from Apple. Except as expressly stated in this notice, +no other rights or licenses, express or implied, are granted by Apple herein, +including but not limited to any patent rights that may be infringed by your +derivative works or by other works in which the Apple Software may be +incorporated. + +The Apple Software is provided by Apple on an "AS IS" basis. APPLE MAKES NO +WARRANTIES, EXPRESS OR IMPLIED, INCLUDING WITHOUT LIMITATION THE IMPLIED +WARRANTIES OF NON-INFRINGEMENT, MERCHANTABILITY AND FITNESS FOR A PARTICULAR +PURPOSE, REGARDING THE APPLE SOFTWARE OR ITS USE AND OPERATION ALONE OR IN +COMBINATION WITH YOUR PRODUCTS. + +IN NO EVENT SHALL APPLE BE LIABLE FOR ANY SPECIAL, INDIRECT, INCIDENTAL OR +CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE +GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) +ARISING IN ANY WAY OUT OF THE USE, REPRODUCTION, MODIFICATION AND/OR +DISTRIBUTION OF THE APPLE SOFTWARE, HOWEVER CAUSED AND WHETHER UNDER THEORY OF +CONTRACT, TORT (INCLUDING NEGLIGENCE), STRICT LIABILITY OR OTHERWISE, EVEN IF +APPLE HAS BEEN ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +Copyright (C) 2008 Apple Inc. All Rights Reserved. + +*/ + +#import + +#import "Platforms/CCGL.h" +#import "CCTexture2D.h" + + +#pragma mark - +#pragma mark CCTexturePVR + +struct CCPVRMipmap { + unsigned char *address; + unsigned int len; +}; + +enum { + CC_PVRMIPMAP_MAX = 16, +}; + +/** CCTexturePVR + + Object that loads PVR images. + + Supported PVR formats: + - RGBA8888 + - BGRA8888 + - RGBA4444 + - RGBA5551 + - RGB565 + - A8 + - I8 + - AI88 + - PVRTC 4BPP + - PVRTC 2BPP + + Limitations: + Pre-generated mipmaps, such as PVR textures with mipmap levels embedded in file, + are only supported if all individual sprites are of _square_ size. + To use mipmaps with non-square textures, instead call CCTexture2D#generateMipmap on the sheet texture itself + (and to save space, save the PVR sprite sheet without mip maps included). + */ +@interface CCTexturePVR : NSObject +{ + struct CCPVRMipmap mipmaps_[CC_PVRMIPMAP_MAX]; // pointer to mipmap images + int numberOfMipmaps_; // number of mipmap used + + unsigned int tableFormatIndex_; + uint32_t width_, height_; + GLuint name_; + BOOL hasAlpha_; + + // cocos2d integration + BOOL retainName_; + CCTexture2DPixelFormat format_; +} + +/** initializes a CCTexturePVR with a path */ +- (id)initWithContentsOfFile:(NSString *)path; +/** initializes a CCTexturePVR with an URL */ +- (id)initWithContentsOfURL:(NSURL *)url; +/** creates and initializes a CCTexturePVR with a path */ ++ (id)pvrTextureWithContentsOfFile:(NSString *)path; +/** creates and initializes a CCTexturePVR with an URL */ ++ (id)pvrTextureWithContentsOfURL:(NSURL *)url; + +/** texture id name */ +@property (nonatomic,readonly) GLuint name; +/** texture width */ +@property (nonatomic,readonly) uint32_t width; +/** texture height */ +@property (nonatomic,readonly) uint32_t height; +/** whether or not the texture has alpha */ +@property (nonatomic,readonly) BOOL hasAlpha; + +// cocos2d integration +@property (nonatomic,readwrite) BOOL retainName; +@property (nonatomic,readonly) CCTexture2DPixelFormat format; + +@end + + diff --git a/libs/cocos2d/CCTexturePVR.m b/libs/cocos2d/CCTexturePVR.m new file mode 100755 index 0000000..692d5f9 --- /dev/null +++ b/libs/cocos2d/CCTexturePVR.m @@ -0,0 +1,428 @@ +/* + +File: PVRTexture.m +Abstract: The PVRTexture class is responsible for loading .pvr files. + +Version: 1.0 + +Disclaimer: IMPORTANT: This Apple software is supplied to you by Apple Inc. +("Apple") in consideration of your agreement to the following terms, and your +use, installation, modification or redistribution of this Apple software +constitutes acceptance of these terms. If you do not agree with these terms, +please do not use, install, modify or redistribute this Apple software. + +In consideration of your agreement to abide by the following terms, and subject +to these terms, Apple grants you a personal, non-exclusive license, under +Apple's copyrights in this original Apple software (the "Apple Software"), to +use, reproduce, modify and redistribute the Apple Software, with or without +modifications, in source and/or binary forms; provided that if you redistribute +the Apple Software in its entirety and without modifications, you must retain +this notice and the following text and disclaimers in all such redistributions +of the Apple Software. +Neither the name, trademarks, service marks or logos of Apple Inc. may be used +to endorse or promote products derived from the Apple Software without specific +prior written permission from Apple. Except as expressly stated in this notice, +no other rights or licenses, express or implied, are granted by Apple herein, +including but not limited to any patent rights that may be infringed by your +derivative works or by other works in which the Apple Software may be +incorporated. + +The Apple Software is provided by Apple on an "AS IS" basis. APPLE MAKES NO +WARRANTIES, EXPRESS OR IMPLIED, INCLUDING WITHOUT LIMITATION THE IMPLIED +WARRANTIES OF NON-INFRINGEMENT, MERCHANTABILITY AND FITNESS FOR A PARTICULAR +PURPOSE, REGARDING THE APPLE SOFTWARE OR ITS USE AND OPERATION ALONE OR IN +COMBINATION WITH YOUR PRODUCTS. + +IN NO EVENT SHALL APPLE BE LIABLE FOR ANY SPECIAL, INDIRECT, INCIDENTAL OR +CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE +GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) +ARISING IN ANY WAY OUT OF THE USE, REPRODUCTION, MODIFICATION AND/OR +DISTRIBUTION OF THE APPLE SOFTWARE, HOWEVER CAUSED AND WHETHER UNDER THEORY OF +CONTRACT, TORT (INCLUDING NEGLIGENCE), STRICT LIABILITY OR OTHERWISE, EVEN IF +APPLE HAS BEEN ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +Copyright (C) 2008 Apple Inc. All Rights Reserved. + +*/ + +/* + * Extended PVR formats for cocos2d project ( http://www.cocos2d-iphone.org ) + * - RGBA8888 + * - BGRA8888 + * - RGBA4444 + * - RGBA5551 + * - RGB565 + * - A8 + * - I8 + * - AI88 + */ + +#import + +#import + +#import "CCTexturePVR.h" +#import "ccMacros.h" +#import "CCConfiguration.h" +#import "Support/ccUtils.h" +#import "Support/CCFileUtils.h" +#import "Support/ZipUtils.h" +#import "Support/OpenGL_Internal.h" + +#pragma mark - +#pragma mark CCTexturePVR + +#define PVR_TEXTURE_FLAG_TYPE_MASK 0xff + +// Values taken from PVRTexture.h from http://www.imgtec.com +enum { + kPVRTextureFlagMipmap = (1<<8), // has mip map levels + kPVRTextureFlagTwiddle = (1<<9), // is twiddled + kPVRTextureFlagBumpmap = (1<<10), // has normals encoded for a bump map + kPVRTextureFlagTiling = (1<<11), // is bordered for tiled pvr + kPVRTextureFlagCubemap = (1<<12), // is a cubemap/skybox + kPVRTextureFlagFalseMipCol = (1<<13), // are there false coloured MIP levels + kPVRTextureFlagVolume = (1<<14), // is this a volume texture + kPVRTextureFlagAlpha = (1<<15), // v2.1 is there transparency info in the texture + kPVRTextureFlagVerticalFlip = (1<<16), // v2.1 is the texture vertically flipped +}; + + +static char gPVRTexIdentifier[4] = "PVR!"; + +enum +{ + kPVRTexturePixelTypeRGBA_4444= 0x10, + kPVRTexturePixelTypeRGBA_5551, + kPVRTexturePixelTypeRGBA_8888, + kPVRTexturePixelTypeRGB_565, + kPVRTexturePixelTypeRGB_555, // unsupported + kPVRTexturePixelTypeRGB_888, // unsupported + kPVRTexturePixelTypeI_8, + kPVRTexturePixelTypeAI_88, + kPVRTexturePixelTypePVRTC_2, + kPVRTexturePixelTypePVRTC_4, + kPVRTexturePixelTypeBGRA_8888, + kPVRTexturePixelTypeA_8, +}; + +static const uint32_t tableFormats[][7] = { + + // - PVR texture format + // - OpenGL internal format + // - OpenGL format + // - OpenGL type + // - bpp + // - compressed + // - Cocos2d texture format constant + { kPVRTexturePixelTypeRGBA_4444, GL_RGBA, GL_RGBA, GL_UNSIGNED_SHORT_4_4_4_4, 16, NO, kCCTexture2DPixelFormat_RGBA4444 }, + { kPVRTexturePixelTypeRGBA_5551, GL_RGBA, GL_RGBA, GL_UNSIGNED_SHORT_5_5_5_1, 16, NO, kCCTexture2DPixelFormat_RGB5A1 }, + { kPVRTexturePixelTypeRGBA_8888, GL_RGBA, GL_RGBA, GL_UNSIGNED_BYTE, 32, NO, kCCTexture2DPixelFormat_RGBA8888 }, + { kPVRTexturePixelTypeRGB_565, GL_RGB, GL_RGB, GL_UNSIGNED_SHORT_5_6_5, 16, NO, kCCTexture2DPixelFormat_RGB565 }, + { kPVRTexturePixelTypeA_8, GL_ALPHA, GL_ALPHA, GL_UNSIGNED_BYTE, 8, NO, kCCTexture2DPixelFormat_A8 }, + { kPVRTexturePixelTypeI_8, GL_LUMINANCE, GL_LUMINANCE, GL_UNSIGNED_BYTE, 8, NO, kCCTexture2DPixelFormat_I8 }, + { kPVRTexturePixelTypeAI_88, GL_LUMINANCE_ALPHA, GL_LUMINANCE_ALPHA, GL_UNSIGNED_BYTE, 16, NO, kCCTexture2DPixelFormat_AI88 }, +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED + { kPVRTexturePixelTypePVRTC_2, GL_COMPRESSED_RGBA_PVRTC_2BPPV1_IMG, -1, -1, 2, YES, kCCTexture2DPixelFormat_PVRTC2 }, + { kPVRTexturePixelTypePVRTC_4, GL_COMPRESSED_RGBA_PVRTC_4BPPV1_IMG, -1, -1, 4, YES, kCCTexture2DPixelFormat_PVRTC4 }, +#endif // iphone only + { kPVRTexturePixelTypeBGRA_8888, GL_RGBA, GL_BGRA, GL_UNSIGNED_BYTE, 32, NO, kCCTexture2DPixelFormat_RGBA8888 }, +}; +#define MAX_TABLE_ELEMENTS (sizeof(tableFormats) / sizeof(tableFormats[0])) + +enum { + kCCInternalPVRTextureFormat, + kCCInternalOpenGLInternalFormat, + kCCInternalOpenGLFormat, + kCCInternalOpenGLType, + kCCInternalBPP, + kCCInternalCompressedImage, + kCCInternalCCTexture2DPixelFormat, +}; + +typedef struct _PVRTexHeader +{ + uint32_t headerLength; + uint32_t height; + uint32_t width; + uint32_t numMipmaps; + uint32_t flags; + uint32_t dataLength; + uint32_t bpp; + uint32_t bitmaskRed; + uint32_t bitmaskGreen; + uint32_t bitmaskBlue; + uint32_t bitmaskAlpha; + uint32_t pvrTag; + uint32_t numSurfs; +} PVRTexHeader; + + +@implementation CCTexturePVR + +@synthesize name = name_; +@synthesize width = width_; +@synthesize height = height_; +@synthesize hasAlpha = hasAlpha_; + +// cocos2d integration +@synthesize retainName = retainName_; +@synthesize format = format_; + + +- (BOOL)unpackPVRData:(unsigned char*)data PVRLen:(NSUInteger)len +{ + BOOL success = FALSE; + PVRTexHeader *header = NULL; + uint32_t flags, pvrTag; + uint32_t dataLength = 0, dataOffset = 0, dataSize = 0; + uint32_t blockSize = 0, widthBlocks = 0, heightBlocks = 0; + uint32_t width = 0, height = 0, bpp = 4; + uint8_t *bytes = NULL; + uint32_t formatFlags; + + header = (PVRTexHeader *)data; + + pvrTag = CFSwapInt32LittleToHost(header->pvrTag); + + if ((uint32_t)gPVRTexIdentifier[0] != ((pvrTag >> 0) & 0xff) || + (uint32_t)gPVRTexIdentifier[1] != ((pvrTag >> 8) & 0xff) || + (uint32_t)gPVRTexIdentifier[2] != ((pvrTag >> 16) & 0xff) || + (uint32_t)gPVRTexIdentifier[3] != ((pvrTag >> 24) & 0xff)) + { + return FALSE; + } + + CCConfiguration *configuration = [CCConfiguration sharedConfiguration]; + + flags = CFSwapInt32LittleToHost(header->flags); + formatFlags = flags & PVR_TEXTURE_FLAG_TYPE_MASK; + BOOL flipped = flags & kPVRTextureFlagVerticalFlip; + if( flipped ) + CCLOG(@"cocos2d: WARNING: Image is flipped. Regenerate it using PVRTexTool"); + + if( ! [configuration supportsNPOT] && + ( header->width != ccNextPOT(header->width) || header->height != ccNextPOT(header->height ) ) ) { + CCLOG(@"cocos2d: ERROR: Loding an NPOT texture (%dx%d) but is not supported on this device", header->width, header->height); + return FALSE; + } + + for( tableFormatIndex_=0; tableFormatIndex_ < (unsigned int)MAX_TABLE_ELEMENTS ; tableFormatIndex_++) { + if( tableFormats[tableFormatIndex_][kCCInternalPVRTextureFormat] == formatFlags ) { + + numberOfMipmaps_ = 0; + + width_ = width = CFSwapInt32LittleToHost(header->width); + height_ = height = CFSwapInt32LittleToHost(header->height); + + if (CFSwapInt32LittleToHost(header->bitmaskAlpha)) + hasAlpha_ = TRUE; + else + hasAlpha_ = FALSE; + + dataLength = CFSwapInt32LittleToHost(header->dataLength); + bytes = ((uint8_t *)data) + sizeof(PVRTexHeader); + format_ = tableFormats[tableFormatIndex_][kCCInternalCCTexture2DPixelFormat]; + bpp = tableFormats[tableFormatIndex_][kCCInternalBPP]; + + // Calculate the data size for each texture level and respect the minimum number of blocks + while (dataOffset < dataLength) + { + switch (formatFlags) { + case kPVRTexturePixelTypePVRTC_2: + blockSize = 8 * 4; // Pixel by pixel block size for 2bpp + widthBlocks = width / 8; + heightBlocks = height / 4; + break; + case kPVRTexturePixelTypePVRTC_4: + blockSize = 4 * 4; // Pixel by pixel block size for 4bpp + widthBlocks = width / 4; + heightBlocks = height / 4; + break; + case kPVRTexturePixelTypeBGRA_8888: + if( ! [[CCConfiguration sharedConfiguration] supportsBGRA8888] ) { + CCLOG(@"cocos2d: TexturePVR. BGRA8888 not supported on this device"); + return FALSE; + } + default: + blockSize = 1; + widthBlocks = width; + heightBlocks = height; + break; + } + + // Clamp to minimum number of blocks + if (widthBlocks < 2) + widthBlocks = 2; + if (heightBlocks < 2) + heightBlocks = 2; + + dataSize = widthBlocks * heightBlocks * ((blockSize * bpp) / 8); + float packetLength = (dataLength-dataOffset); + packetLength = packetLength > dataSize ? dataSize : packetLength; + + mipmaps_[numberOfMipmaps_].address = bytes+dataOffset; + mipmaps_[numberOfMipmaps_].len = packetLength; + numberOfMipmaps_++; + + NSAssert( numberOfMipmaps_ < CC_PVRMIPMAP_MAX, @"TexturePVR: Maximum number of mimpaps reached. Increate the CC_PVRMIPMAP_MAX value"); + + dataOffset += packetLength; + + width = MAX(width >> 1, 1); + height = MAX(height >> 1, 1); + } + + success = TRUE; + break; + } + } + + if( ! success ) + CCLOG(@"cocos2d: WARNING: Unsupported PVR Pixel Format: 0x%2x. Re-encode it with a OpenGL pixel format variant", formatFlags); + + return success; +} + + +- (BOOL)createGLTexture +{ + GLsizei width = width_; + GLsizei height = height_; + GLenum err; + + if (numberOfMipmaps_ > 0) + { + if (name_ != 0) + glDeleteTextures(1, &name_); + + glPixelStorei(GL_UNPACK_ALIGNMENT,1); + glGenTextures(1, &name_); + glBindTexture(GL_TEXTURE_2D, name_); + } + + CHECK_GL_ERROR(); // clean possible GL error + + // Generate textures with mipmaps + for (GLint i=0; i < numberOfMipmaps_; i++) + { + GLenum internalFormat = tableFormats[tableFormatIndex_][kCCInternalOpenGLInternalFormat]; + GLenum format = tableFormats[tableFormatIndex_][kCCInternalOpenGLFormat]; + GLenum type = tableFormats[tableFormatIndex_][kCCInternalOpenGLType]; + BOOL compressed = tableFormats[tableFormatIndex_][kCCInternalCompressedImage]; + + if( compressed && ! [[CCConfiguration sharedConfiguration] supportsPVRTC] ) { + CCLOG(@"cocos2d: WARNING: PVRTC images are not supported"); + return FALSE; + } + + unsigned char *data = mipmaps_[i].address; + unsigned int datalen = mipmaps_[i].len; + + if( compressed) + glCompressedTexImage2D(GL_TEXTURE_2D, i, internalFormat, width, height, 0, datalen, data); + else + glTexImage2D(GL_TEXTURE_2D, i, internalFormat, width, height, 0, format, type, data); + + if( i > 0 && (width != height || ccNextPOT(width) != width ) ) + CCLOG(@"cocos2d: TexturePVR. WARNING. Mipmap level %u is not squared. Texture won't render correctly. width=%u != height=%u", i, width, height); + + err = glGetError(); + if (err != GL_NO_ERROR) + { + CCLOG(@"cocos2d: TexturePVR: Error uploading compressed texture level: %u . glError: 0x%04X", i, err); + return FALSE; + } + + width = MAX(width >> 1, 1); + height = MAX(height >> 1, 1); + } + + return TRUE; +} + + +- (id)initWithContentsOfFile:(NSString *)path +{ + if((self = [super init])) + { + unsigned char *pvrdata = NULL; + NSInteger pvrlen = 0; + NSString *lowerCase = [path lowercaseString]; + + if ( [lowerCase hasSuffix:@".ccz"]) + pvrlen = ccInflateCCZFile( [path UTF8String], &pvrdata ); + + else if( [lowerCase hasSuffix:@".gz"] ) + pvrlen = ccInflateGZipFile( [path UTF8String], &pvrdata ); + + else + pvrlen = ccLoadFileIntoMemory( [path UTF8String], &pvrdata ); + + if( pvrlen < 0 ) { + [self release]; + return nil; + } + + + numberOfMipmaps_ = 0; + + name_ = 0; + width_ = height_ = 0; + tableFormatIndex_ = -1; + hasAlpha_ = FALSE; + + retainName_ = NO; // cocos2d integration + + if( ! [self unpackPVRData:pvrdata PVRLen:pvrlen] || ![self createGLTexture] ) { + free(pvrdata); + [self release]; + return nil; + } + + free(pvrdata); + } + + return self; +} + +- (id)initWithContentsOfURL:(NSURL *)url +{ + if (![url isFileURL]) + { + CCLOG(@"cocos2d: CCPVRTexture: Only files are supported"); + [self release]; + return nil; + } + + return [self initWithContentsOfFile:[url path]]; +} + + ++ (id)pvrTextureWithContentsOfFile:(NSString *)path +{ + return [[[self alloc] initWithContentsOfFile:path] autorelease]; +} + + ++ (id)pvrTextureWithContentsOfURL:(NSURL *)url +{ + if (![url isFileURL]) + return nil; + + return [CCTexturePVR pvrTextureWithContentsOfFile:[url path]]; +} + + +- (void)dealloc +{ + CCLOGINFO( @"cocos2d: deallocing %@", self); + + if (name_ != 0 && ! retainName_ ) + glDeleteTextures(1, &name_); + + [super dealloc]; +} + +@end + diff --git a/libs/cocos2d/CCTileMapAtlas.h b/libs/cocos2d/CCTileMapAtlas.h new file mode 100755 index 0000000..102ae46 --- /dev/null +++ b/libs/cocos2d/CCTileMapAtlas.h @@ -0,0 +1,83 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2008-2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + +#import "CCTextureAtlas.h" +#import "CCAtlasNode.h" +#import "Support/TGAlib.h" + +/** CCTileMapAtlas is a subclass of CCAtlasNode. + + It knows how to render a map based of tiles. + The tiles must be in a .PNG format while the map must be a .TGA file. + + For more information regarding the format, please see this post: + http://www.cocos2d-iphone.org/archives/27 + + All features from CCAtlasNode are valid in CCTileMapAtlas + + IMPORTANT: + This class is deprecated. It is maintained for compatibility reasons only. + You SHOULD not use this class. + Instead, use the newer TMX file format: CCTMXTiledMap + */ +@interface CCTileMapAtlas : CCAtlasNode +{ + + /// info about the map file + tImageTGA *tgaInfo; + + /// x,y to altas dicctionary + NSMutableDictionary *posToAtlasIndex; + + /// numbers of tiles to render + int itemsToRender; +} + +/** TileMap info */ +@property (nonatomic,readonly) tImageTGA *tgaInfo; + +/** creates a CCTileMap with a tile file (atlas) with a map file and the width and height of each tile in points. + The tile file will be loaded using the TextureMgr. + */ ++(id) tileMapAtlasWithTileFile:(NSString*)tile mapFile:(NSString*)map tileWidth:(int)w tileHeight:(int)h; + +/** initializes a CCTileMap with a tile file (atlas) with a map file and the width and height of each tile in points. + The file will be loaded using the TextureMgr. + */ +-(id) initWithTileFile:(NSString*)tile mapFile:(NSString*)map tileWidth:(int)w tileHeight:(int)h; + +/** returns a tile from position x,y. + For the moment only channel R is used + */ +-(ccColor3B) tileAt: (ccGridSize) position; + +/** sets a tile at position x,y. + For the moment only channel R is used + */ +-(void) setTile:(ccColor3B)tile at:(ccGridSize)position; +/** dealloc the map from memory */ +-(void) releaseMap; +@end diff --git a/libs/cocos2d/CCTileMapAtlas.m b/libs/cocos2d/CCTileMapAtlas.m new file mode 100755 index 0000000..aef6fe0 --- /dev/null +++ b/libs/cocos2d/CCTileMapAtlas.m @@ -0,0 +1,234 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2008-2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + +#import "ccConfig.h" +#import "CCTileMapAtlas.h" +#import "ccMacros.h" +#import "Support/CCFileUtils.h" + +@interface CCTileMapAtlas (Private) +-(void) loadTGAfile:(NSString*)file; +-(void) calculateItemsToRender; +-(void) updateAtlasValueAt:(ccGridSize)pos withValue:(ccColor3B)value withIndex:(NSUInteger)idx; +@end + + +@implementation CCTileMapAtlas + +@synthesize tgaInfo; + +#pragma mark CCTileMapAtlas - Creation & Init ++(id) tileMapAtlasWithTileFile:(NSString*)tile mapFile:(NSString*)map tileWidth:(int)w tileHeight:(int)h +{ + return [[[self alloc] initWithTileFile:tile mapFile:map tileWidth:w tileHeight:h] autorelease]; +} + + +-(id) initWithTileFile:(NSString*)tile mapFile:(NSString*)map tileWidth:(int)w tileHeight:(int)h +{ + [self loadTGAfile: map]; + [self calculateItemsToRender]; + + if( (self=[super initWithTileFile:tile tileWidth:w tileHeight:h itemsToRender: itemsToRender]) ) { + + posToAtlasIndex = [[NSMutableDictionary dictionaryWithCapacity:itemsToRender] retain]; + + [self updateAtlasValues]; + + [self setContentSize: CGSizeMake(tgaInfo->width*itemWidth_, tgaInfo->height*itemHeight_)]; + } + + return self; +} + +-(void) dealloc +{ + if( tgaInfo ) + tgaDestroy(tgaInfo); + + [posToAtlasIndex release]; + + [super dealloc]; +} + +-(void) releaseMap +{ + if( tgaInfo ) + tgaDestroy(tgaInfo); + + tgaInfo = nil; + + [posToAtlasIndex release]; + posToAtlasIndex = nil; +} + +-(void) calculateItemsToRender +{ + NSAssert( tgaInfo != nil, @"tgaInfo must be non-nil"); + + itemsToRender = 0; + for(int x = 0;x < tgaInfo->width; x++ ) { + for(int y = 0; y < tgaInfo->height; y++ ) { + ccColor3B *ptr = (ccColor3B*) tgaInfo->imageData; + ccColor3B value = ptr[x + y * tgaInfo->width]; + if( value.r ) + itemsToRender++; + } + } +} + +-(void) loadTGAfile:(NSString*)file +{ + NSAssert( file != nil, @"file must be non-nil"); + + NSString *path = [CCFileUtils fullPathFromRelativePath:file ]; + +// //Find the path of the file +// NSBundle *mainBndl = [CCDirector sharedDirector].loadingBundle; +// NSString *resourcePath = [mainBndl resourcePath]; +// NSString * path = [resourcePath stringByAppendingPathComponent:file]; + + tgaInfo = tgaLoad( [path UTF8String] ); +#if 1 + if( tgaInfo->status != TGA_OK ) + [NSException raise:@"TileMapAtlasLoadTGA" format:@"TileMapAtas cannot load TGA file"]; + +#endif +} + +#pragma mark CCTileMapAtlas - Atlas generation / updates + +-(void) setTile:(ccColor3B) tile at:(ccGridSize) pos +{ + NSAssert( tgaInfo != nil, @"tgaInfo must not be nil"); + NSAssert( posToAtlasIndex != nil, @"posToAtlasIndex must not be nil"); + NSAssert( pos.x < tgaInfo->width, @"Invalid position.x"); + NSAssert( pos.y < tgaInfo->height, @"Invalid position.x"); + NSAssert( tile.r != 0, @"R component must be non 0"); + + ccColor3B *ptr = (ccColor3B*) tgaInfo->imageData; + ccColor3B value = ptr[pos.x + pos.y * tgaInfo->width]; + if( value.r == 0 ) + CCLOG(@"cocos2d: Value.r must be non 0."); + else { + ptr[pos.x + pos.y * tgaInfo->width] = tile; + + // XXX: this method consumes a lot of memory + // XXX: a tree of something like that shall be impolemented + NSNumber *num = [posToAtlasIndex objectForKey: [NSString stringWithFormat:@"%d,%d", pos.x, pos.y]]; + [self updateAtlasValueAt:pos withValue:tile withIndex: [num integerValue]]; + } +} + +-(ccColor3B) tileAt:(ccGridSize) pos +{ + NSAssert( tgaInfo != nil, @"tgaInfo must not be nil"); + NSAssert( pos.x < tgaInfo->width, @"Invalid position.x"); + NSAssert( pos.y < tgaInfo->height, @"Invalid position.y"); + + ccColor3B *ptr = (ccColor3B*) tgaInfo->imageData; + ccColor3B value = ptr[pos.x + pos.y * tgaInfo->width]; + + return value; +} + +-(void) updateAtlasValueAt:(ccGridSize)pos withValue:(ccColor3B)value withIndex:(NSUInteger)idx +{ + ccV3F_C4B_T2F_Quad quad; + + NSInteger x = pos.x; + NSInteger y = pos.y; + float row = (value.r % itemsPerRow_); + float col = (value.r / itemsPerRow_); + + float textureWide = [[textureAtlas_ texture] pixelsWide]; + float textureHigh = [[textureAtlas_ texture] pixelsHigh]; + +#if CC_FIX_ARTIFACTS_BY_STRECHING_TEXEL + float left = (2*row*itemWidth_+1)/(2*textureWide); + float right = left+(itemWidth_*2-2)/(2*textureWide); + float top = (2*col*itemHeight_+1)/(2*textureHigh); + float bottom = top+(itemHeight_*2-2)/(2*textureHigh); +#else + float left = (row*itemWidth_)/textureWide; + float right = left+itemWidth_/textureWide; + float top = (col*itemHeight_)/textureHigh; + float bottom = top+itemHeight_/textureHigh; +#endif + + + quad.tl.texCoords.u = left; + quad.tl.texCoords.v = top; + quad.tr.texCoords.u = right; + quad.tr.texCoords.v = top; + quad.bl.texCoords.u = left; + quad.bl.texCoords.v = bottom; + quad.br.texCoords.u = right; + quad.br.texCoords.v = bottom; + + quad.bl.vertices.x = (int) (x * itemWidth_); + quad.bl.vertices.y = (int) (y * itemHeight_); + quad.bl.vertices.z = 0.0f; + quad.br.vertices.x = (int)(x * itemWidth_ + itemWidth_); + quad.br.vertices.y = (int)(y * itemHeight_); + quad.br.vertices.z = 0.0f; + quad.tl.vertices.x = (int)(x * itemWidth_); + quad.tl.vertices.y = (int)(y * itemHeight_ + itemHeight_); + quad.tl.vertices.z = 0.0f; + quad.tr.vertices.x = (int)(x * itemWidth_ + itemWidth_); + quad.tr.vertices.y = (int)(y * itemHeight_ + itemHeight_); + quad.tr.vertices.z = 0.0f; + + [textureAtlas_ updateQuad:&quad atIndex:idx]; +} + +-(void) updateAtlasValues +{ + NSAssert( tgaInfo != nil, @"tgaInfo must be non-nil"); + + + int total = 0; + + for(int x = 0;x < tgaInfo->width; x++ ) { + for(int y = 0; y < tgaInfo->height; y++ ) { + if( total < itemsToRender ) { + ccColor3B *ptr = (ccColor3B*) tgaInfo->imageData; + ccColor3B value = ptr[x + y * tgaInfo->width]; + + if( value.r != 0 ) { + [self updateAtlasValueAt:ccg(x,y) withValue:value withIndex:total]; + + NSString *key = [NSString stringWithFormat:@"%d,%d", x,y]; + NSNumber *num = [NSNumber numberWithInt:total]; + [posToAtlasIndex setObject:num forKey:key]; + + total++; + } + } + } + } +} +@end diff --git a/libs/cocos2d/CCTransition.h b/libs/cocos2d/CCTransition.h new file mode 100755 index 0000000..e37d3e8 --- /dev/null +++ b/libs/cocos2d/CCTransition.h @@ -0,0 +1,296 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2008-2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + + +#import "CCScene.h" +@class CCActionInterval; +@class CCNode; + +/** CCTransitionEaseScene can ease the actions of the scene protocol. + @since v0.8.2 + */ +@protocol CCTransitionEaseScene +/** returns the Ease action that will be performed on a linear action. + @since v0.8.2 + */ +-(CCActionInterval*) easeActionWithAction:(CCActionInterval*)action; +@end + +/** Orientation Type used by some transitions + */ +typedef enum { + /// An horizontal orientation where the Left is nearer + kOrientationLeftOver = 0, + /// An horizontal orientation where the Right is nearer + kOrientationRightOver = 1, + /// A vertical orientation where the Up is nearer + kOrientationUpOver = 0, + /// A vertical orientation where the Bottom is nearer + kOrientationDownOver = 1, +} tOrientation; + +/** Base class for CCTransition scenes + */ +@interface CCTransitionScene : CCScene +{ + CCScene *inScene_; + CCScene *outScene_; + ccTime duration_; + BOOL inSceneOnTop_; + BOOL sendCleanupToScene_; +} +/** creates a base transition with duration and incoming scene */ ++(id) transitionWithDuration:(ccTime) t scene:(CCScene*)s; +/** initializes a transition with duration and incoming scene */ +-(id) initWithDuration:(ccTime) t scene:(CCScene*)s; +/** called after the transition finishes */ +-(void) finish; +/** used by some transitions to hide the outter scene */ +-(void) hideOutShowIn; +@end + +/** A CCTransition that supports orientation like. + * Possible orientation: LeftOver, RightOver, UpOver, DownOver + */ +@interface CCTransitionSceneOriented : CCTransitionScene +{ + tOrientation orientation; +} +/** creates a base transition with duration and incoming scene */ ++(id) transitionWithDuration:(ccTime) t scene:(CCScene*)s orientation:(tOrientation)o; +/** initializes a transition with duration and incoming scene */ +-(id) initWithDuration:(ccTime) t scene:(CCScene*)s orientation:(tOrientation)o; +@end + + +/** CCTransitionRotoZoom: + Rotate and zoom out the outgoing scene, and then rotate and zoom in the incoming + */ +@interface CCTransitionRotoZoom : CCTransitionScene +{} +@end + +/** CCTransitionJumpZoom: + Zoom out and jump the outgoing scene, and then jump and zoom in the incoming +*/ +@interface CCTransitionJumpZoom : CCTransitionScene +{} +@end + +/** CCTransitionMoveInL: + Move in from to the left the incoming scene. +*/ +@interface CCTransitionMoveInL : CCTransitionScene +{} +/** initializes the scenes */ +-(void) initScenes; +/** returns the action that will be performed */ +-(CCActionInterval*) action; +@end + +/** CCTransitionMoveInR: + Move in from to the right the incoming scene. + */ +@interface CCTransitionMoveInR : CCTransitionMoveInL +{} +@end + +/** CCTransitionMoveInT: + Move in from to the top the incoming scene. + */ +@interface CCTransitionMoveInT : CCTransitionMoveInL +{} +@end + +/** CCTransitionMoveInB: + Move in from to the bottom the incoming scene. + */ +@interface CCTransitionMoveInB : CCTransitionMoveInL +{} +@end + +/** CCTransitionSlideInL: + Slide in the incoming scene from the left border. + */ +@interface CCTransitionSlideInL : CCTransitionScene +{} +/** initializes the scenes */ +-(void) initScenes; +/** returns the action that will be performed by the incomming and outgoing scene */ +-(CCActionInterval*) action; +@end + +/** CCTransitionSlideInR: + Slide in the incoming scene from the right border. + */ +@interface CCTransitionSlideInR : CCTransitionSlideInL +{} +@end + +/** CCTransitionSlideInB: + Slide in the incoming scene from the bottom border. + */ +@interface CCTransitionSlideInB : CCTransitionSlideInL +{} +@end + +/** CCTransitionSlideInT: + Slide in the incoming scene from the top border. + */ +@interface CCTransitionSlideInT : CCTransitionSlideInL +{} +@end + +/** + Shrink the outgoing scene while grow the incoming scene + */ +@interface CCTransitionShrinkGrow : CCTransitionScene +{} +@end + +/** CCTransitionFlipX: + Flips the screen horizontally. + The front face is the outgoing scene and the back face is the incoming scene. + */ +@interface CCTransitionFlipX : CCTransitionSceneOriented +{} +@end + +/** CCTransitionFlipY: + Flips the screen vertically. + The front face is the outgoing scene and the back face is the incoming scene. + */ +@interface CCTransitionFlipY : CCTransitionSceneOriented +{} +@end + +/** CCTransitionFlipAngular: + Flips the screen half horizontally and half vertically. + The front face is the outgoing scene and the back face is the incoming scene. + */ +@interface CCTransitionFlipAngular : CCTransitionSceneOriented +{} +@end + +/** CCTransitionZoomFlipX: + Flips the screen horizontally doing a zoom out/in + The front face is the outgoing scene and the back face is the incoming scene. + */ +@interface CCTransitionZoomFlipX : CCTransitionSceneOriented +{} +@end + +/** CCTransitionZoomFlipY: + Flips the screen vertically doing a little zooming out/in + The front face is the outgoing scene and the back face is the incoming scene. + */ +@interface CCTransitionZoomFlipY : CCTransitionSceneOriented +{} +@end + +/** CCTransitionZoomFlipAngular: + Flips the screen half horizontally and half vertically doing a little zooming out/in. + The front face is the outgoing scene and the back face is the incoming scene. + */ +@interface CCTransitionZoomFlipAngular : CCTransitionSceneOriented +{} +@end + +/** CCTransitionFade: + Fade out the outgoing scene and then fade in the incoming scene.''' + */ +@interface CCTransitionFade : CCTransitionScene +{ + ccColor4B color; +} +/** creates the transition with a duration and with an RGB color + * Example: [FadeTransition transitionWithDuration:2 scene:s withColor:ccc3(255,0,0)]; // red color + */ ++(id) transitionWithDuration:(ccTime)duration scene:(CCScene*)scene withColor:(ccColor3B)color; +/** initializes the transition with a duration and with an RGB color */ +-(id) initWithDuration:(ccTime)duration scene:(CCScene*)scene withColor:(ccColor3B)color; +@end + + +/** + CCTransitionCrossFade: + Cross fades two scenes using the CCRenderTexture object. + */ +@class CCRenderTexture; +@interface CCTransitionCrossFade : CCTransitionScene +{} +@end + +/** CCTransitionTurnOffTiles: + Turn off the tiles of the outgoing scene in random order + */ +@interface CCTransitionTurnOffTiles : CCTransitionScene +{} +@end + +/** CCTransitionSplitCols: + The odd columns goes upwards while the even columns goes downwards. + */ +@interface CCTransitionSplitCols : CCTransitionScene +{} +-(CCActionInterval*) action; +@end + +/** CCTransitionSplitRows: + The odd rows goes to the left while the even rows goes to the right. + */ +@interface CCTransitionSplitRows : CCTransitionSplitCols +{} +@end + +/** CCTransitionFadeTR: + Fade the tiles of the outgoing scene from the left-bottom corner the to top-right corner. + */ +@interface CCTransitionFadeTR : CCTransitionScene +{} +-(CCActionInterval*) actionWithSize:(ccGridSize) vector; +@end + +/** CCTransitionFadeBL: + Fade the tiles of the outgoing scene from the top-right corner to the bottom-left corner. + */ +@interface CCTransitionFadeBL : CCTransitionFadeTR +{} +@end + +/** CCTransitionFadeUp: + * Fade the tiles of the outgoing scene from the bottom to the top. + */ +@interface CCTransitionFadeUp : CCTransitionFadeTR +{} +@end + +/** CCTransitionFadeDown: + * Fade the tiles of the outgoing scene from the top to the bottom. + */ +@interface CCTransitionFadeDown : CCTransitionFadeTR +{} +@end diff --git a/libs/cocos2d/CCTransition.m b/libs/cocos2d/CCTransition.m new file mode 100755 index 0000000..22eed50 --- /dev/null +++ b/libs/cocos2d/CCTransition.m @@ -0,0 +1,1059 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2008-2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + + + +#import "CCTransition.h" +#import "CCNode.h" +#import "CCDirector.h" +#import "CCActionInterval.h" +#import "CCActionInstant.h" +#import "CCActionCamera.h" +#import "CCLayer.h" +#import "CCCamera.h" +#import "CCActionTiledGrid.h" +#import "CCActionEase.h" +#import "CCRenderTexture.h" +#import "Support/CGPointExtension.h" + +#import +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED +#import "Platforms/iOS/CCTouchDispatcher.h" +#elif defined(__MAC_OS_X_VERSION_MAX_ALLOWED) +#import "Platforms/Mac/CCEventDispatcher.h" +#endif + +const uint32_t kSceneFade = 0xFADEFADE; + + +@interface CCTransitionScene (Private) +-(void) sceneOrder; +- (void)setNewScene:(ccTime)dt; +@end + +@implementation CCTransitionScene ++(id) transitionWithDuration:(ccTime) t scene:(CCScene*)s +{ + return [[[self alloc] initWithDuration:t scene:s] autorelease]; +} + +-(id) initWithDuration:(ccTime) t scene:(CCScene*)s +{ + NSAssert( s != nil, @"Argument scene must be non-nil"); + + if( (self=[super init]) ) { + + duration_ = t; + + // retain + inScene_ = [s retain]; + outScene_ = [[CCDirector sharedDirector] runningScene]; + [outScene_ retain]; + + NSAssert( inScene_ != outScene_, @"Incoming scene must be different from the outgoing scene" ); + + // disable events while transitions +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED + [[CCTouchDispatcher sharedDispatcher] setDispatchEvents: NO]; +#elif defined(__MAC_OS_X_VERSION_MAX_ALLOWED) + [[CCEventDispatcher sharedDispatcher] setDispatchEvents: NO]; +#endif + + [self sceneOrder]; + } + return self; +} +-(void) sceneOrder +{ + inSceneOnTop_ = YES; +} + +-(void) draw +{ + [super draw]; + + if( inSceneOnTop_ ) { + [outScene_ visit]; + [inScene_ visit]; + } else { + [inScene_ visit]; + [outScene_ visit]; + } +} + +-(void) finish +{ + /* clean up */ + [inScene_ setVisible:YES]; + [inScene_ setPosition:ccp(0,0)]; + [inScene_ setScale:1.0f]; + [inScene_ setRotation:0.0f]; + [inScene_.camera restore]; + + [outScene_ setVisible:NO]; + [outScene_ setPosition:ccp(0,0)]; + [outScene_ setScale:1.0f]; + [outScene_ setRotation:0.0f]; + [outScene_.camera restore]; + + [self schedule:@selector(setNewScene:) interval:0]; +} + +-(void) setNewScene: (ccTime) dt +{ + [self unschedule:_cmd]; + + CCDirector *director = [CCDirector sharedDirector]; + + // Before replacing, save the "send cleanup to scene" + sendCleanupToScene_ = [director sendCleanupToScene]; + + [director replaceScene: inScene_]; + + // enable events while transitions +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED + [[CCTouchDispatcher sharedDispatcher] setDispatchEvents: YES]; +#elif defined(__MAC_OS_X_VERSION_MAX_ALLOWED) + [[CCEventDispatcher sharedDispatcher] setDispatchEvents: YES]; +#endif + + // issue #267 + [outScene_ setVisible:YES]; +} + +-(void) hideOutShowIn +{ + [inScene_ setVisible:YES]; + [outScene_ setVisible:NO]; +} + +// custom onEnter +-(void) onEnter +{ + [super onEnter]; + [inScene_ onEnter]; + // outScene_ should not receive the onEnter callback +} + +// custom onExit +-(void) onExit +{ + [super onExit]; + [outScene_ onExit]; + + // inScene_ should not receive the onExit callback + // only the onEnterTransitionDidFinish + [inScene_ onEnterTransitionDidFinish]; +} + +// custom cleanup +-(void) cleanup +{ + [super cleanup]; + + if( sendCleanupToScene_ ) + [outScene_ cleanup]; +} + +-(void) dealloc +{ + [inScene_ release]; + [outScene_ release]; + [super dealloc]; +} +@end + +// +// Oriented Transition +// +@implementation CCTransitionSceneOriented ++(id) transitionWithDuration:(ccTime) t scene:(CCScene*)s orientation:(tOrientation)o +{ + return [[[self alloc] initWithDuration:t scene:s orientation:o] autorelease]; +} + +-(id) initWithDuration:(ccTime) t scene:(CCScene*)s orientation:(tOrientation)o +{ + if( (self=[super initWithDuration:t scene:s]) ) + orientation = o; + return self; +} +@end + + +// +// RotoZoom +// +@implementation CCTransitionRotoZoom +-(void) onEnter +{ + [super onEnter]; + + [inScene_ setScale:0.001f]; + [outScene_ setScale:1.0f]; + + [inScene_ setAnchorPoint:ccp(0.5f, 0.5f)]; + [outScene_ setAnchorPoint:ccp(0.5f, 0.5f)]; + + CCActionInterval *rotozoom = [CCSequence actions: [CCSpawn actions: + [CCScaleBy actionWithDuration:duration_/2 scale:0.001f], + [CCRotateBy actionWithDuration:duration_/2 angle:360 *2], + nil], + [CCDelayTime actionWithDuration:duration_/2], + nil]; + + + [outScene_ runAction: rotozoom]; + [inScene_ runAction: [CCSequence actions: + [rotozoom reverse], + [CCCallFunc actionWithTarget:self selector:@selector(finish)], + nil]]; +} +@end + +// +// JumpZoom +// +@implementation CCTransitionJumpZoom +-(void) onEnter +{ + [super onEnter]; + CGSize s = [[CCDirector sharedDirector] winSize]; + + [inScene_ setScale:0.5f]; + [inScene_ setPosition:ccp( s.width,0 )]; + + [inScene_ setAnchorPoint:ccp(0.5f, 0.5f)]; + [outScene_ setAnchorPoint:ccp(0.5f, 0.5f)]; + + CCActionInterval *jump = [CCJumpBy actionWithDuration:duration_/4 position:ccp(-s.width,0) height:s.width/4 jumps:2]; + CCActionInterval *scaleIn = [CCScaleTo actionWithDuration:duration_/4 scale:1.0f]; + CCActionInterval *scaleOut = [CCScaleTo actionWithDuration:duration_/4 scale:0.5f]; + + CCActionInterval *jumpZoomOut = [CCSequence actions: scaleOut, jump, nil]; + CCActionInterval *jumpZoomIn = [CCSequence actions: jump, scaleIn, nil]; + + CCActionInterval *delay = [CCDelayTime actionWithDuration:duration_/2]; + + [outScene_ runAction: jumpZoomOut]; + [inScene_ runAction: [CCSequence actions: delay, + jumpZoomIn, + [CCCallFunc actionWithTarget:self selector:@selector(finish)], + nil] ]; +} +@end + +// +// MoveInL +// +@implementation CCTransitionMoveInL +-(void) onEnter +{ + [super onEnter]; + + [self initScenes]; + + CCActionInterval *a = [self action]; + + [inScene_ runAction: [CCSequence actions: + [self easeActionWithAction:a], + [CCCallFunc actionWithTarget:self selector:@selector(finish)], + nil] + ]; + +} +-(CCActionInterval*) action +{ + return [CCMoveTo actionWithDuration:duration_ position:ccp(0,0)]; +} + +-(CCActionInterval*) easeActionWithAction:(CCActionInterval*)action +{ + return [CCEaseOut actionWithAction:action rate:2.0f]; +// return [EaseElasticOut actionWithAction:action period:0.4f]; +} + +-(void) initScenes +{ + CGSize s = [[CCDirector sharedDirector] winSize]; + [inScene_ setPosition: ccp( -s.width,0) ]; +} +@end + +// +// MoveInR +// +@implementation CCTransitionMoveInR +-(void) initScenes +{ + CGSize s = [[CCDirector sharedDirector] winSize]; + [inScene_ setPosition: ccp( s.width,0) ]; +} +@end + +// +// MoveInT +// +@implementation CCTransitionMoveInT +-(void) initScenes +{ + CGSize s = [[CCDirector sharedDirector] winSize]; + [inScene_ setPosition: ccp( 0, s.height) ]; +} +@end + +// +// MoveInB +// +@implementation CCTransitionMoveInB +-(void) initScenes +{ + CGSize s = [[CCDirector sharedDirector] winSize]; + [inScene_ setPosition: ccp( 0, -s.height) ]; +} +@end + +// +// SlideInL +// + +// The adjust factor is needed to prevent issue #442 +// One solution is to use DONT_RENDER_IN_SUBPIXELS images, but NO +// The other issue is that in some transitions (and I don't know why) +// the order should be reversed (In in top of Out or vice-versa). +#define ADJUST_FACTOR 0.5f +@implementation CCTransitionSlideInL +-(void) onEnter +{ + [super onEnter]; + + [self initScenes]; + + CCActionInterval *in = [self action]; + CCActionInterval *out = [self action]; + + id inAction = [self easeActionWithAction:in]; + id outAction = [CCSequence actions: + [self easeActionWithAction:out], + [CCCallFunc actionWithTarget:self selector:@selector(finish)], + nil]; + + [inScene_ runAction: inAction]; + [outScene_ runAction: outAction]; +} +-(void) sceneOrder +{ + inSceneOnTop_ = NO; +} +-(void) initScenes +{ + CGSize s = [[CCDirector sharedDirector] winSize]; + [inScene_ setPosition: ccp( -(s.width-ADJUST_FACTOR),0) ]; +} +-(CCActionInterval*) action +{ + CGSize s = [[CCDirector sharedDirector] winSize]; + return [CCMoveBy actionWithDuration:duration_ position:ccp(s.width-ADJUST_FACTOR,0)]; +} + +-(CCActionInterval*) easeActionWithAction:(CCActionInterval*)action +{ + return [CCEaseOut actionWithAction:action rate:2.0f]; +// return [EaseElasticOut actionWithAction:action period:0.4f]; +} + +@end + +// +// SlideInR +// +@implementation CCTransitionSlideInR +-(void) sceneOrder +{ + inSceneOnTop_ = YES; +} +-(void) initScenes +{ + CGSize s = [[CCDirector sharedDirector] winSize]; + [inScene_ setPosition: ccp( s.width-ADJUST_FACTOR,0) ]; +} + +-(CCActionInterval*) action +{ + CGSize s = [[CCDirector sharedDirector] winSize]; + return [CCMoveBy actionWithDuration:duration_ position:ccp(-(s.width-ADJUST_FACTOR),0)]; +} + +@end + +// +// SlideInT +// +@implementation CCTransitionSlideInT +-(void) sceneOrder +{ + inSceneOnTop_ = NO; +} +-(void) initScenes +{ + CGSize s = [[CCDirector sharedDirector] winSize]; + [inScene_ setPosition: ccp(0,s.height-ADJUST_FACTOR) ]; +} + +-(CCActionInterval*) action +{ + CGSize s = [[CCDirector sharedDirector] winSize]; + return [CCMoveBy actionWithDuration:duration_ position:ccp(0,-(s.height-ADJUST_FACTOR))]; +} + +@end + +// +// SlideInB +// +@implementation CCTransitionSlideInB +-(void) sceneOrder +{ + inSceneOnTop_ = YES; +} + +-(void) initScenes +{ + CGSize s = [[CCDirector sharedDirector] winSize]; + [inScene_ setPosition: ccp(0,-(s.height-ADJUST_FACTOR)) ]; +} + +-(CCActionInterval*) action +{ + CGSize s = [[CCDirector sharedDirector] winSize]; + return [CCMoveBy actionWithDuration:duration_ position:ccp(0,s.height-ADJUST_FACTOR)]; +} +@end + +// +// ShrinkGrow Transition +// +@implementation CCTransitionShrinkGrow +-(void) onEnter +{ + [super onEnter]; + + [inScene_ setScale:0.001f]; + [outScene_ setScale:1.0f]; + + [inScene_ setAnchorPoint:ccp(2/3.0f,0.5f)]; + [outScene_ setAnchorPoint:ccp(1/3.0f,0.5f)]; + + CCActionInterval *scaleOut = [CCScaleTo actionWithDuration:duration_ scale:0.01f]; + CCActionInterval *scaleIn = [CCScaleTo actionWithDuration:duration_ scale:1.0f]; + + [inScene_ runAction: [self easeActionWithAction:scaleIn]]; + [outScene_ runAction: [CCSequence actions: + [self easeActionWithAction:scaleOut], + [CCCallFunc actionWithTarget:self selector:@selector(finish)], + nil] ]; +} +-(CCActionInterval*) easeActionWithAction:(CCActionInterval*)action +{ + return [CCEaseOut actionWithAction:action rate:2.0f]; +// return [EaseElasticOut actionWithAction:action period:0.3f]; +} +@end + +// +// FlipX Transition +// +@implementation CCTransitionFlipX +-(void) onEnter +{ + [super onEnter]; + + CCActionInterval *inA, *outA; + [inScene_ setVisible: NO]; + + float inDeltaZ, inAngleZ; + float outDeltaZ, outAngleZ; + + if( orientation == kOrientationRightOver ) { + inDeltaZ = 90; + inAngleZ = 270; + outDeltaZ = 90; + outAngleZ = 0; + } else { + inDeltaZ = -90; + inAngleZ = 90; + outDeltaZ = -90; + outAngleZ = 0; + } + + inA = [CCSequence actions: + [CCDelayTime actionWithDuration:duration_/2], + [CCShow action], + [CCOrbitCamera actionWithDuration: duration_/2 radius: 1 deltaRadius:0 angleZ:inAngleZ deltaAngleZ:inDeltaZ angleX:0 deltaAngleX:0], + [CCCallFunc actionWithTarget:self selector:@selector(finish)], + nil ]; + outA = [CCSequence actions: + [CCOrbitCamera actionWithDuration: duration_/2 radius: 1 deltaRadius:0 angleZ:outAngleZ deltaAngleZ:outDeltaZ angleX:0 deltaAngleX:0], + [CCHide action], + [CCDelayTime actionWithDuration:duration_/2], + nil ]; + + [inScene_ runAction: inA]; + [outScene_ runAction: outA]; + +} +@end + +// +// FlipY Transition +// +@implementation CCTransitionFlipY +-(void) onEnter +{ + [super onEnter]; + + CCActionInterval *inA, *outA; + [inScene_ setVisible: NO]; + + float inDeltaZ, inAngleZ; + float outDeltaZ, outAngleZ; + + if( orientation == kOrientationUpOver ) { + inDeltaZ = 90; + inAngleZ = 270; + outDeltaZ = 90; + outAngleZ = 0; + } else { + inDeltaZ = -90; + inAngleZ = 90; + outDeltaZ = -90; + outAngleZ = 0; + } + inA = [CCSequence actions: + [CCDelayTime actionWithDuration:duration_/2], + [CCShow action], + [CCOrbitCamera actionWithDuration: duration_/2 radius: 1 deltaRadius:0 angleZ:inAngleZ deltaAngleZ:inDeltaZ angleX:90 deltaAngleX:0], + [CCCallFunc actionWithTarget:self selector:@selector(finish)], + nil ]; + outA = [CCSequence actions: + [CCOrbitCamera actionWithDuration: duration_/2 radius: 1 deltaRadius:0 angleZ:outAngleZ deltaAngleZ:outDeltaZ angleX:90 deltaAngleX:0], + [CCHide action], + [CCDelayTime actionWithDuration:duration_/2], + nil ]; + + [inScene_ runAction: inA]; + [outScene_ runAction: outA]; + +} +@end + +// +// FlipAngular Transition +// +@implementation CCTransitionFlipAngular +-(void) onEnter +{ + [super onEnter]; + + CCActionInterval *inA, *outA; + [inScene_ setVisible: NO]; + + float inDeltaZ, inAngleZ; + float outDeltaZ, outAngleZ; + + if( orientation == kOrientationRightOver ) { + inDeltaZ = 90; + inAngleZ = 270; + outDeltaZ = 90; + outAngleZ = 0; + } else { + inDeltaZ = -90; + inAngleZ = 90; + outDeltaZ = -90; + outAngleZ = 0; + } + inA = [CCSequence actions: + [CCDelayTime actionWithDuration:duration_/2], + [CCShow action], + [CCOrbitCamera actionWithDuration: duration_/2 radius: 1 deltaRadius:0 angleZ:inAngleZ deltaAngleZ:inDeltaZ angleX:-45 deltaAngleX:0], + [CCCallFunc actionWithTarget:self selector:@selector(finish)], + nil ]; + outA = [CCSequence actions: + [CCOrbitCamera actionWithDuration: duration_/2 radius: 1 deltaRadius:0 angleZ:outAngleZ deltaAngleZ:outDeltaZ angleX:45 deltaAngleX:0], + [CCHide action], + [CCDelayTime actionWithDuration:duration_/2], + nil ]; + + [inScene_ runAction: inA]; + [outScene_ runAction: outA]; +} +@end + +// +// ZoomFlipX Transition +// +@implementation CCTransitionZoomFlipX +-(void) onEnter +{ + [super onEnter]; + + CCActionInterval *inA, *outA; + [inScene_ setVisible: NO]; + + float inDeltaZ, inAngleZ; + float outDeltaZ, outAngleZ; + + if( orientation == kOrientationRightOver ) { + inDeltaZ = 90; + inAngleZ = 270; + outDeltaZ = 90; + outAngleZ = 0; + } else { + inDeltaZ = -90; + inAngleZ = 90; + outDeltaZ = -90; + outAngleZ = 0; + } + inA = [CCSequence actions: + [CCDelayTime actionWithDuration:duration_/2], + [CCSpawn actions: + [CCOrbitCamera actionWithDuration: duration_/2 radius: 1 deltaRadius:0 angleZ:inAngleZ deltaAngleZ:inDeltaZ angleX:0 deltaAngleX:0], + [CCScaleTo actionWithDuration:duration_/2 scale:1], + [CCShow action], + nil], + [CCCallFunc actionWithTarget:self selector:@selector(finish)], + nil ]; + outA = [CCSequence actions: + [CCSpawn actions: + [CCOrbitCamera actionWithDuration: duration_/2 radius: 1 deltaRadius:0 angleZ:outAngleZ deltaAngleZ:outDeltaZ angleX:0 deltaAngleX:0], + [CCScaleTo actionWithDuration:duration_/2 scale:0.5f], + nil], + [CCHide action], + [CCDelayTime actionWithDuration:duration_/2], + nil ]; + + inScene_.scale = 0.5f; + [inScene_ runAction: inA]; + [outScene_ runAction: outA]; +} +@end + +// +// ZoomFlipY Transition +// +@implementation CCTransitionZoomFlipY +-(void) onEnter +{ + [super onEnter]; + + CCActionInterval *inA, *outA; + [inScene_ setVisible: NO]; + + float inDeltaZ, inAngleZ; + float outDeltaZ, outAngleZ; + + if( orientation == kOrientationUpOver ) { + inDeltaZ = 90; + inAngleZ = 270; + outDeltaZ = 90; + outAngleZ = 0; + } else { + inDeltaZ = -90; + inAngleZ = 90; + outDeltaZ = -90; + outAngleZ = 0; + } + + inA = [CCSequence actions: + [CCDelayTime actionWithDuration:duration_/2], + [CCSpawn actions: + [CCOrbitCamera actionWithDuration: duration_/2 radius: 1 deltaRadius:0 angleZ:inAngleZ deltaAngleZ:inDeltaZ angleX:90 deltaAngleX:0], + [CCScaleTo actionWithDuration:duration_/2 scale:1], + [CCShow action], + nil], + [CCCallFunc actionWithTarget:self selector:@selector(finish)], + nil ]; + outA = [CCSequence actions: + [CCSpawn actions: + [CCOrbitCamera actionWithDuration: duration_/2 radius: 1 deltaRadius:0 angleZ:outAngleZ deltaAngleZ:outDeltaZ angleX:90 deltaAngleX:0], + [CCScaleTo actionWithDuration:duration_/2 scale:0.5f], + nil], + [CCHide action], + [CCDelayTime actionWithDuration:duration_/2], + nil ]; + + inScene_.scale = 0.5f; + [inScene_ runAction: inA]; + [outScene_ runAction: outA]; +} +@end + +// +// ZoomFlipAngular Transition +// +@implementation CCTransitionZoomFlipAngular +-(void) onEnter +{ + [super onEnter]; + + CCActionInterval *inA, *outA; + [inScene_ setVisible: NO]; + + float inDeltaZ, inAngleZ; + float outDeltaZ, outAngleZ; + + if( orientation == kOrientationRightOver ) { + inDeltaZ = 90; + inAngleZ = 270; + outDeltaZ = 90; + outAngleZ = 0; + } else { + inDeltaZ = -90; + inAngleZ = 90; + outDeltaZ = -90; + outAngleZ = 0; + } + + inA = [CCSequence actions: + [CCDelayTime actionWithDuration:duration_/2], + [CCSpawn actions: + [CCOrbitCamera actionWithDuration: duration_/2 radius: 1 deltaRadius:0 angleZ:inAngleZ deltaAngleZ:inDeltaZ angleX:-45 deltaAngleX:0], + [CCScaleTo actionWithDuration:duration_/2 scale:1], + [CCShow action], + nil], + [CCShow action], + [CCCallFunc actionWithTarget:self selector:@selector(finish)], + nil ]; + outA = [CCSequence actions: + [CCSpawn actions: + [CCOrbitCamera actionWithDuration: duration_/2 radius: 1 deltaRadius:0 angleZ:outAngleZ deltaAngleZ:outDeltaZ angleX:45 deltaAngleX:0], + [CCScaleTo actionWithDuration:duration_/2 scale:0.5f], + nil], + [CCHide action], + [CCDelayTime actionWithDuration:duration_/2], + nil ]; + + inScene_.scale = 0.5f; + [inScene_ runAction: inA]; + [outScene_ runAction: outA]; +} +@end + + +// +// Fade Transition +// +@implementation CCTransitionFade ++(id) transitionWithDuration:(ccTime)d scene:(CCScene*)s withColor:(ccColor3B)color +{ + return [[[self alloc] initWithDuration:d scene:s withColor:color] autorelease]; +} + +-(id) initWithDuration:(ccTime)d scene:(CCScene*)s withColor:(ccColor3B)aColor +{ + if( (self=[super initWithDuration:d scene:s]) ) { + color.r = aColor.r; + color.g = aColor.g; + color.b = aColor.b; + } + + return self; +} + +-(id) initWithDuration:(ccTime)d scene:(CCScene*)s +{ + return [self initWithDuration:d scene:s withColor:ccBLACK]; +} + +-(void) onEnter +{ + [super onEnter]; + + CCLayerColor *l = [CCLayerColor layerWithColor:color]; + [inScene_ setVisible: NO]; + + [self addChild: l z:2 tag:kSceneFade]; + + + CCNode *f = [self getChildByTag:kSceneFade]; + + CCActionInterval *a = [CCSequence actions: + [CCFadeIn actionWithDuration:duration_/2], + [CCCallFunc actionWithTarget:self selector:@selector(hideOutShowIn)], + [CCFadeOut actionWithDuration:duration_/2], + [CCCallFunc actionWithTarget:self selector:@selector(finish)], + nil ]; + [f runAction: a]; +} + +-(void) onExit +{ + [super onExit]; + [self removeChildByTag:kSceneFade cleanup:NO]; +} +@end + + +// +// Cross Fade Transition +// +@implementation CCTransitionCrossFade + +-(void) draw +{ + // override draw since both scenes (textures) are rendered in 1 scene +} + +-(void) onEnter +{ + [super onEnter]; + + // create a transparent color layer + // in which we are going to add our rendertextures + ccColor4B color = {0,0,0,0}; + CGSize size = [[CCDirector sharedDirector] winSize]; + CCLayerColor * layer = [CCLayerColor layerWithColor:color]; + + // create the first render texture for inScene_ + CCRenderTexture *inTexture = [CCRenderTexture renderTextureWithWidth:size.width height:size.height]; + inTexture.sprite.anchorPoint= ccp(0.5f,0.5f); + inTexture.position = ccp(size.width/2, size.height/2); + inTexture.anchorPoint = ccp(0.5f,0.5f); + + // render inScene_ to its texturebuffer + [inTexture begin]; + [inScene_ visit]; + [inTexture end]; + + // create the second render texture for outScene_ + CCRenderTexture *outTexture = [CCRenderTexture renderTextureWithWidth:size.width height:size.height]; + outTexture.sprite.anchorPoint= ccp(0.5f,0.5f); + outTexture.position = ccp(size.width/2, size.height/2); + outTexture.anchorPoint = ccp(0.5f,0.5f); + + // render outScene_ to its texturebuffer + [outTexture begin]; + [outScene_ visit]; + [outTexture end]; + + // create blend functions + + ccBlendFunc blend1 = {GL_ONE, GL_ONE}; // inScene_ will lay on background and will not be used with alpha + ccBlendFunc blend2 = {GL_SRC_ALPHA, GL_ONE_MINUS_SRC_ALPHA}; // we are going to blend outScene_ via alpha + + // set blendfunctions + [inTexture.sprite setBlendFunc:blend1]; + [outTexture.sprite setBlendFunc:blend2]; + + // add render textures to the layer + [layer addChild:inTexture]; + [layer addChild:outTexture]; + + // initial opacity: + [inTexture.sprite setOpacity:255]; + [outTexture.sprite setOpacity:255]; + + // create the blend action + CCActionInterval * layerAction = [CCSequence actions: + [CCFadeTo actionWithDuration:duration_ opacity:0], + [CCCallFunc actionWithTarget:self selector:@selector(hideOutShowIn)], + [CCCallFunc actionWithTarget:self selector:@selector(finish)], + nil ]; + + + // run the blend action + [outTexture.sprite runAction: layerAction]; + + // add the layer (which contains our two rendertextures) to the scene + [self addChild: layer z:2 tag:kSceneFade]; +} + +// clean up on exit +-(void) onExit +{ + // remove our layer and release all containing objects + [self removeChildByTag:kSceneFade cleanup:NO]; + + [super onExit]; +} +@end + +// +// TurnOffTilesTransition +// +@implementation CCTransitionTurnOffTiles + +// override addScenes, and change the order +-(void) sceneOrder +{ + inSceneOnTop_ = NO; +} + +-(void) onEnter +{ + [super onEnter]; + CGSize s = [[CCDirector sharedDirector] winSize]; + float aspect = s.width / s.height; + int x = 12 * aspect; + int y = 12; + + id toff = [CCTurnOffTiles actionWithSize: ccg(x,y) duration:duration_]; + id action = [self easeActionWithAction:toff]; + [outScene_ runAction: [CCSequence actions: action, + [CCCallFunc actionWithTarget:self selector:@selector(finish)], + [CCStopGrid action], + nil] + ]; + +} +-(CCActionInterval*) easeActionWithAction:(CCActionInterval*)action +{ + return action; +// return [EaseIn actionWithAction:action rate:2.0f]; +} +@end + +#pragma mark Split Transitions + +// +// SplitCols Transition +// +@implementation CCTransitionSplitCols + +-(void) onEnter +{ + [super onEnter]; + + inScene_.visible = NO; + + id split = [self action]; + id seq = [CCSequence actions: + split, + [CCCallFunc actionWithTarget:self selector:@selector(hideOutShowIn)], + [split reverse], + nil + ]; + [self runAction: [CCSequence actions: + [self easeActionWithAction:seq], + [CCCallFunc actionWithTarget:self selector:@selector(finish)], + [CCStopGrid action], + nil] + ]; +} + +-(CCActionInterval*) action +{ + return [CCSplitCols actionWithCols:3 duration:duration_/2.0f]; +} + +-(CCActionInterval*) easeActionWithAction:(CCActionInterval*)action +{ + return [CCEaseInOut actionWithAction:action rate:3.0f]; +} +@end + +// +// SplitRows Transition +// +@implementation CCTransitionSplitRows +-(CCActionInterval*) action +{ + return [CCSplitRows actionWithRows:3 duration:duration_/2.0f]; +} +@end + + +#pragma mark Fade Grid Transitions + +// +// FadeTR Transition +// +@implementation CCTransitionFadeTR +-(void) sceneOrder +{ + inSceneOnTop_ = NO; +} + +-(void) onEnter +{ + [super onEnter]; + + CGSize s = [[CCDirector sharedDirector] winSize]; + float aspect = s.width / s.height; + int x = 12 * aspect; + int y = 12; + + id action = [self actionWithSize:ccg(x,y)]; + + [outScene_ runAction: [CCSequence actions: + [self easeActionWithAction:action], + [CCCallFunc actionWithTarget:self selector:@selector(finish)], + [CCStopGrid action], + nil] + ]; +} + +-(CCActionInterval*) actionWithSize: (ccGridSize) v +{ + return [CCFadeOutTRTiles actionWithSize:v duration:duration_]; +} + +-(CCActionInterval*) easeActionWithAction:(CCActionInterval*)action +{ + return action; +// return [EaseIn actionWithAction:action rate:2.0f]; +} +@end + +// +// FadeBL Transition +// +@implementation CCTransitionFadeBL +-(CCActionInterval*) actionWithSize: (ccGridSize) v +{ + return [CCFadeOutBLTiles actionWithSize:v duration:duration_]; +} +@end + +// +// FadeUp Transition +// +@implementation CCTransitionFadeUp +-(CCActionInterval*) actionWithSize: (ccGridSize) v +{ + return [CCFadeOutUpTiles actionWithSize:v duration:duration_]; +} +@end + +// +// FadeDown Transition +// +@implementation CCTransitionFadeDown +-(CCActionInterval*) actionWithSize: (ccGridSize) v +{ + return [CCFadeOutDownTiles actionWithSize:v duration:duration_]; +} +@end diff --git a/libs/cocos2d/CCTransitionPageTurn.h b/libs/cocos2d/CCTransitionPageTurn.h new file mode 100755 index 0000000..aacb7fc --- /dev/null +++ b/libs/cocos2d/CCTransitionPageTurn.h @@ -0,0 +1,60 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2009 Sindesso Pty Ltd http://www.sindesso.com/ + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + + +#import "CCTransition.h" + +/** CCTransitionPageTurn transition. + * A transition which peels back the bottom right hand corner of a scene + * to transition to the scene beneath it simulating a page turn + * + * This uses a 3DAction so it's strongly recommended that depth buffering + * is turned on in CCDirector using: + * + * [[CCDirector sharedDirector] setDepthBufferFormat:kCCDepthBuffer16]; + * + * @since v0.8.2 + */ +@interface CCTransitionPageTurn : CCTransitionScene +{ + BOOL back_; +} +/** + * creates a base transition with duration and incoming scene + * if back is TRUE then the effect is reversed to appear as if the incoming + * scene is being turned from left over the outgoing scene + */ ++(id) transitionWithDuration:(ccTime) t scene:(CCScene*)s backwards:(BOOL) back; + +/** + * creates a base transition with duration and incoming scene + * if back is TRUE then the effect is reversed to appear as if the incoming + * scene is being turned from left over the outgoing scene + */ +-(id) initWithDuration:(ccTime) t scene:(CCScene*)s backwards:(BOOL) back; + +-(CCActionInterval*) actionWithSize:(ccGridSize) vector; + +@end diff --git a/libs/cocos2d/CCTransitionPageTurn.m b/libs/cocos2d/CCTransitionPageTurn.m new file mode 100755 index 0000000..bff43a7 --- /dev/null +++ b/libs/cocos2d/CCTransitionPageTurn.m @@ -0,0 +1,117 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2009 Sindesso Pty Ltd http://www.sindesso.com/ + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + + +#import "CCTransitionPageTurn.h" +#import "CCActionPageTurn3D.h" +#import "CCDirector.h" + +@implementation CCTransitionPageTurn + +/** creates a base transition with duration and incoming scene */ ++(id) transitionWithDuration:(ccTime) t scene:(CCScene*)s backwards:(BOOL) back +{ + return [[[self alloc] initWithDuration:t scene:s backwards:back] autorelease]; +} + +/** initializes a transition with duration and incoming scene */ +-(id) initWithDuration:(ccTime) t scene:(CCScene*)s backwards:(BOOL) back +{ + // XXX: needed before [super init] + back_ = back; + + if( ( self = [super initWithDuration:t scene:s] ) ) + { + // do something + } + return self; +} + +-(void) sceneOrder +{ + inSceneOnTop_ = back_; +} + +// +-(void) onEnter +{ + [super onEnter]; + + CGSize s = [[CCDirector sharedDirector] winSize]; + int x, y; + if( s.width > s.height) + { + x = 16; + y = 12; + } + else + { + x = 12; + y = 16; + } + + id action = [self actionWithSize:ccg(x,y)]; + + if(! back_ ) + { + [outScene_ runAction: [CCSequence actions: + action, + [CCCallFunc actionWithTarget:self selector:@selector(finish)], + [CCStopGrid action], + nil] + ]; + } + else + { + // to prevent initial flicker + inScene_.visible = NO; + [inScene_ runAction: [CCSequence actions: + [CCShow action], + action, + [CCCallFunc actionWithTarget:self selector:@selector(finish)], + [CCStopGrid action], + nil] + ]; + } + +} + +-(CCActionInterval*) actionWithSize: (ccGridSize) v +{ + if( back_ ) + { + // Get hold of the PageTurn3DAction + return [CCReverseTime actionWithAction: + [CCPageTurn3D actionWithSize:v duration:duration_]]; + } + else + { + // Get hold of the PageTurn3DAction + return [CCPageTurn3D actionWithSize:v duration:duration_]; + } +} + +@end + diff --git a/libs/cocos2d/CCTransitionRadial.h b/libs/cocos2d/CCTransitionRadial.h new file mode 100755 index 0000000..6d4a5e0 --- /dev/null +++ b/libs/cocos2d/CCTransitionRadial.h @@ -0,0 +1,40 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2009 Lam Pham + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + +#import "CCTransition.h" +#import "CCProgressTimer.h" +#import "CCActionProgressTimer.h" + +/** CCTransitionRadialCCW transition. + A counter colock-wise radial transition to the next scene + */ +@interface CCTransitionRadialCCW : CCTransitionScene +@end + +/** CCTransitionRadialCW transition. + A counter colock-wise radial transition to the next scene +*/ +@interface CCTransitionRadialCW : CCTransitionRadialCCW +@end diff --git a/libs/cocos2d/CCTransitionRadial.m b/libs/cocos2d/CCTransitionRadial.m new file mode 100755 index 0000000..a892f35 --- /dev/null +++ b/libs/cocos2d/CCTransitionRadial.m @@ -0,0 +1,115 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2009 Lam Pham + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + + + +#import "CCDirector.h" +#import "CCTransitionRadial.h" +#import "CCRenderTexture.h" +#import "CCLayer.h" +#import "CCActionInstant.h" +#import "Support/CGPointExtension.h" + +enum { + kSceneRadial = 0xc001, +}; + +#pragma mark - +#pragma mark Transition Radial CCW + +@implementation CCTransitionRadialCCW +-(void) sceneOrder +{ + inSceneOnTop_ = NO; +} + +-(CCProgressTimerType) radialType +{ + return kCCProgressTimerTypeRadialCCW; +} + +-(void) onEnter +{ + [super onEnter]; + // create a transparent color layer + // in which we are going to add our rendertextures + CGSize size = [[CCDirector sharedDirector] winSize]; + + // create the second render texture for outScene + CCRenderTexture *outTexture = [CCRenderTexture renderTextureWithWidth:size.width height:size.height]; + outTexture.sprite.anchorPoint= ccp(0.5f,0.5f); + outTexture.position = ccp(size.width/2, size.height/2); + outTexture.anchorPoint = ccp(0.5f,0.5f); + + // render outScene to its texturebuffer + [outTexture clear:0 g:0 b:0 a:1]; + [outTexture begin]; + [outScene_ visit]; + [outTexture end]; + + // Since we've passed the outScene to the texture we don't need it. + [self hideOutShowIn]; + + // We need the texture in RenderTexture. + CCProgressTimer *outNode = [CCProgressTimer progressWithTexture:outTexture.sprite.texture]; + // but it's flipped upside down so we flip the sprite + outNode.sprite.flipY = YES; + // Return the radial type that we want to use + outNode.type = [self radialType]; + outNode.percentage = 100.f; + outNode.position = ccp(size.width/2, size.height/2); + outNode.anchorPoint = ccp(0.5f,0.5f); + + // create the blend action + CCActionInterval * layerAction = [CCSequence actions: + [CCProgressFromTo actionWithDuration:duration_ from:100.f to:0.f], + [CCCallFunc actionWithTarget:self selector:@selector(finish)], + nil ]; + // run the blend action + [outNode runAction: layerAction]; + + // add the layer (which contains our two rendertextures) to the scene + [self addChild: outNode z:2 tag:kSceneRadial]; +} + +// clean up on exit +-(void) onExit +{ + // remove our layer and release all containing objects + [self removeChildByTag:kSceneRadial cleanup:NO]; + [super onExit]; +} +@end + +#pragma mark - +#pragma mark Transition Radial CW + +@implementation CCTransitionRadialCW +-(CCProgressTimerType) radialType +{ + return kCCProgressTimerTypeRadialCW; +} +@end + diff --git a/libs/cocos2d/Platforms/CCGL.h b/libs/cocos2d/Platforms/CCGL.h new file mode 100755 index 0000000..0725f89 --- /dev/null +++ b/libs/cocos2d/Platforms/CCGL.h @@ -0,0 +1,83 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ + +// +// Common layer for OpenGL stuff +// + +#import + +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED +#import +#import +#import +#import "iOS/glu.h" +#import "iOS/EAGLView.h" + +#elif defined(__MAC_OS_X_VERSION_MAX_ALLOWED) +#import +#import +#import // needed for NSOpenGLView +#import "Mac/MacGLView.h" +#endif + + +// iOS +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED +#define CC_GLVIEW EAGLView +#define ccglOrtho glOrthof +#define ccglClearDepth glClearDepthf +#define ccglGenerateMipmap glGenerateMipmapOES +#define ccglGenFramebuffers glGenFramebuffersOES +#define ccglBindFramebuffer glBindFramebufferOES +#define ccglFramebufferTexture2D glFramebufferTexture2DOES +#define ccglDeleteFramebuffers glDeleteFramebuffersOES +#define ccglCheckFramebufferStatus glCheckFramebufferStatusOES +#define ccglTranslate glTranslatef + +#define CC_GL_FRAMEBUFFER GL_FRAMEBUFFER_OES +#define CC_GL_FRAMEBUFFER_BINDING GL_FRAMEBUFFER_BINDING_OES +#define CC_GL_COLOR_ATTACHMENT0 GL_COLOR_ATTACHMENT0_OES +#define CC_GL_FRAMEBUFFER_COMPLETE GL_FRAMEBUFFER_COMPLETE_OES + +// Mac +#elif defined(__MAC_OS_X_VERSION_MAX_ALLOWED) +#define CC_GLVIEW MacGLView +#define ccglOrtho glOrtho +#define ccglClearDepth glClearDepth +#define ccglGenerateMipmap glGenerateMipmap +#define ccglGenFramebuffers glGenFramebuffers +#define ccglBindFramebuffer glBindFramebuffer +#define ccglFramebufferTexture2D glFramebufferTexture2D +#define ccglDeleteFramebuffers glDeleteFramebuffers +#define ccglCheckFramebufferStatus glCheckFramebufferStatus +#define ccglTranslate glTranslated + +#define CC_GL_FRAMEBUFFER GL_FRAMEBUFFER +#define CC_GL_FRAMEBUFFER_BINDING GL_FRAMEBUFFER_BINDING +#define CC_GL_COLOR_ATTACHMENT0 GL_COLOR_ATTACHMENT0 +#define CC_GL_FRAMEBUFFER_COMPLETE GL_FRAMEBUFFER_COMPLETE + +#endif diff --git a/libs/cocos2d/Platforms/CCNS.h b/libs/cocos2d/Platforms/CCNS.h new file mode 100755 index 0000000..c595a18 --- /dev/null +++ b/libs/cocos2d/Platforms/CCNS.h @@ -0,0 +1,78 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ + +// +// Common layer for NS (Next-Step) stuff +// + +#import + +#import // for NSObject + +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED + +#define CCRectFromString(__r__) CGRectFromString(__r__) +#define CCPointFromString(__p__) CGPointFromString(__p__) +#define CCSizeFromString(__s__) CGSizeFromString(__s__) +#define CCNSSizeToCGSize +#define CCNSRectToCGRect +#define CCNSPointToCGPoint +#define CCTextAlignment UITextAlignment +#define CCTextAlignmentCenter UITextAlignmentCenter +#define CCTextAlignmentLeft UITextAlignmentLeft +#define CCTextAlignmentRight UITextAlignmentRight +#define CCLineBreakMode UILineBreakMode +#define CCLineBreakModeWordWrap UILineBreakModeWordWrap +#define CCLineBreakModeCharacterWrap UILineBreakModeCharacterWrap +#define CCLineBreakModeClip UILineBreakModeClip +#define CCLineBreakModeHeadTruncation UILineBreakModeHeadTruncation +#define CCLineBreakModeTailTruncation UILineBreakModeTailTruncation +#define CCLineBreakModeMiddleTruncation UILineBreakModeMiddleTruncation + + + +#elif defined(__MAC_OS_X_VERSION_MAX_ALLOWED) + +#define CCRectFromString(__r__) NSRectToCGRect( NSRectFromString(__r__) ) +#define CCPointFromString(__p__) NSPointToCGPoint( NSPointFromString(__p__) ) +#define CCSizeFromString(__s__) NSSizeToCGSize( NSSizeFromString(__s__) ) +#define CCNSSizeToCGSize NSSizeToCGSize +#define CCNSRectToCGRect NSRectToCGRect +#define CCNSPointToCGPoint NSPointToCGPoint +#define CCTextAlignment NSTextAlignment +#define CCTextAlignmentCenter NSCenterTextAlignment +#define CCTextAlignmentLeft NSLeftTextAlignment +#define CCTextAlignmentRight NSRightTextAlignment +#define CCLineBreakMode NSLineBreakMode +#define CCLineBreakModeWordWrap NSLineBreakByWordWrapping +#define CCLineBreakModeClip -1 +#define CCLineBreakModeHeadTruncation -1 +#define CCLineBreakModeTailTruncation -1 +#define CCLineBreakModeMiddleTruncation -1 + + +#endif + + diff --git a/libs/cocos2d/Platforms/Mac/CCDirectorMac.h b/libs/cocos2d/Platforms/Mac/CCDirectorMac.h new file mode 100755 index 0000000..0d623b4 --- /dev/null +++ b/libs/cocos2d/Platforms/Mac/CCDirectorMac.h @@ -0,0 +1,103 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ + + +// Only compile this code on Mac. These files should not be included on your iOS project. +// But in case they are included, it won't be compiled. +#import +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED +#elif defined(__MAC_OS_X_VERSION_MAX_ALLOWED) + +#import +#import "../../CCDirector.h" + +enum { + /// If the window is resized, it won't be autoscaled + kCCDirectorResize_NoScale, + /// If the window is resized, it will be autoscaled (default behavior) + kCCDirectorResize_AutoScale, +}; + +@interface CCDirector (MacExtension) +/** converts an NSEvent to GL coordinates */ +-(CGPoint) convertEventToGL:(NSEvent*)event; +@end + +/** Base class of Mac directors + @since v0.99.5 + */ +@interface CCDirectorMac : CCDirector +{ + BOOL isFullScreen_; + int resizeMode_; + CGPoint winOffset_; + CGSize originalWinSize_; + + NSWindow *fullScreenWindow_; + + // cache + NSWindow *windowGLView_; + NSView *superViewGLView_; + NSRect originalWinRect_; // Original size and position +} + +// whether or not the view is in fullscreen mode +@property (nonatomic, readonly) BOOL isFullScreen; + +// resize mode: with or without scaling +@property (nonatomic, readwrite) int resizeMode; + +@property (nonatomic, readwrite) CGSize originalWinSize; + +/** Sets the view in fullscreen or window mode */ +- (void) setFullScreen:(BOOL)fullscreen; + +/** Converts window size coordiantes to logical coordinates. + Useful only if resizeMode is kCCDirectorResize_Scale. + If resizeMode is kCCDirectorResize_NoScale, then no conversion will be done. +*/ +- (CGPoint) convertToLogicalCoordinates:(CGPoint)coordinates; +@end + + +/** DisplayLinkDirector is a Director that synchronizes timers with the refresh rate of the display. + * + * Features and Limitations: + * - Only available on 3.1+ + * - Scheduled timers & drawing are synchronizes with the refresh rate of the display + * - Only supports animation intervals of 1/60 1/30 & 1/15 + * + * It is the recommended Director if the SDK is 3.1 or newer + * + * @since v0.8.2 + */ +@interface CCDirectorDisplayLink : CCDirectorMac +{ + CVDisplayLinkRef displayLink; +} +@end + +#endif // __MAC_OS_X_VERSION_MAX_ALLOWED + diff --git a/libs/cocos2d/Platforms/Mac/CCDirectorMac.m b/libs/cocos2d/Platforms/Mac/CCDirectorMac.m new file mode 100755 index 0000000..477081e --- /dev/null +++ b/libs/cocos2d/Platforms/Mac/CCDirectorMac.m @@ -0,0 +1,479 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ + +// Only compile this code on Mac. These files should not be included on your iOS project. +// But in case they are included, it won't be compiled. +#import +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED +#elif defined(__MAC_OS_X_VERSION_MAX_ALLOWED) + +#import + +#import "CCDirectorMac.h" +#import "CCEventDispatcher.h" +#import "MacGLView.h" + +#import "../../CCNode.h" +#import "../../CCScheduler.h" +#import "../../ccMacros.h" + +#pragma mark - +#pragma mark Director Mac extensions + + +@interface CCDirector () +-(void) setNextScene; +-(void) showFPS; +-(void) calculateDeltaTime; +@end + +@implementation CCDirector (MacExtension) +-(CGPoint) convertEventToGL:(NSEvent*)event +{ + NSPoint point = [openGLView_ convertPoint:[event locationInWindow] fromView:nil]; + CGPoint p = NSPointToCGPoint(point); + + return [(CCDirectorMac*)self convertToLogicalCoordinates:p]; +} + +@end + +#pragma mark - +#pragma mark Director Mac + +@implementation CCDirectorMac + +@synthesize isFullScreen = isFullScreen_; +@synthesize originalWinSize = originalWinSize_; + +-(id) init +{ + if( (self = [super init]) ) { + isFullScreen_ = NO; + resizeMode_ = kCCDirectorResize_AutoScale; + + originalWinSize_ = CGSizeZero; + fullScreenWindow_ = nil; + windowGLView_ = nil; + winOffset_ = CGPointZero; + } + + return self; +} + +- (void) dealloc +{ + [superViewGLView_ release]; + [fullScreenWindow_ release]; + [windowGLView_ release]; + [super dealloc]; +} + +// +// setFullScreen code taken from GLFullScreen example by Apple +// +- (void) setFullScreen:(BOOL)fullscreen +{ + // Mac OS X 10.6 and later offer a simplified mechanism to create full-screen contexts +#if MAC_OS_X_VERSION_MIN_REQUIRED > MAC_OS_X_VERSION_10_5 + + if (isFullScreen_ == fullscreen) return; + + if( fullscreen ) { + originalWinRect_ = [openGLView_ frame]; + + // Cache normal window and superview of openGLView + if(!windowGLView_) + windowGLView_ = [[openGLView_ window] retain]; + + [superViewGLView_ release]; + superViewGLView_ = [[openGLView_ superview] retain]; + + + // Get screen size + NSRect displayRect = [[NSScreen mainScreen] frame]; + + // Create a screen-sized window on the display you want to take over + fullScreenWindow_ = [[MacWindow alloc] initWithFrame:displayRect fullscreen:YES]; + + // Remove glView from window + [openGLView_ removeFromSuperview]; + + // Set new frame + [openGLView_ setFrame:displayRect]; + + // Attach glView to fullscreen window + [fullScreenWindow_ setContentView:openGLView_]; + + // Show the fullscreen window + [fullScreenWindow_ makeKeyAndOrderFront:self]; + [fullScreenWindow_ makeMainWindow]; + + } else { + + // Remove glView from fullscreen window + [openGLView_ removeFromSuperview]; + + // Release fullscreen window + [fullScreenWindow_ release]; + fullScreenWindow_ = nil; + + // Attach glView to superview + [superViewGLView_ addSubview:openGLView_]; + + // Set new frame + [openGLView_ setFrame:originalWinRect_]; + + // Show the window + [windowGLView_ makeKeyAndOrderFront:self]; + [windowGLView_ makeMainWindow]; + } + isFullScreen_ = fullscreen; + + [openGLView_ retain]; // Retain +1 + + // re-configure glView + [self setOpenGLView:openGLView_]; + + [openGLView_ release]; // Retain -1 + + [openGLView_ setNeedsDisplay:YES]; +#else +#error Full screen is not supported for Mac OS 10.5 or older yet +#error If you don't want FullScreen support, you can safely remove these 2 lines +#endif +} + +-(void) setOpenGLView:(MacGLView *)view +{ + [super setOpenGLView:view]; + + // cache the NSWindow and NSOpenGLView created from the NIB + if( !isFullScreen_ && CGSizeEqualToSize(originalWinSize_, CGSizeZero)) + { + originalWinSize_ = winSizeInPixels_; + } +} + +-(int) resizeMode +{ + return resizeMode_; +} + +-(void) setResizeMode:(int)mode +{ + if( mode != resizeMode_ ) { + + resizeMode_ = mode; + + [self setProjection:projection_]; + [openGLView_ setNeedsDisplay: YES]; + } +} + +-(void) setProjection:(ccDirectorProjection)projection +{ + CGSize size = winSizeInPixels_; + + CGPoint offset = CGPointZero; + float widthAspect = size.width; + float heightAspect = size.height; + + + if( resizeMode_ == kCCDirectorResize_AutoScale && ! CGSizeEqualToSize(originalWinSize_, CGSizeZero ) ) { + + size = originalWinSize_; + + float aspect = originalWinSize_.width / originalWinSize_.height; + widthAspect = winSizeInPixels_.width; + heightAspect = winSizeInPixels_.width / aspect; + + if( heightAspect > winSizeInPixels_.height ) { + widthAspect = winSizeInPixels_.height * aspect; + heightAspect = winSizeInPixels_.height; + } + + winOffset_.x = (winSizeInPixels_.width - widthAspect) / 2; + winOffset_.y = (winSizeInPixels_.height - heightAspect) / 2; + + offset = winOffset_; + + } + + switch (projection) { + case kCCDirectorProjection2D: + glViewport(offset.x, offset.y, widthAspect, heightAspect); + glMatrixMode(GL_PROJECTION); + glLoadIdentity(); + ccglOrtho(0, size.width, 0, size.height, -1024, 1024); + glMatrixMode(GL_MODELVIEW); + glLoadIdentity(); + break; + + case kCCDirectorProjection3D: + glViewport(offset.x, offset.y, widthAspect, heightAspect); + glMatrixMode(GL_PROJECTION); + glLoadIdentity(); + gluPerspective(60, (GLfloat)widthAspect/heightAspect, 0.1f, 1500.0f); + + glMatrixMode(GL_MODELVIEW); + glLoadIdentity(); + + float eyeZ = size.height * [self getZEye] / winSizeInPixels_.height; + + gluLookAt( size.width/2, size.height/2, eyeZ, + size.width/2, size.height/2, 0, + 0.0f, 1.0f, 0.0f); + break; + + case kCCDirectorProjectionCustom: + if( projectionDelegate_ ) + [projectionDelegate_ updateProjection]; + break; + + default: + CCLOG(@"cocos2d: Director: unrecognized projecgtion"); + break; + } + + projection_ = projection; +} + +// If scaling is supported, then it should always return the original size +// otherwise it should return the "real" size. +-(CGSize) winSize +{ + if( resizeMode_ == kCCDirectorResize_AutoScale ) + return originalWinSize_; + + return winSizeInPixels_; +} + +-(CGSize) winSizeInPixels +{ + return [self winSize]; +} + +- (CGPoint) convertToLogicalCoordinates:(CGPoint)coords +{ + CGPoint ret; + + if( resizeMode_ == kCCDirectorResize_NoScale ) + ret = coords; + + else { + + float x_diff = originalWinSize_.width / (winSizeInPixels_.width - winOffset_.x * 2); + float y_diff = originalWinSize_.height / (winSizeInPixels_.height - winOffset_.y * 2); + + float adjust_x = (winSizeInPixels_.width * x_diff - originalWinSize_.width ) / 2; + float adjust_y = (winSizeInPixels_.height * y_diff - originalWinSize_.height ) / 2; + + ret = CGPointMake( (x_diff * coords.x) - adjust_x, ( y_diff * coords.y ) - adjust_y ); + } + + return ret; +} +@end + + +#pragma mark - +#pragma mark DirectorDisplayLink + + +@implementation CCDirectorDisplayLink + +- (CVReturn) getFrameForTime:(const CVTimeStamp*)outputTime +{ +#if CC_DIRECTOR_MAC_USE_DISPLAY_LINK_THREAD + if( ! runningThread_ ) + runningThread_ = [NSThread currentThread]; + + NSAutoreleasePool *pool = [[NSAutoreleasePool alloc] init]; + + [self drawScene]; + [[CCEventDispatcher sharedDispatcher] dispatchQueuedEvents]; + + [[NSRunLoop currentRunLoop] runMode:NSDefaultRunLoopMode beforeDate:nil]; + + [pool release]; + +#else + [self performSelector:@selector(drawScene) onThread:runningThread_ withObject:nil waitUntilDone:YES]; +#endif + + return kCVReturnSuccess; +} + +// This is the renderer output callback function +static CVReturn MyDisplayLinkCallback(CVDisplayLinkRef displayLink, const CVTimeStamp* now, const CVTimeStamp* outputTime, CVOptionFlags flagsIn, CVOptionFlags* flagsOut, void* displayLinkContext) +{ + CVReturn result = [(CCDirectorDisplayLink*)displayLinkContext getFrameForTime:outputTime]; + return result; +} + +- (void) startAnimation +{ +#if ! CC_DIRECTOR_MAC_USE_DISPLAY_LINK_THREAD + runningThread_ = [[NSThread alloc] initWithTarget:self selector:@selector(mainLoop) object:nil]; + [runningThread_ start]; +#endif + + gettimeofday( &lastUpdate_, NULL); + + // Create a display link capable of being used with all active displays + CVDisplayLinkCreateWithActiveCGDisplays(&displayLink); + + // Set the renderer output callback function + CVDisplayLinkSetOutputCallback(displayLink, &MyDisplayLinkCallback, self); + + // Set the display link for the current renderer + CGLContextObj cglContext = [[openGLView_ openGLContext] CGLContextObj]; + CGLPixelFormatObj cglPixelFormat = [[openGLView_ pixelFormat] CGLPixelFormatObj]; + CVDisplayLinkSetCurrentCGDisplayFromOpenGLContext(displayLink, cglContext, cglPixelFormat); + + // Activate the display link + CVDisplayLinkStart(displayLink); +} + +- (void) stopAnimation +{ + if( displayLink ) { + CVDisplayLinkStop(displayLink); + CVDisplayLinkRelease(displayLink); + displayLink = NULL; + +#if ! CC_DIRECTOR_MAC_USE_DISPLAY_LINK_THREAD + [runningThread_ cancel]; + [runningThread_ release]; + runningThread_ = nil; +#endif + } +} + +-(void) dealloc +{ + if( displayLink ) { + CVDisplayLinkStop(displayLink); + CVDisplayLinkRelease(displayLink); + } + [super dealloc]; +} + +// +// Mac Director has its own thread +// +-(void) mainLoop +{ + while( ![[NSThread currentThread] isCancelled] ) { + // There is no autorelease pool when this method is called because it will be called from a background thread + // It's important to create one or you will leak objects + NSAutoreleasePool *pool = [[NSAutoreleasePool alloc] init]; + + [[NSRunLoop currentRunLoop] run]; + + [pool release]; + } +} + +// +// Draw the Scene +// +- (void) drawScene +{ + // We draw on a secondary thread through the display link + // When resizing the view, -reshape is called automatically on the main thread + // Add a mutex around to avoid the threads accessing the context simultaneously when resizing + CGLLockContext([[openGLView_ openGLContext] CGLContextObj]); + [[openGLView_ openGLContext] makeCurrentContext]; + + /* calculate "global" dt */ + [self calculateDeltaTime]; + + /* tick before glClear: issue #533 */ + if( ! isPaused_ ) { + [[CCScheduler sharedScheduler] tick: dt]; + } + + glClear(GL_COLOR_BUFFER_BIT | GL_DEPTH_BUFFER_BIT); + + /* to avoid flickr, nextScene MUST be here: after tick and before draw. + XXX: Which bug is this one. It seems that it can't be reproduced with v0.9 */ + if( nextScene_ ) + [self setNextScene]; + + glPushMatrix(); + + + // By default enable VertexArray, ColorArray, TextureCoordArray and Texture2D + CC_ENABLE_DEFAULT_GL_STATES(); + + /* draw the scene */ + [runningScene_ visit]; + + /* draw the notification node */ + [notificationNode_ visit]; + + if( displayFPS_ ) + [self showFPS]; + +#if CC_ENABLE_PROFILERS + [self showProfilers]; +#endif + + CC_DISABLE_DEFAULT_GL_STATES(); + + glPopMatrix(); + + [[openGLView_ openGLContext] flushBuffer]; + CGLUnlockContext([[openGLView_ openGLContext] CGLContextObj]); +} + +// set the event dispatcher +-(void) setOpenGLView:(MacGLView *)view +{ + if( view != openGLView_ ) { + + [super setOpenGLView:view]; + + CCEventDispatcher *eventDispatcher = [CCEventDispatcher sharedDispatcher]; + [openGLView_ setEventDelegate: eventDispatcher]; + [eventDispatcher setDispatchEvents: YES]; + + // Enable Touches. Default no. + [view setAcceptsTouchEvents:NO]; +// [view setAcceptsTouchEvents:YES]; + + + // Synchronize buffer swaps with vertical refresh rate + [[view openGLContext] makeCurrentContext]; + GLint swapInt = 1; + [[view openGLContext] setValues:&swapInt forParameter:NSOpenGLCPSwapInterval]; + } +} + +@end + +#endif // __MAC_OS_X_VERSION_MAX_ALLOWED diff --git a/libs/cocos2d/Platforms/Mac/CCEventDispatcher.h b/libs/cocos2d/Platforms/Mac/CCEventDispatcher.h new file mode 100755 index 0000000..06889e8 --- /dev/null +++ b/libs/cocos2d/Platforms/Mac/CCEventDispatcher.h @@ -0,0 +1,277 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ + +// Only compile this code on Mac. These files should not be included on your iOS project. +// But in case they are included, it won't be compiled. +#import +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED +#elif defined(__MAC_OS_X_VERSION_MAX_ALLOWED) + +#import + +#import "MacGLView.h" +#import "../../Support/uthash.h" // hack: uthash needs to be imported before utlist to prevent warning +#import "../../Support/utlist.h" +#import "../../ccConfig.h" + +#pragma mark - +#pragma mark CCMouseEventDelegate + +/** CCMouseEventDelegate protocol. + Implement it in your node to receive any of mouse events + */ +@protocol CCMouseEventDelegate +@optional + +// +// left +// +/** called when the "mouseDown" event is received. + Return YES to avoid propagating the event to other delegates. + */ +-(BOOL) ccMouseDown:(NSEvent*)event; + +/** called when the "mouseDragged" event is received. + Return YES to avoid propagating the event to other delegates. + */ +-(BOOL) ccMouseDragged:(NSEvent*)event; + +/** called when the "mouseMoved" event is received. + Return YES to avoid propagating the event to other delegates. + By default, "mouseMoved" is disabled. To enable it, send the "setAcceptsMouseMovedEvents:YES" message to the main window. + */ +-(BOOL) ccMouseMoved:(NSEvent*)event; + +/** called when the "mouseUp" event is received. + Return YES to avoid propagating the event to other delegates. + */ +-(BOOL) ccMouseUp:(NSEvent*)event; + + +// +// right +// + +/** called when the "rightMouseDown" event is received. + Return YES to avoid propagating the event to other delegates. + */ +-(BOOL) ccRightMouseDown:(NSEvent*)event; + +/** called when the "rightMouseDragged" event is received. + Return YES to avoid propagating the event to other delegates. + */ +-(BOOL) ccRightMouseDragged:(NSEvent*)event; + +/** called when the "rightMouseUp" event is received. + Return YES to avoid propagating the event to other delegates. + */ +-(BOOL) ccRightMouseUp:(NSEvent*)event; + +// +// other +// + +/** called when the "otherMouseDown" event is received. + Return YES to avoid propagating the event to other delegates. + */ +-(BOOL) ccOtherMouseDown:(NSEvent*)event; + +/** called when the "otherMouseDragged" event is received. + Return YES to avoid propagating the event to other delegates. + */ +-(BOOL) ccOtherMouseDragged:(NSEvent*)event; + +/** called when the "otherMouseUp" event is received. + Return YES to avoid propagating the event to other delegates. + */ +-(BOOL) ccOtherMouseUp:(NSEvent*)event; + +// +// scroll wheel +// + +/** called when the "scrollWheel" event is received. + Return YES to avoid propagating the event to other delegates. + */ +- (BOOL)ccScrollWheel:(NSEvent *)theEvent; + + +// +// enter / exit +// + +/** called when the "mouseEntered" event is received. + Return YES to avoid propagating the event to other delegates. + */ +- (void)ccMouseEntered:(NSEvent *)theEvent; + +/** called when the "mouseExited" event is received. + Return YES to avoid propagating the event to other delegates. + */ +- (void)ccMouseExited:(NSEvent *)theEvent; + +@end + +#pragma mark - +#pragma mark CCKeyboardEventDelegate + +/** CCKeyboardEventDelegate protocol. + Implement it in your node to receive any of keyboard events + */ +@protocol CCKeyboardEventDelegate +@optional +/** called when the "keyUp" event is received. + Return YES to avoid propagating the event to other delegates. + */ +-(BOOL) ccKeyUp:(NSEvent*)event; + +/** called when the "keyDown" event is received. + Return YES to avoid propagating the event to other delegates. + */ +-(BOOL) ccKeyDown:(NSEvent*)event; +/** called when the "flagsChanged" event is received. + Return YES to avoid propagating the event to other delegates. + */ +-(BOOL) ccFlagsChanged:(NSEvent*)event; +@end + +#pragma mark - +#pragma mark CCTouchEventDelegate + +/** CCTouchEventDelegate protocol. + Implement it in your node to receive any of touch events + */ +@protocol CCTouchEventDelegate +@optional +/** called when the "touchesBegan" event is received. + Return YES to avoid propagating the event to other delegates. + */ +- (BOOL)ccTouchesBeganWithEvent:(NSEvent *)event; + +/** called when the "touchesMoved" event is received. + Return YES to avoid propagating the event to other delegates. + */ +- (BOOL)ccTouchesMovedWithEvent:(NSEvent *)event; + +/** called when the "touchesEnded" event is received. + Return YES to avoid propagating the event to other delegates. + */ +- (BOOL)ccTouchesEndedWithEvent:(NSEvent *)event; + +/** called when the "touchesCancelled" event is received. + Return YES to avoid propagating the event to other delegates. + */ +- (BOOL)ccTouchesCancelledWithEvent:(NSEvent *)event; + +@end + + +#pragma mark - +#pragma mark CCEventDispatcher + +struct _listEntry; + +/** CCEventDispatcher + + This is object is responsible for dispatching the events: + - Mouse events + - Keyboard events + - Touch events + + Only available on Mac + */ +@interface CCEventDispatcher : NSObject { + + BOOL dispatchEvents_; + + struct _listEntry *keyboardDelegates_; + struct _listEntry *mouseDelegates_; + struct _listEntry *touchDelegates_; +} + +@property (nonatomic, readwrite) BOOL dispatchEvents; + + +/** CCEventDispatcher singleton */ ++(CCEventDispatcher*) sharedDispatcher; + +#pragma mark CCEventDispatcher - Mouse + +/** Adds a mouse delegate to the dispatcher's list. + Delegates with a lower priority value will be called before higher priority values. + All the events will be propgated to all the delegates, unless the one delegate returns YES. + + IMPORTANT: The delegate will be retained. + */ +-(void) addMouseDelegate:(id) delegate priority:(NSInteger)priority; + +/** removes a mouse delegate */ +-(void) removeMouseDelegate:(id) delegate; + +/** Removes all mouse delegates, releasing all the delegates */ +-(void) removeAllMouseDelegates; + +#pragma mark CCEventDispatcher - Keyboard + +/** Adds a Keyboard delegate to the dispatcher's list. + Delegates with a lower priority value will be called before higher priority values. + All the events will be propgated to all the delegates, unless the one delegate returns YES. + + IMPORTANT: The delegate will be retained. + */ +-(void) addKeyboardDelegate:(id) delegate priority:(NSInteger)priority; + +/** removes a mouse delegate */ +-(void) removeKeyboardDelegate:(id) delegate; + +/** Removes all mouse delegates, releasing all the delegates */ +-(void) removeAllKeyboardDelegates; + +#pragma mark CCEventDispatcher - Touches + +/** Adds a Touch delegate to the dispatcher's list. + Delegates with a lower priority value will be called before higher priority values. + All the events will be propgated to all the delegates, unless the one delegate returns YES. + + IMPORTANT: The delegate will be retained. + */ +- (void)addTouchDelegate:(id)delegate priority:(NSInteger)priority; + +/** Removes a touch delegate */ +- (void)removeTouchDelegate:(id) delegate; + +/** Removes all touch delegates, releasing all the delegates */ +- (void)removeAllTouchDelegates; + +#pragma mark CCEventDispatcher - Dispatch Events + +#if CC_DIRECTOR_MAC_USE_DISPLAY_LINK_THREAD +-(void) dispatchQueuedEvents; +#endif + +@end + + +#endif // __MAC_OS_X_VERSION_MAX_ALLOWED diff --git a/libs/cocos2d/Platforms/Mac/CCEventDispatcher.m b/libs/cocos2d/Platforms/Mac/CCEventDispatcher.m new file mode 100755 index 0000000..1d1740e --- /dev/null +++ b/libs/cocos2d/Platforms/Mac/CCEventDispatcher.m @@ -0,0 +1,645 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ + +// Only compile this code on Mac. These files should not be included on your iOS project. +// But in case they are included, it won't be compiled. +#import +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED +#elif defined(__MAC_OS_X_VERSION_MAX_ALLOWED) + +#import "CCEventDispatcher.h" +#import "../../ccConfig.h" + +static CCEventDispatcher *sharedDispatcher = nil; + +enum { + // mouse + kCCImplementsMouseDown = 1 << 0, + kCCImplementsMouseMoved = 1 << 1, + kCCImplementsMouseDragged = 1 << 2, + kCCImplementsMouseUp = 1 << 3, + kCCImplementsRightMouseDown = 1 << 4, + kCCImplementsRightMouseDragged = 1 << 5, + kCCImplementsRightMouseUp = 1 << 6, + kCCImplementsOtherMouseDown = 1 << 7, + kCCImplementsOtherMouseDragged = 1 << 8, + kCCImplementsOtherMouseUp = 1 << 9, + kCCImplementsScrollWheel = 1 << 10, + kCCImplementsMouseEntered = 1 << 11, + kCCImplementsMouseExited = 1 << 12, + + kCCImplementsTouchesBegan = 1 << 13, + kCCImplementsTouchesMoved = 1 << 14, + kCCImplementsTouchesEnded = 1 << 15, + kCCImplementsTouchesCancelled = 1 << 16, + + // keyboard + kCCImplementsKeyUp = 1 << 0, + kCCImplementsKeyDown = 1 << 1, + kCCImplementsFlagsChanged = 1 << 2, +}; + + +typedef struct _listEntry +{ + struct _listEntry *prev, *next; + id delegate; + NSInteger priority; + NSUInteger flags; +} tListEntry; + + +#if CC_DIRECTOR_MAC_USE_DISPLAY_LINK_THREAD + +#define QUEUE_EVENT_MAX 128 +struct _eventQueue { + SEL selector; + NSEvent *event; +}; + +static struct _eventQueue eventQueue[QUEUE_EVENT_MAX]; +static int eventQueueCount; + +#endif // CC_DIRECTOR_MAC_USE_DISPLAY_LINK_THREAD + + +@implementation CCEventDispatcher + +@synthesize dispatchEvents=dispatchEvents_; + + ++(CCEventDispatcher*) sharedDispatcher +{ + @synchronized(self) { + if (sharedDispatcher == nil) + sharedDispatcher = [[self alloc] init]; // assignment not done here + } + return sharedDispatcher; +} + ++(id) allocWithZone:(NSZone *)zone +{ + @synchronized(self) { + NSAssert(sharedDispatcher == nil, @"Attempted to allocate a second instance of a singleton."); + return [super allocWithZone:zone]; + } + return nil; // on subsequent allocation attempts return nil +} + +-(id) init +{ + if( (self = [super init]) ) + { + // events enabled by default + dispatchEvents_ = YES; + + // delegates + keyboardDelegates_ = NULL; + mouseDelegates_ = NULL; + touchDelegates_ = NULL; + +#if CC_DIRECTOR_MAC_USE_DISPLAY_LINK_THREAD + eventQueueCount = 0; +#endif + } + + return self; +} + +- (void) dealloc +{ + [super dealloc]; +} + +#pragma mark CCEventDispatcher - add / remove delegates + +-(void) addDelegate:(id)delegate priority:(NSInteger)priority flags:(NSUInteger)flags list:(tListEntry**)list +{ + tListEntry *listElement = malloc( sizeof(*listElement) ); + + listElement->delegate = [delegate retain]; + listElement->priority = priority; + listElement->flags = flags; + listElement->next = listElement->prev = NULL; + + // empty list ? + if( ! *list ) { + DL_APPEND( *list, listElement ); + + } else { + BOOL added = NO; + + for( tListEntry *elem = *list; elem ; elem = elem->next ) { + if( priority < elem->priority ) { + + if( elem == *list ) + DL_PREPEND(*list, listElement); + else { + listElement->next = elem; + listElement->prev = elem->prev; + + elem->prev->next = listElement; + elem->prev = listElement; + } + + added = YES; + break; + } + } + + // Not added? priority has the higher value. Append it. + if( !added ) + DL_APPEND(*list, listElement); + } +} + +-(void) removeDelegate:(id)delegate fromList:(tListEntry**)list +{ + tListEntry *entry, *tmp; + + // updates with priority < 0 + DL_FOREACH_SAFE( *list, entry, tmp ) { + if( entry->delegate == delegate ) { + DL_DELETE( *list, entry ); + [delegate release]; + free(entry); + break; + } + } +} + +-(void) removeAllDelegatesFromList:(tListEntry**)list +{ + tListEntry *entry, *tmp; + + DL_FOREACH_SAFE( *list, entry, tmp ) { + DL_DELETE( *list, entry ); + free(entry); + } +} + + +-(void) addMouseDelegate:(id) delegate priority:(NSInteger)priority +{ + NSUInteger flags = 0; + + flags |= ( [delegate respondsToSelector:@selector(ccMouseDown:)] ? kCCImplementsMouseDown : 0 ); + flags |= ( [delegate respondsToSelector:@selector(ccMouseDragged:)] ? kCCImplementsMouseDragged : 0 ); + flags |= ( [delegate respondsToSelector:@selector(ccMouseMoved:)] ? kCCImplementsMouseMoved : 0 ); + flags |= ( [delegate respondsToSelector:@selector(ccMouseUp:)] ? kCCImplementsMouseUp : 0 ); + + flags |= ( [delegate respondsToSelector:@selector(ccRightMouseDown:)] ? kCCImplementsRightMouseDown : 0 ); + flags |= ( [delegate respondsToSelector:@selector(ccRightMouseDragged:)] ? kCCImplementsRightMouseDragged : 0 ); + flags |= ( [delegate respondsToSelector:@selector(ccRightMouseUp:)] ? kCCImplementsRightMouseUp : 0 ); + + flags |= ( [delegate respondsToSelector:@selector(ccOtherMouseDown:)] ? kCCImplementsOtherMouseDown : 0 ); + flags |= ( [delegate respondsToSelector:@selector(ccOtherMouseDragged:)] ? kCCImplementsOtherMouseDragged : 0 ); + flags |= ( [delegate respondsToSelector:@selector(ccOtherMouseUp:)] ? kCCImplementsOtherMouseUp : 0 ); + + flags |= ( [delegate respondsToSelector:@selector(ccMouseEntered:)] ? kCCImplementsMouseEntered : 0 ); + flags |= ( [delegate respondsToSelector:@selector(ccMouseExited:)] ? kCCImplementsMouseExited : 0 ); + + flags |= ( [delegate respondsToSelector:@selector(ccScrollWheel:)] ? kCCImplementsScrollWheel : 0 ); + + [self addDelegate:delegate priority:priority flags:flags list:&mouseDelegates_]; +} + +-(void) removeMouseDelegate:(id) delegate +{ + [self removeDelegate:delegate fromList:&mouseDelegates_]; +} + +-(void) removeAllMouseDelegates +{ + [self removeAllDelegatesFromList:&mouseDelegates_]; +} + +-(void) addKeyboardDelegate:(id) delegate priority:(NSInteger)priority +{ + NSUInteger flags = 0; + + flags |= ( [delegate respondsToSelector:@selector(ccKeyUp:)] ? kCCImplementsKeyUp : 0 ); + flags |= ( [delegate respondsToSelector:@selector(ccKeyDown:)] ? kCCImplementsKeyDown : 0 ); + flags |= ( [delegate respondsToSelector:@selector(ccFlagsChanged:)] ? kCCImplementsFlagsChanged : 0 ); + + [self addDelegate:delegate priority:priority flags:flags list:&keyboardDelegates_]; +} + +-(void) removeKeyboardDelegate:(id) delegate +{ + [self removeDelegate:delegate fromList:&keyboardDelegates_]; +} + +-(void) removeAllKeyboardDelegates +{ + [self removeAllDelegatesFromList:&keyboardDelegates_]; +} + +-(void) addTouchDelegate:(id) delegate priority:(NSInteger)priority +{ + NSUInteger flags = 0; + + flags |= ( [delegate respondsToSelector:@selector(ccTouchesBeganWithEvent:)] ? kCCImplementsTouchesBegan : 0 ); + flags |= ( [delegate respondsToSelector:@selector(ccTouchesMovedWithEvent:)] ? kCCImplementsTouchesMoved : 0 ); + flags |= ( [delegate respondsToSelector:@selector(ccTouchesEndedWithEvent:)] ? kCCImplementsTouchesEnded : 0 ); + flags |= ( [delegate respondsToSelector:@selector(ccTouchesCancelledWithEvent:)] ? kCCImplementsTouchesCancelled : 0 ); + + [self addDelegate:delegate priority:priority flags:flags list:&touchDelegates_]; +} + +-(void) removeTouchDelegate:(id) delegate +{ + [self removeDelegate:delegate fromList:&touchDelegates_]; +} + +-(void) removeAllTouchDelegates +{ + [self removeAllDelegatesFromList:&touchDelegates_]; +} + + +#pragma mark CCEventDispatcher - Mouse events +// +// Mouse events +// + +// +// Left +// +- (void)mouseDown:(NSEvent *)event +{ + if( dispatchEvents_ ) { + tListEntry *entry, *tmp; + + DL_FOREACH_SAFE( mouseDelegates_, entry, tmp ) { + if ( entry->flags & kCCImplementsMouseDown ) { + void *swallows = [entry->delegate performSelector:@selector(ccMouseDown:) withObject:event]; + if( swallows ) + break; + } + } + } +} + +- (void)mouseMoved:(NSEvent *)event +{ + if( dispatchEvents_ ) { + tListEntry *entry, *tmp; + + DL_FOREACH_SAFE( mouseDelegates_, entry, tmp ) { + if ( entry->flags & kCCImplementsMouseMoved ) { + void *swallows = [entry->delegate performSelector:@selector(ccMouseMoved:) withObject:event]; + if( swallows ) + break; + } + } + } +} + +- (void)mouseDragged:(NSEvent *)event +{ + if( dispatchEvents_ ) { + tListEntry *entry, *tmp; + + DL_FOREACH_SAFE( mouseDelegates_, entry, tmp ) { + if ( entry->flags & kCCImplementsMouseDragged ) { + void *swallows = [entry->delegate performSelector:@selector(ccMouseDragged:) withObject:event]; + if( swallows ) + break; + } + } + } +} + +- (void)mouseUp:(NSEvent *)event +{ + if( dispatchEvents_ ) { + tListEntry *entry, *tmp; + + DL_FOREACH_SAFE( mouseDelegates_, entry, tmp ) { + if ( entry->flags & kCCImplementsMouseUp ) { + void *swallows = [entry->delegate performSelector:@selector(ccMouseUp:) withObject:event]; + if( swallows ) + break; + } + } + } +} + +// +// Mouse Right +// +- (void)rightMouseDown:(NSEvent *)event +{ + if( dispatchEvents_ ) { + tListEntry *entry, *tmp; + + DL_FOREACH_SAFE( mouseDelegates_, entry, tmp ) { + if ( entry->flags & kCCImplementsRightMouseDown ) { + void *swallows = [entry->delegate performSelector:@selector(ccRightMouseDown:) withObject:event]; + if( swallows ) + break; + } + } + } +} + +- (void)rightMouseDragged:(NSEvent *)event +{ + if( dispatchEvents_ ) { + tListEntry *entry, *tmp; + + DL_FOREACH_SAFE( mouseDelegates_, entry, tmp ) { + if ( entry->flags & kCCImplementsRightMouseDragged ) { + void *swallows = [entry->delegate performSelector:@selector(ccRightMouseDragged:) withObject:event]; + if( swallows ) + break; + } + } + } +} + +- (void)rightMouseUp:(NSEvent *)event +{ + if( dispatchEvents_ ) { + tListEntry *entry, *tmp; + + DL_FOREACH_SAFE( mouseDelegates_, entry, tmp ) { + if ( entry->flags & kCCImplementsRightMouseUp ) { + void *swallows = [entry->delegate performSelector:@selector(ccRightMouseUp:) withObject:event]; + if( swallows ) + break; + } + } + } +} + +// +// Mouse Other +// +- (void)otherMouseDown:(NSEvent *)event +{ + if( dispatchEvents_ ) { + tListEntry *entry, *tmp; + + DL_FOREACH_SAFE( mouseDelegates_, entry, tmp ) { + if ( entry->flags & kCCImplementsOtherMouseDown ) { + void *swallows = [entry->delegate performSelector:@selector(ccOtherMouseDown:) withObject:event]; + if( swallows ) + break; + } + } + } +} + +- (void)otherMouseDragged:(NSEvent *)event +{ + if( dispatchEvents_ ) { + tListEntry *entry, *tmp; + + DL_FOREACH_SAFE( mouseDelegates_, entry, tmp ) { + if ( entry->flags & kCCImplementsOtherMouseDragged ) { + void *swallows = [entry->delegate performSelector:@selector(ccOtherMouseDragged:) withObject:event]; + if( swallows ) + break; + } + } + } +} + +- (void)otherMouseUp:(NSEvent *)event +{ + if( dispatchEvents_ ) { + tListEntry *entry, *tmp; + + DL_FOREACH_SAFE( mouseDelegates_, entry, tmp ) { + if ( entry->flags & kCCImplementsOtherMouseUp ) { + void *swallows = [entry->delegate performSelector:@selector(ccOtherMouseUp:) withObject:event]; + if( swallows ) + break; + } + } + } +} + +// +// Scroll Wheel +// +- (void)scrollWheel:(NSEvent *)event +{ + if( dispatchEvents_ ) { + tListEntry *entry, *tmp; + + DL_FOREACH_SAFE( mouseDelegates_, entry, tmp ) { + if ( entry->flags & kCCImplementsScrollWheel ) { + void *swallows = [entry->delegate performSelector:@selector(ccScrollWheel:) withObject:event]; + if( swallows ) + break; + } + } + } +} + +// +// Mouse enter / exit +- (void)mouseExited:(NSEvent *)event +{ + if( dispatchEvents_ ) { + tListEntry *entry, *tmp; + + DL_FOREACH_SAFE( mouseDelegates_, entry, tmp ) { + if ( entry->flags & kCCImplementsMouseEntered ) { + void *swallows = [entry->delegate performSelector:@selector(ccMouseEntered:) withObject:event]; + if( swallows ) + break; + } + } + } +} + +- (void)mouseEntered:(NSEvent *)event +{ + if( dispatchEvents_ ) { + tListEntry *entry, *tmp; + + DL_FOREACH_SAFE( mouseDelegates_, entry, tmp ) { + if ( entry->flags & kCCImplementsMouseExited) { + void *swallows = [entry->delegate performSelector:@selector(ccMouseExited:) withObject:event]; + if( swallows ) + break; + } + } + } +} + + +#pragma mark CCEventDispatcher - Keyboard events + +// Keyboard events +- (void)keyDown:(NSEvent *)event +{ + if( dispatchEvents_ ) { + tListEntry *entry, *tmp; + + DL_FOREACH_SAFE( keyboardDelegates_, entry, tmp ) { + if ( entry->flags & kCCImplementsKeyDown ) { + void *swallows = [entry->delegate performSelector:@selector(ccKeyDown:) withObject:event]; + if( swallows ) + break; + } + } + } +} + +- (void)keyUp:(NSEvent *)event +{ + if( dispatchEvents_ ) { + tListEntry *entry, *tmp; + + DL_FOREACH_SAFE( keyboardDelegates_, entry, tmp ) { + if ( entry->flags & kCCImplementsKeyUp ) { + void *swallows = [entry->delegate performSelector:@selector(ccKeyUp:) withObject:event]; + if( swallows ) + break; + } + } + } +} + +- (void)flagsChanged:(NSEvent *)event +{ + if( dispatchEvents_ ) { + tListEntry *entry, *tmp; + + DL_FOREACH_SAFE( keyboardDelegates_, entry, tmp ) { + if ( entry->flags & kCCImplementsFlagsChanged ) { + void *swallows = [entry->delegate performSelector:@selector(ccFlagsChanged:) withObject:event]; + if( swallows ) + break; + } + } + } +} + + +#pragma mark CCEventDispatcher - Touch events + +- (void)touchesBeganWithEvent:(NSEvent *)event +{ + if( dispatchEvents_ ) { + tListEntry *entry, *tmp; + + DL_FOREACH_SAFE( touchDelegates_, entry, tmp ) { + if ( entry->flags & kCCImplementsTouchesBegan) { + void *swallows = [entry->delegate performSelector:@selector(ccTouchesBeganWithEvent:) withObject:event]; + if( swallows ) + break; + } + } + } +} + +- (void)touchesMovedWithEvent:(NSEvent *)event +{ + if( dispatchEvents_ ) { + tListEntry *entry, *tmp; + + DL_FOREACH_SAFE( touchDelegates_, entry, tmp ) { + if ( entry->flags & kCCImplementsTouchesMoved) { + void *swallows = [entry->delegate performSelector:@selector(ccTouchesMovedWithEvent:) withObject:event]; + if( swallows ) + break; + } + } + } +} + +- (void)touchesEndedWithEvent:(NSEvent *)event +{ + if( dispatchEvents_ ) { + tListEntry *entry, *tmp; + + DL_FOREACH_SAFE( touchDelegates_, entry, tmp ) { + if ( entry->flags & kCCImplementsTouchesEnded) { + void *swallows = [entry->delegate performSelector:@selector(ccTouchesEndedWithEvent:) withObject:event]; + if( swallows ) + break; + } + } + } +} + +- (void)touchesCancelledWithEvent:(NSEvent *)event +{ + if( dispatchEvents_ ) { + tListEntry *entry, *tmp; + + DL_FOREACH_SAFE( touchDelegates_, entry, tmp ) { + if ( entry->flags & kCCImplementsTouchesCancelled) { + void *swallows = [entry->delegate performSelector:@selector(ccTouchesCancelledWithEvent:) withObject:event]; + if( swallows ) + break; + } + } + } +} + + +#pragma mark CCEventDispatcher - queue events + +#if CC_DIRECTOR_MAC_USE_DISPLAY_LINK_THREAD +-(void) queueEvent:(NSEvent*)event selector:(SEL)selector +{ + NSAssert( eventQueueCount < QUEUE_EVENT_MAX, @"CCEventDispatcher: recompile. Increment QUEUE_EVENT_MAX value"); + + @synchronized (self) { + eventQueue[eventQueueCount].selector = selector; + eventQueue[eventQueueCount].event = [event copy]; + + eventQueueCount++; + } +} + +-(void) dispatchQueuedEvents +{ + @synchronized (self) { + for( int i=0; i < eventQueueCount; i++ ) { + SEL sel = eventQueue[i].selector; + NSEvent *event = eventQueue[i].event; + + [self performSelector:sel withObject:event]; + + [event release]; + } + + eventQueueCount = 0; + } +} +#endif // CC_DIRECTOR_MAC_USE_DISPLAY_LINK_THREAD + + +@end + +#endif // __MAC_OS_X_VERSION_MAX_ALLOWED diff --git a/libs/cocos2d/Platforms/Mac/MacGLView.h b/libs/cocos2d/Platforms/Mac/MacGLView.h new file mode 100755 index 0000000..8099273 --- /dev/null +++ b/libs/cocos2d/Platforms/Mac/MacGLView.h @@ -0,0 +1,89 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ + +// Only compile this code on Mac. These files should not be included on your iOS project. +// But in case they are included, it won't be compiled. +#import +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED +#elif defined(__MAC_OS_X_VERSION_MAX_ALLOWED) + +#import + +#import "../../ccConfig.h" + +//PROTOCOLS: + +@protocol MacEventDelegate +// Mouse +- (void)mouseDown:(NSEvent *)theEvent; +- (void)mouseUp:(NSEvent *)theEvent; +- (void)mouseMoved:(NSEvent *)theEvent; +- (void)mouseDragged:(NSEvent *)theEvent; +- (void)rightMouseDown:(NSEvent*)event; +- (void)rightMouseDragged:(NSEvent*)event; +- (void)rightMouseUp:(NSEvent*)event; +- (void)otherMouseDown:(NSEvent*)event; +- (void)otherMouseDragged:(NSEvent*)event; +- (void)otherMouseUp:(NSEvent*)event; +- (void)scrollWheel:(NSEvent *)theEvent; +- (void)mouseEntered:(NSEvent *)theEvent; +- (void)mouseExited:(NSEvent *)theEvent; + + +// Keyboard +- (void)keyDown:(NSEvent *)theEvent; +- (void)keyUp:(NSEvent *)theEvent; +- (void)flagsChanged:(NSEvent *)theEvent; + +// Touches +- (void)touchesBeganWithEvent:(NSEvent *)event; +- (void)touchesMovedWithEvent:(NSEvent *)event; +- (void)touchesEndedWithEvent:(NSEvent *)event; +- (void)touchesCancelledWithEvent:(NSEvent *)event; + +#if CC_DIRECTOR_MAC_USE_DISPLAY_LINK_THREAD +- (void)queueEvent:(NSEvent*)event selector:(SEL)selector; +#endif + +@end + +/** MacGLView + + Only available for Mac OS X + */ +@interface MacGLView : NSOpenGLView { + id eventDelegate_; +} + +@property (nonatomic, readwrite, assign) id eventDelegate; + +// initializes the MacGLView with a frame rect and an OpenGL context +- (id) initWithFrame:(NSRect)frameRect shareContext:(NSOpenGLContext*)context; + +// private ++(void) load_; +@end + +#endif // __MAC_OS_X_VERSION_MAX_ALLOWED \ No newline at end of file diff --git a/libs/cocos2d/Platforms/Mac/MacGLView.m b/libs/cocos2d/Platforms/Mac/MacGLView.m new file mode 100755 index 0000000..a041dc8 --- /dev/null +++ b/libs/cocos2d/Platforms/Mac/MacGLView.m @@ -0,0 +1,242 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ + +/* + * Idea of subclassing NSOpenGLView was taken from "TextureUpload" Apple's sample + */ + +// Only compile this code on Mac. These files should not be included on your iOS project. +// But in case they are included, it won't be compiled. +#import +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED +#elif defined(__MAC_OS_X_VERSION_MAX_ALLOWED) + +#import "MacGLView.h" +#import + +#import "CCDirectorMac.h" +#import "../../ccConfig.h" + + +@implementation MacGLView + +@synthesize eventDelegate = eventDelegate_; + ++(void) load_ +{ + NSLog(@"%@ loaded", self); +} + +- (id) initWithFrame:(NSRect)frameRect +{ + self = [self initWithFrame:frameRect shareContext:nil]; + return self; +} + +- (id) initWithFrame:(NSRect)frameRect shareContext:(NSOpenGLContext*)context +{ + NSOpenGLPixelFormatAttribute attribs[] = + { + NSOpenGLPFAAccelerated, + NSOpenGLPFANoRecovery, + NSOpenGLPFADoubleBuffer, + NSOpenGLPFADepthSize, 24, + + 0 + }; + + NSOpenGLPixelFormat *pixelFormat = [[NSOpenGLPixelFormat alloc] initWithAttributes:attribs]; + + if (!pixelFormat) + NSLog(@"No OpenGL pixel format"); + + if( (self = [super initWithFrame:frameRect pixelFormat:[pixelFormat autorelease]]) ) { + + if( context ) + [self setOpenGLContext:context]; + + // Synchronize buffer swaps with vertical refresh rate + GLint swapInt = 1; + [[self openGLContext] setValues:&swapInt forParameter:NSOpenGLCPSwapInterval]; + +// GLint order = -1; +// [[self openGLContext] setValues:&order forParameter:NSOpenGLCPSurfaceOrder]; + + // event delegate + eventDelegate_ = nil; + } + + return self; +} + +- (void) reshape +{ + // We draw on a secondary thread through the display link + // When resizing the view, -reshape is called automatically on the main thread + // Add a mutex around to avoid the threads accessing the context simultaneously when resizing + CGLLockContext([[self openGLContext] CGLContextObj]); + + NSRect rect = [self bounds]; + + CCDirector *director = [CCDirector sharedDirector]; + [director reshapeProjection: NSSizeToCGSize(rect.size) ]; + + // avoid flicker + [director drawScene]; +// [self setNeedsDisplay:YES]; + + CGLUnlockContext([[self openGLContext] CGLContextObj]); +} + +- (void) dealloc +{ + + [super dealloc]; +} + +#if CC_DIRECTOR_MAC_USE_DISPLAY_LINK_THREAD +#define DISPATCH_EVENT(__event__, __selector__) [eventDelegate_ queueEvent:__event__ selector:__selector__]; +#else +#define DISPATCH_EVENT(__event__, __selector__) \ + id obj = eventDelegate_; \ + [obj performSelector:__selector__ \ + onThread:[(CCDirectorMac*)[CCDirector sharedDirector] runningThread] \ + withObject:__event__ \ + waitUntilDone:NO]; +#endif + +#pragma mark MacGLView - Mouse events +- (void)mouseDown:(NSEvent *)theEvent +{ + DISPATCH_EVENT(theEvent, _cmd); +} + +- (void)mouseMoved:(NSEvent *)theEvent +{ + DISPATCH_EVENT(theEvent, _cmd); +} + +- (void)mouseDragged:(NSEvent *)theEvent +{ + DISPATCH_EVENT(theEvent, _cmd); +} + +- (void)mouseUp:(NSEvent *)theEvent +{ + DISPATCH_EVENT(theEvent, _cmd); +} + +- (void)rightMouseDown:(NSEvent *)theEvent { + DISPATCH_EVENT(theEvent, _cmd); +} + +- (void)rightMouseDragged:(NSEvent *)theEvent { + DISPATCH_EVENT(theEvent, _cmd); +} + +- (void)rightMouseUp:(NSEvent *)theEvent { + DISPATCH_EVENT(theEvent, _cmd); +} + +- (void)otherMouseDown:(NSEvent *)theEvent { + DISPATCH_EVENT(theEvent, _cmd); +} + +- (void)otherMouseDragged:(NSEvent *)theEvent { + DISPATCH_EVENT(theEvent, _cmd); +} + +- (void)otherMouseUp:(NSEvent *)theEvent { + DISPATCH_EVENT(theEvent, _cmd); +} + +- (void)mouseEntered:(NSEvent *)theEvent { + DISPATCH_EVENT(theEvent, _cmd); +} + +- (void)mouseExited:(NSEvent *)theEvent { + DISPATCH_EVENT(theEvent, _cmd); +} + +-(void) scrollWheel:(NSEvent *)theEvent { + DISPATCH_EVENT(theEvent, _cmd); +} + +#pragma mark MacGLView - Key events + +-(BOOL) becomeFirstResponder +{ + return YES; +} + +-(BOOL) acceptsFirstResponder +{ + return YES; +} + +-(BOOL) resignFirstResponder +{ + return YES; +} + +- (void)keyDown:(NSEvent *)theEvent +{ + DISPATCH_EVENT(theEvent, _cmd); +} + +- (void)keyUp:(NSEvent *)theEvent +{ + DISPATCH_EVENT(theEvent, _cmd); +} + +- (void)flagsChanged:(NSEvent *)theEvent +{ + DISPATCH_EVENT(theEvent, _cmd); +} + +#pragma mark MacGLView - Touch events +- (void)touchesBeganWithEvent:(NSEvent *)theEvent +{ + DISPATCH_EVENT(theEvent, _cmd); +} + +- (void)touchesMovedWithEvent:(NSEvent *)theEvent +{ + DISPATCH_EVENT(theEvent, _cmd); +} + +- (void)touchesEndedWithEvent:(NSEvent *)theEvent +{ + DISPATCH_EVENT(theEvent, _cmd); +} + +- (void)touchesCancelledWithEvent:(NSEvent *)theEvent +{ + DISPATCH_EVENT(theEvent, _cmd); +} + +@end + +#endif // __MAC_OS_X_VERSION_MAX_ALLOWED diff --git a/libs/cocos2d/Platforms/Mac/MacWindow.h b/libs/cocos2d/Platforms/Mac/MacWindow.h new file mode 100755 index 0000000..716fe9b --- /dev/null +++ b/libs/cocos2d/Platforms/Mac/MacWindow.h @@ -0,0 +1,42 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2010 Ricardo Quesada + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ + +// Only compile this code on Mac. These files should not be included on your iOS project. +// But in case they are included, it won't be compiled. +#import +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED +#elif defined(__MAC_OS_X_VERSION_MAX_ALLOWED) + +#import + + +@interface MacWindow : NSWindow +{ +} +- (id) initWithFrame:(NSRect)frame fullscreen:(BOOL)fullscreen; + +@end + + +#endif // __MAC_OS_X_VERSION_MAX_ALLOWED \ No newline at end of file diff --git a/libs/cocos2d/Platforms/Mac/MacWindow.m b/libs/cocos2d/Platforms/Mac/MacWindow.m new file mode 100755 index 0000000..28736a3 --- /dev/null +++ b/libs/cocos2d/Platforms/Mac/MacWindow.m @@ -0,0 +1,70 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2010 Ricardo Quesada + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ + +// Only compile this code on Mac. These files should not be included on your iOS project. +// But in case they are included, it won't be compiled. +#import +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED +#elif defined(__MAC_OS_X_VERSION_MAX_ALLOWED) + +#import "MacWindow.h" + + +@implementation MacWindow + +- (id) initWithFrame:(NSRect)frame fullscreen:(BOOL)fullscreen +{ + int styleMask = fullscreen ? NSBackingStoreBuffered : ( NSTitledWindowMask | NSClosableWindowMask ); + self = [self initWithContentRect:frame + styleMask:styleMask + backing:NSBackingStoreBuffered + defer:YES]; + + if (self != nil) + { + if(fullscreen) + { + [self setLevel:NSMainMenuWindowLevel+1]; + [self setHidesOnDeactivate:YES]; + [self setHasShadow:NO]; + } + + [self setAcceptsMouseMovedEvents:NO]; + [self setOpaque:YES]; + } + return self; +} + +- (BOOL) canBecomeKeyWindow +{ + return YES; +} + +- (BOOL) canBecomeMainWindow +{ + return YES; +} +@end + +#endif // __MAC_OS_X_VERSION_MAX_ALLOWED diff --git a/libs/cocos2d/Platforms/iOS/CCDirectorIOS.h b/libs/cocos2d/Platforms/iOS/CCDirectorIOS.h new file mode 100755 index 0000000..1c264e4 --- /dev/null +++ b/libs/cocos2d/Platforms/iOS/CCDirectorIOS.h @@ -0,0 +1,255 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2008-2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ + + +// Only compile this code on iOS. These files should NOT be included on your Mac project. +// But in case they are included, it won't be compiled. +#import +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED + +#import "../../CCDirector.h" + +/** @typedef ccDeviceOrientation + Possible device orientations + */ +typedef enum { + /// Device oriented vertically, home button on the bottom + kCCDeviceOrientationPortrait = UIDeviceOrientationPortrait, + /// Device oriented vertically, home button on the top + kCCDeviceOrientationPortraitUpsideDown = UIDeviceOrientationPortraitUpsideDown, + /// Device oriented horizontally, home button on the right + kCCDeviceOrientationLandscapeLeft = UIDeviceOrientationLandscapeLeft, + /// Device oriented horizontally, home button on the left + kCCDeviceOrientationLandscapeRight = UIDeviceOrientationLandscapeRight, + + // Backward compatibility stuff + CCDeviceOrientationPortrait = kCCDeviceOrientationPortrait, + CCDeviceOrientationPortraitUpsideDown = kCCDeviceOrientationPortraitUpsideDown, + CCDeviceOrientationLandscapeLeft = kCCDeviceOrientationLandscapeLeft, + CCDeviceOrientationLandscapeRight = kCCDeviceOrientationLandscapeRight, +} ccDeviceOrientation; + +/** @typedef ccDirectorType + Possible Director Types. + @since v0.8.2 + */ +typedef enum { + /** Will use a Director that triggers the main loop from an NSTimer object + * + * Features and Limitations: + * - Integrates OK with UIKit objects + * - It the slowest director + * - The invertal update is customizable from 1 to 60 + */ + kCCDirectorTypeNSTimer, + + /** will use a Director that triggers the main loop from a custom main loop. + * + * Features and Limitations: + * - Faster than NSTimer Director + * - It doesn't integrate well with UIKit objecgts + * - The interval update can't be customizable + */ + kCCDirectorTypeMainLoop, + + /** Will use a Director that triggers the main loop from a thread, but the main loop will be executed on the main thread. + * + * Features and Limitations: + * - Faster than NSTimer Director + * - It doesn't integrate well with UIKit objecgts + * - The interval update can't be customizable + */ + kCCDirectorTypeThreadMainLoop, + + /** Will use a Director that synchronizes timers with the refresh rate of the display. + * + * Features and Limitations: + * - Faster than NSTimer Director + * - Only available on 3.1+ + * - Scheduled timers & drawing are synchronizes with the refresh rate of the display + * - Integrates OK with UIKit objects + * - The interval update can be 1/60, 1/30, 1/15 + */ + kCCDirectorTypeDisplayLink, + + /** Default director is the NSTimer directory */ + kCCDirectorTypeDefault = kCCDirectorTypeNSTimer, + + // backward compatibility stuff + CCDirectorTypeNSTimer = kCCDirectorTypeNSTimer, + CCDirectorTypeMainLoop = kCCDirectorTypeMainLoop, + CCDirectorTypeThreadMainLoop = kCCDirectorTypeThreadMainLoop, + CCDirectorTypeDisplayLink = kCCDirectorTypeDisplayLink, + CCDirectorTypeDefault = kCCDirectorTypeDefault, + + +} ccDirectorType; + +/** CCDirector extensions for iPhone + */ +@interface CCDirector (iOSExtension) + +// rotates the screen if an orientation differnent than Portrait is used +-(void) applyOrientation; + +/** Sets the device orientation. + If the orientation is going to be controlled by an UIViewController, then the orientation should be Portrait + */ +-(void) setDeviceOrientation:(ccDeviceOrientation)orientation; + +/** returns the device orientation */ +-(ccDeviceOrientation) deviceOrientation; + +/** The size in pixels of the surface. It could be different than the screen size. + High-res devices might have a higher surface size than the screen size. + In non High-res device the contentScale will be emulated. + + The recommend way to enable Retina Display is by using the "enableRetinaDisplay:(BOOL)enabled" method. + + @since v0.99.4 + */ +-(void) setContentScaleFactor:(CGFloat)scaleFactor; + +/** Will enable Retina Display on devices that supports it. + It will enable Retina Display on iPhone4 and iPod Touch 4. + It will return YES, if it could enabled it, otherwise it will return NO. + + This is the recommened way to enable Retina Display. + @since v0.99.5 + */ +-(BOOL) enableRetinaDisplay:(BOOL)yes; + + +/** returns the content scale factor */ +-(CGFloat) contentScaleFactor; +@end + +@interface CCDirector (iOSExtensionClassMethods) + +/** There are 4 types of Director. + - kCCDirectorTypeNSTimer (default) + - kCCDirectorTypeMainLoop + - kCCDirectorTypeThreadMainLoop + - kCCDirectorTypeDisplayLink + + Each Director has it's own benefits, limitations. + If you are using SDK 3.1 or newer it is recommed to use the DisplayLink director + + This method should be called before any other call to the director. + + It will return NO if the director type is kCCDirectorTypeDisplayLink and the running SDK is < 3.1. Otherwise it will return YES. + + @since v0.8.2 + */ ++(BOOL) setDirectorType:(ccDirectorType) directorType; +@end + +#pragma mark - +#pragma mark CCDirectorIOS + +/** CCDirectorIOS: Base class of iOS directors + @since v0.99.5 + */ +@interface CCDirectorIOS : CCDirector +{ + /* orientation */ + ccDeviceOrientation deviceOrientation_; + + /* contentScaleFactor could be simulated */ + BOOL isContentScaleSupported_; + +} +@end + +/** FastDirector is a Director that triggers the main loop as fast as possible. + * + * Features and Limitations: + * - Faster than "normal" director + * - Consumes more battery than the "normal" director + * - It has some issues while using UIKit objects + */ +@interface CCDirectorFast : CCDirectorIOS +{ + BOOL isRunning; + + NSAutoreleasePool *autoreleasePool; +} +-(void) mainLoop; +@end + +/** ThreadedFastDirector is a Director that triggers the main loop from a thread. + * + * Features and Limitations: + * - Faster than "normal" director + * - Consumes more battery than the "normal" director + * - It can be used with UIKit objects + * + * @since v0.8.2 + */ +@interface CCDirectorFastThreaded : CCDirectorIOS +{ + BOOL isRunning; +} +-(void) mainLoop; +@end + +/** DisplayLinkDirector is a Director that synchronizes timers with the refresh rate of the display. + * + * Features and Limitations: + * - Only available on 3.1+ + * - Scheduled timers & drawing are synchronizes with the refresh rate of the display + * - Only supports animation intervals of 1/60 1/30 & 1/15 + * + * It is the recommended Director if the SDK is 3.1 or newer + * + * @since v0.8.2 + */ +@interface CCDirectorDisplayLink : CCDirectorIOS +{ + id displayLink; +} +-(void) mainLoop:(id)sender; +@end + +/** TimerDirector is a Director that calls the main loop from an NSTimer object + * + * Features and Limitations: + * - Integrates OK with UIKit objects + * - It the slowest director + * - The invertal update is customizable from 1 to 60 + * + * It is the default Director. + */ +@interface CCDirectorTimer : CCDirectorIOS +{ + NSTimer *animationTimer; +} +-(void) mainLoop; +@end + +// optimization. Should only be used to read it. Never to write it. +extern CGFloat __ccContentScaleFactor; + +#endif // __IPHONE_OS_VERSION_MAX_ALLOWED diff --git a/libs/cocos2d/Platforms/iOS/CCDirectorIOS.m b/libs/cocos2d/Platforms/iOS/CCDirectorIOS.m new file mode 100755 index 0000000..c483665 --- /dev/null +++ b/libs/cocos2d/Platforms/iOS/CCDirectorIOS.m @@ -0,0 +1,735 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + +// Only compile this code on iOS. These files should NOT be included on your Mac project. +// But in case they are included, it won't be compiled. +#import +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED + +#import + +// cocos2d imports +#import "CCDirectorIOS.h" +#import "CCTouchDelegateProtocol.h" +#import "CCTouchDispatcher.h" +#import "../../CCScheduler.h" +#import "../../CCActionManager.h" +#import "../../CCTextureCache.h" +#import "../../ccMacros.h" +#import "../../CCScene.h" + +// support imports +#import "glu.h" +#import "../../Support/OpenGL_Internal.h" +#import "../../Support/CGPointExtension.h" + +#import "CCLayer.h" + +#if CC_ENABLE_PROFILERS +#import "../../Support/CCProfiling.h" +#endif + + +#pragma mark - +#pragma mark Director - global variables (optimization) + +CGFloat __ccContentScaleFactor = 1; + +#pragma mark - +#pragma mark Director iOS + +@interface CCDirector () +-(void) setNextScene; +-(void) showFPS; +-(void) calculateDeltaTime; +@end + +@implementation CCDirector (iOSExtensionClassMethods) + ++(Class) defaultDirector +{ + return [CCDirectorTimer class]; +} + ++ (BOOL) setDirectorType:(ccDirectorType)type +{ + if( type == CCDirectorTypeDisplayLink ) { + NSString *reqSysVer = @"3.1"; + NSString *currSysVer = [[UIDevice currentDevice] systemVersion]; + + if([currSysVer compare:reqSysVer options:NSNumericSearch] == NSOrderedAscending) + return NO; + } + switch (type) { + case CCDirectorTypeNSTimer: + [CCDirectorTimer sharedDirector]; + break; + case CCDirectorTypeDisplayLink: + [CCDirectorDisplayLink sharedDirector]; + break; + case CCDirectorTypeMainLoop: + [CCDirectorFast sharedDirector]; + break; + case CCDirectorTypeThreadMainLoop: + [CCDirectorFastThreaded sharedDirector]; + break; + default: + NSAssert(NO,@"Unknown director type"); + } + + return YES; +} + +@end + + + +#pragma mark - +#pragma mark CCDirectorIOS + +@interface CCDirectorIOS () +-(void) updateContentScaleFactor; + +@end + +@implementation CCDirectorIOS + +- (id) init +{ + if( (self=[super init]) ) { + + // portrait mode default + deviceOrientation_ = CCDeviceOrientationPortrait; + + __ccContentScaleFactor = 1; + isContentScaleSupported_ = NO; + + // running thread is main thread on iOS + runningThread_ = [NSThread currentThread]; + } + + return self; +} + +- (void) dealloc +{ + [super dealloc]; +} + +// +// Draw the Scene +// +- (void) drawScene +{ + /* calculate "global" dt */ + [self calculateDeltaTime]; + + /* tick before glClear: issue #533 */ + if( ! isPaused_ ) { + [[CCScheduler sharedScheduler] tick: dt]; + } + + glClear(GL_COLOR_BUFFER_BIT | GL_DEPTH_BUFFER_BIT); + + /* to avoid flickr, nextScene MUST be here: after tick and before draw. + XXX: Which bug is this one. It seems that it can't be reproduced with v0.9 */ + if( nextScene_ ) + [self setNextScene]; + + glPushMatrix(); + + [self applyOrientation]; + + // By default enable VertexArray, ColorArray, TextureCoordArray and Texture2D + CC_ENABLE_DEFAULT_GL_STATES(); + + /* draw the scene */ + [runningScene_ visit]; + + /* draw the notification node */ + [notificationNode_ visit]; + + if( displayFPS_ ) + [self showFPS]; + +#if CC_ENABLE_PROFILERS + [self showProfilers]; +#endif + + CC_DISABLE_DEFAULT_GL_STATES(); + + glPopMatrix(); + + [openGLView_ swapBuffers]; +} + +-(void) setProjection:(ccDirectorProjection)projection +{ + CGSize size = winSizeInPixels_; + + switch (projection) { + case kCCDirectorProjection2D: + glViewport(0, 0, size.width, size.height); + glMatrixMode(GL_PROJECTION); + glLoadIdentity(); + ccglOrtho(0, size.width, 0, size.height, -1024 * CC_CONTENT_SCALE_FACTOR(), 1024 * CC_CONTENT_SCALE_FACTOR()); + glMatrixMode(GL_MODELVIEW); + glLoadIdentity(); + break; + + case kCCDirectorProjection3D: + { + float zeye = [self getZEye]; + + glViewport(0, 0, size.width, size.height); + glMatrixMode(GL_PROJECTION); + glLoadIdentity(); +// gluPerspective(60, (GLfloat)size.width/size.height, zeye-size.height/2, zeye+size.height/2 ); + gluPerspective(60, (GLfloat)size.width/size.height, 0.5f, 1500); + + glMatrixMode(GL_MODELVIEW); + glLoadIdentity(); + gluLookAt( size.width/2, size.height/2, zeye, + size.width/2, size.height/2, 0, + 0.0f, 1.0f, 0.0f); + break; + } + + case kCCDirectorProjectionCustom: + if( projectionDelegate_ ) + [projectionDelegate_ updateProjection]; + break; + + default: + CCLOG(@"cocos2d: Director: unrecognized projecgtion"); + break; + } + + projection_ = projection; +} + +#pragma mark Director Integration with a UIKit view + +-(void) setOpenGLView:(EAGLView *)view +{ + if( view != openGLView_ ) { + + [super setOpenGLView:view]; + + // set size + winSizeInPixels_ = CGSizeMake(winSizeInPoints_.width * __ccContentScaleFactor, winSizeInPoints_.height *__ccContentScaleFactor); + + if( __ccContentScaleFactor != 1 ) + [self updateContentScaleFactor]; + + CCTouchDispatcher *touchDispatcher = [CCTouchDispatcher sharedDispatcher]; + [openGLView_ setTouchDelegate: touchDispatcher]; + [touchDispatcher setDispatchEvents: YES]; + } +} + +#pragma mark Director - Retina Display + +-(CGFloat) contentScaleFactor +{ + return __ccContentScaleFactor; +} + +-(void) setContentScaleFactor:(CGFloat)scaleFactor +{ + if( scaleFactor != __ccContentScaleFactor ) { + + __ccContentScaleFactor = scaleFactor; + winSizeInPixels_ = CGSizeMake( winSizeInPoints_.width * scaleFactor, winSizeInPoints_.height * scaleFactor ); + + if( openGLView_ ) + [self updateContentScaleFactor]; + + // update projection + [self setProjection:projection_]; + } +} + +-(void) updateContentScaleFactor +{ + // Based on code snippet from: http://developer.apple.com/iphone/prerelease/library/snippets/sp2010/sp28.html + if ([openGLView_ respondsToSelector:@selector(setContentScaleFactor:)]) + { + [openGLView_ setContentScaleFactor: __ccContentScaleFactor]; + + isContentScaleSupported_ = YES; + } + else + CCLOG(@"cocos2d: 'setContentScaleFactor:' is not supported on this device"); +} + +-(BOOL) enableRetinaDisplay:(BOOL)enabled +{ + // Already enabled ? + if( enabled && __ccContentScaleFactor == 2 ) + return YES; + + // Already disabled + if( ! enabled && __ccContentScaleFactor == 1 ) + return YES; + + // setContentScaleFactor is not supported + if (! [openGLView_ respondsToSelector:@selector(setContentScaleFactor:)]) + return NO; + + // SD device + if ([[UIScreen mainScreen] scale] == 1.0) + return NO; + + float newScale = enabled ? 2 : 1; + [self setContentScaleFactor:newScale]; + + return YES; +} + +// overriden, don't call super +-(void) reshapeProjection:(CGSize)size +{ + winSizeInPoints_ = [openGLView_ bounds].size; + winSizeInPixels_ = CGSizeMake(winSizeInPoints_.width * __ccContentScaleFactor, winSizeInPoints_.height *__ccContentScaleFactor); + + [self setProjection:projection_]; +} + +#pragma mark Director Scene Landscape + +-(CGPoint)convertToGL:(CGPoint)uiPoint +{ + CGSize s = winSizeInPoints_; + float newY = s.height - uiPoint.y; + float newX = s.width - uiPoint.x; + + CGPoint ret = CGPointZero; + switch ( deviceOrientation_) { + case CCDeviceOrientationPortrait: + ret = ccp( uiPoint.x, newY ); + break; + case CCDeviceOrientationPortraitUpsideDown: + ret = ccp(newX, uiPoint.y); + break; + case CCDeviceOrientationLandscapeLeft: + ret.x = uiPoint.y; + ret.y = uiPoint.x; + break; + case CCDeviceOrientationLandscapeRight: + ret.x = newY; + ret.y = newX; + break; + } + return ret; +} + +-(CGPoint)convertToUI:(CGPoint)glPoint +{ + CGSize winSize = winSizeInPoints_; + int oppositeX = winSize.width - glPoint.x; + int oppositeY = winSize.height - glPoint.y; + CGPoint uiPoint = CGPointZero; + switch ( deviceOrientation_) { + case CCDeviceOrientationPortrait: + uiPoint = ccp(glPoint.x, oppositeY); + break; + case CCDeviceOrientationPortraitUpsideDown: + uiPoint = ccp(oppositeX, glPoint.y); + break; + case CCDeviceOrientationLandscapeLeft: + uiPoint = ccp(glPoint.y, glPoint.x); + break; + case CCDeviceOrientationLandscapeRight: + // Can't use oppositeX/Y because x/y are flipped + uiPoint = ccp(winSize.width-glPoint.y, winSize.height-glPoint.x); + break; + } + return uiPoint; +} + +// get the current size of the glview +-(CGSize) winSize +{ + CGSize s = winSizeInPoints_; + + if( deviceOrientation_ == CCDeviceOrientationLandscapeLeft || deviceOrientation_ == CCDeviceOrientationLandscapeRight ) { + // swap x,y in landscape mode + CGSize tmp = s; + s.width = tmp.height; + s.height = tmp.width; + } + return s; +} + +-(CGSize) winSizeInPixels +{ + CGSize s = [self winSize]; + + s.width *= CC_CONTENT_SCALE_FACTOR(); + s.height *= CC_CONTENT_SCALE_FACTOR(); + + return s; +} + +-(ccDeviceOrientation) deviceOrientation +{ + return deviceOrientation_; +} + +- (void) setDeviceOrientation:(ccDeviceOrientation) orientation +{ + if( deviceOrientation_ != orientation ) { + deviceOrientation_ = orientation; + switch( deviceOrientation_) { + case CCDeviceOrientationPortrait: + [[UIApplication sharedApplication] setStatusBarOrientation: UIInterfaceOrientationPortrait animated:NO]; + break; + case CCDeviceOrientationPortraitUpsideDown: + [[UIApplication sharedApplication] setStatusBarOrientation: UIInterfaceOrientationPortraitUpsideDown animated:NO]; + break; + case CCDeviceOrientationLandscapeLeft: + [[UIApplication sharedApplication] setStatusBarOrientation: UIInterfaceOrientationLandscapeRight animated:NO]; + break; + case CCDeviceOrientationLandscapeRight: + [[UIApplication sharedApplication] setStatusBarOrientation: UIInterfaceOrientationLandscapeLeft animated:NO]; + break; + default: + NSLog(@"Director: Unknown device orientation"); + break; + } + } +} + +-(void) applyOrientation +{ + CGSize s = winSizeInPixels_; + float w = s.width / 2; + float h = s.height / 2; + + // XXX it's using hardcoded values. + // What if the the screen size changes in the future? + switch ( deviceOrientation_ ) { + case CCDeviceOrientationPortrait: + // nothing + break; + case CCDeviceOrientationPortraitUpsideDown: + // upside down + glTranslatef(w,h,0); + glRotatef(180,0,0,1); + glTranslatef(-w,-h,0); + break; + case CCDeviceOrientationLandscapeRight: + glTranslatef(w,h,0); + glRotatef(90,0,0,1); + glTranslatef(-h,-w,0); + break; + case CCDeviceOrientationLandscapeLeft: + glTranslatef(w,h,0); + glRotatef(-90,0,0,1); + glTranslatef(-h,-w,0); + break; + } +} + +-(void) end +{ + // don't release the event handlers + // They are needed in case the director is run again + [[CCTouchDispatcher sharedDispatcher] removeAllDelegates]; + + [super end]; +} + +@end + + +#pragma mark - +#pragma mark Director TimerDirector + +@implementation CCDirectorTimer +- (void)startAnimation +{ + NSAssert( animationTimer == nil, @"animationTimer must be nil. Calling startAnimation twice?"); + + if( gettimeofday( &lastUpdate_, NULL) != 0 ) { + CCLOG(@"cocos2d: Director: Error in gettimeofday"); + } + + animationTimer = [NSTimer scheduledTimerWithTimeInterval:animationInterval_ target:self selector:@selector(mainLoop) userInfo:nil repeats:YES]; + + // + // If you want to attach the opengl view into UIScrollView + // uncomment this line to prevent 'freezing'. + // It doesn't work on with the Fast Director + // + // [[NSRunLoop currentRunLoop] addTimer:animationTimer + // forMode:NSRunLoopCommonModes]; +} + +-(void) mainLoop +{ + [self drawScene]; +} + +- (void)stopAnimation +{ + [animationTimer invalidate]; + animationTimer = nil; +} + +- (void)setAnimationInterval:(NSTimeInterval)interval +{ + animationInterval_ = interval; + + if(animationTimer) { + [self stopAnimation]; + [self startAnimation]; + } +} + +-(void) dealloc +{ + [animationTimer release]; + [super dealloc]; +} +@end + + +#pragma mark - +#pragma mark Director DirectorFast + +@implementation CCDirectorFast + +- (id) init +{ + if(( self = [super init] )) { + +#if CC_DIRECTOR_DISPATCH_FAST_EVENTS + CCLOG(@"cocos2d: Fast Events enabled"); +#else + CCLOG(@"cocos2d: Fast Events disabled"); +#endif + isRunning = NO; + + // XXX: + // XXX: Don't create any autorelease object before calling "fast director" + // XXX: else it will be leaked + // XXX: + autoreleasePool = [NSAutoreleasePool new]; + } + + return self; +} + +- (void) startAnimation +{ + NSAssert( isRunning == NO, @"isRunning must be NO. Calling startAnimation twice?"); + + // XXX: + // XXX: release autorelease objects created + // XXX: between "use fast director" and "runWithScene" + // XXX: + [autoreleasePool release]; + autoreleasePool = nil; + + if ( gettimeofday( &lastUpdate_, NULL) != 0 ) { + CCLOG(@"cocos2d: Director: Error in gettimeofday"); + } + + + isRunning = YES; + + SEL selector = @selector(mainLoop); + NSMethodSignature* sig = [[[CCDirector sharedDirector] class] + instanceMethodSignatureForSelector:selector]; + NSInvocation* invocation = [NSInvocation + invocationWithMethodSignature:sig]; + [invocation setTarget:[CCDirector sharedDirector]]; + [invocation setSelector:selector]; + [invocation performSelectorOnMainThread:@selector(invokeWithTarget:) + withObject:[CCDirector sharedDirector] waitUntilDone:NO]; + +// NSInvocationOperation *loopOperation = [[[NSInvocationOperation alloc] +// initWithTarget:self selector:@selector(mainLoop) object:nil] +// autorelease]; +// +// [loopOperation performSelectorOnMainThread:@selector(start) withObject:nil +// waitUntilDone:NO]; +} + +-(void) mainLoop +{ + while (isRunning) { + + NSAutoreleasePool *loopPool = [NSAutoreleasePool new]; + +#if CC_DIRECTOR_DISPATCH_FAST_EVENTS + while( CFRunLoopRunInMode(kCFRunLoopDefaultMode, 0.004f, FALSE) == kCFRunLoopRunHandledSource); +#else + while(CFRunLoopRunInMode(kCFRunLoopDefaultMode, 0, TRUE) == kCFRunLoopRunHandledSource); +#endif + + if (isPaused_) { + usleep(250000); // Sleep for a quarter of a second (250,000 microseconds) so that the framerate is 4 fps. + } + + [self drawScene]; + +#if CC_DIRECTOR_DISPATCH_FAST_EVENTS + while( CFRunLoopRunInMode(kCFRunLoopDefaultMode, 0.004f, FALSE) == kCFRunLoopRunHandledSource); +#else + while(CFRunLoopRunInMode(kCFRunLoopDefaultMode, 0, TRUE) == kCFRunLoopRunHandledSource); +#endif + + [loopPool release]; + } +} +- (void) stopAnimation +{ + isRunning = NO; +} + +- (void)setAnimationInterval:(NSTimeInterval)interval +{ + NSLog(@"FastDirectory doesn't support setAnimationInterval, yet"); +} +@end + +#pragma mark - +#pragma mark Director DirectorThreadedFast + +@implementation CCDirectorFastThreaded + +- (id) init +{ + if(( self = [super init] )) { + isRunning = NO; + } + + return self; +} + +- (void) startAnimation +{ + NSAssert( isRunning == NO, @"isRunning must be NO. Calling startAnimation twice?"); + + if ( gettimeofday( &lastUpdate_, NULL) != 0 ) { + CCLOG(@"cocos2d: ThreadedFastDirector: Error on gettimeofday"); + } + + isRunning = YES; + + NSThread *thread = [[NSThread alloc] initWithTarget:self selector:@selector(mainLoop) object:nil]; + [thread start]; + [thread release]; +} + +-(void) mainLoop +{ + while( ![[NSThread currentThread] isCancelled] ) { + if( isRunning ) + [self performSelectorOnMainThread:@selector(drawScene) withObject:nil waitUntilDone:YES]; + + if (isPaused_) { + usleep(250000); // Sleep for a quarter of a second (250,000 microseconds) so that the framerate is 4 fps. + } else { +// usleep(2000); + } + } +} +- (void) stopAnimation +{ + isRunning = NO; +} + +- (void)setAnimationInterval:(NSTimeInterval)interval +{ + NSLog(@"FastDirector doesn't support setAnimationInterval, yet"); +} +@end + +#pragma mark - +#pragma mark DirectorDisplayLink + +// Allows building DisplayLinkDirector for pre-3.1 SDKS +// without getting compiler warnings. +@interface NSObject(CADisplayLink) ++ (id) displayLinkWithTarget:(id)arg1 selector:(SEL)arg2; +- (void) addToRunLoop:(id)arg1 forMode:(id)arg2; +- (void) setFrameInterval:(int)interval; +- (void) invalidate; +@end + +@implementation CCDirectorDisplayLink + +- (void)setAnimationInterval:(NSTimeInterval)interval +{ + animationInterval_ = interval; + if(displayLink){ + [self stopAnimation]; + [self startAnimation]; + } +} + +- (void) startAnimation +{ + NSAssert( displayLink == nil, @"displayLink must be nil. Calling startAnimation twice?"); + + if ( gettimeofday( &lastUpdate_, NULL) != 0 ) { + CCLOG(@"cocos2d: DisplayLinkDirector: Error on gettimeofday"); + } + + // approximate frame rate + // assumes device refreshes at 60 fps + int frameInterval = (int) floor(animationInterval_ * 60.0f); + + CCLOG(@"cocos2d: Frame interval: %d", frameInterval); + + displayLink = [NSClassFromString(@"CADisplayLink") displayLinkWithTarget:self selector:@selector(mainLoop:)]; + [displayLink setFrameInterval:frameInterval]; + [displayLink addToRunLoop:[NSRunLoop currentRunLoop] forMode:NSDefaultRunLoopMode]; +} + +-(void) mainLoop:(id)sender +{ + [self drawScene]; +} + +- (void) stopAnimation +{ + [displayLink invalidate]; + displayLink = nil; +} + +-(void) dealloc +{ + [displayLink release]; + [super dealloc]; +} +@end + +#endif // __IPHONE_OS_VERSION_MAX_ALLOWED diff --git a/libs/cocos2d/Platforms/iOS/CCTouchDelegateProtocol.h b/libs/cocos2d/Platforms/iOS/CCTouchDelegateProtocol.h new file mode 100755 index 0000000..20ba036 --- /dev/null +++ b/libs/cocos2d/Platforms/iOS/CCTouchDelegateProtocol.h @@ -0,0 +1,75 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2009 Valentin Milea + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + +// Only compile this code on iOS. These files should NOT be included on your Mac project. +// But in case they are included, it won't be compiled. +#import +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED + +#import + +/** + CCTargetedTouchDelegate. + + Using this type of delegate results in two benefits: + 1. You don't need to deal with NSSets, the dispatcher does the job of splitting + them. You get exactly one UITouch per call. + 2. You can *claim* a UITouch by returning YES in ccTouchBegan. Updates of claimed + touches are sent only to the delegate(s) that claimed them. So if you get a move/ + ended/cancelled update you're sure it's your touch. This frees you from doing a + lot of checks when doing multi-touch. + + (The name TargetedTouchDelegate relates to updates "targeting" their specific + handler, without bothering the other handlers.) + @since v0.8 + */ +@protocol CCTargetedTouchDelegate + +/** Return YES to claim the touch. + @since v0.8 + */ +- (BOOL)ccTouchBegan:(UITouch *)touch withEvent:(UIEvent *)event; +@optional +// touch updates: +- (void)ccTouchMoved:(UITouch *)touch withEvent:(UIEvent *)event; +- (void)ccTouchEnded:(UITouch *)touch withEvent:(UIEvent *)event; +- (void)ccTouchCancelled:(UITouch *)touch withEvent:(UIEvent *)event; +@end + +/** + CCStandardTouchDelegate. + + This type of delegate is the same one used by CocoaTouch. You will receive all the events (Began,Moved,Ended,Cancelled). + @since v0.8 +*/ +@protocol CCStandardTouchDelegate +@optional +- (void)ccTouchesBegan:(NSSet *)touches withEvent:(UIEvent *)event; +- (void)ccTouchesMoved:(NSSet *)touches withEvent:(UIEvent *)event; +- (void)ccTouchesEnded:(NSSet *)touches withEvent:(UIEvent *)event; +- (void)ccTouchesCancelled:(NSSet *)touches withEvent:(UIEvent *)event; +@end + +#endif // __IPHONE_OS_VERSION_MAX_ALLOWED diff --git a/libs/cocos2d/Platforms/iOS/CCTouchDispatcher.h b/libs/cocos2d/Platforms/iOS/CCTouchDispatcher.h new file mode 100755 index 0000000..9931189 --- /dev/null +++ b/libs/cocos2d/Platforms/iOS/CCTouchDispatcher.h @@ -0,0 +1,123 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2009 Valentin Milea + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + +// Only compile this code on iOS. These files should NOT be included on your Mac project. +// But in case they are included, it won't be compiled. +#import +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED + +#import "CCTouchDelegateProtocol.h" +#import "EAGLView.h" + + +typedef enum +{ + kCCTouchSelectorBeganBit = 1 << 0, + kCCTouchSelectorMovedBit = 1 << 1, + kCCTouchSelectorEndedBit = 1 << 2, + kCCTouchSelectorCancelledBit = 1 << 3, + kCCTouchSelectorAllBits = ( kCCTouchSelectorBeganBit | kCCTouchSelectorMovedBit | kCCTouchSelectorEndedBit | kCCTouchSelectorCancelledBit), +} ccTouchSelectorFlag; + + +enum { + kCCTouchBegan, + kCCTouchMoved, + kCCTouchEnded, + kCCTouchCancelled, + + kCCTouchMax, +}; + +struct ccTouchHandlerHelperData { + SEL touchesSel; + SEL touchSel; + ccTouchSelectorFlag type; +}; + +/** CCTouchDispatcher. + Singleton that handles all the touch events. + The dispatcher dispatches events to the registered TouchHandlers. + There are 2 different type of touch handlers: + - Standard Touch Handlers + - Targeted Touch Handlers + + The Standard Touch Handlers work like the CocoaTouch touch handler: a set of touches is passed to the delegate. + On the other hand, the Targeted Touch Handlers only receive 1 touch at the time, and they can "swallow" touches (avoid the propagation of the event). + + Firstly, the dispatcher sends the received touches to the targeted touches. + These touches can be swallowed by the Targeted Touch Handlers. If there are still remaining touches, then the remaining touches will be sent + to the Standard Touch Handlers. + + @since v0.8.0 + */ +@interface CCTouchDispatcher : NSObject +{ + NSMutableArray *targetedHandlers; + NSMutableArray *standardHandlers; + + BOOL locked; + BOOL toAdd; + BOOL toRemove; + NSMutableArray *handlersToAdd; + NSMutableArray *handlersToRemove; + BOOL toQuit; + + BOOL dispatchEvents; + + // 4, 1 for each type of event + struct ccTouchHandlerHelperData handlerHelperData[kCCTouchMax]; +} + +/** singleton of the CCTouchDispatcher */ ++ (CCTouchDispatcher*)sharedDispatcher; + +/** Whether or not the events are going to be dispatched. Default: YES */ +@property (nonatomic,readwrite, assign) BOOL dispatchEvents; + +/** Adds a standard touch delegate to the dispatcher's list. + See StandardTouchDelegate description. + IMPORTANT: The delegate will be retained. + */ +-(void) addStandardDelegate:(id) delegate priority:(int)priority; +/** Adds a targeted touch delegate to the dispatcher's list. + See TargetedTouchDelegate description. + IMPORTANT: The delegate will be retained. + */ +-(void) addTargetedDelegate:(id) delegate priority:(int)priority swallowsTouches:(BOOL)swallowsTouches; +/** Removes a touch delegate. + The delegate will be released + */ +-(void) removeDelegate:(id) delegate; +/** Removes all touch delegates, releasing all the delegates */ +-(void) removeAllDelegates; +/** Changes the priority of a previously added delegate. The lower the number, + the higher the priority */ +-(void) setPriority:(int) priority forDelegate:(id) delegate; + +NSComparisonResult sortByPriority(id first, id second, void *context); +@end + +#endif // __IPHONE_OS_VERSION_MAX_ALLOWED diff --git a/libs/cocos2d/Platforms/iOS/CCTouchDispatcher.m b/libs/cocos2d/Platforms/iOS/CCTouchDispatcher.m new file mode 100755 index 0000000..1553b48 --- /dev/null +++ b/libs/cocos2d/Platforms/iOS/CCTouchDispatcher.m @@ -0,0 +1,347 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2009 Valentin Milea + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + +// Only compile this code on iOS. These files should NOT be included on your Mac project. +// But in case they are included, it won't be compiled. +#import +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED + + +#import "CCTouchDispatcher.h" +#import "CCTouchHandler.h" + +@implementation CCTouchDispatcher + +@synthesize dispatchEvents; + +static CCTouchDispatcher *sharedDispatcher = nil; + ++(CCTouchDispatcher*) sharedDispatcher +{ + @synchronized(self) { + if (sharedDispatcher == nil) + sharedDispatcher = [[self alloc] init]; // assignment not done here + } + return sharedDispatcher; +} + ++(id) allocWithZone:(NSZone *)zone +{ + @synchronized(self) { + NSAssert(sharedDispatcher == nil, @"Attempted to allocate a second instance of a singleton."); + return [super allocWithZone:zone]; + } + return nil; // on subsequent allocation attempts return nil +} + +-(id) init +{ + if((self = [super init])) { + + dispatchEvents = YES; + targetedHandlers = [[NSMutableArray alloc] initWithCapacity:8]; + standardHandlers = [[NSMutableArray alloc] initWithCapacity:4]; + + handlersToAdd = [[NSMutableArray alloc] initWithCapacity:8]; + handlersToRemove = [[NSMutableArray alloc] initWithCapacity:8]; + + toRemove = NO; + toAdd = NO; + toQuit = NO; + locked = NO; + + handlerHelperData[kCCTouchBegan] = (struct ccTouchHandlerHelperData) {@selector(ccTouchesBegan:withEvent:),@selector(ccTouchBegan:withEvent:),kCCTouchSelectorBeganBit}; + handlerHelperData[kCCTouchMoved] = (struct ccTouchHandlerHelperData) {@selector(ccTouchesMoved:withEvent:),@selector(ccTouchMoved:withEvent:),kCCTouchSelectorMovedBit}; + handlerHelperData[kCCTouchEnded] = (struct ccTouchHandlerHelperData) {@selector(ccTouchesEnded:withEvent:),@selector(ccTouchEnded:withEvent:),kCCTouchSelectorEndedBit}; + handlerHelperData[kCCTouchCancelled] = (struct ccTouchHandlerHelperData) {@selector(ccTouchesCancelled:withEvent:),@selector(ccTouchCancelled:withEvent:),kCCTouchSelectorCancelledBit}; + + } + + return self; +} + +-(void) dealloc +{ + [targetedHandlers release]; + [standardHandlers release]; + [handlersToAdd release]; + [handlersToRemove release]; + [super dealloc]; +} + +// +// handlers management +// + +#pragma mark TouchDispatcher - Add Hanlder + +-(void) forceAddHandler:(CCTouchHandler*)handler array:(NSMutableArray*)array +{ + NSUInteger i = 0; + + for( CCTouchHandler *h in array ) { + if( h.priority < handler.priority ) + i++; + + NSAssert( h.delegate != handler.delegate, @"Delegate already added to touch dispatcher."); + } + [array insertObject:handler atIndex:i]; +} + +-(void) addStandardDelegate:(id) delegate priority:(int)priority +{ + CCTouchHandler *handler = [CCStandardTouchHandler handlerWithDelegate:delegate priority:priority]; + if( ! locked ) { + [self forceAddHandler:handler array:standardHandlers]; + } else { + [handlersToAdd addObject:handler]; + toAdd = YES; + } +} + +-(void) addTargetedDelegate:(id) delegate priority:(int)priority swallowsTouches:(BOOL)swallowsTouches +{ + CCTouchHandler *handler = [CCTargetedTouchHandler handlerWithDelegate:delegate priority:priority swallowsTouches:swallowsTouches]; + if( ! locked ) { + [self forceAddHandler:handler array:targetedHandlers]; + } else { + [handlersToAdd addObject:handler]; + toAdd = YES; + } +} + +#pragma mark TouchDispatcher - removeDelegate + +-(void) forceRemoveDelegate:(id)delegate +{ + // XXX: remove it from both handlers ??? + + for( CCTouchHandler *handler in targetedHandlers ) { + if( handler.delegate == delegate ) { + [targetedHandlers removeObject:handler]; + break; + } + } + + for( CCTouchHandler *handler in standardHandlers ) { + if( handler.delegate == delegate ) { + [standardHandlers removeObject:handler]; + break; + } + } +} + +-(void) removeDelegate:(id) delegate +{ + if( delegate == nil ) + return; + + if( ! locked ) { + [self forceRemoveDelegate:delegate]; + } else { + [handlersToRemove addObject:delegate]; + toRemove = YES; + } +} + +#pragma mark TouchDispatcher - removeAllDelegates + +-(void) forceRemoveAllDelegates +{ + [standardHandlers removeAllObjects]; + [targetedHandlers removeAllObjects]; +} +-(void) removeAllDelegates +{ + if( ! locked ) + [self forceRemoveAllDelegates]; + else + toQuit = YES; +} + +#pragma mark Changing priority of added handlers + +-(CCTouchHandler*) findHandler:(id)delegate +{ + for( CCTouchHandler *handler in targetedHandlers ) { + if( handler.delegate == delegate ) { + return handler; + } + } + + for( CCTouchHandler *handler in standardHandlers ) { + if( handler.delegate == delegate ) { + return handler; + } + } + return nil; +} + +NSComparisonResult sortByPriority(id first, id second, void *context) +{ + if (((CCTouchHandler*)first).priority < ((CCTouchHandler*)second).priority) + return NSOrderedAscending; + else if (((CCTouchHandler*)first).priority > ((CCTouchHandler*)second).priority) + return NSOrderedDescending; + else + return NSOrderedSame; +} + +-(void) rearrangeHandlers:(NSMutableArray*)array +{ + [array sortUsingFunction:sortByPriority context:nil]; +} + +-(void) setPriority:(int) priority forDelegate:(id) delegate +{ + NSAssert(delegate != nil, @"Got nil touch delegate!"); + + CCTouchHandler *handler = nil; + handler = [self findHandler:delegate]; + + NSAssert(handler != nil, @"Delegate not found!"); + + handler.priority = priority; + + [self rearrangeHandlers:targetedHandlers]; + [self rearrangeHandlers:standardHandlers]; +} + +// +// dispatch events +// +-(void) touches:(NSSet*)touches withEvent:(UIEvent*)event withTouchType:(unsigned int)idx +{ + NSAssert(idx < 4, @"Invalid idx value"); + + id mutableTouches; + locked = YES; + + // optimization to prevent a mutable copy when it is not necessary + unsigned int targetedHandlersCount = [targetedHandlers count]; + unsigned int standardHandlersCount = [standardHandlers count]; + BOOL needsMutableSet = (targetedHandlersCount && standardHandlersCount); + + mutableTouches = (needsMutableSet ? [touches mutableCopy] : touches); + + struct ccTouchHandlerHelperData helper = handlerHelperData[idx]; + // + // process the target handlers 1st + // + if( targetedHandlersCount > 0 ) { + for( UITouch *touch in touches ) { + for(CCTargetedTouchHandler *handler in targetedHandlers) { + + BOOL claimed = NO; + if( idx == kCCTouchBegan ) { + claimed = [handler.delegate ccTouchBegan:touch withEvent:event]; + if( claimed ) + [handler.claimedTouches addObject:touch]; + } + + // else (moved, ended, cancelled) + else if( [handler.claimedTouches containsObject:touch] ) { + claimed = YES; + if( handler.enabledSelectors & helper.type ) + [handler.delegate performSelector:helper.touchSel withObject:touch withObject:event]; + + if( helper.type & (kCCTouchSelectorCancelledBit | kCCTouchSelectorEndedBit) ) + [handler.claimedTouches removeObject:touch]; + } + + if( claimed && handler.swallowsTouches ) { + if( needsMutableSet ) + [mutableTouches removeObject:touch]; + break; + } + } + } + } + + // + // process standard handlers 2nd + // + if( standardHandlersCount > 0 && [mutableTouches count]>0 ) { + for( CCTouchHandler *handler in standardHandlers ) { + if( handler.enabledSelectors & helper.type ) + [handler.delegate performSelector:helper.touchesSel withObject:mutableTouches withObject:event]; + } + } + if( needsMutableSet ) + [mutableTouches release]; + + // + // Optimization. To prevent a [handlers copy] which is expensive + // the add/removes/quit is done after the iterations + // + locked = NO; + if( toRemove ) { + toRemove = NO; + for( id delegate in handlersToRemove ) + [self forceRemoveDelegate:delegate]; + [handlersToRemove removeAllObjects]; + } + if( toAdd ) { + toAdd = NO; + for( CCTouchHandler *handler in handlersToAdd ) { + Class targetedClass = [CCTargetedTouchHandler class]; + if( [handler isKindOfClass:targetedClass] ) + [self forceAddHandler:handler array:targetedHandlers]; + else + [self forceAddHandler:handler array:standardHandlers]; + } + [handlersToAdd removeAllObjects]; + } + if( toQuit ) { + toQuit = NO; + [self forceRemoveAllDelegates]; + } +} + +- (void)touchesBegan:(NSSet *)touches withEvent:(UIEvent *)event +{ + if( dispatchEvents ) + [self touches:touches withEvent:event withTouchType:kCCTouchBegan]; +} +- (void)touchesMoved:(NSSet *)touches withEvent:(UIEvent *)event +{ + if( dispatchEvents ) + [self touches:touches withEvent:event withTouchType:kCCTouchMoved]; +} + +- (void)touchesEnded:(NSSet *)touches withEvent:(UIEvent *)event +{ + if( dispatchEvents ) + [self touches:touches withEvent:event withTouchType:kCCTouchEnded]; +} + +- (void)touchesCancelled:(NSSet *)touches withEvent:(UIEvent *)event +{ + if( dispatchEvents ) + [self touches:touches withEvent:event withTouchType:kCCTouchCancelled]; +} +@end + +#endif // __IPHONE_OS_VERSION_MAX_ALLOWED diff --git a/libs/cocos2d/Platforms/iOS/CCTouchHandler.h b/libs/cocos2d/Platforms/iOS/CCTouchHandler.h new file mode 100755 index 0000000..31a3e36 --- /dev/null +++ b/libs/cocos2d/Platforms/iOS/CCTouchHandler.h @@ -0,0 +1,93 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2009 Valentin Milea + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + +// Only compile this code on iOS. These files should NOT be included on your Mac project. +// But in case they are included, it won't be compiled. +#import +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED + +/* + * This file contains the delegates of the touches + * There are 2 possible delegates: + * - CCStandardTouchHandler: propagates all the events at once + * - CCTargetedTouchHandler: propagates 1 event at the time + */ + +#import "CCTouchDelegateProtocol.h" +#import "CCTouchDispatcher.h" + +/** + CCTouchHandler + Object than contains the delegate and priority of the event handler. +*/ +@interface CCTouchHandler : NSObject { + id delegate; + int priority; + ccTouchSelectorFlag enabledSelectors_; +} + +/** delegate */ +@property(nonatomic, readwrite, retain) id delegate; +/** priority */ +@property(nonatomic, readwrite) int priority; // default 0 +/** enabled selectors */ +@property(nonatomic,readwrite) ccTouchSelectorFlag enabledSelectors; + +/** allocates a TouchHandler with a delegate and a priority */ ++ (id)handlerWithDelegate:(id)aDelegate priority:(int)priority; +/** initializes a TouchHandler with a delegate and a priority */ +- (id)initWithDelegate:(id)aDelegate priority:(int)priority; +@end + +/** CCStandardTouchHandler + It forwardes each event to the delegate. + */ +@interface CCStandardTouchHandler : CCTouchHandler +{ +} +@end + +/** + CCTargetedTouchHandler + Object than contains the claimed touches and if it swallos touches. + Used internally by TouchDispatcher + */ +@interface CCTargetedTouchHandler : CCTouchHandler { + BOOL swallowsTouches; + NSMutableSet *claimedTouches; +} +/** whether or not the touches are swallowed */ +@property(nonatomic, readwrite) BOOL swallowsTouches; // default NO +/** MutableSet that contains the claimed touches */ +@property(nonatomic, readonly) NSMutableSet *claimedTouches; + +/** allocates a TargetedTouchHandler with a delegate, a priority and whether or not it swallows touches or not */ ++ (id)handlerWithDelegate:(id) aDelegate priority:(int)priority swallowsTouches:(BOOL)swallowsTouches; +/** initializes a TargetedTouchHandler with a delegate, a priority and whether or not it swallows touches or not */ +- (id)initWithDelegate:(id) aDelegate priority:(int)priority swallowsTouches:(BOOL)swallowsTouches; + +@end + +#endif // __IPHONE_OS_VERSION_MAX_ALLOWED diff --git a/libs/cocos2d/Platforms/iOS/CCTouchHandler.m b/libs/cocos2d/Platforms/iOS/CCTouchHandler.m new file mode 100755 index 0000000..a52103b --- /dev/null +++ b/libs/cocos2d/Platforms/iOS/CCTouchHandler.m @@ -0,0 +1,135 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2009 Valentin Milea + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + + +// Only compile this code on iOS. These files should NOT be included on your Mac project. +// But in case they are included, it won't be compiled. +#import +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED + +/* + * This file contains the delegates of the touches + * There are 2 possible delegates: + * - CCStandardTouchHandler: propagates all the events at once + * - CCTargetedTouchHandler: propagates 1 event at the time + */ + +#import "CCTouchHandler.h" +#import "../../ccMacros.h" + +#pragma mark - +#pragma mark TouchHandler +@implementation CCTouchHandler + +@synthesize delegate, priority; +@synthesize enabledSelectors=enabledSelectors_; + ++ (id)handlerWithDelegate:(id) aDelegate priority:(int)aPriority +{ + return [[[self alloc] initWithDelegate:aDelegate priority:aPriority] autorelease]; +} + +- (id)initWithDelegate:(id) aDelegate priority:(int)aPriority +{ + NSAssert(aDelegate != nil, @"Touch delegate may not be nil"); + + if ((self = [super init])) { + self.delegate = aDelegate; + priority = aPriority; + enabledSelectors_ = 0; + } + + return self; +} + +- (void)dealloc { + CCLOGINFO(@"cocos2d: deallocing %@", self); + [delegate release]; + [super dealloc]; +} +@end + +#pragma mark - +#pragma mark StandardTouchHandler +@implementation CCStandardTouchHandler +-(id) initWithDelegate:(id)del priority:(int)pri +{ + if( (self=[super initWithDelegate:del priority:pri]) ) { + if( [del respondsToSelector:@selector(ccTouchesBegan:withEvent:)] ) + enabledSelectors_ |= kCCTouchSelectorBeganBit; + if( [del respondsToSelector:@selector(ccTouchesMoved:withEvent:)] ) + enabledSelectors_ |= kCCTouchSelectorMovedBit; + if( [del respondsToSelector:@selector(ccTouchesEnded:withEvent:)] ) + enabledSelectors_ |= kCCTouchSelectorEndedBit; + if( [del respondsToSelector:@selector(ccTouchesCancelled:withEvent:)] ) + enabledSelectors_ |= kCCTouchSelectorCancelledBit; + } + return self; +} +@end + +#pragma mark - +#pragma mark TargetedTouchHandler + +@interface CCTargetedTouchHandler (private) +-(void) updateKnownTouches:(NSMutableSet *)touches withEvent:(UIEvent *)event selector:(SEL)selector unclaim:(BOOL)doUnclaim; +@end + +@implementation CCTargetedTouchHandler + +@synthesize swallowsTouches, claimedTouches; + ++ (id)handlerWithDelegate:(id)aDelegate priority:(int)priority swallowsTouches:(BOOL)swallow +{ + return [[[self alloc] initWithDelegate:aDelegate priority:priority swallowsTouches:swallow] autorelease]; +} + +- (id)initWithDelegate:(id)aDelegate priority:(int)aPriority swallowsTouches:(BOOL)swallow +{ + if ((self = [super initWithDelegate:aDelegate priority:aPriority])) { + claimedTouches = [[NSMutableSet alloc] initWithCapacity:2]; + swallowsTouches = swallow; + + if( [aDelegate respondsToSelector:@selector(ccTouchBegan:withEvent:)] ) + enabledSelectors_ |= kCCTouchSelectorBeganBit; + if( [aDelegate respondsToSelector:@selector(ccTouchMoved:withEvent:)] ) + enabledSelectors_ |= kCCTouchSelectorMovedBit; + if( [aDelegate respondsToSelector:@selector(ccTouchEnded:withEvent:)] ) + enabledSelectors_ |= kCCTouchSelectorEndedBit; + if( [aDelegate respondsToSelector:@selector(ccTouchCancelled:withEvent:)] ) + enabledSelectors_ |= kCCTouchSelectorCancelledBit; + } + + return self; +} + +- (void)dealloc { + [claimedTouches release]; + [super dealloc]; +} +@end + + +#endif // __IPHONE_OS_VERSION_MAX_ALLOWED \ No newline at end of file diff --git a/libs/cocos2d/Platforms/iOS/EAGLView.h b/libs/cocos2d/Platforms/iOS/EAGLView.h new file mode 100755 index 0000000..3b6c2f3 --- /dev/null +++ b/libs/cocos2d/Platforms/iOS/EAGLView.h @@ -0,0 +1,155 @@ +/* + +===== IMPORTANT ===== + +This is sample code demonstrating API, technology or techniques in development. +Although this sample code has been reviewed for technical accuracy, it is not +final. Apple is supplying this information to help you plan for the adoption of +the technologies and programming interfaces described herein. This information +is subject to change, and software implemented based on this sample code should +be tested with final operating system software and final documentation. Newer +versions of this sample code may be provided with future seeds of the API or +technology. For information about updates to this and other developer +documentation, view the New & Updated sidebars in subsequent documentation +seeds. + +===================== + +File: EAGLView.h +Abstract: Convenience class that wraps the CAEAGLLayer from CoreAnimation into a +UIView subclass. + +Version: 1.3 + +Disclaimer: IMPORTANT: This Apple software is supplied to you by Apple Inc. +("Apple") in consideration of your agreement to the following terms, and your +use, installation, modification or redistribution of this Apple software +constitutes acceptance of these terms. If you do not agree with these terms, +please do not use, install, modify or redistribute this Apple software. + +In consideration of your agreement to abide by the following terms, and subject +to these terms, Apple grants you a personal, non-exclusive license, under +Apple's copyrights in this original Apple software (the "Apple Software"), to +use, reproduce, modify and redistribute the Apple Software, with or without +modifications, in source and/or binary forms; provided that if you redistribute +the Apple Software in its entirety and without modifications, you must retain +this notice and the following text and disclaimers in all such redistributions +of the Apple Software. +Neither the name, trademarks, service marks or logos of Apple Inc. may be used +to endorse or promote products derived from the Apple Software without specific +prior written permission from Apple. Except as expressly stated in this notice, +no other rights or licenses, express or implied, are granted by Apple herein, +including but not limited to any patent rights that may be infringed by your +derivative works or by other works in which the Apple Software may be +incorporated. + +The Apple Software is provided by Apple on an "AS IS" basis. APPLE MAKES NO +WARRANTIES, EXPRESS OR IMPLIED, INCLUDING WITHOUT LIMITATION THE IMPLIED +WARRANTIES OF NON-INFRINGEMENT, MERCHANTABILITY AND FITNESS FOR A PARTICULAR +PURPOSE, REGARDING THE APPLE SOFTWARE OR ITS USE AND OPERATION ALONE OR IN +COMBINATION WITH YOUR PRODUCTS. + +IN NO EVENT SHALL APPLE BE LIABLE FOR ANY SPECIAL, INDIRECT, INCIDENTAL OR +CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE +GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) +ARISING IN ANY WAY OUT OF THE USE, REPRODUCTION, MODIFICATION AND/OR +DISTRIBUTION OF THE APPLE SOFTWARE, HOWEVER CAUSED AND WHETHER UNDER THEORY OF +CONTRACT, TORT (INCLUDING NEGLIGENCE), STRICT LIABILITY OR OTHERWISE, EVEN IF +APPLE HAS BEEN ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +Copyright (C) 2008 Apple Inc. All Rights Reserved. + +*/ + +// Only compile this code on iOS. These files should NOT be included on your Mac project. +// But in case they are included, it won't be compiled. +#import +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED + +#import +#import +#import +#import +#import + +#import "ESRenderer.h" + +//CLASSES: + +@class EAGLView; +@class EAGLSharegroup; + +//PROTOCOLS: + +@protocol EAGLTouchDelegate +- (void)touchesBegan:(NSSet *)touches withEvent:(UIEvent *)event; +- (void)touchesEnded:(NSSet *)touches withEvent:(UIEvent *)event; +- (void)touchesMoved:(NSSet *)touches withEvent:(UIEvent *)event; +- (void)touchesCancelled:(NSSet *)touches withEvent:(UIEvent *)event; +@end + +//CLASS INTERFACE: + +/** EAGLView Class. + * This class wraps the CAEAGLLayer from CoreAnimation into a convenient UIView subclass. + * The view content is basically an EAGL surface you render your OpenGL scene into. + * Note that setting the view non-opaque will only work if the EAGL surface has an alpha channel. + */ +@interface EAGLView : UIView +{ + id renderer_; + EAGLContext *context_; // weak ref + + NSString *pixelformat_; + GLuint depthFormat_; + BOOL preserveBackbuffer_; + + CGSize size_; + BOOL discardFramebufferSupported_; + id touchDelegate_; + + //fsaa addition + BOOL multisampling_; + unsigned int requestedSamples_; +} + +/** creates an initializes an EAGLView with a frame and 0-bit depth buffer, and a RGB565 color buffer. */ ++ (id) viewWithFrame:(CGRect)frame; +/** creates an initializes an EAGLView with a frame, a color buffer format, and 0-bit depth buffer. */ ++ (id) viewWithFrame:(CGRect)frame pixelFormat:(NSString*)format; +/** creates an initializes an EAGLView with a frame, a color buffer format, and a depth buffer. */ ++ (id) viewWithFrame:(CGRect)frame pixelFormat:(NSString*)format depthFormat:(GLuint)depth; +/** creates an initializes an EAGLView with a frame, a color buffer format, a depth buffer format, a sharegroup, and multisamping */ ++ (id) viewWithFrame:(CGRect)frame pixelFormat:(NSString*)format depthFormat:(GLuint)depth preserveBackbuffer:(BOOL)retained sharegroup:(EAGLSharegroup*)sharegroup multiSampling:(BOOL)multisampling numberOfSamples:(unsigned int)samples; + +/** Initializes an EAGLView with a frame and 0-bit depth buffer, and a RGB565 color buffer */ +- (id) initWithFrame:(CGRect)frame; //These also set the current context +/** Initializes an EAGLView with a frame, a color buffer format, and 0-bit depth buffer */ +- (id) initWithFrame:(CGRect)frame pixelFormat:(NSString*)format; +/** Initializes an EAGLView with a frame, a color buffer format, a depth buffer format, a sharegroup and multisampling support */ +- (id) initWithFrame:(CGRect)frame pixelFormat:(NSString*)format depthFormat:(GLuint)depth preserveBackbuffer:(BOOL)retained sharegroup:(EAGLSharegroup*)sharegroup multiSampling:(BOOL)sampling numberOfSamples:(unsigned int)nSamples; + +/** pixel format: it could be RGBA8 (32-bit) or RGB565 (16-bit) */ +@property(nonatomic,readonly) NSString* pixelFormat; +/** depth format of the render buffer: 0, 16 or 24 bits*/ +@property(nonatomic,readonly) GLuint depthFormat; + +/** returns surface size in pixels */ +@property(nonatomic,readonly) CGSize surfaceSize; + +/** OpenGL context */ +@property(nonatomic,readonly) EAGLContext *context; + +@property(nonatomic,readwrite) BOOL multiSampling; + +/** touch delegate */ +@property(nonatomic,readwrite,assign) id touchDelegate; + +/** EAGLView uses double-buffer. This method swaps the buffers */ +-(void) swapBuffers; + +- (CGPoint) convertPointFromViewToSurface:(CGPoint)point; +- (CGRect) convertRectFromViewToSurface:(CGRect)rect; +@end + +#endif // __IPHONE_OS_VERSION_MAX_ALLOWED diff --git a/libs/cocos2d/Platforms/iOS/EAGLView.m b/libs/cocos2d/Platforms/iOS/EAGLView.m new file mode 100755 index 0000000..d5ead65 --- /dev/null +++ b/libs/cocos2d/Platforms/iOS/EAGLView.m @@ -0,0 +1,343 @@ +/* + +===== IMPORTANT ===== + +This is sample code demonstrating API, technology or techniques in development. +Although this sample code has been reviewed for technical accuracy, it is not +final. Apple is supplying this information to help you plan for the adoption of +the technologies and programming interfaces described herein. This information +is subject to change, and software implemented based on this sample code should +be tested with final operating system software and final documentation. Newer +versions of this sample code may be provided with future seeds of the API or +technology. For information about updates to this and other developer +documentation, view the New & Updated sidebars in subsequent documentation +seeds. + +===================== + +File: EAGLView.m +Abstract: Convenience class that wraps the CAEAGLLayer from CoreAnimation into a +UIView subclass. + +Version: 1.3 + +Disclaimer: IMPORTANT: This Apple software is supplied to you by Apple Inc. +("Apple") in consideration of your agreement to the following terms, and your +use, installation, modification or redistribution of this Apple software +constitutes acceptance of these terms. If you do not agree with these terms, +please do not use, install, modify or redistribute this Apple software. + +In consideration of your agreement to abide by the following terms, and subject +to these terms, Apple grants you a personal, non-exclusive license, under +Apple's copyrights in this original Apple software (the "Apple Software"), to +use, reproduce, modify and redistribute the Apple Software, with or without +modifications, in source and/or binary forms; provided that if you redistribute +the Apple Software in its entirety and without modifications, you must retain +this notice and the following text and disclaimers in all such redistributions +of the Apple Software. +Neither the name, trademarks, service marks or logos of Apple Inc. may be used +to endorse or promote products derived from the Apple Software without specific +prior written permission from Apple. Except as expressly stated in this notice, +no other rights or licenses, express or implied, are granted by Apple herein, +including but not limited to any patent rights that may be infringed by your +derivative works or by other works in which the Apple Software may be +incorporated. + +The Apple Software is provided by Apple on an "AS IS" basis. APPLE MAKES NO +WARRANTIES, EXPRESS OR IMPLIED, INCLUDING WITHOUT LIMITATION THE IMPLIED +WARRANTIES OF NON-INFRINGEMENT, MERCHANTABILITY AND FITNESS FOR A PARTICULAR +PURPOSE, REGARDING THE APPLE SOFTWARE OR ITS USE AND OPERATION ALONE OR IN +COMBINATION WITH YOUR PRODUCTS. + +IN NO EVENT SHALL APPLE BE LIABLE FOR ANY SPECIAL, INDIRECT, INCIDENTAL OR +CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE +GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) +ARISING IN ANY WAY OUT OF THE USE, REPRODUCTION, MODIFICATION AND/OR +DISTRIBUTION OF THE APPLE SOFTWARE, HOWEVER CAUSED AND WHETHER UNDER THEORY OF +CONTRACT, TORT (INCLUDING NEGLIGENCE), STRICT LIABILITY OR OTHERWISE, EVEN IF +APPLE HAS BEEN ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +Copyright (C) 2008 Apple Inc. All Rights Reserved. + +*/ + +// Only compile this code on iOS. These files should NOT be included on your Mac project. +// But in case they are included, it won't be compiled. +#import +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED + +#import + +#import "EAGLView.h" +#import "ES1Renderer.h" +#import "../../CCDirector.h" +#import "../../ccMacros.h" +#import "../../CCConfiguration.h" +#import "../../Support/OpenGL_Internal.h" + + +//CLASS IMPLEMENTATIONS: + +@interface EAGLView (Private) +- (BOOL) setupSurfaceWithSharegroup:(EAGLSharegroup*)sharegroup; +- (unsigned int) convertPixelFormat:(NSString*) pixelFormat; +@end + +@implementation EAGLView + +@synthesize surfaceSize=size_; +@synthesize pixelFormat=pixelformat_, depthFormat=depthFormat_; +@synthesize touchDelegate=touchDelegate_; +@synthesize context=context_; +@synthesize multiSampling=multiSampling_; + ++ (Class) layerClass +{ + return [CAEAGLLayer class]; +} + ++ (id) viewWithFrame:(CGRect)frame +{ + return [[[self alloc] initWithFrame:frame] autorelease]; +} + ++ (id) viewWithFrame:(CGRect)frame pixelFormat:(NSString*)format +{ + return [[[self alloc] initWithFrame:frame pixelFormat:format] autorelease]; +} + ++ (id) viewWithFrame:(CGRect)frame pixelFormat:(NSString*)format depthFormat:(GLuint)depth +{ + return [[[self alloc] initWithFrame:frame pixelFormat:format depthFormat:depth preserveBackbuffer:NO sharegroup:nil multiSampling:NO numberOfSamples:0] autorelease]; +} + ++ (id) viewWithFrame:(CGRect)frame pixelFormat:(NSString*)format depthFormat:(GLuint)depth preserveBackbuffer:(BOOL)retained sharegroup:(EAGLSharegroup*)sharegroup multiSampling:(BOOL)multisampling numberOfSamples:(unsigned int)samples +{ + return [[[self alloc] initWithFrame:frame pixelFormat:format depthFormat:depth preserveBackbuffer:retained sharegroup:sharegroup multiSampling:multisampling numberOfSamples:samples] autorelease]; +} + +- (id) initWithFrame:(CGRect)frame +{ + return [self initWithFrame:frame pixelFormat:kEAGLColorFormatRGB565 depthFormat:0 preserveBackbuffer:NO sharegroup:nil multiSampling:NO numberOfSamples:0]; +} + +- (id) initWithFrame:(CGRect)frame pixelFormat:(NSString*)format +{ + return [self initWithFrame:frame pixelFormat:format depthFormat:0 preserveBackbuffer:NO sharegroup:nil multiSampling:NO numberOfSamples:0]; +} + +- (id) initWithFrame:(CGRect)frame pixelFormat:(NSString*)format depthFormat:(GLuint)depth preserveBackbuffer:(BOOL)retained sharegroup:(EAGLSharegroup*)sharegroup multiSampling:(BOOL)sampling numberOfSamples:(unsigned int)nSamples +{ + if((self = [super initWithFrame:frame])) + { + pixelformat_ = format; + depthFormat_ = depth; + multiSampling_ = sampling; + requestedSamples_ = nSamples; + preserveBackbuffer_ = retained; + + if( ! [self setupSurfaceWithSharegroup:sharegroup] ) { + [self release]; + return nil; + } + } + + return self; +} + +-(id) initWithCoder:(NSCoder *)aDecoder +{ + if( (self = [super initWithCoder:aDecoder]) ) { + + CAEAGLLayer* eaglLayer = (CAEAGLLayer*)[self layer]; + + pixelformat_ = kEAGLColorFormatRGB565; + depthFormat_ = 0; // GL_DEPTH_COMPONENT24_OES; + multiSampling_= NO; + requestedSamples_ = 0; + size_ = [eaglLayer bounds].size; + + if( ! [self setupSurfaceWithSharegroup:nil] ) { + [self release]; + return nil; + } + } + + return self; +} + +-(BOOL) setupSurfaceWithSharegroup:(EAGLSharegroup*)sharegroup +{ + CAEAGLLayer *eaglLayer = (CAEAGLLayer *)self.layer; + + eaglLayer.opaque = YES; + eaglLayer.drawableProperties = [NSDictionary dictionaryWithObjectsAndKeys: + [NSNumber numberWithBool:preserveBackbuffer_], kEAGLDrawablePropertyRetainedBacking, + pixelformat_, kEAGLDrawablePropertyColorFormat, nil]; + + + renderer_ = [[ES1Renderer alloc] initWithDepthFormat:depthFormat_ + withPixelFormat:[self convertPixelFormat:pixelformat_] + withSharegroup:sharegroup + withMultiSampling:multiSampling_ + withNumberOfSamples:requestedSamples_]; + if (!renderer_) + return NO; + + context_ = [renderer_ context]; + [context_ renderbufferStorage:GL_RENDERBUFFER_OES fromDrawable:eaglLayer]; + + discardFramebufferSupported_ = [[CCConfiguration sharedConfiguration] supportsDiscardFramebuffer]; + + return YES; +} + +- (void) dealloc +{ + CCLOGINFO(@"cocos2d: deallocing %@", self); + + + [renderer_ release]; + [super dealloc]; +} + +- (void) layoutSubviews +{ + size_ = [renderer_ backingSize]; + + [renderer_ resizeFromLayer:(CAEAGLLayer*)self.layer]; + + // Issue #914 #924 + CCDirector *director = [CCDirector sharedDirector]; + [director reshapeProjection:size_]; + + // Avoid flicker. Issue #350 + [director performSelectorOnMainThread:@selector(drawScene) withObject:nil waitUntilDone:YES]; +} + +- (void) swapBuffers +{ + // IMPORTANT: + // - preconditions + // -> context_ MUST be the OpenGL context + // -> renderbuffer_ must be the the RENDER BUFFER + +#ifdef __IPHONE_4_0 + + if (multiSampling_) + { + /* Resolve from msaaFramebuffer to resolveFramebuffer */ + //glDisable(GL_SCISSOR_TEST); + glBindFramebufferOES(GL_READ_FRAMEBUFFER_APPLE, [renderer_ msaaFrameBuffer]); + glBindFramebufferOES(GL_DRAW_FRAMEBUFFER_APPLE, [renderer_ defaultFrameBuffer]); + glResolveMultisampleFramebufferAPPLE(); + } + + if( discardFramebufferSupported_) + { + if (multiSampling_) + { + if (depthFormat_) + { + GLenum attachments[] = {GL_COLOR_ATTACHMENT0_OES, GL_DEPTH_ATTACHMENT_OES}; + glDiscardFramebufferEXT(GL_READ_FRAMEBUFFER_APPLE, 2, attachments); + } + else + { + GLenum attachments[] = {GL_COLOR_ATTACHMENT0_OES}; + glDiscardFramebufferEXT(GL_READ_FRAMEBUFFER_APPLE, 1, attachments); + } + + glBindRenderbufferOES(GL_RENDERBUFFER_OES, [renderer_ colorRenderBuffer]); + + } + + // not MSAA + else if (depthFormat_ ) { + GLenum attachments[] = { GL_DEPTH_ATTACHMENT_OES}; + glDiscardFramebufferEXT(GL_FRAMEBUFFER_OES, 1, attachments); + } + } + +#endif // __IPHONE_4_0 + + if(![context_ presentRenderbuffer:GL_RENDERBUFFER_OES]) + CCLOG(@"cocos2d: Failed to swap renderbuffer in %s\n", __FUNCTION__); + +#if COCOS2D_DEBUG + CHECK_GL_ERROR(); +#endif + + // We can safely re-bind the framebuffer here, since this will be the + // 1st instruction of the new main loop + if( multiSampling_ ) + glBindFramebufferOES(GL_FRAMEBUFFER_OES, [renderer_ msaaFrameBuffer]); +} + +- (unsigned int) convertPixelFormat:(NSString*) pixelFormat +{ + // define the pixel format + GLenum pFormat; + + + if([pixelFormat isEqualToString:@"EAGLColorFormat565"]) + pFormat = GL_RGB565_OES; + else + pFormat = GL_RGBA8_OES; + + return pFormat; +} + +#pragma mark EAGLView - Point conversion + +- (CGPoint) convertPointFromViewToSurface:(CGPoint)point +{ + CGRect bounds = [self bounds]; + + return CGPointMake((point.x - bounds.origin.x) / bounds.size.width * size_.width, (point.y - bounds.origin.y) / bounds.size.height * size_.height); +} + +- (CGRect) convertRectFromViewToSurface:(CGRect)rect +{ + CGRect bounds = [self bounds]; + + return CGRectMake((rect.origin.x - bounds.origin.x) / bounds.size.width * size_.width, (rect.origin.y - bounds.origin.y) / bounds.size.height * size_.height, rect.size.width / bounds.size.width * size_.width, rect.size.height / bounds.size.height * size_.height); +} + +// Pass the touches to the superview +#pragma mark EAGLView - Touch Delegate + +- (void)touchesBegan:(NSSet *)touches withEvent:(UIEvent *)event +{ + if(touchDelegate_) + { + [touchDelegate_ touchesBegan:touches withEvent:event]; + } +} + +- (void)touchesMoved:(NSSet *)touches withEvent:(UIEvent *)event +{ + if(touchDelegate_) + { + [touchDelegate_ touchesMoved:touches withEvent:event]; + } +} + +- (void)touchesEnded:(NSSet *)touches withEvent:(UIEvent *)event +{ + if(touchDelegate_) + { + [touchDelegate_ touchesEnded:touches withEvent:event]; + } +} +- (void)touchesCancelled:(NSSet *)touches withEvent:(UIEvent *)event +{ + if(touchDelegate_) + { + [touchDelegate_ touchesCancelled:touches withEvent:event]; + } +} + +@end + +#endif // __IPHONE_OS_VERSION_MAX_ALLOWED \ No newline at end of file diff --git a/libs/cocos2d/Platforms/iOS/ES1Renderer.h b/libs/cocos2d/Platforms/iOS/ES1Renderer.h new file mode 100755 index 0000000..fd946a7 --- /dev/null +++ b/libs/cocos2d/Platforms/iOS/ES1Renderer.h @@ -0,0 +1,72 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + * + * File autogenerated with Xcode. Adapted for cocos2d needs. + */ + +// Only compile this code on iOS. These files should NOT be included on your Mac project. +// But in case they are included, it won't be compiled. +#import +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED + + +#import "ESRenderer.h" + +#import +#import + +@interface ES1Renderer : NSObject +{ + // The pixel dimensions of the CAEAGLLayer + GLint backingWidth_; + GLint backingHeight_; + + unsigned int samplesToUse_; + BOOL multiSampling_; + + unsigned int depthFormat_; + unsigned int pixelFormat_; + + // The OpenGL ES names for the framebuffer and renderbuffer used to render to this view + GLuint defaultFramebuffer_; + GLuint colorRenderbuffer_; + GLuint depthBuffer_; + + + //buffers for MSAA + GLuint msaaFramebuffer_; + GLuint msaaColorbuffer_; + + EAGLContext *context_; +} + +/** EAGLContext */ +@property (nonatomic,readonly) EAGLContext* context; + +- (BOOL)resizeFromLayer:(CAEAGLLayer *)layer; + +@end + +#endif // __IPHONE_OS_VERSION_MAX_ALLOWED diff --git a/libs/cocos2d/Platforms/iOS/ES1Renderer.m b/libs/cocos2d/Platforms/iOS/ES1Renderer.m new file mode 100755 index 0000000..398d946 --- /dev/null +++ b/libs/cocos2d/Platforms/iOS/ES1Renderer.m @@ -0,0 +1,259 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + * + * File autogenerated with Xcode. Adapted for cocos2d needs. + */ + +// Only compile this code on iOS. These files should NOT be included on your Mac project. +// But in case they are included, it won't be compiled. +#import +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED + +#import "ES1Renderer.h" +#import "../../Support/OpenGL_Internal.h" +#import "../../ccMacros.h" + + +@interface ES1Renderer (private) + +- (GLenum) convertPixelFormat:(int) pixelFormat; + +@end + + +@implementation ES1Renderer + +@synthesize context=context_; + +- (id) initWithDepthFormat:(unsigned int)depthFormat withPixelFormat:(unsigned int)pixelFormat withSharegroup:(EAGLSharegroup*)sharegroup withMultiSampling:(BOOL) multiSampling withNumberOfSamples:(unsigned int) requestedSamples +{ + if ((self = [super init])) + { + if ( sharegroup == nil ) + { + context_ = [[EAGLContext alloc] initWithAPI:kEAGLRenderingAPIOpenGLES1]; + } + else + { + context_ = [[EAGLContext alloc] initWithAPI:kEAGLRenderingAPIOpenGLES1 sharegroup:sharegroup]; + } + + if (!context_ || ![EAGLContext setCurrentContext:context_]) + { + [self release]; + return nil; + } + + // Create default framebuffer object. The backing will be allocated for the current layer in -resizeFromLayer + glGenFramebuffersOES(1, &defaultFramebuffer_); + NSAssert( defaultFramebuffer_, @"Can't create default frame buffer"); + glGenRenderbuffersOES(1, &colorRenderbuffer_); + NSAssert( colorRenderbuffer_, @"Can't create default render buffer"); + + glBindFramebufferOES(GL_FRAMEBUFFER_OES, defaultFramebuffer_); + glBindRenderbufferOES(GL_RENDERBUFFER_OES, colorRenderbuffer_); + glFramebufferRenderbufferOES(GL_FRAMEBUFFER_OES, GL_COLOR_ATTACHMENT0_OES, GL_RENDERBUFFER_OES, colorRenderbuffer_); + + depthFormat_ = depthFormat; + + if( depthFormat_ ) { +// glGenRenderbuffersOES(1, &depthBuffer_); +// glBindRenderbufferOES(GL_RENDERBUFFER_OES, depthBuffer_); +// glRenderbufferStorageOES(GL_RENDERBUFFER_OES, depthFormat_, 100, 100); +// glFramebufferRenderbufferOES(GL_FRAMEBUFFER_OES, GL_DEPTH_ATTACHMENT_OES, GL_RENDERBUFFER_OES, depthBuffer_); + + // default buffer +// glBindRenderbufferOES(GL_RENDERBUFFER_OES, colorRenderbuffer_); + } + + pixelFormat_ = pixelFormat; + multiSampling_ = multiSampling; + if (multiSampling_) + { + GLint maxSamplesAllowed; + glGetIntegerv(GL_MAX_SAMPLES_APPLE, &maxSamplesAllowed); + samplesToUse_ = MIN(maxSamplesAllowed,requestedSamples); + + /* Create the MSAA framebuffer (offscreen) */ + glGenFramebuffersOES(1, &msaaFramebuffer_); + glBindFramebufferOES(GL_FRAMEBUFFER_OES, msaaFramebuffer_); + + } + + CHECK_GL_ERROR(); + } + + return self; +} + +- (BOOL)resizeFromLayer:(CAEAGLLayer *)layer +{ + // Allocate color buffer backing based on the current layer size + + glBindRenderbufferOES(GL_RENDERBUFFER_OES, colorRenderbuffer_); + + if (![context_ renderbufferStorage:GL_RENDERBUFFER_OES fromDrawable:layer]) + { + CCLOG(@"failed to call context"); + } + + glGetRenderbufferParameterivOES(GL_RENDERBUFFER_OES, GL_RENDERBUFFER_WIDTH_OES, &backingWidth_); + glGetRenderbufferParameterivOES(GL_RENDERBUFFER_OES, GL_RENDERBUFFER_HEIGHT_OES, &backingHeight_); + + CCLOG(@"cocos2d: surface size: %dx%d", (int)backingWidth_, (int)backingHeight_); + + if (multiSampling_) + { + + if ( msaaColorbuffer_) { + glDeleteRenderbuffersOES(1, &msaaColorbuffer_); + msaaColorbuffer_ = 0; + } + + /* Create the offscreen MSAA color buffer. + After rendering, the contents of this will be blitted into ColorRenderbuffer */ + + //msaaFrameBuffer needs to be binded + glBindFramebufferOES(GL_FRAMEBUFFER_OES, msaaFramebuffer_); + glGenRenderbuffersOES(1, &msaaColorbuffer_); + glBindRenderbufferOES(GL_RENDERBUFFER_OES, msaaColorbuffer_); + glRenderbufferStorageMultisampleAPPLE(GL_RENDERBUFFER_OES, samplesToUse_,pixelFormat_ , backingWidth_, backingHeight_); + glFramebufferRenderbufferOES(GL_FRAMEBUFFER_OES, GL_COLOR_ATTACHMENT0_OES, GL_RENDERBUFFER_OES, msaaColorbuffer_); + + if (glCheckFramebufferStatusOES(GL_FRAMEBUFFER_OES) != GL_FRAMEBUFFER_COMPLETE_OES) + { + CCLOG(@"Failed to make complete framebuffer object %x", glCheckFramebufferStatusOES(GL_FRAMEBUFFER_OES)); + return NO; + } + } + + if (depthFormat_) + { + if( ! depthBuffer_ ) + glGenRenderbuffersOES(1, &depthBuffer_); + + glBindRenderbufferOES(GL_RENDERBUFFER_OES, depthBuffer_); + if( multiSampling_ ) + glRenderbufferStorageMultisampleAPPLE(GL_RENDERBUFFER_OES, samplesToUse_, depthFormat_,backingWidth_, backingHeight_); + else + glRenderbufferStorageOES(GL_RENDERBUFFER_OES, depthFormat_, backingWidth_, backingHeight_); + glFramebufferRenderbufferOES(GL_FRAMEBUFFER_OES, GL_DEPTH_ATTACHMENT_OES, GL_RENDERBUFFER_OES, depthBuffer_); + + // bind color buffer + glBindRenderbufferOES(GL_RENDERBUFFER_OES, colorRenderbuffer_); + } + + glBindFramebufferOES(GL_FRAMEBUFFER_OES, defaultFramebuffer_); + + if (glCheckFramebufferStatusOES(GL_FRAMEBUFFER_OES) != GL_FRAMEBUFFER_COMPLETE_OES) + { + CCLOG(@"Failed to make complete framebuffer object %x", glCheckFramebufferStatusOES(GL_FRAMEBUFFER_OES)); + return NO; + } + + CHECK_GL_ERROR(); + + return YES; +} + +-(CGSize) backingSize +{ + return CGSizeMake( backingWidth_, backingHeight_); +} + +- (NSString*) description +{ + return [NSString stringWithFormat:@"<%@ = %08X | size = %ix%i>", [self class], self, backingWidth_, backingHeight_]; +} + + +- (void)dealloc +{ + CCLOGINFO(@"cocos2d: deallocing %@", self); + + // Tear down GL + if(defaultFramebuffer_) + { + glDeleteFramebuffersOES(1, &defaultFramebuffer_); + defaultFramebuffer_ = 0; + } + + if(colorRenderbuffer_) + { + glDeleteRenderbuffersOES(1, &colorRenderbuffer_); + colorRenderbuffer_ = 0; + } + + if( depthBuffer_ ) + { + glDeleteRenderbuffersOES(1, &depthBuffer_); + depthBuffer_ = 0; + } + + if ( msaaColorbuffer_) + { + glDeleteRenderbuffersOES(1, &msaaColorbuffer_); + msaaColorbuffer_ = 0; + } + + if ( msaaFramebuffer_) + { + glDeleteRenderbuffersOES(1, &msaaFramebuffer_); + msaaFramebuffer_ = 0; + } + + // Tear down context + if ([EAGLContext currentContext] == context_) + [EAGLContext setCurrentContext:nil]; + + [context_ release]; + context_ = nil; + + [super dealloc]; +} + +- (unsigned int) colorRenderBuffer +{ + return colorRenderbuffer_; +} + +- (unsigned int) defaultFrameBuffer +{ + return defaultFramebuffer_; +} + +- (unsigned int) msaaFrameBuffer +{ + return msaaFramebuffer_; +} + +- (unsigned int) msaaColorBuffer +{ + return msaaColorbuffer_; +} + +@end + +#endif // __IPHONE_OS_VERSION_MAX_ALLOWED diff --git a/libs/cocos2d/Platforms/iOS/ESRenderer.h b/libs/cocos2d/Platforms/iOS/ESRenderer.h new file mode 100755 index 0000000..e612eee --- /dev/null +++ b/libs/cocos2d/Platforms/iOS/ESRenderer.h @@ -0,0 +1,54 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + * + * File autogenerated with Xcode. Adapted for cocos2d needs. + */ + +// Only compile this code on iOS. These files should NOT be included on your Mac project. +// But in case they are included, it won't be compiled. +#import +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED + +#import + +#import +#import + +@protocol ESRenderer + +- (id) initWithDepthFormat:(unsigned int)depthFormat withPixelFormat:(unsigned int)pixelFormat withSharegroup:(EAGLSharegroup*)sharegroup withMultiSampling:(BOOL) multiSampling withNumberOfSamples:(unsigned int) requestedSamples; + +- (BOOL) resizeFromLayer:(CAEAGLLayer *)layer; + +- (EAGLContext*) context; +- (CGSize) backingSize; + +- (unsigned int) colorRenderBuffer; +- (unsigned int) defaultFrameBuffer; +- (unsigned int) msaaFrameBuffer; +- (unsigned int) msaaColorBuffer; +@end + +#endif // __IPHONE_OS_VERSION_MAX_ALLOWED diff --git a/libs/cocos2d/Platforms/iOS/glu.c b/libs/cocos2d/Platforms/iOS/glu.c new file mode 100755 index 0000000..2e00d5f --- /dev/null +++ b/libs/cocos2d/Platforms/iOS/glu.c @@ -0,0 +1,113 @@ +// +// cocos2d (incomplete) GLU implementation +// +// gluLookAt and gluPerspective from: +// http://jet.ro/creations (San Angeles Observation) +// +// + +// Only compile this code on iOS. These files should NOT be included on your Mac project. +// But in case they are included, it won't be compiled. +#import +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED + +#import +#import +#import "../../Support/OpenGL_Internal.h" +#include "glu.h" + +void gluPerspective(GLfloat fovy, GLfloat aspect, GLfloat zNear, GLfloat zFar) +{ + GLfloat xmin, xmax, ymin, ymax; + + ymax = zNear * (GLfloat)tanf(fovy * (float)M_PI / 360); + ymin = -ymax; + xmin = ymin * aspect; + xmax = ymax * aspect; + + glFrustumf(xmin, xmax, + ymin, ymax, + zNear, zFar); +} + +void gluLookAt(GLfloat eyex, GLfloat eyey, GLfloat eyez, + GLfloat centerx, GLfloat centery, GLfloat centerz, + GLfloat upx, GLfloat upy, GLfloat upz) +{ + GLfloat m[16]; + GLfloat x[3], y[3], z[3]; + GLfloat mag; + + /* Make rotation matrix */ + + /* Z vector */ + z[0] = eyex - centerx; + z[1] = eyey - centery; + z[2] = eyez - centerz; + mag = (float)sqrtf(z[0] * z[0] + z[1] * z[1] + z[2] * z[2]); + if (mag) { + z[0] /= mag; + z[1] /= mag; + z[2] /= mag; + } + + /* Y vector */ + y[0] = upx; + y[1] = upy; + y[2] = upz; + + /* X vector = Y cross Z */ + x[0] = y[1] * z[2] - y[2] * z[1]; + x[1] = -y[0] * z[2] + y[2] * z[0]; + x[2] = y[0] * z[1] - y[1] * z[0]; + + /* Recompute Y = Z cross X */ + y[0] = z[1] * x[2] - z[2] * x[1]; + y[1] = -z[0] * x[2] + z[2] * x[0]; + y[2] = z[0] * x[1] - z[1] * x[0]; + + /* cross product gives area of parallelogram, which is < 1.0 for + * non-perpendicular unit-length vectors; so normalize x, y here + */ + + mag = (float)sqrtf(x[0] * x[0] + x[1] * x[1] + x[2] * x[2]); + if (mag) { + x[0] /= mag; + x[1] /= mag; + x[2] /= mag; + } + + mag = (float)sqrtf(y[0] * y[0] + y[1] * y[1] + y[2] * y[2]); + if (mag) { + y[0] /= mag; + y[1] /= mag; + y[2] /= mag; + } + +#define M(row,col) m[col*4+row] + M(0, 0) = x[0]; + M(0, 1) = x[1]; + M(0, 2) = x[2]; + M(0, 3) = 0.0f; + M(1, 0) = y[0]; + M(1, 1) = y[1]; + M(1, 2) = y[2]; + M(1, 3) = 0.0f; + M(2, 0) = z[0]; + M(2, 1) = z[1]; + M(2, 2) = z[2]; + M(2, 3) = 0.0f; + M(3, 0) = 0.0f; + M(3, 1) = 0.0f; + M(3, 2) = 0.0f; + M(3, 3) = 1.0f; +#undef M + + glMultMatrixf(m); + + + /* Translate Eye to Origin */ + glTranslatef(-eyex, -eyey, -eyez); +} + +#endif // __IPHONE_OS_VERSION_MAX_ALLOWED diff --git a/libs/cocos2d/Platforms/iOS/glu.h b/libs/cocos2d/Platforms/iOS/glu.h new file mode 100755 index 0000000..86dcac7 --- /dev/null +++ b/libs/cocos2d/Platforms/iOS/glu.h @@ -0,0 +1,29 @@ +// +// cocos2d GLU implementation +// +// implementation of GLU functions +// +#ifndef __COCOS2D_GLU_H +#define __COCOS2D_GLU_H + +// Only compile this code on iOS. These files should NOT be included on your Mac project. +// But in case they are included, it won't be compiled. +#import +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED + +#import + +/** + @file + cocos2d OpenGL GLU implementation + */ + +/** OpenGL gluLookAt implementation */ +void gluLookAt(float eyeX, float eyeY, float eyeZ, float lookAtX, float lookAtY, float lookAtZ, float upX, float upY, float upZ); +/** OpenGL gluPerspective implementation */ +void gluPerspective(GLfloat fovy, GLfloat aspect, GLfloat zNear, GLfloat zFar); + +#endif // __IPHONE_OS_VERSION_MAX_ALLOWED + +#endif /* __COCOS2D_GLU_H */ + diff --git a/libs/cocos2d/Support/CCArray.h b/libs/cocos2d/Support/CCArray.h new file mode 100755 index 0000000..0c7b2b8 --- /dev/null +++ b/libs/cocos2d/Support/CCArray.h @@ -0,0 +1,106 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2010 ForzeField Studios S.L. http://forzefield.com + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ + + +#import "ccCArray.h" + + +/** A faster alternative of NSArray. + CCArray uses internally a c-array. + @since v0.99.4 + */ + + +/** @def CCARRAY_FOREACH + A convience macro to iterate over a CCArray using. It is faster than the "fast enumeration" interface. + @since v0.99.4 + */ + +#define CCARRAY_FOREACH(__array__, __object__) \ +if (__array__ && __array__->data->num > 0) \ +for(id *__arr__ = __array__->data->arr, *end = __array__->data->arr + __array__->data->num-1; \ + __arr__ <= end && ((__object__ = *__arr__) != nil || true); \ + __arr__++) + +@interface CCArray : NSObject +{ + @public ccArray *data; +} + ++ (id) array; ++ (id) arrayWithCapacity:(NSUInteger)capacity; ++ (id) arrayWithArray:(CCArray*)otherArray; ++ (id) arrayWithNSArray:(NSArray*)otherArray; + + +- (id) initWithCapacity:(NSUInteger)capacity; +- (id) initWithArray:(CCArray*)otherArray; +- (id) initWithNSArray:(NSArray*)otherArray; + + +// Querying an Array + +- (NSUInteger) count; +- (NSUInteger) capacity; +- (NSUInteger) indexOfObject:(id)object; +- (id) objectAtIndex:(NSUInteger)index; +- (BOOL) containsObject:(id)object; +- (id) randomObject; +- (id) lastObject; +- (NSArray*) getNSArray; + + +// Adding Objects + +- (void) addObject:(id)object; +- (void) addObjectsFromArray:(CCArray*)otherArray; +- (void) addObjectsFromNSArray:(NSArray*)otherArray; +- (void) insertObject:(id)object atIndex:(NSUInteger)index; + + +// Removing Objects + +- (void) removeLastObject; +- (void) removeObject:(id)object; +- (void) removeObjectAtIndex:(NSUInteger)index; +- (void) removeObjectsInArray:(CCArray*)otherArray; +- (void) removeAllObjects; +- (void) fastRemoveObject:(id)object; +- (void) fastRemoveObjectAtIndex:(NSUInteger)index; + + +// Rearranging Content + +- (void) exchangeObject:(id)object1 withObject:(id)object2; +- (void) exchangeObjectAtIndex:(NSUInteger)index1 withObjectAtIndex:(NSUInteger)index2; +- (void) reverseObjects; +- (void) reduceMemoryFootprint; + +// Sending Messages to Elements + +- (void) makeObjectsPerformSelector:(SEL)aSelector; +- (void) makeObjectsPerformSelector:(SEL)aSelector withObject:(id)object; + + +@end diff --git a/libs/cocos2d/Support/CCArray.m b/libs/cocos2d/Support/CCArray.m new file mode 100755 index 0000000..a48a5f3 --- /dev/null +++ b/libs/cocos2d/Support/CCArray.m @@ -0,0 +1,290 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2010 ForzeField Studios S.L. http://forzefield.com + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ + +#import "CCArray.h" +#import "../ccMacros.h" + + +@implementation CCArray + ++ (id) array +{ + return [[[self alloc] init] autorelease]; +} + ++ (id) arrayWithCapacity:(NSUInteger)capacity +{ + return [[[self alloc] initWithCapacity:capacity] autorelease]; +} + ++ (id) arrayWithArray:(CCArray*)otherArray +{ + return [[(CCArray*)[self alloc] initWithArray:otherArray] autorelease]; +} + ++ (id) arrayWithNSArray:(NSArray*)otherArray +{ + return [[(CCArray*)[self alloc] initWithNSArray:otherArray] autorelease]; +} + +- (id) init +{ + self = [self initWithCapacity:2]; + return self; +} + +- (id) initWithCapacity:(NSUInteger)capacity +{ + self = [super init]; + if (self != nil) { + data = ccArrayNew(capacity); + } + return self; +} + +- (id) initWithArray:(CCArray*)otherArray +{ + self = [self initWithCapacity:otherArray->data->num]; + if (self != nil) { + [self addObjectsFromArray:otherArray]; + } + return self; +} + +- (id) initWithNSArray:(NSArray*)otherArray +{ + self = [self initWithCapacity:otherArray.count]; + if (self != nil) { + [self addObjectsFromNSArray:otherArray]; + } + return self; +} + +- (id) initWithCoder:(NSCoder*)coder +{ + self = [self initWithNSArray:[coder decodeObjectForKey:@"nsarray"]]; + return self; +} + + +#pragma mark Querying an Array + +- (NSUInteger) count +{ + return data->num; +} + +- (NSUInteger) capacity +{ + return data->max; +} + +- (NSUInteger) indexOfObject:(id)object +{ + return ccArrayGetIndexOfObject(data, object); +} + +- (id) objectAtIndex:(NSUInteger)index +{ + NSAssert2( index < data->num, @"index out of range in objectAtIndex(%d), index %i", data->num, index ); + + return data->arr[index]; +} + +- (BOOL) containsObject:(id)object +{ + return ccArrayContainsObject(data, object); +} + +- (id) lastObject +{ + if( data->num > 0 ) + return data->arr[data->num-1]; + return nil; +} + +- (id) randomObject +{ + if(data->num==0) return nil; + return data->arr[(int)(data->num*CCRANDOM_0_1())]; +} + +- (NSArray*) getNSArray +{ + return [NSArray arrayWithObjects:data->arr count:data->num]; +} + + +#pragma mark Adding Objects + +- (void) addObject:(id)object +{ + ccArrayAppendObjectWithResize(data, object); +} + +- (void) addObjectsFromArray:(CCArray*)otherArray +{ + ccArrayAppendArrayWithResize(data, otherArray->data); +} + +- (void) addObjectsFromNSArray:(NSArray*)otherArray +{ + ccArrayEnsureExtraCapacity(data, otherArray.count); + for(id object in otherArray) + ccArrayAppendObject(data, object); +} + +- (void) insertObject:(id)object atIndex:(NSUInteger)index +{ + ccArrayInsertObjectAtIndex(data, object, index); +} + + +#pragma mark Removing Objects + +- (void) removeObject:(id)object +{ + ccArrayRemoveObject(data, object); +} + +- (void) removeObjectAtIndex:(NSUInteger)index +{ + ccArrayRemoveObjectAtIndex(data, index); +} + +- (void) fastRemoveObject:(id)object +{ + ccArrayFastRemoveObject(data, object); +} + +- (void) fastRemoveObjectAtIndex:(NSUInteger)index +{ + ccArrayFastRemoveObjectAtIndex(data, index); +} + +- (void) removeObjectsInArray:(CCArray*)otherArray +{ + ccArrayRemoveArray(data, otherArray->data); +} + +- (void) removeLastObject +{ + NSAssert( data->num > 0, @"no objects added" ); + + ccArrayRemoveObjectAtIndex(data, data->num-1); +} + +- (void) removeAllObjects +{ + ccArrayRemoveAllObjects(data); +} + + +#pragma mark Rearranging Content + +- (void) exchangeObject:(id)object1 withObject:(id)object2 +{ + NSUInteger index1 = ccArrayGetIndexOfObject(data, object1); + if(index1 == NSNotFound) return; + NSUInteger index2 = ccArrayGetIndexOfObject(data, object2); + if(index2 == NSNotFound) return; + + ccArraySwapObjectsAtIndexes(data, index1, index2); +} + +- (void) exchangeObjectAtIndex:(NSUInteger)index1 withObjectAtIndex:(NSUInteger)index2 +{ + ccArraySwapObjectsAtIndexes(data, index1, index2); +} + +- (void) reverseObjects +{ + if (data->num > 1) + { + //floor it since in case of a oneven number the number of swaps stays the same + int count = (int) floorf(data->num/2.f); + NSUInteger maxIndex = data->num - 1; + + for (int i = 0; i < count ; i++) + { + ccArraySwapObjectsAtIndexes(data, i, maxIndex); + maxIndex--; + } + } +} + +- (void) reduceMemoryFootprint +{ + ccArrayShrink(data); +} + +#pragma mark Sending Messages to Elements + +- (void) makeObjectsPerformSelector:(SEL)aSelector +{ + ccArrayMakeObjectsPerformSelector(data, aSelector); +} + +- (void) makeObjectsPerformSelector:(SEL)aSelector withObject:(id)object +{ + ccArrayMakeObjectsPerformSelectorWithObject(data, aSelector, object); +} + + +#pragma mark CCArray - NSFastEnumeration protocol + +- (NSUInteger)countByEnumeratingWithState:(NSFastEnumerationState *)state objects:(id *)stackbuf count:(NSUInteger)len +{ + if(state->state == 1) return 0; + + state->mutationsPtr = (unsigned long *)self; + state->itemsPtr = &data->arr[0]; + state->state = 1; + return data->num; +} + + +#pragma mark CCArray - NSCopying protocol + +- (id)copyWithZone:(NSZone *)zone +{ + NSArray *nsArray = [self getNSArray]; + CCArray *newArray = [[[self class] allocWithZone:zone] initWithNSArray:nsArray]; + return newArray; +} + +- (void) encodeWithCoder:(NSCoder *)coder +{ + [coder encodeObject:[self getNSArray] forKey:@"nsarray"]; +} + +#pragma mark + +- (void) dealloc +{ + ccArrayFree(data); + [super dealloc]; +} + +@end diff --git a/libs/cocos2d/Support/CCFileUtils.h b/libs/cocos2d/Support/CCFileUtils.h new file mode 100755 index 0000000..0455202 --- /dev/null +++ b/libs/cocos2d/Support/CCFileUtils.h @@ -0,0 +1,62 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2008-2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + + +#import + + +/** Helper class to handle file operations */ +@interface CCFileUtils : NSObject +{ +} + +/** Returns the fullpath of an filename. + + If this method is when Retina Display is enabled, then the + Retina Display suffix will be appended to the file (See ccConfig.h). + + If the Retina Display image doesn't exist, then it will return the "non-Retina Display" image + + */ ++(NSString*) fullPathFromRelativePath:(NSString*) relPath; +@end + +/** loads a file into memory. + the caller should release the allocated buffer. + + @returns the size of the allocated buffer + @since v0.99.5 + */ +NSInteger ccLoadFileIntoMemory(const char *filename, unsigned char **out); + + +/** removes the HD suffix from a path + + @returns NSString * without the HD suffix + @since v0.99.5 + */ +NSString *ccRemoveHDSuffixFromFile( NSString *path ); + diff --git a/libs/cocos2d/Support/CCFileUtils.m b/libs/cocos2d/Support/CCFileUtils.m new file mode 100755 index 0000000..6d33799 --- /dev/null +++ b/libs/cocos2d/Support/CCFileUtils.m @@ -0,0 +1,169 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2008-2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + + +#import +#import "CCFileUtils.h" +#import "../CCConfiguration.h" +#import "../ccMacros.h" +#import "../ccConfig.h" + +static NSFileManager *__localFileManager=nil; + +// +NSInteger ccLoadFileIntoMemory(const char *filename, unsigned char **out) +{ + NSCAssert( out, @"ccLoadFileIntoMemory: invalid 'out' parameter"); + NSCAssert( &*out, @"ccLoadFileIntoMemory: invalid 'out' parameter"); + + size_t size = 0; + FILE *f = fopen(filename, "rb"); + if( !f ) { + *out = NULL; + return -1; + } + + fseek(f, 0, SEEK_END); + size = ftell(f); + fseek(f, 0, SEEK_SET); + + *out = malloc(size); + size_t read = fread(*out, 1, size, f); + if( read != size ) { + free(*out); + *out = NULL; + return -1; + } + + fclose(f); + + return size; +} + +NSString *ccRemoveHDSuffixFromFile( NSString *path ) +{ +#if CC_IS_RETINA_DISPLAY_SUPPORTED + + if( CC_CONTENT_SCALE_FACTOR() == 2 ) { + + NSString *name = [path lastPathComponent]; + + // check if path already has the suffix. + if( [name rangeOfString:CC_RETINA_DISPLAY_FILENAME_SUFFIX].location != NSNotFound ) { + + CCLOG(@"cocos2d: Filename(%@) contains %@ suffix. Removing it. See cocos2d issue #1040", path, CC_RETINA_DISPLAY_FILENAME_SUFFIX); + + NSString *newLastname = [name stringByReplacingOccurrencesOfString:CC_RETINA_DISPLAY_FILENAME_SUFFIX withString:@""]; + + NSString *pathWithoutLastname = [path stringByDeletingLastPathComponent]; + return [pathWithoutLastname stringByAppendingPathComponent:newLastname]; + } + } + +#endif // CC_IS_RETINA_DISPLAY_SUPPORTED + + return path; + +} + + +@implementation CCFileUtils + ++(void) initialize +{ + if( self == [CCFileUtils class] ) + __localFileManager = [[NSFileManager alloc] init]; +} + ++(NSString*) getDoubleResolutionImage:(NSString*)path +{ +#if CC_IS_RETINA_DISPLAY_SUPPORTED + + if( CC_CONTENT_SCALE_FACTOR() == 2 ) + { + + NSString *pathWithoutExtension = [path stringByDeletingPathExtension]; + NSString *name = [pathWithoutExtension lastPathComponent]; + + // check if path already has the suffix. + if( [name rangeOfString:CC_RETINA_DISPLAY_FILENAME_SUFFIX].location != NSNotFound ) { + + CCLOG(@"cocos2d: WARNING Filename(%@) already has the suffix %@. Using it.", name, CC_RETINA_DISPLAY_FILENAME_SUFFIX); + return path; + } + + + NSString *extension = [path pathExtension]; + + if( [extension isEqualToString:@"ccz"] || [extension isEqualToString:@"gz"] ) + { + // All ccz / gz files should be in the format filename.xxx.ccz + // so we need to pull off the .xxx part of the extension as well + extension = [NSString stringWithFormat:@"%@.%@", [pathWithoutExtension pathExtension], extension]; + pathWithoutExtension = [pathWithoutExtension stringByDeletingPathExtension]; + } + + + NSString *retinaName = [pathWithoutExtension stringByAppendingString:CC_RETINA_DISPLAY_FILENAME_SUFFIX]; + retinaName = [retinaName stringByAppendingPathExtension:extension]; + + if( [__localFileManager fileExistsAtPath:retinaName] ) + return retinaName; + + CCLOG(@"cocos2d: CCFileUtils: Warning HD file not found: %@", [retinaName lastPathComponent] ); + } + +#endif // CC_IS_RETINA_DISPLAY_SUPPORTED + + return path; +} + ++(NSString*) fullPathFromRelativePath:(NSString*) relPath +{ + NSAssert(relPath != nil, @"CCFileUtils: Invalid path"); + + NSString *fullpath = nil; + + // only if it is not an absolute path + if( ! [relPath isAbsolutePath] ) + { + NSString *file = [relPath lastPathComponent]; + NSString *imageDirectory = [relPath stringByDeletingLastPathComponent]; + + fullpath = [[NSBundle mainBundle] pathForResource:file + ofType:nil + inDirectory:imageDirectory]; + } + + if (fullpath == nil) + fullpath = relPath; + + fullpath = [self getDoubleResolutionImage:fullpath]; + + return fullpath; +} + +@end diff --git a/libs/cocos2d/Support/CCProfiling.h b/libs/cocos2d/Support/CCProfiling.h new file mode 100755 index 0000000..b241fb9 --- /dev/null +++ b/libs/cocos2d/Support/CCProfiling.h @@ -0,0 +1,53 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2010 Stuart Carnie + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + + +#import +#import + +@class CCProfilingTimer; + +@interface CCProfiler : NSObject { + NSMutableArray* activeTimers; +} + ++ (CCProfiler*)sharedProfiler; ++ (CCProfilingTimer*)timerWithName:(NSString*)timerName andInstance:(id)instance; ++ (void)releaseTimer:(CCProfilingTimer*)timer; +- (void)displayTimers; + +@end + + +@interface CCProfilingTimer : NSObject { + NSString* name; + struct timeval startTime; + double averageTime; +} + +@end + +extern void CCProfilingBeginTimingBlock(CCProfilingTimer* timer); +extern void CCProfilingEndTimingBlock(CCProfilingTimer* timer); diff --git a/libs/cocos2d/Support/CCProfiling.m b/libs/cocos2d/Support/CCProfiling.m new file mode 100755 index 0000000..13c8c81 --- /dev/null +++ b/libs/cocos2d/Support/CCProfiling.m @@ -0,0 +1,117 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2010 Stuart Carnie + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + +#import "../ccConfig.h" + +#if CC_ENABLE_PROFILERS + +#import "CCProfiling.h" + +@interface CCProfilingTimer() +- (id)initWithName:(NSString*)timerName andInstance:(id)instance; +@end + +@implementation CCProfiler + +static CCProfiler* g_sharedProfiler; + ++ (CCProfiler*)sharedProfiler { + if (!g_sharedProfiler) + g_sharedProfiler = [[CCProfiler alloc] init]; + + return g_sharedProfiler; +} + ++ (CCProfilingTimer*)timerWithName:(NSString*)timerName andInstance:(id)instance { + CCProfiler* p = [CCProfiler sharedProfiler]; + CCProfilingTimer* t = [[CCProfilingTimer alloc] initWithName:timerName andInstance:instance]; + [p->activeTimers addObject:t]; + [t release]; + return t; +} + ++ (void)releaseTimer:(CCProfilingTimer*)timer { + CCProfiler* p = [CCProfiler sharedProfiler]; + [p->activeTimers removeObject:timer]; +} + +- (id)init { + if (!(self = [super init])) return nil; + + activeTimers = [[NSMutableArray alloc] init]; + + return self; +} + +- (void)dealloc { + [activeTimers release]; + [super dealloc]; +} + +- (void)displayTimers { + for (id timer in activeTimers) { + printf("%s\n", [[timer description] cStringUsingEncoding:[NSString defaultCStringEncoding]]); + } +} + +@end + +@implementation CCProfilingTimer + +- (id)initWithName:(NSString*)timerName andInstance:(id)instance { + if (!(self = [super init])) return nil; + + name = [[NSString stringWithFormat:@"%@ (0x%.8x)", timerName, instance] retain]; + + return self; +} + +- (void)dealloc { + [name release]; + [super dealloc]; +} + +- (NSString*)description { + return [NSString stringWithFormat:@"%@ : avg time, %fms", name, averageTime]; +} + +void CCProfilingBeginTimingBlock(CCProfilingTimer* timer) { + gettimeofday(&timer->startTime, NULL); +} + +typedef unsigned int uint32; +void CCProfilingEndTimingBlock(CCProfilingTimer* timer) { + struct timeval currentTime; + gettimeofday(¤tTime, NULL); + timersub(¤tTime, &timer->startTime, ¤tTime); + double duration = currentTime.tv_sec * 1000.0 + currentTime.tv_usec / 1000.0; + + // return in milliseconds + timer->averageTime = (timer->averageTime + duration) / 2.0f; +} + +@end + +#endif diff --git a/libs/cocos2d/Support/CGPointExtension.h b/libs/cocos2d/Support/CGPointExtension.h new file mode 100755 index 0000000..96edeb7 --- /dev/null +++ b/libs/cocos2d/Support/CGPointExtension.h @@ -0,0 +1,334 @@ +/* cocos2d for iPhone + * http://www.cocos2d-iphone.org + * + * Copyright (c) 2007 Scott Lembcke + * + * Copyright (c) 2010 Lam Pham + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE + * SOFTWARE. + */ + +/* + * Some of the functions were based on Chipmunk's cpVect.h. + */ + +/** + @file + CGPoint extensions based on Chipmunk's cpVect file. + These extensions work both with CGPoint and cpVect. + + The "ccp" prefix means: "CoCos2d Point" + + Examples: + - ccpAdd( ccp(1,1), ccp(2,2) ); // preferred cocos2d way + - ccpAdd( CGPointMake(1,1), CGPointMake(2,2) ); // also ok but more verbose + + - cpvadd( cpv(1,1), cpv(2,2) ); // way of the chipmunk + - ccpAdd( cpv(1,1), cpv(2,2) ); // mixing chipmunk and cocos2d (avoid) + - cpvadd( CGPointMake(1,1), CGPointMake(2,2) ); // mixing chipmunk and CG (avoid) + */ + +#import + +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED +#import +#elif defined(__MAC_OS_X_VERSION_MAX_ALLOWED) +#import +#endif + +#import +#import + +#ifdef __cplusplus +extern "C" { +#endif + +/** Helper macro that creates a CGPoint + @return CGPoint + @since v0.7.2 + */ +#define ccp(__X__,__Y__) CGPointMake(__X__,__Y__) + + +/** Returns opposite of point. + @return CGPoint + @since v0.7.2 + */ +static inline CGPoint +ccpNeg(const CGPoint v) +{ + return ccp(-v.x, -v.y); +} + +/** Calculates sum of two points. + @return CGPoint + @since v0.7.2 + */ +static inline CGPoint +ccpAdd(const CGPoint v1, const CGPoint v2) +{ + return ccp(v1.x + v2.x, v1.y + v2.y); +} + +/** Calculates difference of two points. + @return CGPoint + @since v0.7.2 + */ +static inline CGPoint +ccpSub(const CGPoint v1, const CGPoint v2) +{ + return ccp(v1.x - v2.x, v1.y - v2.y); +} + +/** Returns point multiplied by given factor. + @return CGPoint + @since v0.7.2 + */ +static inline CGPoint +ccpMult(const CGPoint v, const CGFloat s) +{ + return ccp(v.x*s, v.y*s); +} + +/** Calculates midpoint between two points. + @return CGPoint + @since v0.7.2 + */ +static inline CGPoint +ccpMidpoint(const CGPoint v1, const CGPoint v2) +{ + return ccpMult(ccpAdd(v1, v2), 0.5f); +} + +/** Calculates dot product of two points. + @return CGFloat + @since v0.7.2 + */ +static inline CGFloat +ccpDot(const CGPoint v1, const CGPoint v2) +{ + return v1.x*v2.x + v1.y*v2.y; +} + +/** Calculates cross product of two points. + @return CGFloat + @since v0.7.2 + */ +static inline CGFloat +ccpCross(const CGPoint v1, const CGPoint v2) +{ + return v1.x*v2.y - v1.y*v2.x; +} + +/** Calculates perpendicular of v, rotated 90 degrees counter-clockwise -- cross(v, perp(v)) >= 0 + @return CGPoint + @since v0.7.2 + */ +static inline CGPoint +ccpPerp(const CGPoint v) +{ + return ccp(-v.y, v.x); +} + +/** Calculates perpendicular of v, rotated 90 degrees clockwise -- cross(v, rperp(v)) <= 0 + @return CGPoint + @since v0.7.2 + */ +static inline CGPoint +ccpRPerp(const CGPoint v) +{ + return ccp(v.y, -v.x); +} + +/** Calculates the projection of v1 over v2. + @return CGPoint + @since v0.7.2 + */ +static inline CGPoint +ccpProject(const CGPoint v1, const CGPoint v2) +{ + return ccpMult(v2, ccpDot(v1, v2)/ccpDot(v2, v2)); +} + +/** Rotates two points. + @return CGPoint + @since v0.7.2 + */ +static inline CGPoint +ccpRotate(const CGPoint v1, const CGPoint v2) +{ + return ccp(v1.x*v2.x - v1.y*v2.y, v1.x*v2.y + v1.y*v2.x); +} + +/** Unrotates two points. + @return CGPoint + @since v0.7.2 + */ +static inline CGPoint +ccpUnrotate(const CGPoint v1, const CGPoint v2) +{ + return ccp(v1.x*v2.x + v1.y*v2.y, v1.y*v2.x - v1.x*v2.y); +} + +/** Calculates the square length of a CGPoint (not calling sqrt() ) + @return CGFloat + @since v0.7.2 + */ +static inline CGFloat +ccpLengthSQ(const CGPoint v) +{ + return ccpDot(v, v); +} + +/** Calculates distance between point an origin + @return CGFloat + @since v0.7.2 + */ +CGFloat ccpLength(const CGPoint v); + +/** Calculates the distance between two points + @return CGFloat + @since v0.7.2 + */ +CGFloat ccpDistance(const CGPoint v1, const CGPoint v2); + +/** Returns point multiplied to a length of 1. + @return CGPoint + @since v0.7.2 + */ +CGPoint ccpNormalize(const CGPoint v); + +/** Converts radians to a normalized vector. + @return CGPoint + @since v0.7.2 + */ +CGPoint ccpForAngle(const CGFloat a); + +/** Converts a vector to radians. + @return CGFloat + @since v0.7.2 + */ +CGFloat ccpToAngle(const CGPoint v); + + +/** Clamp a value between from and to. + @since v0.99.1 + */ +float clampf(float value, float min_inclusive, float max_inclusive); + +/** Clamp a point between from and to. + @since v0.99.1 + */ +CGPoint ccpClamp(CGPoint p, CGPoint from, CGPoint to); + +/** Quickly convert CGSize to a CGPoint + @since v0.99.1 + */ +CGPoint ccpFromSize(CGSize s); + +/** Run a math operation function on each point component + * absf, fllorf, ceilf, roundf + * any function that has the signature: float func(float); + * For example: let's try to take the floor of x,y + * ccpCompOp(p,floorf); + @since v0.99.1 + */ +CGPoint ccpCompOp(CGPoint p, float (*opFunc)(float)); + +/** Linear Interpolation between two points a and b + @returns + alpha == 0 ? a + alpha == 1 ? b + otherwise a value between a..b + @since v0.99.1 + */ +CGPoint ccpLerp(CGPoint a, CGPoint b, float alpha); + + +/** @returns if points have fuzzy equality which means equal with some degree of variance. + @since v0.99.1 + */ +BOOL ccpFuzzyEqual(CGPoint a, CGPoint b, float variance); + + +/** Multiplies a nd b components, a.x*b.x, a.y*b.y + @returns a component-wise multiplication + @since v0.99.1 + */ +CGPoint ccpCompMult(CGPoint a, CGPoint b); + +/** @returns the signed angle in radians between two vector directions + @since v0.99.1 + */ +float ccpAngleSigned(CGPoint a, CGPoint b); + +/** @returns the angle in radians between two vector directions + @since v0.99.1 +*/ +float ccpAngle(CGPoint a, CGPoint b); + +/** Rotates a point counter clockwise by the angle around a pivot + @param v is the point to rotate + @param pivot is the pivot, naturally + @param angle is the angle of rotation cw in radians + @returns the rotated point + @since v0.99.1 + */ +CGPoint ccpRotateByAngle(CGPoint v, CGPoint pivot, float angle); + +/** A general line-line intersection test + @param p1 + is the startpoint for the first line P1 = (p1 - p2) + @param p2 + is the endpoint for the first line P1 = (p1 - p2) + @param p3 + is the startpoint for the second line P2 = (p3 - p4) + @param p4 + is the endpoint for the second line P2 = (p3 - p4) + @param s + is the range for a hitpoint in P1 (pa = p1 + s*(p2 - p1)) + @param t + is the range for a hitpoint in P3 (pa = p2 + t*(p4 - p3)) + @return bool + indicating successful intersection of a line + note that to truly test intersection for segments we have to make + sure that s & t lie within [0..1] and for rays, make sure s & t > 0 + the hit point is p3 + t * (p4 - p3); + the hit point also is p1 + s * (p2 - p1); + @since v0.99.1 + */ +BOOL ccpLineIntersect(CGPoint p1, CGPoint p2, + CGPoint p3, CGPoint p4, + float *s, float *t); + +/* + ccpSegmentIntersect returns YES if Segment A-B intersects with segment C-D + @since v1.0.0 + */ +BOOL ccpSegmentIntersect(CGPoint A, CGPoint B, CGPoint C, CGPoint D); + +/* + ccpIntersectPoint returns the intersection point of line A-B, C-D + @since v1.0.0 + */ +CGPoint ccpIntersectPoint(CGPoint A, CGPoint B, CGPoint C, CGPoint D); + +#ifdef __cplusplus +} +#endif diff --git a/libs/cocos2d/Support/CGPointExtension.m b/libs/cocos2d/Support/CGPointExtension.m new file mode 100755 index 0000000..b06859d --- /dev/null +++ b/libs/cocos2d/Support/CGPointExtension.m @@ -0,0 +1,196 @@ +/* cocos2d for iPhone + * http://www.cocos2d-iphone.org + * + * Copyright (c) 2007 Scott Lembcke + * + * Copyright (c) 2010 Lam Pham + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE + * SOFTWARE. + */ + +#include "stdio.h" +#include "math.h" + +#import "../ccMacros.h" // CC_SWAP +#include "CGPointExtension.h" + +#define kCGPointEpsilon FLT_EPSILON + +CGFloat +ccpLength(const CGPoint v) +{ + return sqrtf(ccpLengthSQ(v)); +} + +CGFloat +ccpDistance(const CGPoint v1, const CGPoint v2) +{ + return ccpLength(ccpSub(v1, v2)); +} + +CGPoint +ccpNormalize(const CGPoint v) +{ + return ccpMult(v, 1.0f/ccpLength(v)); +} + +CGPoint +ccpForAngle(const CGFloat a) +{ + return ccp(cosf(a), sinf(a)); +} + +CGFloat +ccpToAngle(const CGPoint v) +{ + return atan2f(v.y, v.x); +} + +CGPoint ccpLerp(CGPoint a, CGPoint b, float alpha) +{ + return ccpAdd(ccpMult(a, 1.f - alpha), ccpMult(b, alpha)); +} + +float clampf(float value, float min_inclusive, float max_inclusive) +{ + if (min_inclusive > max_inclusive) { + CC_SWAP(min_inclusive,max_inclusive); + } + return value < min_inclusive ? min_inclusive : value < max_inclusive? value : max_inclusive; +} + +CGPoint ccpClamp(CGPoint p, CGPoint min_inclusive, CGPoint max_inclusive) +{ + return ccp(clampf(p.x,min_inclusive.x,max_inclusive.x), clampf(p.y, min_inclusive.y, max_inclusive.y)); +} + +CGPoint ccpFromSize(CGSize s) +{ + return ccp(s.width, s.height); +} + +CGPoint ccpCompOp(CGPoint p, float (*opFunc)(float)) +{ + return ccp(opFunc(p.x), opFunc(p.y)); +} + +BOOL ccpFuzzyEqual(CGPoint a, CGPoint b, float var) +{ + if(a.x - var <= b.x && b.x <= a.x + var) + if(a.y - var <= b.y && b.y <= a.y + var) + return true; + return false; +} + +CGPoint ccpCompMult(CGPoint a, CGPoint b) +{ + return ccp(a.x * b.x, a.y * b.y); +} + +float ccpAngleSigned(CGPoint a, CGPoint b) +{ + CGPoint a2 = ccpNormalize(a); + CGPoint b2 = ccpNormalize(b); + float angle = atan2f(a2.x * b2.y - a2.y * b2.x, ccpDot(a2, b2)); + if( fabs(angle) < kCGPointEpsilon ) return 0.f; + return angle; +} + +CGPoint ccpRotateByAngle(CGPoint v, CGPoint pivot, float angle) +{ + CGPoint r = ccpSub(v, pivot); + float cosa = cosf(angle), sina = sinf(angle); + float t = r.x; + r.x = t*cosa - r.y*sina + pivot.x; + r.y = t*sina + r.y*cosa + pivot.y; + return r; +} + + +BOOL ccpSegmentIntersect(CGPoint A, CGPoint B, CGPoint C, CGPoint D) +{ + float S, T; + + if( ccpLineIntersect(A, B, C, D, &S, &T ) + && (S >= 0.0f && S <= 1.0f && T >= 0.0f && T <= 1.0f) ) + return YES; + + return NO; +} + +CGPoint ccpIntersectPoint(CGPoint A, CGPoint B, CGPoint C, CGPoint D) +{ + float S, T; + + if( ccpLineIntersect(A, B, C, D, &S, &T) ) { + // Point of intersection + CGPoint P; + P.x = A.x + S * (B.x - A.x); + P.y = A.y + S * (B.y - A.y); + return P; + } + + return CGPointZero; +} + +BOOL ccpLineIntersect(CGPoint A, CGPoint B, + CGPoint C, CGPoint D, + float *S, float *T) +{ + // FAIL: Line undefined + if ( (A.x==B.x && A.y==B.y) || (C.x==D.x && C.y==D.y) ) return NO; + + const float BAx = B.x - A.x; + const float BAy = B.y - A.y; + const float DCx = D.x - C.x; + const float DCy = D.y - C.y; + const float ACx = A.x - C.x; + const float ACy = A.y - C.y; + + const float denom = DCy*BAx - DCx*BAy; + + *S = DCx*ACy - DCy*ACx; + *T = BAx*ACy - BAy*ACx; + + if (denom == 0) { + if (*S == 0 || *T == 0) { + // Lines incident + return YES; + } + // Lines parallel and not incident + return NO; + } + + *S = *S / denom; + *T = *T / denom; + + // Point of intersection + // CGPoint P; + // P.x = A.x + *S * (B.x - A.x); + // P.y = A.y + *S * (B.y - A.y); + + return YES; +} + +float ccpAngle(CGPoint a, CGPoint b) +{ + float angle = acosf(ccpDot(ccpNormalize(a), ccpNormalize(b))); + if( fabs(angle) < kCGPointEpsilon ) return 0.f; + return angle; +} diff --git a/libs/cocos2d/Support/OpenGL_Internal.h b/libs/cocos2d/Support/OpenGL_Internal.h new file mode 100755 index 0000000..4789683 --- /dev/null +++ b/libs/cocos2d/Support/OpenGL_Internal.h @@ -0,0 +1,80 @@ +/* + +===== IMPORTANT ===== + +This is sample code demonstrating API, technology or techniques in development. +Although this sample code has been reviewed for technical accuracy, it is not +final. Apple is supplying this information to help you plan for the adoption of +the technologies and programming interfaces described herein. This information +is subject to change, and software implemented based on this sample code should +be tested with final operating system software and final documentation. Newer +versions of this sample code may be provided with future seeds of the API or +technology. For information about updates to this and other developer +documentation, view the New & Updated sidebars in subsequent documentation +seeds. + +===================== + +File: OpenGL_Internal.h +Abstract: This file is included for support purposes and isn't necessary for +understanding this sample. + +Version: 1.0 + +Disclaimer: IMPORTANT: This Apple software is supplied to you by Apple Inc. +("Apple") in consideration of your agreement to the following terms, and your +use, installation, modification or redistribution of this Apple software +constitutes acceptance of these terms. If you do not agree with these terms, +please do not use, install, modify or redistribute this Apple software. + +In consideration of your agreement to abide by the following terms, and subject +to these terms, Apple grants you a personal, non-exclusive license, under +Apple's copyrights in this original Apple software (the "Apple Software"), to +use, reproduce, modify and redistribute the Apple Software, with or without +modifications, in source and/or binary forms; provided that if you redistribute +the Apple Software in its entirety and without modifications, you must retain +this notice and the following text and disclaimers in all such redistributions +of the Apple Software. +Neither the name, trademarks, service marks or logos of Apple Inc. may be used +to endorse or promote products derived from the Apple Software without specific +prior written permission from Apple. Except as expressly stated in this notice, +no other rights or licenses, express or implied, are granted by Apple herein, +including but not limited to any patent rights that may be infringed by your +derivative works or by other works in which the Apple Software may be +incorporated. + +The Apple Software is provided by Apple on an "AS IS" basis. APPLE MAKES NO +WARRANTIES, EXPRESS OR IMPLIED, INCLUDING WITHOUT LIMITATION THE IMPLIED +WARRANTIES OF NON-INFRINGEMENT, MERCHANTABILITY AND FITNESS FOR A PARTICULAR +PURPOSE, REGARDING THE APPLE SOFTWARE OR ITS USE AND OPERATION ALONE OR IN +COMBINATION WITH YOUR PRODUCTS. + +IN NO EVENT SHALL APPLE BE LIABLE FOR ANY SPECIAL, INDIRECT, INCIDENTAL OR +CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE +GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) +ARISING IN ANY WAY OUT OF THE USE, REPRODUCTION, MODIFICATION AND/OR +DISTRIBUTION OF THE APPLE SOFTWARE, HOWEVER CAUSED AND WHETHER UNDER THEORY OF +CONTRACT, TORT (INCLUDING NEGLIGENCE), STRICT LIABILITY OR OTHERWISE, EVEN IF +APPLE HAS BEEN ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +Copyright (C) 2008 Apple Inc. All Rights Reserved. + +*/ + +/* Generic error reporting */ +#define REPORT_ERROR(__FORMAT__, ...) printf("%s: %s\n", __FUNCTION__, [[NSString stringWithFormat:__FORMAT__, __VA_ARGS__] UTF8String]) + +/* EAGL and GL functions calling wrappers that log on error */ +#define CALL_EAGL_FUNCTION(__FUNC__, ...) ({ EAGLError __error = __FUNC__( __VA_ARGS__ ); if(__error != kEAGLErrorSuccess) printf("%s() called from %s returned error %i\n", #__FUNC__, __FUNCTION__, __error); (__error ? NO : YES); }) +//#define CHECK_GL_ERROR() ({ GLenum __error = glGetError(); if(__error) printf("OpenGL error 0x%04X in %s\n", __error, __FUNCTION__); (__error ? NO : YES); }) +#define CHECK_GL_ERROR() ({ GLenum __error = glGetError(); if(__error) printf("OpenGL error 0x%04X in %s\n", __error, __FUNCTION__); }) + +/* Optional delegate methods support */ +#ifndef __DELEGATE_IVAR__ +#define __DELEGATE_IVAR__ _delegate +#endif +#ifndef __DELEGATE_METHODS_IVAR__ +#define __DELEGATE_METHODS_IVAR__ _delegateMethods +#endif +#define TEST_DELEGATE_METHOD_BIT(__BIT__) (self->__DELEGATE_METHODS_IVAR__ & (1 << __BIT__)) +#define SET_DELEGATE_METHOD_BIT(__BIT__, __NAME__) { if([self->__DELEGATE_IVAR__ respondsToSelector:@selector(__NAME__)]) self->__DELEGATE_METHODS_IVAR__ |= (1 << __BIT__); else self->__DELEGATE_METHODS_IVAR__ &= ~(1 << __BIT__); } diff --git a/libs/cocos2d/Support/TGAlib.h b/libs/cocos2d/Support/TGAlib.h new file mode 100755 index 0000000..247084e --- /dev/null +++ b/libs/cocos2d/Support/TGAlib.h @@ -0,0 +1,55 @@ +// +// TGA lib for cocos2d-iphone +// +// sources from: http://www.lighthouse3d.com/opengl/terrain/index.php3?tgasource +// + +//#ifndef TGA_LIB +//#define TGA_LIB + +/** + @file + TGA image support + */ + +enum { + TGA_OK, + TGA_ERROR_FILE_OPEN, + TGA_ERROR_READING_FILE, + TGA_ERROR_INDEXED_COLOR, + TGA_ERROR_MEMORY, + TGA_ERROR_COMPRESSED_FILE, +}; + +/** TGA format */ +typedef struct sImageTGA { + int status; + unsigned char type, pixelDepth; + + /** map width */ + short int width; + + /** map height */ + short int height; + + /** raw data */ + unsigned char *imageData; + int flipped; +} tImageTGA; + +/// load the image header fields. We only keep those that matter! +void tgaLoadHeader(FILE *file, tImageTGA *info); + +/// loads the image pixels. You shouldn't call this function directly +void tgaLoadImageData(FILE *file, tImageTGA *info); + +/// this is the function to call when we want to load an image +tImageTGA * tgaLoad(const char *filename); + +// /converts RGB to greyscale +void tgaRGBtogreyscale(tImageTGA *info); + +/// releases the memory used for the image +void tgaDestroy(tImageTGA *info); + +//#endif // TGA_LIB diff --git a/libs/cocos2d/Support/TGAlib.m b/libs/cocos2d/Support/TGAlib.m new file mode 100755 index 0000000..11303b4 --- /dev/null +++ b/libs/cocos2d/Support/TGAlib.m @@ -0,0 +1,274 @@ +// +// TGA lib for cocos2d-iphone +// +// sources from: http://www.lighthouse3d.com/opengl/terrain/index.php3?tgasource +// +// TGA RLE compression support by Ernesto Corvi + +#include +#include +#include + +#import "TGAlib.h" + +void tgaLoadRLEImageData(FILE *file, tImageTGA *info); +void tgaFlipImage( tImageTGA *info ); + +// load the image header fields. We only keep those that matter! +void tgaLoadHeader(FILE *file, tImageTGA *info) { + unsigned char cGarbage; + short int iGarbage; + + fread(&cGarbage, sizeof(unsigned char), 1, file); + fread(&cGarbage, sizeof(unsigned char), 1, file); + + // type must be 2 or 3 + fread(&info->type, sizeof(unsigned char), 1, file); + + fread(&iGarbage, sizeof(short int), 1, file); + fread(&iGarbage, sizeof(short int), 1, file); + fread(&cGarbage, sizeof(unsigned char), 1, file); + fread(&iGarbage, sizeof(short int), 1, file); + fread(&iGarbage, sizeof(short int), 1, file); + + fread(&info->width, sizeof(short int), 1, file); + fread(&info->height, sizeof(short int), 1, file); + fread(&info->pixelDepth, sizeof(unsigned char), 1, file); + + fread(&cGarbage, sizeof(unsigned char), 1, file); + + info->flipped = 0; + if ( cGarbage & 0x20 ) info->flipped = 1; +} + +// loads the image pixels. You shouldn't call this function directly +void tgaLoadImageData(FILE *file, tImageTGA *info) { + + int mode,total,i; + unsigned char aux; + + // mode equal the number of components for each pixel + mode = info->pixelDepth / 8; + // total is the number of unsigned chars we'll have to read + total = info->height * info->width * mode; + + fread(info->imageData,sizeof(unsigned char),total,file); + + // mode=3 or 4 implies that the image is RGB(A). However TGA + // stores it as BGR(A) so we'll have to swap R and B. + if (mode >= 3) + for (i=0; i < total; i+= mode) { + aux = info->imageData[i]; + info->imageData[i] = info->imageData[i+2]; + info->imageData[i+2] = aux; + } +} + +// loads the RLE encoded image pixels. You shouldn't call this function directly +void tgaLoadRLEImageData(FILE *file, tImageTGA *info) +{ + unsigned int mode,total,i, index = 0; + unsigned char aux[4], runlength = 0; + unsigned int skip = 0, flag = 0; + + // mode equal the number of components for each pixel + mode = info->pixelDepth / 8; + // total is the number of unsigned chars we'll have to read + total = info->height * info->width; + + for( i = 0; i < total; i++ ) + { + // if we have a run length pending, run it + if ( runlength != 0 ) + { + // we do, update the run length count + runlength--; + skip = (flag != 0); + } + else + { + // otherwise, read in the run length token + if ( fread(&runlength,sizeof(unsigned char),1,file) != 1 ) + return; + + // see if it's a RLE encoded sequence + flag = runlength & 0x80; + if ( flag ) runlength -= 128; + skip = 0; + } + + // do we need to skip reading this pixel? + if ( !skip ) + { + // no, read in the pixel data + if ( fread(aux,sizeof(unsigned char),mode,file) != mode ) + return; + + // mode=3 or 4 implies that the image is RGB(A). However TGA + // stores it as BGR(A) so we'll have to swap R and B. + if ( mode >= 3 ) + { + unsigned char tmp; + + tmp = aux[0]; + aux[0] = aux[2]; + aux[2] = tmp; + } + } + + // add the pixel to our image + memcpy(&info->imageData[index], aux, mode); + index += mode; + } +} + +void tgaFlipImage( tImageTGA *info ) +{ + // mode equal the number of components for each pixel + int mode = info->pixelDepth / 8; + int rowbytes = info->width*mode; + unsigned char *row = (unsigned char *)malloc(rowbytes); + int y; + + if (row == NULL) return; + + for( y = 0; y < (info->height/2); y++ ) + { + memcpy(row, &info->imageData[y*rowbytes],rowbytes); + memcpy(&info->imageData[y*rowbytes], &info->imageData[(info->height-(y+1))*rowbytes], rowbytes); + memcpy(&info->imageData[(info->height-(y+1))*rowbytes], row, rowbytes); + } + + free(row); + info->flipped = 0; +} + +// this is the function to call when we want to load an image +tImageTGA * tgaLoad(const char *filename) { + + FILE *file; + tImageTGA *info; + int mode,total; + + // allocate memory for the info struct and check! + info = (tImageTGA *)malloc(sizeof(tImageTGA)); + if (info == NULL) + return(NULL); + + + // open the file for reading (binary mode) + file = fopen(filename, "rb"); + if (file == NULL) { + info->status = TGA_ERROR_FILE_OPEN; + return(info); + } + + // load the header + tgaLoadHeader(file,info); + + // check for errors when loading the header + if (ferror(file)) { + info->status = TGA_ERROR_READING_FILE; + fclose(file); + return(info); + } + + // check if the image is color indexed + if (info->type == 1) { + info->status = TGA_ERROR_INDEXED_COLOR; + fclose(file); + return(info); + } + // check for other types (compressed images) + if ((info->type != 2) && (info->type !=3) && (info->type !=10) ) { + info->status = TGA_ERROR_COMPRESSED_FILE; + fclose(file); + return(info); + } + + // mode equals the number of image components + mode = info->pixelDepth / 8; + // total is the number of unsigned chars to read + total = info->height * info->width * mode; + // allocate memory for image pixels + info->imageData = (unsigned char *)malloc(sizeof(unsigned char) * + total); + + // check to make sure we have the memory required + if (info->imageData == NULL) { + info->status = TGA_ERROR_MEMORY; + fclose(file); + return(info); + } + // finally load the image pixels + if ( info->type == 10 ) + tgaLoadRLEImageData(file, info); + else + tgaLoadImageData(file,info); + + // check for errors when reading the pixels + if (ferror(file)) { + info->status = TGA_ERROR_READING_FILE; + fclose(file); + return(info); + } + fclose(file); + info->status = TGA_OK; + + if ( info->flipped ) + { + tgaFlipImage( info ); + if ( info->flipped ) info->status = TGA_ERROR_MEMORY; + } + + return(info); +} + +// converts RGB to greyscale +void tgaRGBtogreyscale(tImageTGA *info) { + + int mode,i,j; + + unsigned char *newImageData; + + // if the image is already greyscale do nothing + if (info->pixelDepth == 8) + return; + + // compute the number of actual components + mode = info->pixelDepth / 8; + + // allocate an array for the new image data + newImageData = (unsigned char *)malloc(sizeof(unsigned char) * + info->height * info->width); + if (newImageData == NULL) { + return; + } + + // convert pixels: greyscale = o.30 * R + 0.59 * G + 0.11 * B + for (i = 0,j = 0; j < info->width * info->height; i +=mode, j++) + newImageData[j] = + (unsigned char)(0.30 * info->imageData[i] + + 0.59 * info->imageData[i+1] + + 0.11 * info->imageData[i+2]); + + + //free old image data + free(info->imageData); + + // reassign pixelDepth and type according to the new image type + info->pixelDepth = 8; + info->type = 3; + // reassing imageData to the new array. + info->imageData = newImageData; +} + +// releases the memory used for the image +void tgaDestroy(tImageTGA *info) { + + if (info != NULL) { + if (info->imageData != NULL) + free(info->imageData); + free(info); + } +} diff --git a/libs/cocos2d/Support/TransformUtils.h b/libs/cocos2d/Support/TransformUtils.h new file mode 100755 index 0000000..49fde35 --- /dev/null +++ b/libs/cocos2d/Support/TransformUtils.h @@ -0,0 +1,37 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2009 Valentin Milea + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + +#import + +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED +#import +#import +#elif defined(__MAC_OS_X_VERSION_MAX_ALLOWED) +#import +#import +#endif + +void CGAffineToGL(const CGAffineTransform *t, GLfloat *m); +void GLToCGAffine(const GLfloat *m, CGAffineTransform *t); diff --git a/libs/cocos2d/Support/TransformUtils.m b/libs/cocos2d/Support/TransformUtils.m new file mode 100755 index 0000000..9caecf0 --- /dev/null +++ b/libs/cocos2d/Support/TransformUtils.m @@ -0,0 +1,46 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2009 Valentin Milea + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + + +#import "TransformUtils.h" + +void CGAffineToGL(const CGAffineTransform *t, GLfloat *m) +{ + // | m[0] m[4] m[8] m[12] | | m11 m21 m31 m41 | | a c 0 tx | + // | m[1] m[5] m[9] m[13] | | m12 m22 m32 m42 | | b d 0 ty | + // | m[2] m[6] m[10] m[14] | <=> | m13 m23 m33 m43 | <=> | 0 0 1 0 | + // | m[3] m[7] m[11] m[15] | | m14 m24 m34 m44 | | 0 0 0 1 | + + m[2] = m[3] = m[6] = m[7] = m[8] = m[9] = m[11] = m[14] = 0.0f; + m[10] = m[15] = 1.0f; + m[0] = t->a; m[4] = t->c; m[12] = t->tx; + m[1] = t->b; m[5] = t->d; m[13] = t->ty; +} + +void GLToCGAffine(const GLfloat *m, CGAffineTransform *t) +{ + t->a = m[0]; t->c = m[4]; t->tx = m[12]; + t->b = m[1]; t->d = m[5]; t->ty = m[13]; +} diff --git a/libs/cocos2d/Support/ZipUtils.h b/libs/cocos2d/Support/ZipUtils.h new file mode 100755 index 0000000..363f911 --- /dev/null +++ b/libs/cocos2d/Support/ZipUtils.h @@ -0,0 +1,91 @@ +/* cocos2d for iPhone + * + * http://www.cocos2d-iphone.org + * + * + * inflateMemory_ based on zlib example code + * http://www.zlib.net + * + * Some ideas were taken from: + * http://themanaworld.org/ + * from the mapreader.cpp file + * + */ + +#ifndef __CC_ZIP_UTILS_H +#define __CC_ZIP_UTILS_H + +#import + +#ifdef __cplusplus +extern "C" { +#endif + + /* XXX: pragma pack ??? */ + /** @struct CCZHeader + */ + struct CCZHeader { + uint8_t sig[4]; // signature. Should be 'CCZ!' 4 bytes + uint16_t compression_type; // should 0 + uint16_t version; // should be 2 (although version type==1 is also supported) + uint32_t reserved; // Reserverd for users. + uint32_t len; // size of the uncompressed file + }; + + enum { + CCZ_COMPRESSION_ZLIB, // zlib format. + CCZ_COMPRESSION_BZIP2, // bzip2 format (not supported yet) + CCZ_COMPRESSION_GZIP, // gzip format (not supported yet) + CCZ_COMPRESSION_NONE, // plain (not supported yet) + }; + +/** @file + * Zip helper functions + */ + +/** + * Inflates either zlib or gzip deflated memory. The inflated memory is + * expected to be freed by the caller. + * + * It will allocate 256k for the destination buffer. If it is not enought it will multiply the previous buffer size per 2, until there is enough memory. + * @returns the length of the deflated buffer + * + @since v0.8.1 + */ +int ccInflateMemory(unsigned char *in, unsigned int inLength, unsigned char **out); + +/** + * Inflates either zlib or gzip deflated memory. The inflated memory is + * expected to be freed by the caller. + * + * outLenghtHint is assumed to be the needed room to allocate the inflated buffer. + * + * @returns the length of the deflated buffer + * + @since v1.0.0 + */ +int ccInflateMemoryWithHint(unsigned char *in, unsigned int inLength, unsigned char **out, unsigned int outLenghtHint ); + + +/** inflates a GZip file into memory + * + * @returns the length of the deflated buffer + * + * @since v0.99.5 + */ +int ccInflateGZipFile(const char *filename, unsigned char **out); + +/** inflates a CCZ file into memory + * + * @returns the length of the deflated buffer + * + * @since v0.99.5 + */ +int ccInflateCCZFile(const char *filename, unsigned char **out); + + +#ifdef __cplusplus +} +#endif + +#endif // __CC_ZIP_UTILS_H diff --git a/libs/cocos2d/Support/ZipUtils.m b/libs/cocos2d/Support/ZipUtils.m new file mode 100755 index 0000000..ccd8bbc --- /dev/null +++ b/libs/cocos2d/Support/ZipUtils.m @@ -0,0 +1,251 @@ +/* cocos2d for iPhone + * + * http://www.cocos2d-iphone.org + * + * + * Inflates either zlib or gzip deflated memory. The inflated memory is + * expected to be freed by the caller. + * + * inflateMemory_ based on zlib example code + * http://www.zlib.net + * + * Some ideas were taken from: + * http://themanaworld.org/ + * from the mapreader.cpp file + */ + +#import + +#import +#import +#import +#import + +#import "ZipUtils.h" +#import "CCFileUtils.h" +#import "../ccMacros.h" + +// memory in iPhone is precious +// Should buffer factor be 1.5 instead of 2 ? +#define BUFFER_INC_FACTOR (2) + +static int inflateMemoryWithHint(unsigned char *in, unsigned int inLength, unsigned char **out, unsigned int *outLength, unsigned int outLenghtHint ) +{ + /* ret value */ + int err = Z_OK; + + int bufferSize = outLenghtHint; + *out = (unsigned char*) malloc(bufferSize); + + z_stream d_stream; /* decompression stream */ + d_stream.zalloc = (alloc_func)0; + d_stream.zfree = (free_func)0; + d_stream.opaque = (voidpf)0; + + d_stream.next_in = in; + d_stream.avail_in = inLength; + d_stream.next_out = *out; + d_stream.avail_out = bufferSize; + + /* window size to hold 256k */ + if( (err = inflateInit2(&d_stream, 15 + 32)) != Z_OK ) + return err; + + for (;;) { + err = inflate(&d_stream, Z_NO_FLUSH); + + if (err == Z_STREAM_END) + break; + + switch (err) { + case Z_NEED_DICT: + err = Z_DATA_ERROR; + case Z_DATA_ERROR: + case Z_MEM_ERROR: + inflateEnd(&d_stream); + return err; + } + + // not enough memory ? + if (err != Z_STREAM_END) { + + unsigned char *tmp = realloc(*out, bufferSize * BUFFER_INC_FACTOR); + + /* not enough memory, ouch */ + if (! tmp ) { + CCLOG(@"cocos2d: ZipUtils: realloc failed"); + inflateEnd(&d_stream); + return Z_MEM_ERROR; + } + /* only assign to *out if tmp is valid. it's not guaranteed that realloc will reuse the memory */ + *out = tmp; + + d_stream.next_out = *out + bufferSize; + d_stream.avail_out = bufferSize; + bufferSize *= BUFFER_INC_FACTOR; + } + } + + + *outLength = bufferSize - d_stream.avail_out; + err = inflateEnd(&d_stream); + return err; +} + +int ccInflateMemoryWithHint(unsigned char *in, unsigned int inLength, unsigned char **out, unsigned int outLengthHint ) +{ + unsigned int outLength = 0; + int err = inflateMemoryWithHint(in, inLength, out, &outLength, outLengthHint ); + + if (err != Z_OK || *out == NULL) { + if (err == Z_MEM_ERROR) + CCLOG(@"cocos2d: ZipUtils: Out of memory while decompressing map data!"); + + else if (err == Z_VERSION_ERROR) + CCLOG(@"cocos2d: ZipUtils: Incompatible zlib version!"); + + else if (err == Z_DATA_ERROR) + CCLOG(@"cocos2d: ZipUtils: Incorrect zlib compressed data!"); + + else + CCLOG(@"cocos2d: ZipUtils: Unknown error while decompressing map data!"); + + free(*out); + *out = NULL; + outLength = 0; + } + + return outLength; +} + +int ccInflateMemory(unsigned char *in, unsigned int inLength, unsigned char **out) +{ + // 256k for hint + return ccInflateMemoryWithHint(in, inLength, out, 256 * 1024 ); +} + +int ccInflateGZipFile(const char *path, unsigned char **out) +{ + int len; + unsigned int offset = 0; + + NSCAssert( out, @"ccInflateGZipFile: invalid 'out' parameter"); + NSCAssert( &*out, @"ccInflateGZipFile: invalid 'out' parameter"); + + gzFile inFile = gzopen(path, "rb"); + if( inFile == NULL ) { + CCLOG(@"cocos2d: ZipUtils: error open gzip file: %s", path); + return -1; + } + + /* 512k initial decompress buffer */ + int bufferSize = 512 * 1024; + unsigned int totalBufferSize = bufferSize; + + *out = malloc( bufferSize ); + if( ! out ) { + CCLOG(@"cocos2d: ZipUtils: out of memory"); + return -1; + } + + for (;;) { + len = gzread(inFile, *out + offset, bufferSize); + if (len < 0) { + CCLOG(@"cocos2d: ZipUtils: error in gzread"); + free( *out ); + *out = NULL; + return -1; + } + if (len == 0) + break; + + offset += len; + + // finish reading the file + if( len < bufferSize ) + break; + + bufferSize *= BUFFER_INC_FACTOR; + totalBufferSize += bufferSize; + unsigned char *tmp = realloc(*out, totalBufferSize ); + + if( ! tmp ) { + CCLOG(@"cocos2d: ZipUtils: out of memory"); + free( *out ); + *out = NULL; + return -1; + } + + *out = tmp; + } + + if (gzclose(inFile) != Z_OK) + CCLOG(@"cocos2d: ZipUtils: gzclose failed"); + + return offset; +} + +int ccInflateCCZFile(const char *path, unsigned char **out) +{ + NSCAssert( out, @"ccInflateCCZFile: invalid 'out' parameter"); + NSCAssert( &*out, @"ccInflateCCZFile: invalid 'out' parameter"); + + // load file into memory + unsigned char *compressed = NULL; + NSInteger fileLen = ccLoadFileIntoMemory( path, &compressed ); + if( fileLen < 0 ) { + CCLOG(@"cocos2d: Error loading CCZ compressed file"); + } + + struct CCZHeader *header = (struct CCZHeader*) compressed; + + // verify header + if( header->sig[0] != 'C' || header->sig[1] != 'C' || header->sig[2] != 'Z' || header->sig[3] != '!' ) { + CCLOG(@"cocos2d: Invalid CCZ file"); + free(compressed); + return -1; + } + + // verify header version + uint16_t version = CFSwapInt16BigToHost( header->version ); + if( version > 2 ) { + CCLOG(@"cocos2d: Unsupported CCZ header format"); + free(compressed); + return -1; + } + + // verify compression format + if( CFSwapInt16BigToHost(header->compression_type) != CCZ_COMPRESSION_ZLIB ) { + CCLOG(@"cocos2d: CCZ Unsupported compression method"); + free(compressed); + return -1; + } + + uint32_t len = CFSwapInt32BigToHost( header->len ); + + *out = malloc( len ); + if(! *out ) + { + CCLOG(@"cocos2d: CCZ: Failed to allocate memory for texture"); + free(compressed); + return -1; + } + + + uLongf destlen = len; + uLongf source = (uLongf) compressed + sizeof(*header); + int ret = uncompress(*out, &destlen, (Bytef*)source, fileLen - sizeof(*header) ); + + free( compressed ); + + if( ret != Z_OK ) + { + CCLOG(@"cocos2d: CCZ: Failed to uncompress data"); + free( *out ); + *out = NULL; + return -1; + } + + + return len; +} diff --git a/libs/cocos2d/Support/base64.c b/libs/cocos2d/Support/base64.c new file mode 100755 index 0000000..9aa52a6 --- /dev/null +++ b/libs/cocos2d/Support/base64.c @@ -0,0 +1,93 @@ +/* + public domain BASE64 code + + modified for cocos2d-iphone: http://www.cocos2d-iphone.org + */ + +#include +#include + +#include "base64.h" + +unsigned char alphabet[64] = "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/"; + +int _base64Decode( unsigned char *input, unsigned int input_len, unsigned char *output, unsigned int *output_len ); + +int _base64Decode( unsigned char *input, unsigned int input_len, unsigned char *output, unsigned int *output_len ) +{ + static char inalphabet[256], decoder[256]; + int i, bits, c, char_count, errors = 0; + unsigned int input_idx = 0; + unsigned int output_idx = 0; + + for (i = (sizeof alphabet) - 1; i >= 0 ; i--) { + inalphabet[alphabet[i]] = 1; + decoder[alphabet[i]] = i; + } + + char_count = 0; + bits = 0; + for( input_idx=0; input_idx < input_len ; input_idx++ ) { + c = input[ input_idx ]; + if (c == '=') + break; + if (c > 255 || ! inalphabet[c]) + continue; + bits += decoder[c]; + char_count++; + if (char_count == 4) { + output[ output_idx++ ] = (bits >> 16); + output[ output_idx++ ] = ((bits >> 8) & 0xff); + output[ output_idx++ ] = ( bits & 0xff); + bits = 0; + char_count = 0; + } else { + bits <<= 6; + } + } + + if( c == '=' ) { + switch (char_count) { + case 1: + fprintf(stderr, "base64Decode: encoding incomplete: at least 2 bits missing"); + errors++; + break; + case 2: + output[ output_idx++ ] = ( bits >> 10 ); + break; + case 3: + output[ output_idx++ ] = ( bits >> 16 ); + output[ output_idx++ ] = (( bits >> 8 ) & 0xff); + break; + } + } else if ( input_idx < input_len ) { + if (char_count) { + fprintf(stderr, "base64 encoding incomplete: at least %d bits truncated", + ((4 - char_count) * 6)); + errors++; + } + } + + *output_len = output_idx; + return errors; +} + +int base64Decode(unsigned char *in, unsigned int inLength, unsigned char **out) +{ + unsigned int outLength = 0; + + //should be enough to store 6-bit buffers in 8-bit buffers + *out = malloc( inLength * 3.0f / 4.0f + 1 ); + if( *out ) { + int ret = _base64Decode(in, inLength, *out, &outLength); + + if (ret > 0 ) + { + printf("Base64Utils: error decoding"); + free(*out); + *out = NULL; + outLength = 0; + } + } + return outLength; +} diff --git a/libs/cocos2d/Support/base64.h b/libs/cocos2d/Support/base64.h new file mode 100755 index 0000000..d30878e --- /dev/null +++ b/libs/cocos2d/Support/base64.h @@ -0,0 +1,33 @@ +/* + public domain BASE64 code + + modified for cocos2d-iphone: http://www.cocos2d-iphone.org + */ + +#ifndef __CC_BASE64_DECODE_H +#define __CC_BASE64_DECODE_H + +#ifdef __cplusplus +extern "C" { +#endif + + +/** @file + base64 helper functions + */ + +/** + * Decodes a 64base encoded memory. The decoded memory is + * expected to be freed by the caller. + * + * @returns the length of the out buffer + * + @since v0.8.1 + */ +int base64Decode(unsigned char *in, unsigned int inLength, unsigned char **out); + +#ifdef __cplusplus +} +#endif + +#endif // __CC_BASE64_DECODE_H diff --git a/libs/cocos2d/Support/ccCArray.h b/libs/cocos2d/Support/ccCArray.h new file mode 100755 index 0000000..20d9633 --- /dev/null +++ b/libs/cocos2d/Support/ccCArray.h @@ -0,0 +1,447 @@ +/* Copyright (c) 2007 Scott Lembcke + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE + * SOFTWARE. + */ + +/** + @file + Based on Chipmunk cpArray. + ccArray is a faster alternative to NSMutableArray, it does pretty much the + same thing (stores NSObjects and retains/releases them appropriately). It's + faster because: + - it uses a plain C interface so it doesn't incur Objective-c messaging overhead + - it assumes you know what you're doing, so it doesn't spend time on safety checks + (index out of bounds, required capacity etc.) + - comparisons are done using pointer equality instead of isEqual + + There are 2 kind of functions: + - ccArray functions that manipulates objective-c objects (retain and release are performanced) + - ccCArray functions that manipulates values like if they were standard C structures (no retain/release is performed) + */ + +#ifndef CC_ARRAY_H +#define CC_ARRAY_H + +#import + +#import +#import + + +#pragma mark - +#pragma mark ccArray for Objects + +// Easy integration +#define CCARRAYDATA_FOREACH(__array__, __object__) \ +__object__=__array__->arr[0]; for(NSUInteger i=0, num=__array__->num; iarr[i]) \ + + +typedef struct ccArray { + NSUInteger num, max; + id *arr; +} ccArray; + +/** Allocates and initializes a new array with specified capacity */ +static inline ccArray* ccArrayNew(NSUInteger capacity) { + if (capacity == 0) + capacity = 1; + + ccArray *arr = (ccArray*)malloc( sizeof(ccArray) ); + arr->num = 0; + arr->arr = (id*) malloc( capacity * sizeof(id) ); + arr->max = capacity; + + return arr; +} + +static inline void ccArrayRemoveAllObjects(ccArray *arr); + +/** Frees array after removing all remaining objects. Silently ignores nil arr. */ +static inline void ccArrayFree(ccArray *arr) +{ + if( arr == nil ) return; + + ccArrayRemoveAllObjects(arr); + + free(arr->arr); + free(arr); +} + +/** Doubles array capacity */ +static inline void ccArrayDoubleCapacity(ccArray *arr) +{ + arr->max *= 2; + id *newArr = (id *)realloc( arr->arr, arr->max * sizeof(id) ); + // will fail when there's not enough memory + NSCAssert(newArr != NULL, @"ccArrayDoubleCapacity failed. Not enough memory"); + arr->arr = newArr; +} + +/** Increases array capacity such that max >= num + extra. */ +static inline void ccArrayEnsureExtraCapacity(ccArray *arr, NSUInteger extra) +{ + while (arr->max < arr->num + extra) + ccArrayDoubleCapacity(arr); +} + +/** shrinks the array so the memory footprint corresponds with the number of items */ +static inline void ccArrayShrink(ccArray *arr) +{ + NSUInteger newSize; + + //only resize when necessary + if (arr->max > arr->num && !(arr->num==0 && arr->max==1)) + { + if (arr->num!=0) + { + newSize=arr->num; + arr->max=arr->num; + } + else + {//minimum capacity of 1, with 0 elements the array would be free'd by realloc + newSize=1; + arr->max=1; + } + + arr->arr = (id*) realloc(arr->arr,newSize * sizeof(id) ); + NSCAssert(arr->arr!=NULL,@"could not reallocate the memory"); + } +} + +/** Returns index of first occurence of object, NSNotFound if object not found. */ +static inline NSUInteger ccArrayGetIndexOfObject(ccArray *arr, id object) +{ + for( NSUInteger i = 0; i < arr->num; i++) + if( arr->arr[i] == object ) return i; + + return NSNotFound; +} + +/** Returns a Boolean value that indicates whether object is present in array. */ +static inline BOOL ccArrayContainsObject(ccArray *arr, id object) +{ + return ccArrayGetIndexOfObject(arr, object) != NSNotFound; +} + +/** Appends an object. Bahaviour undefined if array doesn't have enough capacity. */ +static inline void ccArrayAppendObject(ccArray *arr, id object) +{ + arr->arr[arr->num] = [object retain]; + arr->num++; +} + +/** Appends an object. Capacity of arr is increased if needed. */ +static inline void ccArrayAppendObjectWithResize(ccArray *arr, id object) +{ + ccArrayEnsureExtraCapacity(arr, 1); + ccArrayAppendObject(arr, object); +} + +/** Appends objects from plusArr to arr. Behaviour undefined if arr doesn't have + enough capacity. */ +static inline void ccArrayAppendArray(ccArray *arr, ccArray *plusArr) +{ + for( NSUInteger i = 0; i < plusArr->num; i++) + ccArrayAppendObject(arr, plusArr->arr[i]); +} + +/** Appends objects from plusArr to arr. Capacity of arr is increased if needed. */ +static inline void ccArrayAppendArrayWithResize(ccArray *arr, ccArray *plusArr) +{ + ccArrayEnsureExtraCapacity(arr, plusArr->num); + ccArrayAppendArray(arr, plusArr); +} + +/** Inserts an object at index */ +static inline void ccArrayInsertObjectAtIndex(ccArray *arr, id object, NSUInteger index) +{ + NSCAssert(index<=arr->num, @"Invalid index. Out of bounds"); + + ccArrayEnsureExtraCapacity(arr, 1); + + NSUInteger remaining = arr->num - index; + if( remaining > 0) + memmove(&arr->arr[index+1], &arr->arr[index], sizeof(id) * remaining ); + + arr->arr[index] = [object retain]; + arr->num++; +} + +/** Swaps two objects */ +static inline void ccArraySwapObjectsAtIndexes(ccArray *arr, NSUInteger index1, NSUInteger index2) +{ + NSCAssert(index1 < arr->num, @"(1) Invalid index. Out of bounds"); + NSCAssert(index2 < arr->num, @"(2) Invalid index. Out of bounds"); + + id object1 = arr->arr[index1]; + + arr->arr[index1] = arr->arr[index2]; + arr->arr[index2] = object1; +} + +/** Removes all objects from arr */ +static inline void ccArrayRemoveAllObjects(ccArray *arr) +{ + while( arr->num > 0 ) + [arr->arr[--arr->num] release]; +} + +/** Removes object at specified index and pushes back all subsequent objects. + Behaviour undefined if index outside [0, num-1]. */ +static inline void ccArrayRemoveObjectAtIndex(ccArray *arr, NSUInteger index) +{ + [arr->arr[index] release]; + arr->num--; + + NSUInteger remaining = arr->num - index; + if(remaining>0) + memmove(&arr->arr[index], &arr->arr[index+1], remaining * sizeof(id)); +} + +/** Removes object at specified index and fills the gap with the last object, + thereby avoiding the need to push back subsequent objects. + Behaviour undefined if index outside [0, num-1]. */ +static inline void ccArrayFastRemoveObjectAtIndex(ccArray *arr, NSUInteger index) +{ + [arr->arr[index] release]; + NSUInteger last = --arr->num; + arr->arr[index] = arr->arr[last]; +} + +static inline void ccArrayFastRemoveObject(ccArray *arr, id object) +{ + NSUInteger index = ccArrayGetIndexOfObject(arr, object); + if (index != NSNotFound) + ccArrayFastRemoveObjectAtIndex(arr, index); +} + +/** Searches for the first occurance of object and removes it. If object is not + found the function has no effect. */ +static inline void ccArrayRemoveObject(ccArray *arr, id object) +{ + NSUInteger index = ccArrayGetIndexOfObject(arr, object); + if (index != NSNotFound) + ccArrayRemoveObjectAtIndex(arr, index); +} + +/** Removes from arr all objects in minusArr. For each object in minusArr, the + first matching instance in arr will be removed. */ +static inline void ccArrayRemoveArray(ccArray *arr, ccArray *minusArr) +{ + for( NSUInteger i = 0; i < minusArr->num; i++) + ccArrayRemoveObject(arr, minusArr->arr[i]); +} + +/** Removes from arr all objects in minusArr. For each object in minusArr, all + matching instances in arr will be removed. */ +static inline void ccArrayFullRemoveArray(ccArray *arr, ccArray *minusArr) +{ + NSUInteger back = 0; + + for( NSUInteger i = 0; i < arr->num; i++) { + if( ccArrayContainsObject(minusArr, arr->arr[i]) ) { + [arr->arr[i] release]; + back++; + } else + arr->arr[i - back] = arr->arr[i]; + } + + arr->num -= back; +} + +/** Sends to each object in arr the message identified by given selector. */ +static inline void ccArrayMakeObjectsPerformSelector(ccArray *arr, SEL sel) +{ + for( NSUInteger i = 0; i < arr->num; i++) + [arr->arr[i] performSelector:sel]; +} + +static inline void ccArrayMakeObjectsPerformSelectorWithObject(ccArray *arr, SEL sel, id object) +{ + for( NSUInteger i = 0; i < arr->num; i++) + [arr->arr[i] performSelector:sel withObject:object]; +} + + +#pragma mark - +#pragma mark ccCArray for Values (c structures) + +typedef ccArray ccCArray; + +static inline void ccCArrayRemoveAllValues(ccCArray *arr); + +/** Allocates and initializes a new C array with specified capacity */ +static inline ccCArray* ccCArrayNew(NSUInteger capacity) { + if (capacity == 0) + capacity = 1; + + ccCArray *arr = (ccCArray*)malloc( sizeof(ccCArray) ); + arr->num = 0; + arr->arr = (id*) malloc( capacity * sizeof(id) ); + arr->max = capacity; + + return arr; +} + +/** Frees C array after removing all remaining values. Silently ignores nil arr. */ +static inline void ccCArrayFree(ccCArray *arr) +{ + if( arr == nil ) return; + + ccCArrayRemoveAllValues(arr); + + free(arr->arr); + free(arr); +} + +/** Doubles C array capacity */ +static inline void ccCArrayDoubleCapacity(ccCArray *arr) +{ + ccArrayDoubleCapacity(arr); +} + +/** Increases array capacity such that max >= num + extra. */ +static inline void ccCArrayEnsureExtraCapacity(ccCArray *arr, NSUInteger extra) +{ + ccArrayEnsureExtraCapacity(arr,extra); +} + +/** Returns index of first occurence of value, NSNotFound if value not found. */ +static inline NSUInteger ccCArrayGetIndexOfValue(ccCArray *arr, void* value) +{ + for( NSUInteger i = 0; i < arr->num; i++) + if( arr->arr[i] == value ) return i; + return NSNotFound; +} + +/** Returns a Boolean value that indicates whether value is present in the C array. */ +static inline BOOL ccCArrayContainsValue(ccCArray *arr, void* value) +{ + return ccCArrayGetIndexOfValue(arr, value) != NSNotFound; +} + +/** Inserts a value at a certain position. Behaviour undefined if aray doesn't have enough capacity */ +static inline void ccCArrayInsertValueAtIndex( ccCArray *arr, void *value, NSUInteger index) +{ + NSCAssert( index < arr->max, @"ccCArrayInsertValueAtIndex: invalid index"); + + NSUInteger remaining = arr->num - index; + + // last Value doesn't need to be moved + if( remaining > 0) { + // tex coordinates + memmove( &arr->arr[index+1],&arr->arr[index], sizeof(void*) * remaining ); + } + + arr->num++; + arr->arr[index] = (id) value; +} + +/** Appends an value. Bahaviour undefined if array doesn't have enough capacity. */ +static inline void ccCArrayAppendValue(ccCArray *arr, void* value) +{ + arr->arr[arr->num] = (id) value; + arr->num++; +} + +/** Appends an value. Capacity of arr is increased if needed. */ +static inline void ccCArrayAppendValueWithResize(ccCArray *arr, void* value) +{ + ccCArrayEnsureExtraCapacity(arr, 1); + ccCArrayAppendValue(arr, value); +} + +/** Appends values from plusArr to arr. Behaviour undefined if arr doesn't have + enough capacity. */ +static inline void ccCArrayAppendArray(ccCArray *arr, ccCArray *plusArr) +{ + for( NSUInteger i = 0; i < plusArr->num; i++) + ccCArrayAppendValue(arr, plusArr->arr[i]); +} + +/** Appends values from plusArr to arr. Capacity of arr is increased if needed. */ +static inline void ccCArrayAppendArrayWithResize(ccCArray *arr, ccCArray *plusArr) +{ + ccCArrayEnsureExtraCapacity(arr, plusArr->num); + ccCArrayAppendArray(arr, plusArr); +} + +/** Removes all values from arr */ +static inline void ccCArrayRemoveAllValues(ccCArray *arr) +{ + arr->num = 0; +} + +/** Removes value at specified index and pushes back all subsequent values. + Behaviour undefined if index outside [0, num-1]. + @since v0.99.4 + */ +static inline void ccCArrayRemoveValueAtIndex(ccCArray *arr, NSUInteger index) +{ + for( NSUInteger last = --arr->num; index < last; index++) + arr->arr[index] = arr->arr[index + 1]; +} + +/** Removes value at specified index and fills the gap with the last value, + thereby avoiding the need to push back subsequent values. + Behaviour undefined if index outside [0, num-1]. + @since v0.99.4 + */ +static inline void ccCArrayFastRemoveValueAtIndex(ccCArray *arr, NSUInteger index) +{ + NSUInteger last = --arr->num; + arr->arr[index] = arr->arr[last]; +} + +/** Searches for the first occurance of value and removes it. If value is not found the function has no effect. + @since v0.99.4 + */ +static inline void ccCArrayRemoveValue(ccCArray *arr, void* value) +{ + NSUInteger index = ccCArrayGetIndexOfValue(arr, value); + if (index != NSNotFound) + ccCArrayRemoveValueAtIndex(arr, index); +} + +/** Removes from arr all values in minusArr. For each Value in minusArr, the first matching instance in arr will be removed. + @since v0.99.4 + */ +static inline void ccCArrayRemoveArray(ccCArray *arr, ccCArray *minusArr) +{ + for( NSUInteger i = 0; i < minusArr->num; i++) + ccCArrayRemoveValue(arr, minusArr->arr[i]); +} + +/** Removes from arr all values in minusArr. For each value in minusArr, all matching instances in arr will be removed. + @since v0.99.4 + */ +static inline void ccCArrayFullRemoveArray(ccCArray *arr, ccCArray *minusArr) +{ + NSUInteger back = 0; + + for( NSUInteger i = 0; i < arr->num; i++) { + if( ccCArrayContainsValue(minusArr, arr->arr[i]) ) { + back++; + } else + arr->arr[i - back] = arr->arr[i]; + } + + arr->num -= back; +} +#endif // CC_ARRAY_H diff --git a/libs/cocos2d/Support/ccUtils.c b/libs/cocos2d/Support/ccUtils.c new file mode 100755 index 0000000..39786ec --- /dev/null +++ b/libs/cocos2d/Support/ccUtils.c @@ -0,0 +1,20 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + */ + +/* + ccNextPOT function is licensed under the same license that is used in CCTexture2D.m. + */ +#include "ccUtils.h" + +unsigned long ccNextPOT(unsigned long x) +{ + x = x - 1; + x = x | (x >> 1); + x = x | (x >> 2); + x = x | (x >> 4); + x = x | (x >> 8); + x = x | (x >>16); + return x + 1; +} \ No newline at end of file diff --git a/libs/cocos2d/Support/ccUtils.h b/libs/cocos2d/Support/ccUtils.h new file mode 100755 index 0000000..783fc54 --- /dev/null +++ b/libs/cocos2d/Support/ccUtils.h @@ -0,0 +1,29 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + */ + +#ifndef __CC_UTILS_H +#define __CC_UTILS_H + +/** @file ccUtils.h + Misc free functions + */ + +/* + ccNextPOT function is licensed under the same license that is used in CCTexture2D.m. + */ + +/** returns the Next Power of Two value. + + Examples: + - If "value" is 15, it will return 16. + - If "value" is 16, it will return 16. + - If "value" is 17, it will return 32. + + @since v0.99.5 + */ + +unsigned long ccNextPOT( unsigned long value ); + +#endif // ! __CC_UTILS_H diff --git a/libs/cocos2d/Support/uthash.h b/libs/cocos2d/Support/uthash.h new file mode 100755 index 0000000..a4bdc18 --- /dev/null +++ b/libs/cocos2d/Support/uthash.h @@ -0,0 +1,972 @@ +/* +Copyright (c) 2003-2010, Troy D. Hanson http://uthash.sourceforge.net +All rights reserved. + +Redistribution and use in source and binary forms, with or without +modification, are permitted provided that the following conditions are met: + + * Redistributions of source code must retain the above copyright + notice, this list of conditions and the following disclaimer. + +THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS +IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED +TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A +PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER +OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, +EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, +PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR +PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF +LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING +NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS +SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. +*/ + +#ifndef UTHASH_H +#define UTHASH_H + +#include /* memcmp,strlen */ +#include /* ptrdiff_t */ + +/* These macros use decltype or the earlier __typeof GNU extension. + As decltype is only available in newer compilers (VS2010 or gcc 4.3+ + when compiling c++ source) this code uses whatever method is needed + or, for VS2008 where neither is available, uses casting workarounds. */ +#ifdef _MSC_VER /* MS compiler */ +#if _MSC_VER >= 1600 && defined(__cplusplus) /* VS2010 or newer in C++ mode */ +#define DECLTYPE(x) (decltype(x)) +#else /* VS2008 or older (or VS2010 in C mode) */ +#define NO_DECLTYPE +#define DECLTYPE(x) +#endif +#else /* GNU, Sun and other compilers */ +#define DECLTYPE(x) (__typeof(x)) +#endif + +#ifdef NO_DECLTYPE +#define DECLTYPE_ASSIGN(dst,src) \ +do { \ + char **_da_dst = (char**)(&(dst)); \ + *_da_dst = (char*)(src); \ +} while(0) +#else +#define DECLTYPE_ASSIGN(dst,src) \ +do { \ + (dst) = DECLTYPE(dst)(src); \ +} while(0) +#endif + +/* a number of the hash function use uint32_t which isn't defined on win32 */ +#ifdef _MSC_VER +typedef unsigned int uint32_t; +#else +#include /* uint32_t */ +#endif + +#define UTHASH_VERSION 1.9.3 + +#define uthash_fatal(msg) exit(-1) /* fatal error (out of memory,etc) */ +#define uthash_malloc(sz) malloc(sz) /* malloc fcn */ +#define uthash_free(ptr,sz) free(ptr) /* free fcn */ + +#define uthash_noexpand_fyi(tbl) /* can be defined to log noexpand */ +#define uthash_expand_fyi(tbl) /* can be defined to log expands */ + +/* initial number of buckets */ +#define HASH_INITIAL_NUM_BUCKETS 32 /* initial number of buckets */ +#define HASH_INITIAL_NUM_BUCKETS_LOG2 5 /* lg2 of initial number of buckets */ +#define HASH_BKT_CAPACITY_THRESH 10 /* expand when bucket count reaches */ + +/* calculate the element whose hash handle address is hhe */ +#define ELMT_FROM_HH(tbl,hhp) ((void*)(((char*)(hhp)) - ((tbl)->hho))) + +#define HASH_FIND(hh,head,keyptr,keylen,out) \ +do { \ + unsigned _hf_bkt,_hf_hashv; \ + out=NULL; \ + if (head) { \ + HASH_FCN(keyptr,keylen, (head)->hh.tbl->num_buckets, _hf_hashv, _hf_bkt); \ + if (HASH_BLOOM_TEST((head)->hh.tbl, _hf_hashv)) { \ + HASH_FIND_IN_BKT((head)->hh.tbl, hh, (head)->hh.tbl->buckets[ _hf_bkt ], \ + keyptr,keylen,out); \ + } \ + } \ +} while (0) + +#ifdef HASH_BLOOM +#define HASH_BLOOM_BITLEN (1ULL << HASH_BLOOM) +#define HASH_BLOOM_BYTELEN (HASH_BLOOM_BITLEN/8) + ((HASH_BLOOM_BITLEN%8) ? 1:0) +#define HASH_BLOOM_MAKE(tbl) \ +do { \ + (tbl)->bloom_nbits = HASH_BLOOM; \ + (tbl)->bloom_bv = (uint8_t*)uthash_malloc(HASH_BLOOM_BYTELEN); \ + if (!((tbl)->bloom_bv)) { uthash_fatal( "out of memory"); } \ + memset((tbl)->bloom_bv, 0, HASH_BLOOM_BYTELEN); \ + (tbl)->bloom_sig = HASH_BLOOM_SIGNATURE; \ +} while (0); + +#define HASH_BLOOM_FREE(tbl) \ +do { \ + uthash_free((tbl)->bloom_bv, HASH_BLOOM_BYTELEN); \ +} while (0); + +#define HASH_BLOOM_BITSET(bv,idx) (bv[(idx)/8] |= (1U << ((idx)%8))) +#define HASH_BLOOM_BITTEST(bv,idx) (bv[(idx)/8] & (1U << ((idx)%8))) + +#define HASH_BLOOM_ADD(tbl,hashv) \ + HASH_BLOOM_BITSET((tbl)->bloom_bv, (hashv & (uint32_t)((1ULL << (tbl)->bloom_nbits) - 1))) + +#define HASH_BLOOM_TEST(tbl,hashv) \ + HASH_BLOOM_BITTEST((tbl)->bloom_bv, (hashv & (uint32_t)((1ULL << (tbl)->bloom_nbits) - 1))) + +#else +#define HASH_BLOOM_MAKE(tbl) +#define HASH_BLOOM_FREE(tbl) +#define HASH_BLOOM_ADD(tbl,hashv) +#define HASH_BLOOM_TEST(tbl,hashv) (1) +#endif + +#define HASH_MAKE_TABLE(hh,head) \ +do { \ + (head)->hh.tbl = (UT_hash_table*)uthash_malloc( \ + sizeof(UT_hash_table)); \ + if (!((head)->hh.tbl)) { uthash_fatal( "out of memory"); } \ + memset((head)->hh.tbl, 0, sizeof(UT_hash_table)); \ + (head)->hh.tbl->tail = &((head)->hh); \ + (head)->hh.tbl->num_buckets = HASH_INITIAL_NUM_BUCKETS; \ + (head)->hh.tbl->log2_num_buckets = HASH_INITIAL_NUM_BUCKETS_LOG2; \ + (head)->hh.tbl->hho = (char*)(&(head)->hh) - (char*)(head); \ + (head)->hh.tbl->buckets = (UT_hash_bucket*)uthash_malloc( \ + HASH_INITIAL_NUM_BUCKETS*sizeof(struct UT_hash_bucket)); \ + if (! (head)->hh.tbl->buckets) { uthash_fatal( "out of memory"); } \ + memset((head)->hh.tbl->buckets, 0, \ + HASH_INITIAL_NUM_BUCKETS*sizeof(struct UT_hash_bucket)); \ + HASH_BLOOM_MAKE((head)->hh.tbl); \ + (head)->hh.tbl->signature = HASH_SIGNATURE; \ +} while(0) + +#define HASH_ADD(hh,head,fieldname,keylen_in,add) \ + HASH_ADD_KEYPTR(hh,head,&add->fieldname,keylen_in,add) + +#define HASH_ADD_KEYPTR(hh,head,keyptr,keylen_in,add) \ +do { \ + unsigned _ha_bkt; \ + (add)->hh.next = NULL; \ + (add)->hh.key = (char*)keyptr; \ + (add)->hh.keylen = keylen_in; \ + if (!(head)) { \ + head = (add); \ + (head)->hh.prev = NULL; \ + HASH_MAKE_TABLE(hh,head); \ + } else { \ + (head)->hh.tbl->tail->next = (add); \ + (add)->hh.prev = ELMT_FROM_HH((head)->hh.tbl, (head)->hh.tbl->tail); \ + (head)->hh.tbl->tail = &((add)->hh); \ + } \ + (head)->hh.tbl->num_items++; \ + (add)->hh.tbl = (head)->hh.tbl; \ + HASH_FCN(keyptr,keylen_in, (head)->hh.tbl->num_buckets, \ + (add)->hh.hashv, _ha_bkt); \ + HASH_ADD_TO_BKT((head)->hh.tbl->buckets[_ha_bkt],&(add)->hh); \ + HASH_BLOOM_ADD((head)->hh.tbl,(add)->hh.hashv); \ + HASH_EMIT_KEY(hh,head,keyptr,keylen_in); \ + HASH_FSCK(hh,head); \ +} while(0) + +#define HASH_TO_BKT( hashv, num_bkts, bkt ) \ +do { \ + bkt = ((hashv) & ((num_bkts) - 1)); \ +} while(0) + +/* delete "delptr" from the hash table. + * "the usual" patch-up process for the app-order doubly-linked-list. + * The use of _hd_hh_del below deserves special explanation. + * These used to be expressed using (delptr) but that led to a bug + * if someone used the same symbol for the head and deletee, like + * HASH_DELETE(hh,users,users); + * We want that to work, but by changing the head (users) below + * we were forfeiting our ability to further refer to the deletee (users) + * in the patch-up process. Solution: use scratch space to + * copy the deletee pointer, then the latter references are via that + * scratch pointer rather than through the repointed (users) symbol. + */ +#define HASH_DELETE(hh,head,delptr) \ +do { \ + unsigned _hd_bkt; \ + struct UT_hash_handle *_hd_hh_del; \ + if ( ((delptr)->hh.prev == NULL) && ((delptr)->hh.next == NULL) ) { \ + uthash_free((head)->hh.tbl->buckets, \ + (head)->hh.tbl->num_buckets*sizeof(struct UT_hash_bucket) ); \ + HASH_BLOOM_FREE((head)->hh.tbl); \ + uthash_free((head)->hh.tbl, sizeof(UT_hash_table)); \ + head = NULL; \ + } else { \ + _hd_hh_del = &((delptr)->hh); \ + if ((delptr) == ELMT_FROM_HH((head)->hh.tbl,(head)->hh.tbl->tail)) { \ + (head)->hh.tbl->tail = \ + (UT_hash_handle*)((char*)((delptr)->hh.prev) + \ + (head)->hh.tbl->hho); \ + } \ + if ((delptr)->hh.prev) { \ + ((UT_hash_handle*)((char*)((delptr)->hh.prev) + \ + (head)->hh.tbl->hho))->next = (delptr)->hh.next; \ + } else { \ + DECLTYPE_ASSIGN(head,(delptr)->hh.next); \ + } \ + if (_hd_hh_del->next) { \ + ((UT_hash_handle*)((char*)_hd_hh_del->next + \ + (head)->hh.tbl->hho))->prev = \ + _hd_hh_del->prev; \ + } \ + HASH_TO_BKT( _hd_hh_del->hashv, (head)->hh.tbl->num_buckets, _hd_bkt); \ + HASH_DEL_IN_BKT(hh,(head)->hh.tbl->buckets[_hd_bkt], _hd_hh_del); \ + (head)->hh.tbl->num_items--; \ + } \ + HASH_FSCK(hh,head); \ +} while (0) + + +/* convenience forms of HASH_FIND/HASH_ADD/HASH_DEL */ +#define HASH_FIND_STR(head,findstr,out) \ + HASH_FIND(hh,head,findstr,strlen(findstr),out) +#define HASH_ADD_STR(head,strfield,add) \ + HASH_ADD(hh,head,strfield,strlen(add->strfield),add) +#define HASH_FIND_INT(head,findint,out) \ + HASH_FIND(hh,head,findint,sizeof(int),out) +#define HASH_ADD_INT(head,intfield,add) \ + HASH_ADD(hh,head,intfield,sizeof(int),add) +#define HASH_FIND_PTR(head,findptr,out) \ + HASH_FIND(hh,head,findptr,sizeof(void *),out) +#define HASH_ADD_PTR(head,ptrfield,add) \ + HASH_ADD(hh,head,ptrfield,sizeof(void *),add) +#define HASH_DEL(head,delptr) \ + HASH_DELETE(hh,head,delptr) + +/* HASH_FSCK checks hash integrity on every add/delete when HASH_DEBUG is defined. + * This is for uthash developer only; it compiles away if HASH_DEBUG isn't defined. + */ +#ifdef HASH_DEBUG +#define HASH_OOPS(...) do { fprintf(stderr,__VA_ARGS__); exit(-1); } while (0) +#define HASH_FSCK(hh,head) \ +do { \ + unsigned _bkt_i; \ + unsigned _count, _bkt_count; \ + char *_prev; \ + struct UT_hash_handle *_thh; \ + if (head) { \ + _count = 0; \ + for( _bkt_i = 0; _bkt_i < (head)->hh.tbl->num_buckets; _bkt_i++) { \ + _bkt_count = 0; \ + _thh = (head)->hh.tbl->buckets[_bkt_i].hh_head; \ + _prev = NULL; \ + while (_thh) { \ + if (_prev != (char*)(_thh->hh_prev)) { \ + HASH_OOPS("invalid hh_prev %p, actual %p\n", \ + _thh->hh_prev, _prev ); \ + } \ + _bkt_count++; \ + _prev = (char*)(_thh); \ + _thh = _thh->hh_next; \ + } \ + _count += _bkt_count; \ + if ((head)->hh.tbl->buckets[_bkt_i].count != _bkt_count) { \ + HASH_OOPS("invalid bucket count %d, actual %d\n", \ + (head)->hh.tbl->buckets[_bkt_i].count, _bkt_count); \ + } \ + } \ + if (_count != (head)->hh.tbl->num_items) { \ + HASH_OOPS("invalid hh item count %d, actual %d\n", \ + (head)->hh.tbl->num_items, _count ); \ + } \ + /* traverse hh in app order; check next/prev integrity, count */ \ + _count = 0; \ + _prev = NULL; \ + _thh = &(head)->hh; \ + while (_thh) { \ + _count++; \ + if (_prev !=(char*)(_thh->prev)) { \ + HASH_OOPS("invalid prev %p, actual %p\n", \ + _thh->prev, _prev ); \ + } \ + _prev = (char*)ELMT_FROM_HH((head)->hh.tbl, _thh); \ + _thh = ( _thh->next ? (UT_hash_handle*)((char*)(_thh->next) + \ + (head)->hh.tbl->hho) : NULL ); \ + } \ + if (_count != (head)->hh.tbl->num_items) { \ + HASH_OOPS("invalid app item count %d, actual %d\n", \ + (head)->hh.tbl->num_items, _count ); \ + } \ + } \ +} while (0) +#else +#define HASH_FSCK(hh,head) +#endif + +/* When compiled with -DHASH_EMIT_KEYS, length-prefixed keys are emitted to + * the descriptor to which this macro is defined for tuning the hash function. + * The app can #include to get the prototype for write(2). */ +#ifdef HASH_EMIT_KEYS +#define HASH_EMIT_KEY(hh,head,keyptr,fieldlen) \ +do { \ + unsigned _klen = fieldlen; \ + write(HASH_EMIT_KEYS, &_klen, sizeof(_klen)); \ + write(HASH_EMIT_KEYS, keyptr, fieldlen); \ +} while (0) +#else +#define HASH_EMIT_KEY(hh,head,keyptr,fieldlen) +#endif + +/* default to Jenkin's hash unless overridden e.g. DHASH_FUNCTION=HASH_SAX */ +#ifdef HASH_FUNCTION +#define HASH_FCN HASH_FUNCTION +#else +#define HASH_FCN HASH_JEN +#endif + +/* The Bernstein hash function, used in Perl prior to v5.6 */ +#define HASH_BER(key,keylen,num_bkts,hashv,bkt) \ +do { \ + unsigned _hb_keylen=keylen; \ + char *_hb_key=(char*)(key); \ + (hashv) = 0; \ + while (_hb_keylen--) { (hashv) = ((hashv) * 33) + *_hb_key++; } \ + bkt = (hashv) & (num_bkts-1); \ +} while (0) + + +/* SAX/FNV/OAT/JEN hash functions are macro variants of those listed at + * http://eternallyconfuzzled.com/tuts/algorithms/jsw_tut_hashing.aspx */ +#define HASH_SAX(key,keylen,num_bkts,hashv,bkt) \ +do { \ + unsigned _sx_i; \ + char *_hs_key=(char*)(key); \ + hashv = 0; \ + for(_sx_i=0; _sx_i < keylen; _sx_i++) \ + hashv ^= (hashv << 5) + (hashv >> 2) + _hs_key[_sx_i]; \ + bkt = hashv & (num_bkts-1); \ +} while (0) + +#define HASH_FNV(key,keylen,num_bkts,hashv,bkt) \ +do { \ + unsigned _fn_i; \ + char *_hf_key=(char*)(key); \ + hashv = 2166136261UL; \ + for(_fn_i=0; _fn_i < keylen; _fn_i++) \ + hashv = (hashv * 16777619) ^ _hf_key[_fn_i]; \ + bkt = hashv & (num_bkts-1); \ +} while(0); + +#define HASH_OAT(key,keylen,num_bkts,hashv,bkt) \ +do { \ + unsigned _ho_i; \ + char *_ho_key=(char*)(key); \ + hashv = 0; \ + for(_ho_i=0; _ho_i < keylen; _ho_i++) { \ + hashv += _ho_key[_ho_i]; \ + hashv += (hashv << 10); \ + hashv ^= (hashv >> 6); \ + } \ + hashv += (hashv << 3); \ + hashv ^= (hashv >> 11); \ + hashv += (hashv << 15); \ + bkt = hashv & (num_bkts-1); \ +} while(0) + +#define HASH_JEN_MIX(a,b,c) \ +do { \ + a -= b; a -= c; a ^= ( c >> 13 ); \ + b -= c; b -= a; b ^= ( a << 8 ); \ + c -= a; c -= b; c ^= ( b >> 13 ); \ + a -= b; a -= c; a ^= ( c >> 12 ); \ + b -= c; b -= a; b ^= ( a << 16 ); \ + c -= a; c -= b; c ^= ( b >> 5 ); \ + a -= b; a -= c; a ^= ( c >> 3 ); \ + b -= c; b -= a; b ^= ( a << 10 ); \ + c -= a; c -= b; c ^= ( b >> 15 ); \ +} while (0) + +#define HASH_JEN(key,keylen,num_bkts,hashv,bkt) \ +do { \ + unsigned _hj_i,_hj_j,_hj_k; \ + char *_hj_key=(char*)(key); \ + hashv = 0xfeedbeef; \ + _hj_i = _hj_j = 0x9e3779b9; \ + _hj_k = keylen; \ + while (_hj_k >= 12) { \ + _hj_i += (_hj_key[0] + ( (unsigned)_hj_key[1] << 8 ) \ + + ( (unsigned)_hj_key[2] << 16 ) \ + + ( (unsigned)_hj_key[3] << 24 ) ); \ + _hj_j += (_hj_key[4] + ( (unsigned)_hj_key[5] << 8 ) \ + + ( (unsigned)_hj_key[6] << 16 ) \ + + ( (unsigned)_hj_key[7] << 24 ) ); \ + hashv += (_hj_key[8] + ( (unsigned)_hj_key[9] << 8 ) \ + + ( (unsigned)_hj_key[10] << 16 ) \ + + ( (unsigned)_hj_key[11] << 24 ) ); \ + \ + HASH_JEN_MIX(_hj_i, _hj_j, hashv); \ + \ + _hj_key += 12; \ + _hj_k -= 12; \ + } \ + hashv += keylen; \ + switch ( _hj_k ) { \ + case 11: hashv += ( (unsigned)_hj_key[10] << 24 ); \ + case 10: hashv += ( (unsigned)_hj_key[9] << 16 ); \ + case 9: hashv += ( (unsigned)_hj_key[8] << 8 ); \ + case 8: _hj_j += ( (unsigned)_hj_key[7] << 24 ); \ + case 7: _hj_j += ( (unsigned)_hj_key[6] << 16 ); \ + case 6: _hj_j += ( (unsigned)_hj_key[5] << 8 ); \ + case 5: _hj_j += _hj_key[4]; \ + case 4: _hj_i += ( (unsigned)_hj_key[3] << 24 ); \ + case 3: _hj_i += ( (unsigned)_hj_key[2] << 16 ); \ + case 2: _hj_i += ( (unsigned)_hj_key[1] << 8 ); \ + case 1: _hj_i += _hj_key[0]; \ + } \ + HASH_JEN_MIX(_hj_i, _hj_j, hashv); \ + bkt = hashv & (num_bkts-1); \ +} while(0) + +/* The Paul Hsieh hash function */ +#undef get16bits +#if (defined(__GNUC__) && defined(__i386__)) || defined(__WATCOMC__) \ + || defined(_MSC_VER) || defined (__BORLANDC__) || defined (__TURBOC__) +#define get16bits(d) (*((const uint16_t *) (d))) +#endif + +#if !defined (get16bits) +#define get16bits(d) ((((uint32_t)(((const uint8_t *)(d))[1])) << 8) \ + +(uint32_t)(((const uint8_t *)(d))[0]) ) +#endif +#define HASH_SFH(key,keylen,num_bkts,hashv,bkt) \ +do { \ + char *_sfh_key=(char*)(key); \ + uint32_t _sfh_tmp, _sfh_len = keylen; \ + \ + int _sfh_rem = _sfh_len & 3; \ + _sfh_len >>= 2; \ + hashv = 0xcafebabe; \ + \ + /* Main loop */ \ + for (;_sfh_len > 0; _sfh_len--) { \ + hashv += get16bits (_sfh_key); \ + _sfh_tmp = (get16bits (_sfh_key+2) << 11) ^ hashv; \ + hashv = (hashv << 16) ^ _sfh_tmp; \ + _sfh_key += 2*sizeof (uint16_t); \ + hashv += hashv >> 11; \ + } \ + \ + /* Handle end cases */ \ + switch (_sfh_rem) { \ + case 3: hashv += get16bits (_sfh_key); \ + hashv ^= hashv << 16; \ + hashv ^= _sfh_key[sizeof (uint16_t)] << 18; \ + hashv += hashv >> 11; \ + break; \ + case 2: hashv += get16bits (_sfh_key); \ + hashv ^= hashv << 11; \ + hashv += hashv >> 17; \ + break; \ + case 1: hashv += *_sfh_key; \ + hashv ^= hashv << 10; \ + hashv += hashv >> 1; \ + } \ + \ + /* Force "avalanching" of final 127 bits */ \ + hashv ^= hashv << 3; \ + hashv += hashv >> 5; \ + hashv ^= hashv << 4; \ + hashv += hashv >> 17; \ + hashv ^= hashv << 25; \ + hashv += hashv >> 6; \ + bkt = hashv & (num_bkts-1); \ +} while(0); + +#ifdef HASH_USING_NO_STRICT_ALIASING +/* The MurmurHash exploits some CPU's (e.g. x86) tolerance for unaligned reads. + * For other types of CPU's (e.g. Sparc) an unaligned read causes a bus error. + * So MurmurHash comes in two versions, the faster unaligned one and the slower + * aligned one. We only use the faster one on CPU's where we know it's safe. + * + * Note the preprocessor built-in defines can be emitted using: + * + * gcc -m64 -dM -E - < /dev/null (on gcc) + * cc -## a.c (where a.c is a simple test file) (Sun Studio) + */ +#if (defined(__i386__) || defined(__x86_64__)) +#define HASH_MUR HASH_MUR_UNALIGNED +#else +#define HASH_MUR HASH_MUR_ALIGNED +#endif + +/* Appleby's MurmurHash fast version for unaligned-tolerant archs like i386 */ +#define HASH_MUR_UNALIGNED(key,keylen,num_bkts,hashv,bkt) \ +do { \ + const unsigned int _mur_m = 0x5bd1e995; \ + const int _mur_r = 24; \ + hashv = 0xcafebabe ^ keylen; \ + char *_mur_key = (char *)(key); \ + uint32_t _mur_tmp, _mur_len = keylen; \ + \ + for (;_mur_len >= 4; _mur_len-=4) { \ + _mur_tmp = *(uint32_t *)_mur_key; \ + _mur_tmp *= _mur_m; \ + _mur_tmp ^= _mur_tmp >> _mur_r; \ + _mur_tmp *= _mur_m; \ + hashv *= _mur_m; \ + hashv ^= _mur_tmp; \ + _mur_key += 4; \ + } \ + \ + switch(_mur_len) \ + { \ + case 3: hashv ^= _mur_key[2] << 16; \ + case 2: hashv ^= _mur_key[1] << 8; \ + case 1: hashv ^= _mur_key[0]; \ + hashv *= _mur_m; \ + }; \ + \ + hashv ^= hashv >> 13; \ + hashv *= _mur_m; \ + hashv ^= hashv >> 15; \ + \ + bkt = hashv & (num_bkts-1); \ +} while(0) + +/* Appleby's MurmurHash version for alignment-sensitive archs like Sparc */ +#define HASH_MUR_ALIGNED(key,keylen,num_bkts,hashv,bkt) \ +do { \ + const unsigned int _mur_m = 0x5bd1e995; \ + const int _mur_r = 24; \ + hashv = 0xcafebabe ^ (keylen); \ + char *_mur_key = (char *)(key); \ + uint32_t _mur_len = keylen; \ + int _mur_align = (int)_mur_key & 3; \ + \ + if (_mur_align && (_mur_len >= 4)) { \ + unsigned _mur_t = 0, _mur_d = 0; \ + switch(_mur_align) { \ + case 1: _mur_t |= _mur_key[2] << 16; \ + case 2: _mur_t |= _mur_key[1] << 8; \ + case 3: _mur_t |= _mur_key[0]; \ + } \ + _mur_t <<= (8 * _mur_align); \ + _mur_key += 4-_mur_align; \ + _mur_len -= 4-_mur_align; \ + int _mur_sl = 8 * (4-_mur_align); \ + int _mur_sr = 8 * _mur_align; \ + \ + for (;_mur_len >= 4; _mur_len-=4) { \ + _mur_d = *(unsigned *)_mur_key; \ + _mur_t = (_mur_t >> _mur_sr) | (_mur_d << _mur_sl); \ + unsigned _mur_k = _mur_t; \ + _mur_k *= _mur_m; \ + _mur_k ^= _mur_k >> _mur_r; \ + _mur_k *= _mur_m; \ + hashv *= _mur_m; \ + hashv ^= _mur_k; \ + _mur_t = _mur_d; \ + _mur_key += 4; \ + } \ + _mur_d = 0; \ + if(_mur_len >= _mur_align) { \ + switch(_mur_align) { \ + case 3: _mur_d |= _mur_key[2] << 16; \ + case 2: _mur_d |= _mur_key[1] << 8; \ + case 1: _mur_d |= _mur_key[0]; \ + } \ + unsigned _mur_k = (_mur_t >> _mur_sr) | (_mur_d << _mur_sl); \ + _mur_k *= _mur_m; \ + _mur_k ^= _mur_k >> _mur_r; \ + _mur_k *= _mur_m; \ + hashv *= _mur_m; \ + hashv ^= _mur_k; \ + _mur_k += _mur_align; \ + _mur_len -= _mur_align; \ + \ + switch(_mur_len) \ + { \ + case 3: hashv ^= _mur_key[2] << 16; \ + case 2: hashv ^= _mur_key[1] << 8; \ + case 1: hashv ^= _mur_key[0]; \ + hashv *= _mur_m; \ + } \ + } else { \ + switch(_mur_len) \ + { \ + case 3: _mur_d ^= _mur_key[2] << 16; \ + case 2: _mur_d ^= _mur_key[1] << 8; \ + case 1: _mur_d ^= _mur_key[0]; \ + case 0: hashv ^= (_mur_t >> _mur_sr) | (_mur_d << _mur_sl); \ + hashv *= _mur_m; \ + } \ + } \ + \ + hashv ^= hashv >> 13; \ + hashv *= _mur_m; \ + hashv ^= hashv >> 15; \ + } else { \ + for (;_mur_len >= 4; _mur_len-=4) { \ + unsigned _mur_k = *(unsigned*)_mur_key; \ + _mur_k *= _mur_m; \ + _mur_k ^= _mur_k >> _mur_r; \ + _mur_k *= _mur_m; \ + hashv *= _mur_m; \ + hashv ^= _mur_k; \ + _mur_key += 4; \ + } \ + switch(_mur_len) \ + { \ + case 3: hashv ^= _mur_key[2] << 16; \ + case 2: hashv ^= _mur_key[1] << 8; \ + case 1: hashv ^= _mur_key[0]; \ + hashv *= _mur_m; \ + } \ + \ + hashv ^= hashv >> 13; \ + hashv *= _mur_m; \ + hashv ^= hashv >> 15; \ + } \ + bkt = hashv & (num_bkts-1); \ +} while(0) +#endif /* HASH_USING_NO_STRICT_ALIASING */ + +/* key comparison function; return 0 if keys equal */ +#define HASH_KEYCMP(a,b,len) memcmp(a,b,len) + +/* iterate over items in a known bucket to find desired item */ +#define HASH_FIND_IN_BKT(tbl,hh,head,keyptr,keylen_in,out) \ +do { \ + if (head.hh_head) DECLTYPE_ASSIGN(out,ELMT_FROM_HH(tbl,head.hh_head)); \ + else out=NULL; \ + while (out) { \ + if (out->hh.keylen == keylen_in) { \ + if ((HASH_KEYCMP(out->hh.key,keyptr,keylen_in)) == 0) break; \ + } \ + if (out->hh.hh_next) DECLTYPE_ASSIGN(out,ELMT_FROM_HH(tbl,out->hh.hh_next)); \ + else out = NULL; \ + } \ +} while(0) + +/* add an item to a bucket */ +#define HASH_ADD_TO_BKT(head,addhh) \ +do { \ + head.count++; \ + (addhh)->hh_next = head.hh_head; \ + (addhh)->hh_prev = NULL; \ + if (head.hh_head) { (head).hh_head->hh_prev = (addhh); } \ + (head).hh_head=addhh; \ + if (head.count >= ((head.expand_mult+1) * HASH_BKT_CAPACITY_THRESH) \ + && (addhh)->tbl->noexpand != 1) { \ + HASH_EXPAND_BUCKETS((addhh)->tbl); \ + } \ +} while(0) + +/* remove an item from a given bucket */ +#define HASH_DEL_IN_BKT(hh,head,hh_del) \ + (head).count--; \ + if ((head).hh_head == hh_del) { \ + (head).hh_head = hh_del->hh_next; \ + } \ + if (hh_del->hh_prev) { \ + hh_del->hh_prev->hh_next = hh_del->hh_next; \ + } \ + if (hh_del->hh_next) { \ + hh_del->hh_next->hh_prev = hh_del->hh_prev; \ + } + +/* Bucket expansion has the effect of doubling the number of buckets + * and redistributing the items into the new buckets. Ideally the + * items will distribute more or less evenly into the new buckets + * (the extent to which this is true is a measure of the quality of + * the hash function as it applies to the key domain). + * + * With the items distributed into more buckets, the chain length + * (item count) in each bucket is reduced. Thus by expanding buckets + * the hash keeps a bound on the chain length. This bounded chain + * length is the essence of how a hash provides constant time lookup. + * + * The calculation of tbl->ideal_chain_maxlen below deserves some + * explanation. First, keep in mind that we're calculating the ideal + * maximum chain length based on the *new* (doubled) bucket count. + * In fractions this is just n/b (n=number of items,b=new num buckets). + * Since the ideal chain length is an integer, we want to calculate + * ceil(n/b). We don't depend on floating point arithmetic in this + * hash, so to calculate ceil(n/b) with integers we could write + * + * ceil(n/b) = (n/b) + ((n%b)?1:0) + * + * and in fact a previous version of this hash did just that. + * But now we have improved things a bit by recognizing that b is + * always a power of two. We keep its base 2 log handy (call it lb), + * so now we can write this with a bit shift and logical AND: + * + * ceil(n/b) = (n>>lb) + ( (n & (b-1)) ? 1:0) + * + */ +#define HASH_EXPAND_BUCKETS(tbl) \ +do { \ + unsigned _he_bkt; \ + unsigned _he_bkt_i; \ + struct UT_hash_handle *_he_thh, *_he_hh_nxt; \ + UT_hash_bucket *_he_new_buckets, *_he_newbkt; \ + _he_new_buckets = (UT_hash_bucket*)uthash_malloc( \ + 2 * tbl->num_buckets * sizeof(struct UT_hash_bucket)); \ + if (!_he_new_buckets) { uthash_fatal( "out of memory"); } \ + memset(_he_new_buckets, 0, \ + 2 * tbl->num_buckets * sizeof(struct UT_hash_bucket)); \ + tbl->ideal_chain_maxlen = \ + (tbl->num_items >> (tbl->log2_num_buckets+1)) + \ + ((tbl->num_items & ((tbl->num_buckets*2)-1)) ? 1 : 0); \ + tbl->nonideal_items = 0; \ + for(_he_bkt_i = 0; _he_bkt_i < tbl->num_buckets; _he_bkt_i++) \ + { \ + _he_thh = tbl->buckets[ _he_bkt_i ].hh_head; \ + while (_he_thh) { \ + _he_hh_nxt = _he_thh->hh_next; \ + HASH_TO_BKT( _he_thh->hashv, tbl->num_buckets*2, _he_bkt); \ + _he_newbkt = &(_he_new_buckets[ _he_bkt ]); \ + if (++(_he_newbkt->count) > tbl->ideal_chain_maxlen) { \ + tbl->nonideal_items++; \ + _he_newbkt->expand_mult = _he_newbkt->count / \ + tbl->ideal_chain_maxlen; \ + } \ + _he_thh->hh_prev = NULL; \ + _he_thh->hh_next = _he_newbkt->hh_head; \ + if (_he_newbkt->hh_head) _he_newbkt->hh_head->hh_prev = \ + _he_thh; \ + _he_newbkt->hh_head = _he_thh; \ + _he_thh = _he_hh_nxt; \ + } \ + } \ + uthash_free( tbl->buckets, tbl->num_buckets*sizeof(struct UT_hash_bucket) ); \ + tbl->num_buckets *= 2; \ + tbl->log2_num_buckets++; \ + tbl->buckets = _he_new_buckets; \ + tbl->ineff_expands = (tbl->nonideal_items > (tbl->num_items >> 1)) ? \ + (tbl->ineff_expands+1) : 0; \ + if (tbl->ineff_expands > 1) { \ + tbl->noexpand=1; \ + uthash_noexpand_fyi(tbl); \ + } \ + uthash_expand_fyi(tbl); \ +} while(0) + + +/* This is an adaptation of Simon Tatham's O(n log(n)) mergesort */ +/* Note that HASH_SORT assumes the hash handle name to be hh. + * HASH_SRT was added to allow the hash handle name to be passed in. */ +#define HASH_SORT(head,cmpfcn) HASH_SRT(hh,head,cmpfcn) +#define HASH_SRT(hh,head,cmpfcn) \ +do { \ + unsigned _hs_i; \ + unsigned _hs_looping,_hs_nmerges,_hs_insize,_hs_psize,_hs_qsize; \ + struct UT_hash_handle *_hs_p, *_hs_q, *_hs_e, *_hs_list, *_hs_tail; \ + if (head) { \ + _hs_insize = 1; \ + _hs_looping = 1; \ + _hs_list = &((head)->hh); \ + while (_hs_looping) { \ + _hs_p = _hs_list; \ + _hs_list = NULL; \ + _hs_tail = NULL; \ + _hs_nmerges = 0; \ + while (_hs_p) { \ + _hs_nmerges++; \ + _hs_q = _hs_p; \ + _hs_psize = 0; \ + for ( _hs_i = 0; _hs_i < _hs_insize; _hs_i++ ) { \ + _hs_psize++; \ + _hs_q = (UT_hash_handle*)((_hs_q->next) ? \ + ((void*)((char*)(_hs_q->next) + \ + (head)->hh.tbl->hho)) : NULL); \ + if (! (_hs_q) ) break; \ + } \ + _hs_qsize = _hs_insize; \ + while ((_hs_psize > 0) || ((_hs_qsize > 0) && _hs_q )) { \ + if (_hs_psize == 0) { \ + _hs_e = _hs_q; \ + _hs_q = (UT_hash_handle*)((_hs_q->next) ? \ + ((void*)((char*)(_hs_q->next) + \ + (head)->hh.tbl->hho)) : NULL); \ + _hs_qsize--; \ + } else if ( (_hs_qsize == 0) || !(_hs_q) ) { \ + _hs_e = _hs_p; \ + _hs_p = (UT_hash_handle*)((_hs_p->next) ? \ + ((void*)((char*)(_hs_p->next) + \ + (head)->hh.tbl->hho)) : NULL); \ + _hs_psize--; \ + } else if (( \ + cmpfcn(DECLTYPE(head)(ELMT_FROM_HH((head)->hh.tbl,_hs_p)), \ + DECLTYPE(head)(ELMT_FROM_HH((head)->hh.tbl,_hs_q))) \ + ) <= 0) { \ + _hs_e = _hs_p; \ + _hs_p = (UT_hash_handle*)((_hs_p->next) ? \ + ((void*)((char*)(_hs_p->next) + \ + (head)->hh.tbl->hho)) : NULL); \ + _hs_psize--; \ + } else { \ + _hs_e = _hs_q; \ + _hs_q = (UT_hash_handle*)((_hs_q->next) ? \ + ((void*)((char*)(_hs_q->next) + \ + (head)->hh.tbl->hho)) : NULL); \ + _hs_qsize--; \ + } \ + if ( _hs_tail ) { \ + _hs_tail->next = ((_hs_e) ? \ + ELMT_FROM_HH((head)->hh.tbl,_hs_e) : NULL); \ + } else { \ + _hs_list = _hs_e; \ + } \ + _hs_e->prev = ((_hs_tail) ? \ + ELMT_FROM_HH((head)->hh.tbl,_hs_tail) : NULL); \ + _hs_tail = _hs_e; \ + } \ + _hs_p = _hs_q; \ + } \ + _hs_tail->next = NULL; \ + if ( _hs_nmerges <= 1 ) { \ + _hs_looping=0; \ + (head)->hh.tbl->tail = _hs_tail; \ + DECLTYPE_ASSIGN(head,ELMT_FROM_HH((head)->hh.tbl, _hs_list)); \ + } \ + _hs_insize *= 2; \ + } \ + HASH_FSCK(hh,head); \ + } \ +} while (0) + +/* This function selects items from one hash into another hash. + * The end result is that the selected items have dual presence + * in both hashes. There is no copy of the items made; rather + * they are added into the new hash through a secondary hash + * hash handle that must be present in the structure. */ +#define HASH_SELECT(hh_dst, dst, hh_src, src, cond) \ +do { \ + unsigned _src_bkt, _dst_bkt; \ + void *_last_elt=NULL, *_elt; \ + UT_hash_handle *_src_hh, *_dst_hh, *_last_elt_hh=NULL; \ + ptrdiff_t _dst_hho = ((char*)(&(dst)->hh_dst) - (char*)(dst)); \ + if (src) { \ + for(_src_bkt=0; _src_bkt < (src)->hh_src.tbl->num_buckets; _src_bkt++) { \ + for(_src_hh = (src)->hh_src.tbl->buckets[_src_bkt].hh_head; \ + _src_hh; \ + _src_hh = _src_hh->hh_next) { \ + _elt = ELMT_FROM_HH((src)->hh_src.tbl, _src_hh); \ + if (cond(_elt)) { \ + _dst_hh = (UT_hash_handle*)(((char*)_elt) + _dst_hho); \ + _dst_hh->key = _src_hh->key; \ + _dst_hh->keylen = _src_hh->keylen; \ + _dst_hh->hashv = _src_hh->hashv; \ + _dst_hh->prev = _last_elt; \ + _dst_hh->next = NULL; \ + if (_last_elt_hh) { _last_elt_hh->next = _elt; } \ + if (!dst) { \ + DECLTYPE_ASSIGN(dst,_elt); \ + HASH_MAKE_TABLE(hh_dst,dst); \ + } else { \ + _dst_hh->tbl = (dst)->hh_dst.tbl; \ + } \ + HASH_TO_BKT(_dst_hh->hashv, _dst_hh->tbl->num_buckets, _dst_bkt); \ + HASH_ADD_TO_BKT(_dst_hh->tbl->buckets[_dst_bkt],_dst_hh); \ + (dst)->hh_dst.tbl->num_items++; \ + _last_elt = _elt; \ + _last_elt_hh = _dst_hh; \ + } \ + } \ + } \ + } \ + HASH_FSCK(hh_dst,dst); \ +} while (0) + +#define HASH_CLEAR(hh,head) \ +do { \ + if (head) { \ + uthash_free((head)->hh.tbl->buckets, \ + (head)->hh.tbl->num_buckets*sizeof(struct UT_hash_bucket)); \ + uthash_free((head)->hh.tbl, sizeof(UT_hash_table)); \ + (head)=NULL; \ + } \ +} while(0) + +#ifdef NO_DECLTYPE +#define HASH_ITER(hh,head,el,tmp) \ +for((el)=(head), (*(char**)(&(tmp)))=(char*)((head)?(head)->hh.next:NULL); \ + el; (el)=(tmp),(*(char**)(&(tmp)))=(char*)((tmp)?(tmp)->hh.next:NULL)) +#else +#define HASH_ITER(hh,head,el,tmp) \ +for((el)=(head),(tmp)=DECLTYPE(el)((head)?(head)->hh.next:NULL); \ + el; (el)=(tmp),(tmp)=DECLTYPE(el)((tmp)?(tmp)->hh.next:NULL)) +#endif + +/* obtain a count of items in the hash */ +#define HASH_COUNT(head) HASH_CNT(hh,head) +#define HASH_CNT(hh,head) ((head)?((head)->hh.tbl->num_items):0) + +typedef struct UT_hash_bucket { + struct UT_hash_handle *hh_head; + unsigned count; + + /* expand_mult is normally set to 0. In this situation, the max chain length + * threshold is enforced at its default value, HASH_BKT_CAPACITY_THRESH. (If + * the bucket's chain exceeds this length, bucket expansion is triggered). + * However, setting expand_mult to a non-zero value delays bucket expansion + * (that would be triggered by additions to this particular bucket) + * until its chain length reaches a *multiple* of HASH_BKT_CAPACITY_THRESH. + * (The multiplier is simply expand_mult+1). The whole idea of this + * multiplier is to reduce bucket expansions, since they are expensive, in + * situations where we know that a particular bucket tends to be overused. + * It is better to let its chain length grow to a longer yet-still-bounded + * value, than to do an O(n) bucket expansion too often. + */ + unsigned expand_mult; + +} UT_hash_bucket; + +/* random signature used only to find hash tables in external analysis */ +#define HASH_SIGNATURE 0xa0111fe1 +#define HASH_BLOOM_SIGNATURE 0xb12220f2 + +typedef struct UT_hash_table { + UT_hash_bucket *buckets; + unsigned num_buckets, log2_num_buckets; + unsigned num_items; + struct UT_hash_handle *tail; /* tail hh in app order, for fast append */ + ptrdiff_t hho; /* hash handle offset (byte pos of hash handle in element */ + + /* in an ideal situation (all buckets used equally), no bucket would have + * more than ceil(#items/#buckets) items. that's the ideal chain length. */ + unsigned ideal_chain_maxlen; + + /* nonideal_items is the number of items in the hash whose chain position + * exceeds the ideal chain maxlen. these items pay the penalty for an uneven + * hash distribution; reaching them in a chain traversal takes >ideal steps */ + unsigned nonideal_items; + + /* ineffective expands occur when a bucket doubling was performed, but + * afterward, more than half the items in the hash had nonideal chain + * positions. If this happens on two consecutive expansions we inhibit any + * further expansion, as it's not helping; this happens when the hash + * function isn't a good fit for the key domain. When expansion is inhibited + * the hash will still work, albeit no longer in constant time. */ + unsigned ineff_expands, noexpand; + + uint32_t signature; /* used only to find hash tables in external analysis */ +#ifdef HASH_BLOOM + uint32_t bloom_sig; /* used only to test bloom exists in external analysis */ + uint8_t *bloom_bv; + char bloom_nbits; +#endif + +} UT_hash_table; + +typedef struct UT_hash_handle { + struct UT_hash_table *tbl; + void *prev; /* prev element in app order */ + void *next; /* next element in app order */ + struct UT_hash_handle *hh_prev; /* previous hh in bucket order */ + struct UT_hash_handle *hh_next; /* next hh in bucket order */ + void *key; /* ptr to enclosing struct's key */ + unsigned keylen; /* enclosing struct's key len */ + unsigned hashv; /* result of hash-fcn(key) */ +} UT_hash_handle; + +#endif /* UTHASH_H */ diff --git a/libs/cocos2d/Support/utlist.h b/libs/cocos2d/Support/utlist.h new file mode 100755 index 0000000..34c725b --- /dev/null +++ b/libs/cocos2d/Support/utlist.h @@ -0,0 +1,490 @@ +/* +Copyright (c) 2007-2010, Troy D. Hanson http://uthash.sourceforge.net +All rights reserved. + +Redistribution and use in source and binary forms, with or without +modification, are permitted provided that the following conditions are met: + + * Redistributions of source code must retain the above copyright + notice, this list of conditions and the following disclaimer. + +THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS +IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED +TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A +PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER +OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, +EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, +PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR +PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF +LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING +NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS +SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. +*/ + +#ifndef UTLIST_H +#define UTLIST_H + +#define UTLIST_VERSION 1.9.1 + +/* + * This file contains macros to manipulate singly and doubly-linked lists. + * + * 1. LL_ macros: singly-linked lists. + * 2. DL_ macros: doubly-linked lists. + * 3. CDL_ macros: circular doubly-linked lists. + * + * To use singly-linked lists, your structure must have a "next" pointer. + * To use doubly-linked lists, your structure must "prev" and "next" pointers. + * Either way, the pointer to the head of the list must be initialized to NULL. + * + * ----------------.EXAMPLE ------------------------- + * struct item { + * int id; + * struct item *prev, *next; + * } + * + * struct item *list = NULL: + * + * int main() { + * struct item *item; + * ... allocate and populate item ... + * DL_APPEND(list, item); + * } + * -------------------------------------------------- + * + * For doubly-linked lists, the append and delete macros are O(1) + * For singly-linked lists, append and delete are O(n) but prepend is O(1) + * The sort macro is O(n log(n)) for all types of single/double/circular lists. + */ + +/* These macros use decltype or the earlier __typeof GNU extension. + As decltype is only available in newer compilers (VS2010 or gcc 4.3+ + when compiling c++ code), this code uses whatever method is needed + or, for VS2008 where neither is available, uses casting workarounds. */ +#ifdef _MSC_VER /* MS compiler */ +#if _MSC_VER >= 1600 && defined(__cplusplus) /* VS2010 or newer in C++ mode */ +#define LDECLTYPE(x) decltype(x) +#else /* VS2008 or older (or VS2010 in C mode) */ +#define NO_DECLTYPE +#define LDECLTYPE(x) char* +#endif +#else /* GNU, Sun and other compilers */ +#define LDECLTYPE(x) __typeof(x) +#endif + +/* for VS2008 we use some workarounds to get around the lack of decltype, + * namely, we always reassign our tmp variable to the list head if we need + * to dereference its prev/next pointers, and save/restore the real head.*/ +#ifdef NO_DECLTYPE +#define _SV(elt,list) _tmp = (char*)(list); {char **_alias = (char**)&(list); *_alias = (elt); } +#define _NEXT(elt,list) ((char*)((list)->next)) +#define _NEXTASGN(elt,list,to) { char **_alias = (char**)&((list)->next); *_alias=(char*)(to); } +#define _PREV(elt,list) ((char*)((list)->prev)) +#define _PREVASGN(elt,list,to) { char **_alias = (char**)&((list)->prev); *_alias=(char*)(to); } +#define _RS(list) { char **_alias = (char**)&(list); *_alias=_tmp; } +#define _CASTASGN(a,b) { char **_alias = (char**)&(a); *_alias=(char*)(b); } +#else +#define _SV(elt,list) +#define _NEXT(elt,list) ((elt)->next) +#define _NEXTASGN(elt,list,to) ((elt)->next)=(to) +#define _PREV(elt,list) ((elt)->prev) +#define _PREVASGN(elt,list,to) ((elt)->prev)=(to) +#define _RS(list) +#define _CASTASGN(a,b) (a)=(b) +#endif + +/****************************************************************************** + * The sort macro is an adaptation of Simon Tatham's O(n log(n)) mergesort * + * Unwieldy variable names used here to avoid shadowing passed-in variables. * + *****************************************************************************/ +#define LL_SORT(list, cmp) \ +do { \ + LDECLTYPE(list) _ls_p; \ + LDECLTYPE(list) _ls_q; \ + LDECLTYPE(list) _ls_e; \ + LDECLTYPE(list) _ls_tail; \ + LDECLTYPE(list) _ls_oldhead; \ + LDECLTYPE(list) _tmp; \ + int _ls_insize, _ls_nmerges, _ls_psize, _ls_qsize, _ls_i, _ls_looping; \ + if (list) { \ + _ls_insize = 1; \ + _ls_looping = 1; \ + while (_ls_looping) { \ + _CASTASGN(_ls_p,list); \ + _CASTASGN(_ls_oldhead,list); \ + list = NULL; \ + _ls_tail = NULL; \ + _ls_nmerges = 0; \ + while (_ls_p) { \ + _ls_nmerges++; \ + _ls_q = _ls_p; \ + _ls_psize = 0; \ + for (_ls_i = 0; _ls_i < _ls_insize; _ls_i++) { \ + _ls_psize++; \ + _SV(_ls_q,list); _ls_q = _NEXT(_ls_q,list); _RS(list); \ + if (!_ls_q) break; \ + } \ + _ls_qsize = _ls_insize; \ + while (_ls_psize > 0 || (_ls_qsize > 0 && _ls_q)) { \ + if (_ls_psize == 0) { \ + _ls_e = _ls_q; _SV(_ls_q,list); _ls_q = _NEXT(_ls_q,list); _RS(list); _ls_qsize--; \ + } else if (_ls_qsize == 0 || !_ls_q) { \ + _ls_e = _ls_p; _SV(_ls_p,list); _ls_p = _NEXT(_ls_p,list); _RS(list); _ls_psize--; \ + } else if (cmp(_ls_p,_ls_q) <= 0) { \ + _ls_e = _ls_p; _SV(_ls_p,list); _ls_p = _NEXT(_ls_p,list); _RS(list); _ls_psize--; \ + } else { \ + _ls_e = _ls_q; _SV(_ls_q,list); _ls_q = _NEXT(_ls_q,list); _RS(list); _ls_qsize--; \ + } \ + if (_ls_tail) { \ + _SV(_ls_tail,list); _NEXTASGN(_ls_tail,list,_ls_e); _RS(list); \ + } else { \ + _CASTASGN(list,_ls_e); \ + } \ + _ls_tail = _ls_e; \ + } \ + _ls_p = _ls_q; \ + } \ + _SV(_ls_tail,list); _NEXTASGN(_ls_tail,list,NULL); _RS(list); \ + if (_ls_nmerges <= 1) { \ + _ls_looping=0; \ + } \ + _ls_insize *= 2; \ + } \ + } else _tmp=NULL; /* quiet gcc unused variable warning */ \ +} while (0) + +#define DL_SORT(list, cmp) \ +do { \ + LDECLTYPE(list) _ls_p; \ + LDECLTYPE(list) _ls_q; \ + LDECLTYPE(list) _ls_e; \ + LDECLTYPE(list) _ls_tail; \ + LDECLTYPE(list) _ls_oldhead; \ + LDECLTYPE(list) _tmp; \ + int _ls_insize, _ls_nmerges, _ls_psize, _ls_qsize, _ls_i, _ls_looping; \ + if (list) { \ + _ls_insize = 1; \ + _ls_looping = 1; \ + while (_ls_looping) { \ + _CASTASGN(_ls_p,list); \ + _CASTASGN(_ls_oldhead,list); \ + list = NULL; \ + _ls_tail = NULL; \ + _ls_nmerges = 0; \ + while (_ls_p) { \ + _ls_nmerges++; \ + _ls_q = _ls_p; \ + _ls_psize = 0; \ + for (_ls_i = 0; _ls_i < _ls_insize; _ls_i++) { \ + _ls_psize++; \ + _SV(_ls_q,list); _ls_q = _NEXT(_ls_q,list); _RS(list); \ + if (!_ls_q) break; \ + } \ + _ls_qsize = _ls_insize; \ + while (_ls_psize > 0 || (_ls_qsize > 0 && _ls_q)) { \ + if (_ls_psize == 0) { \ + _ls_e = _ls_q; _SV(_ls_q,list); _ls_q = _NEXT(_ls_q,list); _RS(list); _ls_qsize--; \ + } else if (_ls_qsize == 0 || !_ls_q) { \ + _ls_e = _ls_p; _SV(_ls_p,list); _ls_p = _NEXT(_ls_p,list); _RS(list); _ls_psize--; \ + } else if (cmp(_ls_p,_ls_q) <= 0) { \ + _ls_e = _ls_p; _SV(_ls_p,list); _ls_p = _NEXT(_ls_p,list); _RS(list); _ls_psize--; \ + } else { \ + _ls_e = _ls_q; _SV(_ls_q,list); _ls_q = _NEXT(_ls_q,list); _RS(list); _ls_qsize--; \ + } \ + if (_ls_tail) { \ + _SV(_ls_tail,list); _NEXTASGN(_ls_tail,list,_ls_e); _RS(list); \ + } else { \ + _CASTASGN(list,_ls_e); \ + } \ + _SV(_ls_e,list); _PREVASGN(_ls_e,list,_ls_tail); _RS(list); \ + _ls_tail = _ls_e; \ + } \ + _ls_p = _ls_q; \ + } \ + _CASTASGN(list->prev, _ls_tail); \ + _SV(_ls_tail,list); _NEXTASGN(_ls_tail,list,NULL); _RS(list); \ + if (_ls_nmerges <= 1) { \ + _ls_looping=0; \ + } \ + _ls_insize *= 2; \ + } \ + } else _tmp=NULL; /* quiet gcc unused variable warning */ \ +} while (0) + +#define CDL_SORT(list, cmp) \ +do { \ + LDECLTYPE(list) _ls_p; \ + LDECLTYPE(list) _ls_q; \ + LDECLTYPE(list) _ls_e; \ + LDECLTYPE(list) _ls_tail; \ + LDECLTYPE(list) _ls_oldhead; \ + LDECLTYPE(list) _tmp; \ + LDECLTYPE(list) _tmp2; \ + int _ls_insize, _ls_nmerges, _ls_psize, _ls_qsize, _ls_i, _ls_looping; \ + if (list) { \ + _ls_insize = 1; \ + _ls_looping = 1; \ + while (_ls_looping) { \ + _CASTASGN(_ls_p,list); \ + _CASTASGN(_ls_oldhead,list); \ + list = NULL; \ + _ls_tail = NULL; \ + _ls_nmerges = 0; \ + while (_ls_p) { \ + _ls_nmerges++; \ + _ls_q = _ls_p; \ + _ls_psize = 0; \ + for (_ls_i = 0; _ls_i < _ls_insize; _ls_i++) { \ + _ls_psize++; \ + _SV(_ls_q,list); \ + if (_NEXT(_ls_q,list) == _ls_oldhead) { \ + _ls_q = NULL; \ + } else { \ + _ls_q = _NEXT(_ls_q,list); \ + } \ + _RS(list); \ + if (!_ls_q) break; \ + } \ + _ls_qsize = _ls_insize; \ + while (_ls_psize > 0 || (_ls_qsize > 0 && _ls_q)) { \ + if (_ls_psize == 0) { \ + _ls_e = _ls_q; _SV(_ls_q,list); _ls_q = _NEXT(_ls_q,list); _RS(list); _ls_qsize--; \ + if (_ls_q == _ls_oldhead) { _ls_q = NULL; } \ + } else if (_ls_qsize == 0 || !_ls_q) { \ + _ls_e = _ls_p; _SV(_ls_p,list); _ls_p = _NEXT(_ls_p,list); _RS(list); _ls_psize--; \ + if (_ls_p == _ls_oldhead) { _ls_p = NULL; } \ + } else if (cmp(_ls_p,_ls_q) <= 0) { \ + _ls_e = _ls_p; _SV(_ls_p,list); _ls_p = _NEXT(_ls_p,list); _RS(list); _ls_psize--; \ + if (_ls_p == _ls_oldhead) { _ls_p = NULL; } \ + } else { \ + _ls_e = _ls_q; _SV(_ls_q,list); _ls_q = _NEXT(_ls_q,list); _RS(list); _ls_qsize--; \ + if (_ls_q == _ls_oldhead) { _ls_q = NULL; } \ + } \ + if (_ls_tail) { \ + _SV(_ls_tail,list); _NEXTASGN(_ls_tail,list,_ls_e); _RS(list); \ + } else { \ + _CASTASGN(list,_ls_e); \ + } \ + _SV(_ls_e,list); _PREVASGN(_ls_e,list,_ls_tail); _RS(list); \ + _ls_tail = _ls_e; \ + } \ + _ls_p = _ls_q; \ + } \ + _CASTASGN(list->prev,_ls_tail); \ + _CASTASGN(_tmp2,list); \ + _SV(_ls_tail,list); _NEXTASGN(_ls_tail,list,_tmp2); _RS(list); \ + if (_ls_nmerges <= 1) { \ + _ls_looping=0; \ + } \ + _ls_insize *= 2; \ + } \ + } else _tmp=NULL; /* quiet gcc unused variable warning */ \ +} while (0) + +/****************************************************************************** + * singly linked list macros (non-circular) * + *****************************************************************************/ +#define LL_PREPEND(head,add) \ +do { \ + (add)->next = head; \ + head = add; \ +} while (0) + +#define LL_APPEND(head,add) \ +do { \ + LDECLTYPE(head) _tmp; \ + (add)->next=NULL; \ + if (head) { \ + _tmp = head; \ + while (_tmp->next) { _tmp = _tmp->next; } \ + _tmp->next=(add); \ + } else { \ + (head)=(add); \ + } \ +} while (0) + +#define LL_DELETE(head,del) \ +do { \ + LDECLTYPE(head) _tmp; \ + if ((head) == (del)) { \ + (head)=(head)->next; \ + } else { \ + _tmp = head; \ + while (_tmp->next && (_tmp->next != (del))) { \ + _tmp = _tmp->next; \ + } \ + if (_tmp->next) { \ + _tmp->next = ((del)->next); \ + } \ + } \ +} while (0) + +/* Here are VS2008 replacements for LL_APPEND and LL_DELETE */ +#define LL_APPEND_VS2008(head,add) \ +do { \ + if (head) { \ + (add)->next = head; /* use add->next as a temp variable */ \ + while ((add)->next->next) { (add)->next = (add)->next->next; } \ + (add)->next->next=(add); \ + } else { \ + (head)=(add); \ + } \ + (add)->next=NULL; \ +} while (0) + +#define LL_DELETE_VS2008(head,del) \ +do { \ + if ((head) == (del)) { \ + (head)=(head)->next; \ + } else { \ + char *_tmp = (char*)(head); \ + while (head->next && (head->next != (del))) { \ + head = head->next; \ + } \ + if (head->next) { \ + head->next = ((del)->next); \ + } \ + { \ + char **_head_alias = (char**)&(head); \ + *_head_alias = _tmp; \ + } \ + } \ +} while (0) +#ifdef NO_DECLTYPE +#undef LL_APPEND +#define LL_APPEND LL_APPEND_VS2008 +#undef LL_DELETE +#define LL_DELETE LL_DELETE_VS2008 +#endif +/* end VS2008 replacements */ + +#define LL_FOREACH(head,el) \ + for(el=head;el;el=el->next) + +#define LL_FOREACH_SAFE(head,el,tmp) \ + for((el)=(head);(el) && (tmp = (el)->next, 1); (el) = tmp) + +#define LL_SEARCH_SCALAR(head,out,field,val) \ +do { \ + LL_FOREACH(head,out) { \ + if ((out)->field == (val)) break; \ + } \ +} while(0) + +#define LL_SEARCH(head,out,elt,cmp) \ +do { \ + LL_FOREACH(head,out) { \ + if ((cmp(out,elt))==0) break; \ + } \ +} while(0) + +/****************************************************************************** + * doubly linked list macros (non-circular) * + *****************************************************************************/ +#define DL_PREPEND(head,add) \ +do { \ + (add)->next = head; \ + if (head) { \ + (add)->prev = (head)->prev; \ + (head)->prev = (add); \ + } else { \ + (add)->prev = (add); \ + } \ + (head) = (add); \ +} while (0) + +#define DL_APPEND(head,add) \ +do { \ + if (head) { \ + (add)->prev = (head)->prev; \ + (head)->prev->next = (add); \ + (head)->prev = (add); \ + (add)->next = NULL; \ + } else { \ + (head)=(add); \ + (head)->prev = (head); \ + (head)->next = NULL; \ + } \ +} while (0); + +#define DL_DELETE(head,del) \ +do { \ + if ((del)->prev == (del)) { \ + (head)=NULL; \ + } else if ((del)==(head)) { \ + (del)->next->prev = (del)->prev; \ + (head) = (del)->next; \ + } else { \ + (del)->prev->next = (del)->next; \ + if ((del)->next) { \ + (del)->next->prev = (del)->prev; \ + } else { \ + (head)->prev = (del)->prev; \ + } \ + } \ +} while (0); + + +#define DL_FOREACH(head,el) \ + for(el=head;el;el=el->next) + +/* this version is safe for deleting the elements during iteration */ +#define DL_FOREACH_SAFE(head,el,tmp) \ + for((el)=(head);(el) && (tmp = (el)->next, 1); (el) = tmp) + +/* these are identical to their singly-linked list counterparts */ +#define DL_SEARCH_SCALAR LL_SEARCH_SCALAR +#define DL_SEARCH LL_SEARCH + +/****************************************************************************** + * circular doubly linked list macros * + *****************************************************************************/ +#define CDL_PREPEND(head,add) \ +do { \ + if (head) { \ + (add)->prev = (head)->prev; \ + (add)->next = (head); \ + (head)->prev = (add); \ + (add)->prev->next = (add); \ + } else { \ + (add)->prev = (add); \ + (add)->next = (add); \ + } \ +(head)=(add); \ +} while (0) + +#define CDL_DELETE(head,del) \ +do { \ + if ( ((head)==(del)) && ((head)->next == (head))) { \ + (head) = 0L; \ + } else { \ + (del)->next->prev = (del)->prev; \ + (del)->prev->next = (del)->next; \ + if ((del) == (head)) (head)=(del)->next; \ + } \ +} while (0); + +#define CDL_FOREACH(head,el) \ + for(el=head;el;el=(el->next==head ? 0L : el->next)) + +#define CDL_FOREACH_SAFE(head,el,tmp1,tmp2) \ + for((el)=(head), ((tmp1)=(head)?((head)->prev):NULL); \ + (el) && ((tmp2)=(el)->next, 1); \ + ((el) = (((el)==(tmp1)) ? 0L : (tmp2)))) + +#define CDL_SEARCH_SCALAR(head,out,field,val) \ +do { \ + CDL_FOREACH(head,out) { \ + if ((out)->field == (val)) break; \ + } \ +} while(0) + +#define CDL_SEARCH(head,out,elt,cmp) \ +do { \ + CDL_FOREACH(head,out) { \ + if ((cmp(out,elt))==0) break; \ + } \ +} while(0) + +#endif /* UTLIST_H */ + diff --git a/libs/cocos2d/ccConfig.h b/libs/cocos2d/ccConfig.h new file mode 100755 index 0000000..55b4cd8 --- /dev/null +++ b/libs/cocos2d/ccConfig.h @@ -0,0 +1,334 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2008-2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ + + +#import + +/** + @file + cocos2d (cc) configuration file +*/ + +/** @def CC_FIX_ARTIFACTS_BY_STRECHING_TEXEL + If enabled, the texture coordinates will be calculated by using this formula: + - texCoord.left = (rect.origin.x*2+1) / (texture.wide*2); + - texCoord.right = texCoord.left + (rect.size.width*2-2)/(texture.wide*2); + + The same for bottom and top. + + This formula prevents artifacts by using 99% of the texture. + The "correct" way to prevent artifacts is by using the spritesheet-artifact-fixer.py or a similar tool. + + Affected nodes: + - CCSprite / CCSpriteBatchNode and subclasses: CCLabelBMFont, CCTMXTiledMap + - CCLabelAtlas + - CCQuadParticleSystem + - CCTileMap + + To enabled set it to 1. Disabled by default. + + @since v0.99.5 + */ +#ifndef CC_FIX_ARTIFACTS_BY_STRECHING_TEXEL +#define CC_FIX_ARTIFACTS_BY_STRECHING_TEXEL 0 +#endif + + +/** @def CC_FONT_LABEL_SUPPORT + If enabled, FontLabel will be used to render .ttf files. + If the .ttf file is not found, then it will use the standard UIFont class + If disabled, the standard UIFont class will be used. + + To disable set it to 0. Enabled by default. + + Only valid for cocos2d-ios. Not supported on cocos2d-mac + */ +#ifndef CC_FONT_LABEL_SUPPORT +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED +#define CC_FONT_LABEL_SUPPORT 1 +#elif defined(__MAC_OS_X_VERSION_MAX_ALLOWED) +#define CC_FONT_LABEL_SUPPORT 0 +#endif +#endif + +/** @def CC_DIRECTOR_FAST_FPS + If enabled, then the FPS will be drawn using CCLabelAtlas (fast rendering). + You will need to add the fps_images.png to your project. + If disabled, the FPS will be rendered using CCLabel (slow rendering) + + To enable set it to a value different than 0. Enabled by default. + */ +#ifndef CC_DIRECTOR_FAST_FPS +#define CC_DIRECTOR_FAST_FPS 1 +#endif + +/** @def CC_DIRECTOR_FPS_INTERVAL + Senconds between FPS updates. + 0.5 seconds, means that the FPS number will be updated every 0.5 seconds. + Having a bigger number means a more reliable FPS + + Default value: 0.1f + */ +#ifndef CC_DIRECTOR_FPS_INTERVAL +#define CC_DIRECTOR_FPS_INTERVAL (0.1f) +#endif + +/** @def CC_DIRECTOR_DISPATCH_FAST_EVENTS + If enabled, and only when it is used with CCFastDirector, the main loop will wait 0.04 seconds to + dispatch all the events, even if there are not events to dispatch. + If your game uses lot's of events (eg: touches) it might be a good idea to enable this feature. + Otherwise, it is safe to leave it disabled. + + To enable set it to 1. Disabled by default. + + @warning This feature is experimental + */ +#ifndef CC_DIRECTOR_DISPATCH_FAST_EVENTS +#define CC_DIRECTOR_DISPATCH_FAST_EVENTS 0 +#endif + +/** @def CC_DIRECTOR_MAC_USE_DISPLAY_LINK_THREAD + If enabled, cocos2d-mac will run on the Display Link thread. If disabled cocos2d-mac will run in its own thread. + + If enabled, the images will be drawn at the "correct" time, but the events might not be very responsive. + If disabled, some frames might be skipped, but the events will be dispatched as they arrived. + + To enable set it to a 1, to disable it set to 0. Enabled by default. + + Only valid for cocos2d-mac. Not supported on cocos2d-ios. + + */ +#ifndef CC_DIRECTOR_MAC_USE_DISPLAY_LINK_THREAD +#define CC_DIRECTOR_MAC_USE_DISPLAY_LINK_THREAD 1 +#endif + +/** @def CC_COCOSNODE_RENDER_SUBPIXEL + If enabled, the CCNode objects (CCSprite, CCLabel,etc) will be able to render in subpixels. + If disabled, integer pixels will be used. + + To enable set it to 1. Enabled by default. + */ +#ifndef CC_COCOSNODE_RENDER_SUBPIXEL +#define CC_COCOSNODE_RENDER_SUBPIXEL 1 +#endif + +/** @def CC_SPRITEBATCHNODE_RENDER_SUBPIXEL + If enabled, the CCSprite objects rendered with CCSpriteBatchNode will be able to render in subpixels. + If disabled, integer pixels will be used. + + To enable set it to 1. Enabled by default. + */ +#ifndef CC_SPRITEBATCHNODE_RENDER_SUBPIXEL +#define CC_SPRITEBATCHNODE_RENDER_SUBPIXEL 1 +#endif + +/** @def CC_USES_VBO + If enabled, batch nodes (texture atlas and particle system) will use VBO instead of vertex list (VBO is recommended by Apple) + + To enable set it to 1. + Enabled by default on iPhone with ARMv7 processors, iPhone Simulator and Mac + Disabled by default on iPhone with ARMv6 processors. + + @since v0.99.5 + */ +#ifndef CC_USES_VBO +#if defined(__ARM_NEON__) || TARGET_IPHONE_SIMULATOR || defined(__MAC_OS_X_VERSION_MAX_ALLOWED) +#define CC_USES_VBO 1 +#else +#define CC_USES_VBO 0 +#endif +#endif + +/** @def CC_NODE_TRANSFORM_USING_AFFINE_MATRIX + If enabled, CCNode will transform the nodes using a cached Affine matrix. + If disabled, the node will be transformed using glTranslate,glRotate,glScale. + Using the affine matrix only requires 2 GL calls. + Using the translate/rotate/scale requires 5 GL calls. + But computing the Affine matrix is relative expensive. + But according to performance tests, Affine matrix performs better. + This parameter doesn't affect CCSpriteBatchNode nodes. + + To enable set it to a value different than 0. Enabled by default. + + */ +#ifndef CC_NODE_TRANSFORM_USING_AFFINE_MATRIX +#define CC_NODE_TRANSFORM_USING_AFFINE_MATRIX 1 +#endif + +/** @def CC_OPTIMIZE_BLEND_FUNC_FOR_PREMULTIPLIED_ALPHA + If most of your imamges have pre-multiplied alpha, set it to 1 (if you are going to use .PNG/.JPG file images). + Only set to 0 if ALL your images by-pass Apple UIImage loading system (eg: if you use libpng or PVR images) + + To enable set it to a value different than 0. Enabled by default. + + @since v0.99.5 + */ +#ifndef CC_OPTIMIZE_BLEND_FUNC_FOR_PREMULTIPLIED_ALPHA +#define CC_OPTIMIZE_BLEND_FUNC_FOR_PREMULTIPLIED_ALPHA 1 +#endif + +/** @def CC_TEXTURE_ATLAS_USE_TRIANGLE_STRIP + Use GL_TRIANGLE_STRIP instead of GL_TRIANGLES when rendering the texture atlas. + It seems it is the recommend way, but it is much slower, so, enable it at your own risk + + To enable set it to a value different than 0. Disabled by default. + + */ +#ifndef CC_TEXTURE_ATLAS_USE_TRIANGLE_STRIP +#define CC_TEXTURE_ATLAS_USE_TRIANGLE_STRIP 0 +#endif + +/** @def CC_TEXTURE_NPOT_SUPPORT + If enabled, NPOT textures will be used where available. Only 3rd gen (and newer) devices support NPOT textures. + NPOT textures have the following limitations: + - They can't have mipmaps + - They only accept GL_CLAMP_TO_EDGE in GL_TEXTURE_WRAP_{S,T} + + To enable set it to a value different than 0. Disabled by default. + + This value governs only the PNG, GIF, BMP, images. + This value DOES NOT govern the PVR (PVR.GZ, PVR.CCZ) files. If NPOT PVR is loaded, then it will create an NPOT texture ignoring this value. + + @deprecated This value will be removed in 1.1 and NPOT textures will be loaded by default if the device supports it. + + @since v0.99.2 + */ +#ifndef CC_TEXTURE_NPOT_SUPPORT +#define CC_TEXTURE_NPOT_SUPPORT 0 +#endif + +/** @def CC_RETINA_DISPLAY_SUPPORT + If enabled, cocos2d supports retina display. + For performance reasons, it's recommended disable it in games without retina display support, like iPad only games. + + To enable set it to 1. Use 0 to disable it. Enabled by default. + + @since v0.99.5 + */ +#ifndef CC_RETINA_DISPLAY_SUPPORT +#define CC_RETINA_DISPLAY_SUPPORT 1 +#endif + +/** @def CC_RETINA_DISPLAY_FILENAME_SUFFIX + It's the suffix that will be appended to the files in order to load "retina display" images. + + On an iPhone4 with Retina Display support enabled, the file @"sprite-hd.png" will be loaded instead of @"sprite.png". + If the file doesn't exist it will use the non-retina display image. + + Platforms: Only used on Retina Display devices like iPhone 4. + + @since v0.99.5 + */ +#ifndef CC_RETINA_DISPLAY_FILENAME_SUFFIX +#define CC_RETINA_DISPLAY_FILENAME_SUFFIX @"-hd" +#endif + +/** @def CC_USE_LA88_LABELS_ON_NEON_ARCH + If enabled, it will use LA88 (16-bit textures) on Neon devices for CCLabelTTF objects. + If it is disabled, or if it is used on another architecture it will use A8 (8-bit textures). + On Neon devices, LA88 textures are 6% faster than A8 textures, but then will consume 2x memory. + + This feature is disabled by default. + + Platforms: Only used on ARM Neon architectures like iPhone 3GS or newer and iPad. + + @since v0.99.5 + */ +#ifndef CC_USE_LA88_LABELS_ON_NEON_ARCH +#define CC_USE_LA88_LABELS_ON_NEON_ARCH 0 +#endif + +/** @def CC_SPRITE_DEBUG_DRAW + If enabled, all subclasses of CCSprite will draw a bounding box + Useful for debugging purposes only. It is recommened to leave it disabled. + + To enable set it to a value different than 0. Disabled by default: + 0 -- disabled + 1 -- draw bounding box + 2 -- draw texture box + */ +#ifndef CC_SPRITE_DEBUG_DRAW +#define CC_SPRITE_DEBUG_DRAW 0 +#endif + +/** @def CC_SPRITEBATCHNODE_DEBUG_DRAW + If enabled, all subclasses of CCSprite that are rendered using an CCSpriteBatchNode draw a bounding box. + Useful for debugging purposes only. It is recommened to leave it disabled. + + To enable set it to a value different than 0. Disabled by default. + */ +#ifndef CC_SPRITEBATCHNODE_DEBUG_DRAW +#define CC_SPRITEBATCHNODE_DEBUG_DRAW 0 +#endif + +/** @def CC_LABELBMFONT_DEBUG_DRAW + If enabled, all subclasses of CCLabelBMFont will draw a bounding box + Useful for debugging purposes only. It is recommened to leave it disabled. + + To enable set it to a value different than 0. Disabled by default. + */ +#ifndef CC_LABELBMFONT_DEBUG_DRAW +#define CC_LABELBMFONT_DEBUG_DRAW 0 +#endif + +/** @def CC_LABELBMFONT_DEBUG_DRAW + If enabled, all subclasses of CCLabeltAtlas will draw a bounding box + Useful for debugging purposes only. It is recommened to leave it disabled. + + To enable set it to a value different than 0. Disabled by default. + */ +#ifndef CC_LABELATLAS_DEBUG_DRAW +#define CC_LABELATLAS_DEBUG_DRAW 0 +#endif + +/** @def CC_ENABLE_PROFILERS + If enabled, will activate various profilers withing cocos2d. This statistical data will be output to the console + once per second showing average time (in milliseconds) required to execute the specific routine(s). + Useful for debugging purposes only. It is recommened to leave it disabled. + + To enable set it to a value different than 0. Disabled by default. + */ +#ifndef CC_ENABLE_PROFILERS +#define CC_ENABLE_PROFILERS 0 +#endif + +// +// DON'T edit this macro. +// +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED + +#if CC_RETINA_DISPLAY_SUPPORT +#define CC_IS_RETINA_DISPLAY_SUPPORTED 1 +#else +#define CC_IS_RETINA_DISPLAY_SUPPORTED 0 +#endif + +#elif __MAC_OS_X_VERSION_MAX_ALLOWED + +#define CC_IS_RETINA_DISPLAY_SUPPORTED 0 + +#endif + + diff --git a/libs/cocos2d/ccMacros.h b/libs/cocos2d/ccMacros.h new file mode 100755 index 0000000..4e08725 --- /dev/null +++ b/libs/cocos2d/ccMacros.h @@ -0,0 +1,253 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2008-2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ + + +#import +#import "ccConfig.h" + +#import +#import + +/** + @file + cocos2d helper macros + */ + +/* + * if COCOS2D_DEBUG is not defined, or if it is 0 then + * all CCLOGXXX macros will be disabled + * + * if COCOS2D_DEBUG==1 then: + * CCLOG() will be enabled + * CCLOGERROR() will be enabled + * CCLOGINFO() will be disabled + * + * if COCOS2D_DEBUG==2 or higher then: + * CCLOG() will be enabled + * CCLOGERROR() will be enabled + * CCLOGINFO() will be enabled + */ +#if !defined(COCOS2D_DEBUG) || COCOS2D_DEBUG == 0 +#define CCLOG(...) do {} while (0) +#define CCLOGINFO(...) do {} while (0) +#define CCLOGERROR(...) do {} while (0) + +#elif COCOS2D_DEBUG == 1 +#define CCLOG(...) NSLog(__VA_ARGS__) +#define CCLOGERROR(...) NSLog(__VA_ARGS__) +#define CCLOGINFO(...) do {} while (0) + +#elif COCOS2D_DEBUG > 1 +#define CCLOG(...) NSLog(__VA_ARGS__) +#define CCLOGERROR(...) NSLog(__VA_ARGS__) +#define CCLOGINFO(...) NSLog(__VA_ARGS__) +#endif // COCOS2D_DEBUG + +/** @def CC_SWAP +simple macro that swaps 2 variables +*/ +#define CC_SWAP( x, y ) \ +({ __typeof__(x) temp = (x); \ + x = y; y = temp; \ +}) + + +/** @def CCRANDOM_MINUS1_1 + returns a random float between -1 and 1 + */ +#define CCRANDOM_MINUS1_1() ((random() / (float)0x3fffffff )-1.0f) + +/** @def CCRANDOM_0_1 + returns a random float between 0 and 1 + */ +#define CCRANDOM_0_1() ((random() / (float)0x7fffffff )) + +/** @def CC_DEGREES_TO_RADIANS + converts degrees to radians + */ +#define CC_DEGREES_TO_RADIANS(__ANGLE__) ((__ANGLE__) * 0.01745329252f) // PI / 180 + +/** @def CC_RADIANS_TO_DEGREES + converts radians to degrees + */ +#define CC_RADIANS_TO_DEGREES(__ANGLE__) ((__ANGLE__) * 57.29577951f) // PI * 180 + +/** @def CC_BLEND_SRC +default gl blend src function. Compatible with premultiplied alpha images. +*/ +#if CC_OPTIMIZE_BLEND_FUNC_FOR_PREMULTIPLIED_ALPHA +#define CC_BLEND_SRC GL_ONE +#define CC_BLEND_DST GL_ONE_MINUS_SRC_ALPHA +#else +#define CC_BLEND_SRC GL_SRC_ALPHA +#define CC_BLEND_DST GL_ONE_MINUS_SRC_ALPHA +#endif // ! CC_OPTIMIZE_BLEND_FUNC_FOR_PREMULTIPLIED_ALPHA + +/** @def CC_ENABLE_DEFAULT_GL_STATES + GL states that are enabled: + - GL_TEXTURE_2D + - GL_VERTEX_ARRAY + - GL_TEXTURE_COORD_ARRAY + - GL_COLOR_ARRAY + */ +#define CC_ENABLE_DEFAULT_GL_STATES() { \ + glEnableClientState(GL_VERTEX_ARRAY); \ + glEnableClientState(GL_COLOR_ARRAY); \ + glEnableClientState(GL_TEXTURE_COORD_ARRAY); \ + glEnable(GL_TEXTURE_2D); \ +} + +/** @def CC_DISABLE_DEFAULT_GL_STATES + Disable default GL states: + - GL_TEXTURE_2D + - GL_VERTEX_ARRAY + - GL_TEXTURE_COORD_ARRAY + - GL_COLOR_ARRAY + */ +#define CC_DISABLE_DEFAULT_GL_STATES() { \ + glDisable(GL_TEXTURE_2D); \ + glDisableClientState(GL_TEXTURE_COORD_ARRAY); \ + glDisableClientState(GL_COLOR_ARRAY); \ + glDisableClientState(GL_VERTEX_ARRAY); \ +} + +/** @def CC_DIRECTOR_INIT + - Initializes an EAGLView with 0-bit depth format, and RGB565 render buffer. + - The EAGLView view will have multiple touches disabled. + - It will create a UIWindow and it will assign it the 'window' variable. 'window' must be declared before calling this marcro. + - It will parent the EAGLView to the created window + - If the firmware >= 3.1 it will create a Display Link Director. Else it will create an NSTimer director. + - It will try to run at 60 FPS. + - The FPS won't be displayed. + - The orientation will be portrait. + - It will connect the director with the EAGLView. + + IMPORTANT: If you want to use another type of render buffer (eg: RGBA8) + or if you want to use a 16-bit or 24-bit depth buffer, you should NOT + use this macro. Instead, you should create the EAGLView manually. + + @since v0.99.4 + */ + +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED + +#define CC_DIRECTOR_INIT() \ +do { \ + window = [[UIWindow alloc] initWithFrame:[[UIScreen mainScreen] bounds]]; \ + if( ! [CCDirector setDirectorType:kCCDirectorTypeDisplayLink] ) \ + [CCDirector setDirectorType:kCCDirectorTypeNSTimer]; \ + CCDirector *__director = [CCDirector sharedDirector]; \ + [__director setDeviceOrientation:kCCDeviceOrientationPortrait]; \ + [__director setDisplayFPS:NO]; \ + [__director setAnimationInterval:1.0/60]; \ + EAGLView *__glView = [EAGLView viewWithFrame:[window bounds] \ + pixelFormat:kEAGLColorFormatRGB565 \ + depthFormat:0 /* GL_DEPTH_COMPONENT24_OES */ \ + preserveBackbuffer:NO \ + sharegroup:nil \ + multiSampling:NO \ + numberOfSamples:0 \ + ]; \ + [__director setOpenGLView:__glView]; \ + [window addSubview:__glView]; \ + [window makeKeyAndVisible]; \ +} while(0) + + +#elif __MAC_OS_X_VERSION_MAX_ALLOWED + +#import "Platforms/Mac/MacWindow.h" + +#define CC_DIRECTOR_INIT(__WINSIZE__) \ +do { \ + NSRect frameRect = NSMakeRect(0, 0, (__WINSIZE__).width, (__WINSIZE__).height); \ + self.window = [[MacWindow alloc] initWithFrame:frameRect fullscreen:NO]; \ + self.glView = [[MacGLView alloc] initWithFrame:frameRect shareContext:nil]; \ + [self.window setContentView:self.glView]; \ + CCDirector *__director = [CCDirector sharedDirector]; \ + [__director setDisplayFPS:NO]; \ + [__director setOpenGLView:self.glView]; \ + [(CCDirectorMac*)__director setOriginalWinSize:__WINSIZE__]; \ + [self.window makeMainWindow]; \ + [self.window makeKeyAndOrderFront:self]; \ +} while(0) + +#endif + + + /** @def CC_DIRECTOR_END + Stops and removes the director from memory. + Removes the EAGLView from its parent + + @since v0.99.4 + */ +#define CC_DIRECTOR_END() \ +do { \ + CCDirector *__director = [CCDirector sharedDirector]; \ + CC_GLVIEW *__view = [__director openGLView]; \ + [__view removeFromSuperview]; \ + [__director end]; \ +} while(0) + + +#if CC_IS_RETINA_DISPLAY_SUPPORTED + +/****************************/ +/** RETINA DISPLAY ENABLED **/ +/****************************/ + +/** @def CC_CONTENT_SCALE_FACTOR + On Mac it returns 1; + On iPhone it returns 2 if RetinaDisplay is On. Otherwise it returns 1 + */ +#import "Platforms/iOS/CCDirectorIOS.h" +#define CC_CONTENT_SCALE_FACTOR() __ccContentScaleFactor + + +/** @def CC_RECT_PIXELS_TO_POINTS + Converts a rect in pixels to points + */ +#define CC_RECT_PIXELS_TO_POINTS(__pixels__) \ + CGRectMake( (__pixels__).origin.x / CC_CONTENT_SCALE_FACTOR(), (__pixels__).origin.y / CC_CONTENT_SCALE_FACTOR(), \ + (__pixels__).size.width / CC_CONTENT_SCALE_FACTOR(), (__pixels__).size.height / CC_CONTENT_SCALE_FACTOR() ) + +/** @def CC_RECT_POINTS_TO_PIXELS + Converts a rect in points to pixels + */ +#define CC_RECT_POINTS_TO_PIXELS(__points__) \ + CGRectMake( (__points__).origin.x * CC_CONTENT_SCALE_FACTOR(), (__points__).origin.y * CC_CONTENT_SCALE_FACTOR(), \ + (__points__).size.width * CC_CONTENT_SCALE_FACTOR(), (__points__).size.height * CC_CONTENT_SCALE_FACTOR() ) + +#else // retina disabled + +/*****************************/ +/** RETINA DISPLAY DISABLED **/ +/*****************************/ + +#define CC_CONTENT_SCALE_FACTOR() 1 +#define CC_RECT_PIXELS_TO_POINTS(__pixels__) __pixels__ +#define CC_RECT_POINTS_TO_PIXELS(__points__) __points__ + +#endif // CC_IS_RETINA_DISPLAY_SUPPORTED diff --git a/libs/cocos2d/ccTypes.h b/libs/cocos2d/ccTypes.h new file mode 100755 index 0000000..46917b3 --- /dev/null +++ b/libs/cocos2d/ccTypes.h @@ -0,0 +1,287 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2008-2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ + + +/** + @file + cocos2d (cc) types +*/ + +#import +#import + +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED +#import // CGPoint +#endif + +#import "Platforms/CCGL.h" + +/** RGB color composed of bytes 3 bytes +@since v0.8 + */ +typedef struct _ccColor3B +{ + GLubyte r; + GLubyte g; + GLubyte b; +} ccColor3B; + +//! helper macro that creates an ccColor3B type +static inline ccColor3B +ccc3(const GLubyte r, const GLubyte g, const GLubyte b) +{ + ccColor3B c = {r, g, b}; + return c; +} +//ccColor3B predefined colors +//! White color (255,255,255) +static const ccColor3B ccWHITE = {255,255,255}; +//! Yellow color (255,255,0) +static const ccColor3B ccYELLOW = {255,255,0}; +//! Blue color (0,0,255) +static const ccColor3B ccBLUE = {0,0,255}; +//! Green Color (0,255,0) +static const ccColor3B ccGREEN = {0,255,0}; +//! Red Color (255,0,0,) +static const ccColor3B ccRED = {255,0,0}; +//! Magenta Color (255,0,255) +static const ccColor3B ccMAGENTA = {255,0,255}; +//! Black Color (0,0,0) +static const ccColor3B ccBLACK = {0,0,0}; +//! Orange Color (255,127,0) +static const ccColor3B ccORANGE = {255,127,0}; +//! Gray Color (166,166,166) +static const ccColor3B ccGRAY = {166,166,166}; + +/** RGBA color composed of 4 bytes +@since v0.8 +*/ +typedef struct _ccColor4B +{ + GLubyte r; + GLubyte g; + GLubyte b; + GLubyte a; +} ccColor4B; +//! helper macro that creates an ccColor4B type +static inline ccColor4B +ccc4(const GLubyte r, const GLubyte g, const GLubyte b, const GLubyte o) +{ + ccColor4B c = {r, g, b, o}; + return c; +} + + +/** RGBA color composed of 4 floats +@since v0.8 +*/ +typedef struct _ccColor4F { + GLfloat r; + GLfloat g; + GLfloat b; + GLfloat a; +} ccColor4F; + +/** Returns a ccColor4F from a ccColor3B. Alpha will be 1. + @since v0.99.1 + */ +static inline ccColor4F ccc4FFromccc3B(ccColor3B c) +{ + return (ccColor4F){c.r/255.f, c.g/255.f, c.b/255.f, 1.f}; +} + +/** Returns a ccColor4F from a ccColor4B. + @since v0.99.1 + */ +static inline ccColor4F ccc4FFromccc4B(ccColor4B c) +{ + return (ccColor4F){c.r/255.f, c.g/255.f, c.b/255.f, c.a/255.f}; +} + +/** returns YES if both ccColor4F are equal. Otherwise it returns NO. + @since v0.99.1 + */ +static inline BOOL ccc4FEqual(ccColor4F a, ccColor4F b) +{ + return a.r == b.r && a.g == b.g && a.b == b.b && a.a == b.a; +} + +/** A vertex composed of 2 GLfloats: x, y + @since v0.8 + */ +typedef struct _ccVertex2F +{ + GLfloat x; + GLfloat y; +} ccVertex2F; + +/** A vertex composed of 2 floats: x, y + @since v0.8 + */ +typedef struct _ccVertex3F +{ + GLfloat x; + GLfloat y; + GLfloat z; +} ccVertex3F; + +/** A texcoord composed of 2 floats: u, y + @since v0.8 + */ +typedef struct _ccTex2F { + GLfloat u; + GLfloat v; +} ccTex2F; + + +//! Point Sprite component +typedef struct _ccPointSprite +{ + ccVertex2F pos; // 8 bytes + ccColor4B color; // 4 bytes + GLfloat size; // 4 bytes +} ccPointSprite; + +//! A 2D Quad. 4 * 2 floats +typedef struct _ccQuad2 { + ccVertex2F tl; + ccVertex2F tr; + ccVertex2F bl; + ccVertex2F br; +} ccQuad2; + + +//! A 3D Quad. 4 * 3 floats +typedef struct _ccQuad3 { + ccVertex3F bl; + ccVertex3F br; + ccVertex3F tl; + ccVertex3F tr; +} ccQuad3; + +//! A 2D grid size +typedef struct _ccGridSize +{ + NSInteger x; + NSInteger y; +} ccGridSize; + +//! helper function to create a ccGridSize +static inline ccGridSize +ccg(const NSInteger x, const NSInteger y) +{ + ccGridSize v = {x, y}; + return v; +} + +//! a Point with a vertex point, a tex coord point and a color 4B +typedef struct _ccV2F_C4B_T2F +{ + //! vertices (2F) + ccVertex2F vertices; + //! colors (4B) + ccColor4B colors; + //! tex coords (2F) + ccTex2F texCoords; +} ccV2F_C4B_T2F; + +//! a Point with a vertex point, a tex coord point and a color 4F +typedef struct _ccV2F_C4F_T2F +{ + //! vertices (2F) + ccVertex2F vertices; + //! colors (4F) + ccColor4F colors; + //! tex coords (2F) + ccTex2F texCoords; +} ccV2F_C4F_T2F; + +//! a Point with a vertex point, a tex coord point and a color 4B +typedef struct _ccV3F_C4B_T2F +{ + //! vertices (3F) + ccVertex3F vertices; // 12 bytes +// char __padding__[4]; + + //! colors (4B) + ccColor4B colors; // 4 bytes +// char __padding2__[4]; + + // tex coords (2F) + ccTex2F texCoords; // 8 byts +} ccV3F_C4B_T2F; + +//! 4 ccVertex2FTex2FColor4B Quad +typedef struct _ccV2F_C4B_T2F_Quad +{ + //! bottom left + ccV2F_C4B_T2F bl; + //! bottom right + ccV2F_C4B_T2F br; + //! top left + ccV2F_C4B_T2F tl; + //! top right + ccV2F_C4B_T2F tr; +} ccV2F_C4B_T2F_Quad; + +//! 4 ccVertex3FTex2FColor4B +typedef struct _ccV3F_C4B_T2F_Quad +{ + //! top left + ccV3F_C4B_T2F tl; + //! bottom left + ccV3F_C4B_T2F bl; + //! top right + ccV3F_C4B_T2F tr; + //! bottom right + ccV3F_C4B_T2F br; +} ccV3F_C4B_T2F_Quad; + +//! 4 ccVertex2FTex2FColor4F Quad +typedef struct _ccV2F_C4F_T2F_Quad +{ + //! bottom left + ccV2F_C4F_T2F bl; + //! bottom right + ccV2F_C4F_T2F br; + //! top left + ccV2F_C4F_T2F tl; + //! top right + ccV2F_C4F_T2F tr; +} ccV2F_C4F_T2F_Quad; + +//! Blend Function used for textures +typedef struct _ccBlendFunc +{ + //! source blend function + GLenum src; + //! destination blend function + GLenum dst; +} ccBlendFunc; + +//! delta time type +//! if you want more resolution redefine it as a double +typedef float ccTime; +//typedef double ccTime; diff --git a/libs/cocos2d/cocos2d.h b/libs/cocos2d/cocos2d.h new file mode 100755 index 0000000..fed2a9b --- /dev/null +++ b/libs/cocos2d/cocos2d.h @@ -0,0 +1,161 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2008-2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ + +/** @mainpage cocos2d for iPhone API reference + * + * @image html Icon.png + * + * @section intro Introduction + * This is cocos2d API reference + * + * The programming guide is hosted here: http://www.cocos2d-iphone.org/wiki/doku.php/prog_guide:index + * + *
+ * + * @todo A native english speaker should check the grammar. We need your help! + * + */ + +// 0x00 HI ME LO +// 00 01 00 00 +#define COCOS2D_VERSION 0x00010000 + +#import + +// +// all cocos2d include files +// +#import "ccConfig.h" // should be included first + +#import "CCActionManager.h" +#import "CCAction.h" +#import "CCActionInstant.h" +#import "CCActionInterval.h" +#import "CCActionEase.h" +#import "CCActionCamera.h" +#import "CCActionTween.h" +#import "CCActionEase.h" +#import "CCActionTiledGrid.h" +#import "CCActionGrid3D.h" +#import "CCActionGrid.h" +#import "CCActionProgressTimer.h" +#import "CCActionPageTurn3D.h" + +#import "CCAnimation.h" +#import "CCAnimationCache.h" +#import "CCSprite.h" +#import "CCSpriteFrame.h" +#import "CCSpriteBatchNode.h" +#import "CCSpriteFrameCache.h" + +#import "CCLabelTTF.h" +#import "CCLabelBMFont.h" +#import "CCLabelAtlas.h" + +#import "CCParticleSystem.h" +#import "CCParticleSystemPoint.h" +#import "CCParticleSystemQuad.h" +#import "CCParticleExamples.h" + +#import "CCTexture2D.h" +#import "CCTexturePVR.h" +#import "CCTextureCache.h" +#import "CCTextureAtlas.h" + +#import "CCTransition.h" +#import "CCTransitionPageTurn.h" +#import "CCTransitionRadial.h" + +#import "CCTMXTiledMap.h" +#import "CCTMXLayer.h" +#import "CCTMXObjectGroup.h" +#import "CCTMXXMLParser.h" +#import "CCTileMapAtlas.h" + +#import "CCLayer.h" +#import "CCMenu.h" +#import "CCMenuItem.h" +#import "CCDrawingPrimitives.h" +#import "CCScene.h" +#import "CCScheduler.h" +#import "CCBlockSupport.h" +#import "CCCamera.h" +#import "CCProtocols.h" +#import "CCNode.h" +#import "CCDirector.h" +#import "CCAtlasNode.h" +#import "CCGrabber.h" +#import "CCGrid.h" +#import "CCParallaxNode.h" +#import "CCRenderTexture.h" +#import "CCMotionStreak.h" +#import "CCConfiguration.h" + +// +// cocos2d macros +// +#import "ccTypes.h" +#import "ccMacros.h" + + +// Platform common +#import "Platforms/CCGL.h" +#import "Platforms/CCNS.h" + +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED +#import "Platforms/iOS/CCTouchDispatcher.h" +#import "Platforms/iOS/CCTouchDelegateProtocol.h" +#import "Platforms/iOS/CCTouchHandler.h" +#import "Platforms/iOS/EAGLView.h" +#import "Platforms/iOS/CCDirectorIOS.h" + +#elif defined(__MAC_OS_X_VERSION_MAX_ALLOWED) +#import "Platforms/Mac/MacGLView.h" +#import "Platforms/Mac/CCDirectorMac.h" +#endif + +// +// cocos2d helper files +// +#import "Support/OpenGL_Internal.h" +#import "Support/CCFileUtils.h" +#import "Support/CGPointExtension.h" +#import "Support/ccCArray.h" +#import "Support/CCArray.h" +#import "Support/ccUtils.h" + +#if CC_ENABLE_PROFILERS +#import "Support/CCProfiling.h" +#endif // CC_ENABLE_PROFILERS + + +// free functions +NSString * cocos2dVersion(void); + +#ifdef __IPHONE_OS_VERSION_MAX_ALLOWED +#ifndef __IPHONE_4_0 +#error "If you are targeting iPad, you should set BASE SDK = 4.0 (or 4.1, or 4.2), and set the 'iOS deploy target' = 3.2" +#endif +#endif diff --git a/libs/cocos2d/cocos2d.m b/libs/cocos2d/cocos2d.m new file mode 100755 index 0000000..8df3b6f --- /dev/null +++ b/libs/cocos2d/cocos2d.m @@ -0,0 +1,34 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2008-2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + */ + + +#import +#import "cocos2d.h" +static NSString *version = @"cocos2d v1.0.0"; + +NSString *cocos2dVersion() +{ + return version; +} diff --git a/libs/cocoslive/CLScoreServerPost.h b/libs/cocoslive/CLScoreServerPost.h new file mode 100755 index 0000000..e782b90 --- /dev/null +++ b/libs/cocoslive/CLScoreServerPost.h @@ -0,0 +1,142 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2008-2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + + + +#import + +// for MD5 signing +#import + +// cocoslive definitions +#import "cocoslive.h" + +// Score Server protocol version +#define SCORE_SERVER_PROTOCOL_VERSION @"1.1" + +// Server URL +#ifdef USE_LOCAL_SERVER +#define SCORE_SERVER_SEND_URL @"http://localhost:8080/api/post-score" +#define SCORE_SERVER_UPDATE_URL @"http://localhost:8080/api/update-score" +#else +#define SCORE_SERVER_SEND_URL @"http://fourislandscores.appspot.com/api/post-score" +#define SCORE_SERVER_UPDATE_URL @"http://fourislandscores.appspot.com/api/update-score" +#endif + +/// Type of errors from the Post Score request +typedef enum { + /// post request successful + kPostStatusOK = 0, + /// post request failed to establish a connection. wi-fi isn't enabled. + /// Don't retry when this option is preset + kPostStatusConnectionFailed = 1, + /// post request failed to post the score. Server might be busy. + /// Retry is suggested + kPostStatusPostFailed = 2, +} tPostStatus; + +enum { + //! Invalid Ranking. Valid rankins are from 1 to ... + kServerPostInvalidRanking = 0, +}; + +/** + * Handles the Score Post to the cocos live server + */ +@interface CLScoreServerPost : NSObject { + /// game key. secret shared with the server. + /// used to sign the values to prevent spoofing. + NSString *gameKey; + + /// game name, used as a login name. + NSString *gameName; + + /// delegate instance of fetch score + id delegate; + + /// ranking + NSUInteger ranking_; + + /// score was updated + BOOL scoreDidUpdate_; + + /// data received + NSMutableData *receivedData; + + /// values to send in the POST + NSMutableArray *bodyValues; + + /// status of the request + tPostStatus postStatus_; + + /// mdt context + CC_MD5_CTX md5Ctx; + + /// the connection + NSURLConnection *connection_; +} + +/** status from the score post */ +@property (nonatomic,readonly) tPostStatus postStatus; + +/** connection to the server */ +@property (nonatomic, retain) NSURLConnection *connection; + +/** ranking of your score + @since v0.7.3 + */ +@property (nonatomic,readonly) NSUInteger ranking; + +/** whether or not the score was updated + @since v0.7.3 + */ +@property (nonatomic,readonly) BOOL scoreDidUpdate; + +/** creates a cocos server with a game name and a game key */ ++(id) serverWithGameName:(NSString*) name gameKey:(NSString*) key delegate:(id)delegate; + +/** initializes a cocos server with a game name and a game key */ +-(id) initWithGameName:(NSString*) name gameKey:(NSString*) key delegate:(id)delegate; + +/** send the scores to the server. A new entre will be created on the server */ +-(BOOL) sendScore: (NSDictionary*) dict; + +/** + * Sends a score dictionary to the server for updating an existing entry by playername and device id, or creating a new one. + * The passed dictionary must contain a cc_playername key, otherwise it will raise and exception. + * @since v0.7.1 + */ +-(BOOL) updateScore: (NSDictionary*) dict; + +@end + +/** CocosLivePost protocol */ +@protocol CLPostDelegate +/** callback method that will be called if the post is successful */ +-(void) scorePostOk:(id) sender; +/** callback method that will be called if the post fails */ +-(void) scorePostFail:(id) sender; +@end diff --git a/libs/cocoslive/CLScoreServerPost.m b/libs/cocoslive/CLScoreServerPost.m new file mode 100755 index 0000000..43ee7b2 --- /dev/null +++ b/libs/cocoslive/CLScoreServerPost.m @@ -0,0 +1,335 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2008-2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + + +#import "CLScoreServerPost.h" +#import "ccMacros.h" + +// free function used to sort +NSInteger alphabeticSort(id string1, id string2, void *reverse); + +NSInteger alphabeticSort(id string1, id string2, void *reverse) +{ + if ((NSInteger *)reverse == NO) + return [string2 localizedCaseInsensitiveCompare:string1]; + return [string1 localizedCaseInsensitiveCompare:string2]; +} + + +@interface CLScoreServerPost (Private) +-(void) addValue:(NSString*)value key:(NSString*)key; +-(void) calculateHashAndAddValue:(id)value key:(NSString*)key; +-(NSString*) getHashForData; +-(NSData*) getBodyValues; +-(NSString*) encodeData:(NSString*)data; +-(NSMutableURLRequest *) scoreServerRequestWithURLString:(NSString *)url; +-(BOOL) submitScore:(NSDictionary*)dict forUpdate:(BOOL)isUpdate; +@end + + +@implementation CLScoreServerPost + +@synthesize postStatus = postStatus_; +@synthesize ranking = ranking_; +@synthesize scoreDidUpdate = scoreDidUpdate_; +@synthesize connection = connection_; + ++(id) serverWithGameName:(NSString*) name gameKey:(NSString*) key delegate:(id) delegate +{ + return [[[self alloc] initWithGameName:name gameKey:key delegate:delegate] autorelease]; +} + +-(id) initWithGameName:(NSString*) name gameKey:(NSString*) key delegate:(id)aDelegate +{ + self = [super init]; + if( self ) { + gameKey = [key retain]; + gameName = [name retain]; + bodyValues = [[NSMutableArray arrayWithCapacity:5] retain]; + delegate = [aDelegate retain]; + receivedData = [[NSMutableData data] retain]; + + ranking_ = kServerPostInvalidRanking; + } + + return self; +} + +-(void) dealloc +{ + CCLOGINFO(@"deallocing %@", self); + [delegate release]; + [gameKey release]; + [gameName release]; + [bodyValues release]; + [receivedData release]; + [connection_ release]; + [super dealloc]; +} + + +#pragma mark ScoreServer send scores +-(BOOL) sendScore: (NSDictionary*) dict +{ + return [self submitScore:dict forUpdate:NO]; +} + +-(BOOL) updateScore: (NSDictionary*) dict +{ + if (![dict objectForKey:@"cc_playername"]) { + // fail. cc_playername + cc_device_id are needed to update an score + [NSException raise:@"cocosLive:updateScore" format:@"cc_playername not found"]; + } + return [self submitScore:dict forUpdate:YES]; +} + +-(BOOL) submitScore: (NSDictionary*)dict forUpdate:(BOOL)isUpdate +{ + [receivedData setLength:0]; + [bodyValues removeAllObjects]; + + // reset status + postStatus_ = kPostStatusOK; + + // create the request + NSMutableURLRequest *post = [self scoreServerRequestWithURLString:(isUpdate ? SCORE_SERVER_UPDATE_URL : SCORE_SERVER_SEND_URL)]; + + CC_MD5_Init( &md5Ctx); + + // hash SHALL be calculated in certain order + NSArray *keys = [dict allKeys]; + int reverseSort = NO; + NSArray *sortedKeys = [keys sortedArrayUsingFunction:alphabeticSort context:&reverseSort]; + for( id key in sortedKeys ) + [self calculateHashAndAddValue:[dict objectForKey:key] key:key]; + + // device id is hashed to prevent spoofing this same score from different devices + // one way to prevent a replay attack is to send cc_id & cc_time and use it as primary keys + + [self addValue:[[UIDevice currentDevice] uniqueIdentifier] key:@"cc_device_id"]; + [self addValue:gameName key:@"cc_gamename"]; + [self addValue:[self getHashForData] key:@"cc_hash"]; + [self addValue:SCORE_SERVER_PROTOCOL_VERSION key:@"cc_prot_ver"]; + + [post setHTTPBody: [self getBodyValues] ]; + + // create the connection with the request + // and start loading the data + self.connection=[NSURLConnection connectionWithRequest:post delegate:self]; + + if ( ! connection_) + return NO; + + return YES; +} + +-(NSMutableURLRequest *) scoreServerRequestWithURLString:(NSString *)url { + NSMutableURLRequest *request=[NSMutableURLRequest requestWithURL:[NSURL URLWithString: url] + cachePolicy:NSURLRequestUseProtocolCachePolicy + timeoutInterval:10.0]; + + [request setHTTPMethod: @"POST"]; + [request setValue:@"application/x-www-form-urlencoded" forHTTPHeaderField:@"Content-Type"]; + return request; +} + +-(void) calculateHashAndAddValue:(id) value key:(NSString*) key +{ + NSString *val; + // value shall be a string or nsnumber + if( [value respondsToSelector:@selector(stringValue)] ) + val = [value stringValue]; + else if( [value isKindOfClass:[NSString class]] ) + val = value; + else + [NSException raise:@"Invalid format for value" format:@"Invalid format for value. addValue"]; + + [self addValue:val key:key]; + + const char * data = [val UTF8String]; + CC_MD5_Update( &md5Ctx, data, strlen(data) ); +} + +-(void) addValue:(NSString*)value key:(NSString*) key +{ + + NSString *encodedValue = [self encodeData:value]; + NSString *encodedKey = [self encodeData:key]; + + [bodyValues addObject: [NSString stringWithFormat:@"%@=%@", encodedKey, encodedValue] ]; +} + +-(NSData*) getBodyValues { + NSMutableData *data = [[NSMutableData alloc] init]; + + BOOL first=YES; + for( NSString *s in bodyValues ) { + if( !first) + [data appendBytes:"&" length:1]; + + [data appendBytes:[s UTF8String] length:[s length]]; + first = NO; + } + + return [data autorelease]; +} + +-(NSString*) getHashForData +{ + NSString *ret; + unsigned char pTempKey[16]; + + // update the hash with the secret key + const char *data = [gameKey UTF8String]; + CC_MD5_Update(&md5Ctx, data, strlen(data)); + + // then get the hash + CC_MD5_Final( pTempKey, &md5Ctx); + +// NSData *nsdata = [NSData dataWithBytes:pTempKey length:16]; + ret = [NSString stringWithString:@""]; + for( int i=0;i<16;i++) { + ret = [NSString stringWithFormat:@"%@%02x", ret, pTempKey[i] ]; + } + + return ret; +} + +-(NSString*) encodeData:(NSString*) data +{ + NSString *newData; + + newData = [data stringByAddingPercentEscapesUsingEncoding:NSUTF8StringEncoding]; + + // '&' and '=' should be encoded manually + newData = [newData stringByReplacingOccurrencesOfString:@"&" withString:@"%26"]; + newData = [newData stringByReplacingOccurrencesOfString:@"=" withString:@"%3D"]; + + return newData; +} + +#pragma mark NSURLConnection Delegate + +- (void)connection:(NSURLConnection *)connection didReceiveResponse:(NSURLResponse *)response +{ + // this method is called when the server has determined that it + // has enough information to create the NSURLResponse + + // it can be called multiple times, for example in the case of a + // redirect, so each time we reset the data. + // receivedData is declared as a method instance elsewhere + [receivedData setLength:0]; +} + +- (void)connection:(NSURLConnection *)connection didReceiveData:(NSData *)data +{ + // append the new data to the receivedData + // receivedData is declared as a method instance elsewhere + [receivedData appendData:data]; + +// NSString *dataString = [NSString stringWithCString:[data bytes] length: [data length]]; +// CCLOG( @"data: %@", dataString); +} + +- (void)connection:(NSURLConnection *)connection didFailWithError:(NSError *)error +{ + CCLOG(@"Connection failed"); + + // wifi problems ? + postStatus_ = kPostStatusConnectionFailed; + + // release the connection + self.connection = nil; + + if( [delegate respondsToSelector:@selector(scorePostFail:) ] ) + [delegate scorePostFail:self]; +} + +- (void)connectionDidFinishLoading:(NSURLConnection *)connection +{ + // release the connection + self.connection = nil; + +// NSString *dataString = [NSString stringWithCString:[receivedData bytes] length: [receivedData length]]; + NSString *dataString = [NSString stringWithCString:[receivedData bytes] encoding: NSASCIIStringEncoding]; + + if( [dataString hasPrefix:@"OK:"] ) { + // parse ranking and other possible answers + NSArray *values = [dataString componentsSeparatedByString:@":"]; + NSArray *answer = [ [values objectAtIndex:1] componentsSeparatedByString:@","]; + NSEnumerator *nse = [answer objectEnumerator]; + + // Create a holder for each line we are going to work with + NSString *line; + + // Loop through all the lines in the lines array processing each one + while( (line = [nse nextObject]) ) { + NSArray *keyvalue = [line componentsSeparatedByString:@"="]; +// NSLog(@"%@",keyvalue); + if( [[keyvalue objectAtIndex:0] isEqual:@"ranking"] ) { + ranking_ = [[keyvalue objectAtIndex:1] intValue]; + } else if( [[keyvalue objectAtIndex:0] isEqual:@"score_updated"] ) { + scoreDidUpdate_ = [[keyvalue objectAtIndex:1] boolValue]; + } + + } + if( [delegate respondsToSelector:@selector(scorePostOk:) ] ) + [delegate scorePostOk:self]; + + } else if( [dataString hasPrefix: @"OK"] ) { + + // Ok + postStatus_ = kPostStatusOK; + + if( [delegate respondsToSelector:@selector(scorePostOk:) ] ) + [delegate scorePostOk:self]; + + + } else { + + NSLog(@"cocoslive: Post Score failed. Reason: %@", dataString); + + // Error parsing answer + postStatus_ = kPostStatusPostFailed; + + if( [delegate respondsToSelector:@selector(scorePostFail:) ] ) + [delegate scorePostFail:self]; + } +} + +-(NSURLRequest *)connection:(NSURLConnection *)connection + willSendRequest:(NSURLRequest *)request + redirectResponse:(NSURLResponse *)redirectResponse +{ + NSURLRequest *newRequest=request; + if (redirectResponse) { + newRequest=nil; + } + + return newRequest; +} + +@end diff --git a/libs/cocoslive/CLScoreServerRequest.h b/libs/cocoslive/CLScoreServerRequest.h new file mode 100755 index 0000000..2002d4c --- /dev/null +++ b/libs/cocoslive/CLScoreServerRequest.h @@ -0,0 +1,122 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2008-2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + + + +#import + +// cocoslive definitions +#import "cocoslive.h" + +// Server URL +#if USE_LOCAL_SERVER +#define SCORE_SERVER_REQUEST_URL @"http://localhost:8080/api/get-scores" +#define SCORE_SERVER_GETRANK_URL @"http://localhost:8080/api/get-rank-for-score" +#else +#define SCORE_SERVER_REQUEST_URL @"http://fourislandscores.appspot.com/api/get-scores" +#define SCORE_SERVER_GETRANK_URL @"http://fourislandscores.appspot.com/api/get-rank-for-score" +#endif + +/** Type of predefined Query */ +typedef enum { + kQueryIgnore = 0, + kQueryDay = 1, + kQueryWeek = 2, + kQueryMonth = 3, + kQueryAllTime = 4, +} tQueryType; + +/** Flags that can be added to the query */ +typedef enum { + kQueryFlagIgnore = 0, + kQueryFlagByCountry = 1 << 0, + kQueryFlagByDevice = 1 << 1, +} tQueryFlags; + +/** + * Handles the Request Scores to the cocos live server + */ +@interface CLScoreServerRequest : NSObject { + + /// game name, used as a login name. + NSString *gameName; + + /// delegate instance of fetch score + id delegate; + + // data received + NSMutableData *receivedData; + + // To determine which delegate method will be called in connectionDidFinishLoading: of NSURLConnection Delegate + BOOL reqRankOnly; + + /// the connection + NSURLConnection *connection_; +} + +/** connection to the server */ +@property (nonatomic, retain) NSURLConnection *connection; + + +/** creates a ScoreServerRequest server with a game name*/ ++(id) serverWithGameName:(NSString*) name delegate:(id)delegate; + +/** initializes a ScoreServerRequest with a game name*/ +-(id) initWithGameName:(NSString*) name delegate:(id)delegate; + +/** request scores from server using a predefined query. This is an asyncronous request. + * limit: how many scores are being requested. Maximun is 100 + * flags: can be kQueryFlagByCountry (fetches only scores from country) + * category: an NSString. For example: 'easy', 'medium', 'type1'... When requesting scores, they can be filtered by this field. + */ +-(BOOL) requestScores: (tQueryType) type limit:(int)limit offset:(int)offset flags:(tQueryFlags)flags category:(NSString*)category; + +/** request scores from server using a predefined query. This is an asyncronous request. + * limit: how many scores are being requested. Maximun is 100 + * flags: can be kQueryFlagByCountry (fetches only scores from country) + */ +-(BOOL) requestScores: (tQueryType) type limit:(int)limit offset:(int)offset flags:(tQueryFlags)flags; + +/** parse the received JSON scores and convert it to objective-c objects */ +-(NSArray*) parseScores; + +/** request rank for a given score using a predefined query. This is an asyncronous request. + * score: int for a score + * category: an NSString. For example: 'easy', 'medium', 'type1'... When requesting ranks, they can be filtered by this field. + */ +-(BOOL) requestRankForScore:(int)score andCategory:(NSString*)category; + +/** It's actually not parsing anything, just returning int for a rank. Kept name PARSE for convinience with parseScores */ +-(int) parseRank; + +@end + +/** CocosLive Request protocol */ +@protocol CLRequestDelegate +-(void) scoreRequestOk:(id) sender; +-(void) scoreRequestRankOk:(id) sender; +-(void) scoreRequestFail:(id) sender; +@end diff --git a/libs/cocoslive/CLScoreServerRequest.m b/libs/cocoslive/CLScoreServerRequest.m new file mode 100755 index 0000000..e16b895 --- /dev/null +++ b/libs/cocoslive/CLScoreServerRequest.m @@ -0,0 +1,257 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2008-2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + + +// 3rd party imports +#import "CJSONDeserializer.h" + +// local imports +#import "CLScoreServerPost.h" +#import "CLScoreServerRequest.h" +#import "ccMacros.h" + +@implementation CLScoreServerRequest + +@synthesize connection=connection_; + ++(id) serverWithGameName:(NSString*) name delegate:(id)delegate +{ + return [[[self alloc] initWithGameName:name delegate:delegate] autorelease]; +} + +-(id) initWithGameName:(NSString*) name delegate:(id)aDelegate +{ + self = [super init]; + if( self ) { + gameName = [[name stringByAddingPercentEscapesUsingEncoding:NSUTF8StringEncoding] retain]; + delegate = [aDelegate retain]; + receivedData = [[NSMutableData data] retain]; + } + return self; +} + +-(void) dealloc +{ + CCLOGINFO(@"deallocing %@", self); + + [delegate release]; + [gameName release]; + [receivedData release]; + [connection_ release]; + [super dealloc]; +} + +-(BOOL) requestScores:(tQueryType)type + limit:(int)limit + offset:(int)offset + flags:(tQueryFlags)flags + category:(NSString*)category +{ + // create the request + [receivedData setLength:0]; + + // it's not a call for rank + reqRankOnly = NO; + + NSString *device = @""; + if( flags & kQueryFlagByDevice ) + device = [[UIDevice currentDevice] uniqueIdentifier]; + + // arguments: + // query: type of query + // limit: how many scores are being requested. Default is 25. Maximun is 100 + // offset: offset of the scores + // flags: bring only country scores, world scores, etc. + // category: string user defined string used to filter + NSString *url= [NSString stringWithFormat:@"%@?gamename=%@&querytype=%d&offset=%d&limit=%d&flags=%d&category=%@&device=%@", + SCORE_SERVER_REQUEST_URL, + gameName, + type, + offset, + limit, + flags, + [category stringByAddingPercentEscapesUsingEncoding: NSUTF8StringEncoding], + device + ]; + + // NSLog(@"%@", url); + + NSURLRequest *request=[NSURLRequest requestWithURL:[NSURL URLWithString:url] + cachePolicy:NSURLRequestUseProtocolCachePolicy + timeoutInterval:10.0]; + + // create the connection with the request + // and start loading the data + self.connection=[NSURLConnection connectionWithRequest:request delegate:self]; + if (! connection_) + return NO; + + return YES; +} + +-(BOOL) requestScores:(tQueryType)type + limit:(int)limit + offset:(int)offset + flags:(tQueryFlags)flags +{ + // create the request + [receivedData setLength:0]; + + // arguments: + // query: type of query + // limit: how many scores are being requested. Maximun is 100 + // offset: offset of the scores + // flags: bring only country scores, world scores, etc. + return [self requestScores:type limit:limit offset:offset flags:flags category:@""]; +} + +-(NSArray*) parseScores +{ + NSArray *array = nil; + NSError *error = nil; + NSDictionary *dictionary = [[CJSONDeserializer deserializer] deserializeAsDictionary:receivedData error:&error]; + +// NSLog(@"r: %@", dictionary); + if( ! error ) { + array = [dictionary objectForKey:@"scores"]; + } else { + CCLOG(@"Error parsing scores: %@", error); + } + return array; +} + +#pragma mark Request rank for score + +-(BOOL) requestRankForScore:(int)score andCategory:(NSString*)category { + // create the request + [receivedData setLength:0]; + + reqRankOnly = YES; + + // arguments: + // score: score for which you need rank + // category: user defined string used to filter + NSString *url= [NSString stringWithFormat:@"%@?gamename=%@&category=%@&score=%d", + SCORE_SERVER_GETRANK_URL, + gameName, + [category stringByAddingPercentEscapesUsingEncoding: NSUTF8StringEncoding], + score + ]; + + NSURLRequest *request=[NSURLRequest requestWithURL:[NSURL URLWithString:url] + cachePolicy:NSURLRequestUseProtocolCachePolicy + timeoutInterval:10.0]; + + // create the connection with the request + // and start loading the data + self.connection=[NSURLConnection connectionWithRequest:request delegate:self]; + if (! connection_) + return NO; + + return YES; +} + +-(int) parseRank { +// NSString *rankStr = [NSString stringWithCString:[receivedData bytes] length: [receivedData length]]; + NSString *rankStr = [NSString stringWithCString:[receivedData bytes] encoding: NSASCIIStringEncoding]; + +// NSLog(@"XXXX: Ranking: %@", rankStr); + + // creating trimmed string by trimming everything that's not numbers from the receivedData + NSString *trimmedStr = [rankStr stringByTrimmingCharactersInSet:[[NSCharacterSet decimalDigitCharacterSet] invertedSet]]; + + int scoreInt = [trimmedStr intValue]; + + return scoreInt; +} + + +#pragma mark NSURLConnection Delegate + +- (void)connection:(NSURLConnection *)connection didReceiveResponse:(NSURLResponse *)response +{ + // this method is called when the server has determined that it + // has enough information to create the NSURLResponse + + // it can be called multiple times, for example in the case of a + // redirect, so each time we reset the data. + // receivedData is declared as a method instance elsewhere + + [receivedData setLength:0]; +} + +- (void)connection:(NSURLConnection *)connection didReceiveData:(NSData *)data +{ + // append the new data to the receivedData + // receivedData is declared as a method instance elsewhere + [receivedData appendData:data]; +} + +- (void)connection:(NSURLConnection *)connection didFailWithError:(NSError *)error +{ + // release the connection, and the data object + self.connection = nil; + + + CCLOG(@"Error getting scores: %@", error); + + if( [delegate respondsToSelector:@selector(scoreRequestFail:) ] ) + [delegate scoreRequestFail:self]; + +} + +- (void)connectionDidFinishLoading:(NSURLConnection *)connection +{ + // release the connection, and the data object + self.connection = nil; + + + if(reqRankOnly) { + // because it's request for rank, different delegate method is called scoreRequestRankOk: + // if connection failed the same delegate method is used as for standard scores - scoreRequestFail: + if( [delegate respondsToSelector:@selector(scoreRequestRankOk:) ] ) { + [delegate scoreRequestRankOk:self]; + } + } else { + if( [delegate respondsToSelector:@selector(scoreRequestOk:) ] ) { + [delegate scoreRequestOk:self]; + } + + } +} + +-(NSURLRequest *)connection:(NSURLConnection *)connection + willSendRequest:(NSURLRequest *)request + redirectResponse:(NSURLResponse *)redirectResponse +{ + NSURLRequest *newRequest=request; + if (redirectResponse) { + newRequest=nil; + } + return newRequest; +} + +@end diff --git a/libs/cocoslive/cocoslive.h b/libs/cocoslive/cocoslive.h new file mode 100755 index 0000000..15dbe1a --- /dev/null +++ b/libs/cocoslive/cocoslive.h @@ -0,0 +1,43 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2008-2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + + + +// 0x00 HI ME LO +// 00 00 03 02 +#define COCOSLIVE_VERSION 0x00000302 + +// to use localserver. DEBUG ONLY +//#define USE_LOCAL_SERVER 1 + +// all cocos live include files +// +#import "CLScoreServerPost.h" +#import "CLScoreServerRequest.h" + + +// free functions +NSString * cocosLiveVersion(void); diff --git a/libs/cocoslive/cocoslive.m b/libs/cocoslive/cocoslive.m new file mode 100755 index 0000000..613a9d7 --- /dev/null +++ b/libs/cocoslive/cocoslive.m @@ -0,0 +1,37 @@ +/* + * cocos2d for iPhone: http://www.cocos2d-iphone.org + * + * Copyright (c) 2008-2010 Ricardo Quesada + * Copyright (c) 2011 Zynga Inc. + * + * Permission is hereby granted, free of charge, to any person obtaining a copy + * of this software and associated documentation files (the "Software"), to deal + * in the Software without restriction, including without limitation the rights + * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell + * copies of the Software, and to permit persons to whom the Software is + * furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE + * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN + * THE SOFTWARE. + * + */ + + +#import + +#import "cocoslive.h" + +static NSString *version = @"cocoslive v0.3.2"; + +NSString *cocosLiveVersion() +{ + return version; +} -- cgit 1.4.1